| Title: | Sound Synthesis and Acoustic Analysis |
|---|---|
| Description: | Performs parametric synthesis of sounds with harmonic and noise components such as animal vocalizations or human voice. Also offers tools for audio manipulation and acoustic analysis, including pitch tracking, spectral analysis, audio segmentation, pitch and formant shifting, etc. Includes four interactive web apps for synthesizing and annotating audio, manually correcting pitch contours, and measuring formant frequencies. Reference: Anikin (2019) <doi:10.3758/s13428-018-1095-7>. |
| Authors: | Andrey Anikin [aut, cre] |
| Maintainer: | Andrey Anikin <[email protected]> |
| License: | GPL (>= 2) |
| Version: | 2.9.0 |
| Built: | 2026-07-03 20:52:27 UTC |
| Source: | https://github.com/cran/soundgen |
Adds sinusoidal or logistic amplitude modulation to a sound. This produces additional harmonics in the spectrum at ±am_freq around each original harmonic and makes the sound rough. The optimal frequency for creating a perception of roughness is ~70 Hz (Fastl & Zwicker "Psychoacoustics"). Sinusoidal AM creates a single pair of new harmonics, while non-sinusoidal AM creates more extra harmonics (see examples).
addAM( x, samplingRate = NULL, amDep = 25, amFreq = 30, amType = c("logistic", "sine")[1], amShape = 0, invalidArgAction = c("adjust", "abort", "ignore")[1], plot = FALSE, play = FALSE, saveAudio = NULL, reportEvery = NULL, cores = 1 )addAM( x, samplingRate = NULL, amDep = 25, amFreq = 30, amType = c("logistic", "sine")[1], amShape = 0, invalidArgAction = c("adjust", "abort", "ignore")[1], plot = FALSE, play = FALSE, saveAudio = NULL, reportEvery = NULL, cores = 1 )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
amDep |
amplitude modulation (AM) depth, %. 0: no change; 100: AM with amplitude range equal to the dynamic range of the sound (anchor format) |
amFreq |
AM frequency, Hz (anchor format) |
amType |
"sine" = sinusoidal, "logistic" = logistic (default) |
amShape |
ignore if amType = "sine", otherwise determines the shape of non-sinusoidal AM: 0 = ~sine, -1 = notches, +1 = clicks (anchor format) |
invalidArgAction |
what to do if an argument is invalid or outside the
range in |
plot |
if TRUE, plots the amplitude modulation |
play |
if TRUE, plays the processed audio |
saveAudio |
full (!) path to folder for saving the processed audio; NULL = don't save, ” = same as input folder (NB: overwrites the originals!) |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
sound1 = soundgen(pitch = c(200, 300), addSilence = 0) s1 = addAM(sound1, 16000, amDep = c(0, 50, 0), amFreq = 75, plot = TRUE) # playme(s1) ## Not run: # Parameters can be specified as in the soundgen() function, eg: s2 = addAM(sound1, 16000, amDep = list(time = c(0, 50, 52, 200, 201, 300), value = c(0, 0, 35, 25, 0, 0)), plot = TRUE, play = TRUE) # Sinusoidal AM produces exactly 2 extra harmonics at ±am_freq # around each f0 harmonic: s3 = addAM(sound1, 16000, amDep = 30, amFreq = c(50, 80), amType = 'sine', plot = TRUE, play = TRUE) spectrogram(s3, 16000, windowLength = 150, ylim = c(0, 2)) # Non-sinusoidal AM produces multiple new harmonics, # which can resemble subharmonics... s4 = addAM(sound1, 16000, amDep = 70, amFreq = 50, amShape = -1, plot = TRUE, play = TRUE) spectrogram(s4, 16000, windowLength = 150, ylim = c(0, 2)) # ...but more often look like sidebands sound3 = soundgen(sylLen = 600, pitch = c(800, 1300, 1100), addSilence = 0) s5 = addAM(sound3, 16000, amDep = c(0, 30, 100, 40, 0), amFreq = 105, amShape = -.3, plot = TRUE, play = TRUE) spectrogram(s5, 16000, ylim = c(0, 5)) # Feel free to add AM stochastically: s6 = addAM(sound1, 16000, amDep = rnorm(10, 40, 20), amFreq = rnorm(20, 70, 20), plot = TRUE, play = TRUE) spectrogram(s6, 16000, windowLength = 150, ylim = c(0, 2)) # If am_freq is locked to an integer ratio of f0, we can get subharmonics # For ex., here is with pitch 400-600-400 Hz (soundgen interpolates pitch # on a log scale and am_freq on a linear scale, so we align them by extracting # a long contour on a log scale for both) con = getSmoothContour(anchors = c(400, 600, 400), len = 20, thisIsPitch = TRUE) s = soundgen(sylLen = 1500, pitch = con, amFreq = con/3, amDep = 30, plot = TRUE, play = TRUE, ylim = c(0, 3)) # Process all files in a folder and save the modified audio addAM('~/Downloads/temp', saveAudio = '~/Downloads/temp/AM', amFreq = 70, amDep = c(0, 50)) ## End(Not run)sound1 = soundgen(pitch = c(200, 300), addSilence = 0) s1 = addAM(sound1, 16000, amDep = c(0, 50, 0), amFreq = 75, plot = TRUE) # playme(s1) ## Not run: # Parameters can be specified as in the soundgen() function, eg: s2 = addAM(sound1, 16000, amDep = list(time = c(0, 50, 52, 200, 201, 300), value = c(0, 0, 35, 25, 0, 0)), plot = TRUE, play = TRUE) # Sinusoidal AM produces exactly 2 extra harmonics at ±am_freq # around each f0 harmonic: s3 = addAM(sound1, 16000, amDep = 30, amFreq = c(50, 80), amType = 'sine', plot = TRUE, play = TRUE) spectrogram(s3, 16000, windowLength = 150, ylim = c(0, 2)) # Non-sinusoidal AM produces multiple new harmonics, # which can resemble subharmonics... s4 = addAM(sound1, 16000, amDep = 70, amFreq = 50, amShape = -1, plot = TRUE, play = TRUE) spectrogram(s4, 16000, windowLength = 150, ylim = c(0, 2)) # ...but more often look like sidebands sound3 = soundgen(sylLen = 600, pitch = c(800, 1300, 1100), addSilence = 0) s5 = addAM(sound3, 16000, amDep = c(0, 30, 100, 40, 0), amFreq = 105, amShape = -.3, plot = TRUE, play = TRUE) spectrogram(s5, 16000, ylim = c(0, 5)) # Feel free to add AM stochastically: s6 = addAM(sound1, 16000, amDep = rnorm(10, 40, 20), amFreq = rnorm(20, 70, 20), plot = TRUE, play = TRUE) spectrogram(s6, 16000, windowLength = 150, ylim = c(0, 2)) # If am_freq is locked to an integer ratio of f0, we can get subharmonics # For ex., here is with pitch 400-600-400 Hz (soundgen interpolates pitch # on a log scale and am_freq on a linear scale, so we align them by extracting # a long contour on a log scale for both) con = getSmoothContour(anchors = c(400, 600, 400), len = 20, thisIsPitch = TRUE) s = soundgen(sylLen = 1500, pitch = con, amFreq = con/3, amDep = 30, plot = TRUE, play = TRUE, ylim = c(0, 3)) # Process all files in a folder and save the modified audio addAM('~/Downloads/temp', saveAudio = '~/Downloads/temp/AM', amFreq = 70, amDep = c(0, 50)) ## End(Not run)
A spectral filter that either adds or removes formants from a sound - that
is, amplifies or dampens certain frequency bands, as in human vowels. See
soundgen and getSpectralEnvelope for more
information. With action = 'remove' this function can perform inverse
filtering to remove formants and obtain raw glottal output, provided that you
can specify the correct formant structure. Instead of formants, any arbitrary
spectral filtering function can be applied using the spectralEnvelope
argument (eg for a low/high/bandpass filter).
addFormants( x, samplingRate = NULL, formants = NULL, spectralEnvelope = NULL, action = c("add", "remove")[1], dB = NULL, specificity = 1, zFun = NULL, vocalTract = NA, formantDep = 1, formantDepStoch = 1, formantWidth = 1, formantCeiling = 2, lipRad = 6, noseRad = 4, mouthOpenThres = 0, mouth = NA, temperature = 0.025, formDrift = 0.3, formDisp = 0.2, smoothing = list(), windowLength_points = 800, overlap = 75, normalize = c("max", "orig", "none")[1], play = FALSE, saveAudio = NULL, reportEvery = NULL, cores = 1, ... )addFormants( x, samplingRate = NULL, formants = NULL, spectralEnvelope = NULL, action = c("add", "remove")[1], dB = NULL, specificity = 1, zFun = NULL, vocalTract = NA, formantDep = 1, formantDepStoch = 1, formantWidth = 1, formantCeiling = 2, lipRad = 6, noseRad = 4, mouthOpenThres = 0, mouth = NA, temperature = 0.025, formDrift = 0.3, formDisp = 0.2, smoothing = list(), windowLength_points = 800, overlap = 75, normalize = c("max", "orig", "none")[1], play = FALSE, saveAudio = NULL, reportEvery = NULL, cores = 1, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling frequency, Hz |
formants |
either a character string referring to default presets for
speaker "M1" (implemented: "aoieu0") or a list of formant times,
frequencies, amplitudes, and bandwidths (see examples). NA or NULL means no
formants, only lip radiation. Time stamps for formants and mouthOpening can
be specified in ms relative to |
spectralEnvelope |
(optional): as an alternative to specifying formant frequencies, we can provide the exact filter - a vector of non-negative numbers specifying the power in each frequency bin on a linear scale (interpolated to length equal to windowLength_points/2). A matrix specifying the filter for each STFT step is also accepted. The easiest way to create this matrix is to call soundgen:::getSpectralEnvelope or to use the spectrum of a recorded sound |
action |
'add' = add formants to the sound, 'remove' = remove formants (inverse filtering) |
dB |
if NULL (default), the spectral envelope is applied on the original scale; otherwise, it is set to range from 1 to 10 ^ (dB / 20) |
specificity |
a way to sharpen or blur the spectral envelope (spectrum ^ specificity) : 1 = no change, >1 = sharper, <1 = blurred |
zFun |
(optional) an arbitrary function to apply to the spectrogram prior to iSTFT, where "z" is the spectrogram - a matrix of complex values (see examples) |
vocalTract |
the length of vocal tract, cm. Used for calculating formant
dispersion (for adding extra formants) and formant transitions as the mouth
opens and closes. If |
formantDep |
scale factor of formant amplitude (1 = no change relative
to amplitudes in |
formantDepStoch |
the amplitude of additional stochastic formants added above the highest specified formant, dB (only if temperature > 0) |
formantWidth |
scale factor of formant bandwidth (1 = no change) |
formantCeiling |
frequency to which stochastic formants are calculated, in multiples of the Nyquist frequency; increase up to ~10 for long vocal tracts to avoid losing energy in the upper part of the spectrum |
lipRad |
the effect of lip radiation on source spectrum, dB/oct (the default of +6 dB/oct produces a high-frequency boost when the mouth is open) |
noseRad |
the effect of radiation through the nose on source spectrum,
dB/oct (the alternative to |
mouthOpenThres |
open the lips (switch from nose radiation to lip
radiation) when the mouth is open |
mouth |
mouth opening (0 to 1, 0.5 = neutral, i.e. no modification) (anchor format) |
temperature |
hyperparameter for regulating the amount of stochasticity in sound generation |
formDrift, formDisp
|
scaling factors for the effect of temperature on formant drift and dispersal, respectively |
smoothing |
a list of parameters passed to
|
windowLength_points |
length of FFT window, points |
overlap |
FFT window overlap, %. For allowed values, see
|
normalize |
"orig" = same as input (default), "max" = maximum possible peak amplitude, "none" = no normalization |
play |
if TRUE, plays the synthesized sound using the default player on
your system. If character, passed to |
saveAudio |
path + filename for saving the output, e.g. '~/Downloads/temp.wav'. If NULL = doesn't save |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
... |
other plotting parameters passed to |
Algorithm: converts input from a time series (time domain) to a spectrogram
(frequency domain) through short-time Fourier transform (STFT), multiples by
the spectral filter containing the specified formants, and transforms back to
a time series via inverse STFT. This is a subroutine for voice synthesis in
soundgen, but it can also be applied to a recording.
getSpectralEnvelope transplantFormants
soundgen
sound = c(rep(0, 1000), runif(8000) * 2 - 1, rep(0, 1000)) # white noise # NB: pad with silence to avoid artefacts if removing formants # playme(sound) # spectrogram(sound, samplingRate = 16000) # add F1 = 900, F2 = 1300 Hz sound_filtered = addFormants(sound, samplingRate = 16000, formants = c(900, 1300)) # playme(sound_filtered) # spectrogram(sound_filtered, samplingRate = 16000) # ...and remove them again (assuming we know what the formants are) sound_inverse_filt = addFormants(sound_filtered, samplingRate = 16000, formants = c(900, 1300), action = 'remove') # playme(sound_inverse_filt) # spectrogram(sound_inverse_filt, samplingRate = 16000) ## Not run: ## Perform some user-defined manipulation of the spectrogram with zFun # Ex.: noise removal - silence all bins under threshold, # say -0 dB below the max value s_noisy = soundgen(sylLen = 200, addSilence = 0, noise = list(time = c(-100, 300), value = -20)) spectrogram(s_noisy, 16000) # playme(s_noisy) zFun = function(z, cutoff = -50) { az = abs(z) thres = max(az) * 10 ^ (cutoff / 20) z[which(az < thres)] = 0 return(z) } s_denoised = addFormants(s_noisy, samplingRate = 16000, formants = NA, zFun = zFun, cutoff = -40) spectrogram(s_denoised, 16000) # playme(s_denoised) # If neither formants nor spectralEnvelope are defined, only lipRad has an effect # For ex., we can boost low frequencies by 6 dB/oct noise = runif(8000) noise1 = addFormants(noise, 16000, lipRad = -6) seewave::meanspec(noise1, f = 16000, dB = 'max0') # Arbitrary spectra can be defined with spectralEnvelope. For ex., we can # have a flat spectrum up to 2 kHz (Nyquist / 4) and -3 dB/kHz above: freqs = seq(0, 16000 / 2, length.out = 100) n = length(freqs) idx = (n / 4):n sp_dB = c(rep(0, n / 4 - 1), (freqs[idx] - freqs[idx[1]]) / 1000 * (-3)) plot(freqs, sp_dB, type = 'b') noise2 = addFormants(noise, 16000, lipRad = 0, spectralEnvelope = 10 ^ (sp_dB / 20)) seewave::meanspec(noise2, f = 16000, dB = 'max0') ## Use the spectral envelope of an existing recording (bleating of a sheep) # (see also the same example with noise as source in ?generateNoise) # (NB: this can also be achieved with a single call to transplantFormants) data(sheep, package = 'seewave') # import a recording from seewave sound_orig = as.numeric(scale(sheep@left)) samplingRate = [email protected] sound_orig = sound_orig / max(abs(sound_orig)) # range -1 to +1 # playme(sound_orig, samplingRate) # get a few pitch anchors to reproduce the original intonation pitch = analyze(sound_orig, samplingRate = samplingRate, pitchMethod = c('autocor', 'dom'))$detailed$pitch pitch = pitch[!is.na(pitch)] # extract a frequency-smoothed version of the original spectrogram # to use as filter specEnv_bleating = spectrogram(sound_orig, windowLength = 5, samplingRate = samplingRate, output = 'original', plot = FALSE) # image(t(log(specEnv_bleating))) # Synthesize source only, with flat spectrum sound_unfilt = soundgen(sylLen = 2500, pitch = pitch, rolloff = 0, rolloffOct = 0, rolloffKHz = 0, temperature = 0, jitterDep = 0, subDep = 0, formants = NULL, lipRad = 0, samplingRate = samplingRate, invalidArgAction = 'ignore') # prevent soundgen from increasing samplingRate # playme(sound_unfilt, samplingRate) # seewave::meanspec(sound_unfilt, f = samplingRate, dB = 'max0') # ~flat # Force spectral envelope to the shape of target sound_filt = addFormants(sound_unfilt, formants = NULL, spectralEnvelope = specEnv_bleating, samplingRate = samplingRate) # playme(sound_filt, samplingRate) # playme(sound_orig, samplingRate) # spectrogram(sound_filt, samplingRate) # spectrogram(sound_orig, samplingRate) # The spectral envelope is now similar to the original recording. Compare: par(mfrow = c(1, 2)) seewave::meanspec(sound_orig, f = samplingRate, dB = 'max0', alim = c(-50, 20)) seewave::meanspec(sound_filt, f = samplingRate, dB = 'max0', alim = c(-50, 20)) par(mfrow = c(1, 1)) # NB: but the source of excitation in the original is actually a mix of # harmonics and noise, while the new sound is purely tonal ## End(Not run)sound = c(rep(0, 1000), runif(8000) * 2 - 1, rep(0, 1000)) # white noise # NB: pad with silence to avoid artefacts if removing formants # playme(sound) # spectrogram(sound, samplingRate = 16000) # add F1 = 900, F2 = 1300 Hz sound_filtered = addFormants(sound, samplingRate = 16000, formants = c(900, 1300)) # playme(sound_filtered) # spectrogram(sound_filtered, samplingRate = 16000) # ...and remove them again (assuming we know what the formants are) sound_inverse_filt = addFormants(sound_filtered, samplingRate = 16000, formants = c(900, 1300), action = 'remove') # playme(sound_inverse_filt) # spectrogram(sound_inverse_filt, samplingRate = 16000) ## Not run: ## Perform some user-defined manipulation of the spectrogram with zFun # Ex.: noise removal - silence all bins under threshold, # say -0 dB below the max value s_noisy = soundgen(sylLen = 200, addSilence = 0, noise = list(time = c(-100, 300), value = -20)) spectrogram(s_noisy, 16000) # playme(s_noisy) zFun = function(z, cutoff = -50) { az = abs(z) thres = max(az) * 10 ^ (cutoff / 20) z[which(az < thres)] = 0 return(z) } s_denoised = addFormants(s_noisy, samplingRate = 16000, formants = NA, zFun = zFun, cutoff = -40) spectrogram(s_denoised, 16000) # playme(s_denoised) # If neither formants nor spectralEnvelope are defined, only lipRad has an effect # For ex., we can boost low frequencies by 6 dB/oct noise = runif(8000) noise1 = addFormants(noise, 16000, lipRad = -6) seewave::meanspec(noise1, f = 16000, dB = 'max0') # Arbitrary spectra can be defined with spectralEnvelope. For ex., we can # have a flat spectrum up to 2 kHz (Nyquist / 4) and -3 dB/kHz above: freqs = seq(0, 16000 / 2, length.out = 100) n = length(freqs) idx = (n / 4):n sp_dB = c(rep(0, n / 4 - 1), (freqs[idx] - freqs[idx[1]]) / 1000 * (-3)) plot(freqs, sp_dB, type = 'b') noise2 = addFormants(noise, 16000, lipRad = 0, spectralEnvelope = 10 ^ (sp_dB / 20)) seewave::meanspec(noise2, f = 16000, dB = 'max0') ## Use the spectral envelope of an existing recording (bleating of a sheep) # (see also the same example with noise as source in ?generateNoise) # (NB: this can also be achieved with a single call to transplantFormants) data(sheep, package = 'seewave') # import a recording from seewave sound_orig = as.numeric(scale(sheep@left)) samplingRate = sheep@samp.rate sound_orig = sound_orig / max(abs(sound_orig)) # range -1 to +1 # playme(sound_orig, samplingRate) # get a few pitch anchors to reproduce the original intonation pitch = analyze(sound_orig, samplingRate = samplingRate, pitchMethod = c('autocor', 'dom'))$detailed$pitch pitch = pitch[!is.na(pitch)] # extract a frequency-smoothed version of the original spectrogram # to use as filter specEnv_bleating = spectrogram(sound_orig, windowLength = 5, samplingRate = samplingRate, output = 'original', plot = FALSE) # image(t(log(specEnv_bleating))) # Synthesize source only, with flat spectrum sound_unfilt = soundgen(sylLen = 2500, pitch = pitch, rolloff = 0, rolloffOct = 0, rolloffKHz = 0, temperature = 0, jitterDep = 0, subDep = 0, formants = NULL, lipRad = 0, samplingRate = samplingRate, invalidArgAction = 'ignore') # prevent soundgen from increasing samplingRate # playme(sound_unfilt, samplingRate) # seewave::meanspec(sound_unfilt, f = samplingRate, dB = 'max0') # ~flat # Force spectral envelope to the shape of target sound_filt = addFormants(sound_unfilt, formants = NULL, spectralEnvelope = specEnv_bleating, samplingRate = samplingRate) # playme(sound_filt, samplingRate) # playme(sound_orig, samplingRate) # spectrogram(sound_filt, samplingRate) # spectrogram(sound_orig, samplingRate) # The spectral envelope is now similar to the original recording. Compare: par(mfrow = c(1, 2)) seewave::meanspec(sound_orig, f = samplingRate, dB = 'max0', alim = c(-50, 20)) seewave::meanspec(sound_filt, f = samplingRate, dB = 'max0', alim = c(-50, 20)) par(mfrow = c(1, 1)) # NB: but the source of excitation in the original is actually a mix of # harmonics and noise, while the new sound is purely tonal ## End(Not run)
Internal soundgen function
addPitchJumps(pitch, magn, nj = 1, prop = 0.1, plot = FALSE)addPitchJumps(pitch, magn, nj = 1, prop = 0.1, plot = FALSE)
pitch |
numeric vector of f0 values over time (any step is OK) |
magn |
magnitude of jump(s) in semitones, a numeric vector of length 1 or nj |
nj |
number of jump pairs = affected segments (e.g., a single fragment is transposed if nj = 1) |
prop |
duration of transposed episode(s) a a proportion of the total
voiced duration (length of |
plot |
if TRUE, plots the original and modified contours |
Adds random discontinuities (jumps) to a pitch contour in a manner that shifts a segment of pitch contour up or down. Careful when adding several jumps: one can land on top of another, and it gets rather weird rather quickly.
pitch = getSmoothContour(c(100, 350, 320, 110), len = 100, interpol = 'loess') addPitchJumps(pitch, magn = runif(1, 3, 12), plot = TRUE) addPitchJumps(pitch, magn = c(6, 1), nj = 2, plot = TRUE) addPitchJumps(pitch, magn = 3, nj = 5, plot = TRUE) pitch2 = c(rep(NA, 10), pitch[1:50], rep(NA, 25), pitch[51:100], rep(NA, 17)) addPitchJumps(pitch2, magn = c(6, 1), nj = 2, plot = TRUE)pitch = getSmoothContour(c(100, 350, 320, 110), len = 100, interpol = 'loess') addPitchJumps(pitch, magn = runif(1, 3, 12), plot = TRUE) addPitchJumps(pitch, magn = c(6, 1), nj = 2, plot = TRUE) addPitchJumps(pitch, magn = 3, nj = 5, plot = TRUE) pitch2 = c(rep(NA, 10), pitch[1:50], rep(NA, 25), pitch[51:100], rep(NA, 17)) addPitchJumps(pitch2, magn = c(6, 1), nj = 2, plot = TRUE)
Adds two partly overlapping vectors, such as two waveforms, to produce a longer vector. The location at which vector 2 is pasted is defined by insertionPoint. Algorithm: both vectors are padded with zeros to match in length and then added. All NA's are converted to 0.
addVectors(v1, v2, insertionPoint = 1L, normalize = TRUE)addVectors(v1, v2, insertionPoint = 1L, normalize = TRUE)
v1, v2
|
numeric vectors |
insertionPoint |
the index of element in vector 1 at which vector 2 will be inserted (any integer, can also be negative) |
normalize |
if TRUE, the output is normalized to range from -1 to +1 |
v1 = 1:6 v2 = rep(100, 3) addVectors(v1, v2, insertionPoint = 5, normalize = FALSE) addVectors(v1, v2, insertionPoint = -4, normalize = FALSE) addVectors(v1, rep(100, 15), insertionPoint = -4, normalize = FALSE) # note the asymmetry: insertionPoint refers to the first arg addVectors(v2, v1, insertionPoint = -4, normalize = FALSE) v3 = rep(100, 15) addVectors(v1, v3, insertionPoint = -4, normalize = FALSE) addVectors(v2, v3, insertionPoint = 7, normalize = FALSE) addVectors(1:6, 3:6, insertionPoint = 3, normalize = FALSE)v1 = 1:6 v2 = rep(100, 3) addVectors(v1, v2, insertionPoint = 5, normalize = FALSE) addVectors(v1, v2, insertionPoint = -4, normalize = FALSE) addVectors(v1, rep(100, 15), insertionPoint = -4, normalize = FALSE) # note the asymmetry: insertionPoint refers to the first arg addVectors(v2, v1, insertionPoint = -4, normalize = FALSE) v3 = rep(100, 15) addVectors(v1, v3, insertionPoint = -4, normalize = FALSE) addVectors(v2, v3, insertionPoint = 7, normalize = FALSE) addVectors(1:6, 3:6, insertionPoint = 3, normalize = FALSE)
Acoustic analysis of one or more sounds: pitch tracking, basic spectral
characteristics, formants, estimated loudness (see
getLoudness), roughness (see modulationSpectrum),
novelty (see ssm), etc. The default values of arguments are
optimized for human non-linguistic vocalizations. See
vignette('acoustic_analysis', package = 'soundgen') for details. The defaults
and reasonable ranges of all arguments can be found in
defaults_analyze. For high-precision work, first extract and
manually correct pitch contours with pitch_app, PRAAT, or
whatever, and then run analyze(pitchManual = ...) with these manual
contours. For more information, see
https://cogsci.se/soundgen/acoustic_analysis.html
analyze( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, dynamicRange = 80, silence = 0.04, windowLength = 50, step = windowLength/2, overlap = 50, specType = c("spectrum", "reassign", "spectralDerivative")[1], wn = "gaussian", zp = 0, cutFreq = NULL, nFormants = 3, formants = list(), loudness = list(SPL_measured = 70), roughness = list(msType = "1D", windowLength = 25, step = 2, amRes = 5), novelty = list(input = "melspec", kernelLen = 1000), pitchMethods = c("dom", "autocor"), pitchManual = NULL, entropyThres = 0.6, pitchFloor = 75, pitchCeiling = 3500, priorMean = 300, priorSD = 6, priorAdapt = TRUE, nCands = 1, minVoicedCands = NULL, pitchDom = list(domThres = 0.1, domSmooth = 220), pitchAutocor = list(autocorThres = 0.7, autocorSmooth = 7, autocorUpsample = 25, autocorBestPeak = 0.975, interpol = "sinc"), pitchCep = list(cepThres = 0.75, cepZp = 0), pitchSpec = list(specThres = 0.05, specPeak = 0.25, specHNRslope = 0.8, specSmooth = 150, specMerge = 0.1, specSinglePeakCert = 0.4, specRatios = 3), pitchHps = list(hpsNum = 5, hpsThres = 0.1, hpsNorm = 2, hpsPenalty = 2), pitchZc = list(zcThres = 0.1, zcWin = 5), harmHeight = list(harmThres = 3, harmTol = 0.25, harmPerSel = 5), subh = list(method = c("cep", "pitchCands", "harm")[1], nSubh = 5, tol = 0.05, nHarm = 5, harmThres = 12, harmTol = 0.25, amRange = c(10, 200)), flux = list(thres = 0.15, smoothWin = 100), amRange = c(10, 200), fmRange = c(5, 1000/step/2), shortestSyl = 20, shortestPause = 60, interpol = list(win = 75, tol = 0.3, cert = 0.3), pathfinding = c("none", "fast", "slow")[2], annealPars = list(maxit = 5000, temp = 1000), certWeight = 0.5, snakeStep = 0, snakePlot = FALSE, smooth = 1, smoothVars = c("pitch", "dom"), summaryFun = c("mean", "median", "sd"), invalidArgAction = c("adjust", "abort", "ignore")[1], reportEvery = NULL, cores = 1, plot = FALSE, osc = "linear", showLegend = TRUE, savePlots = NULL, pitchPlot = list(col = rgb(0, 0, 1, 0.75), lwd = 3, showPrior = TRUE), extraContour = NULL, ylim = NULL, xlab = "Time", ylab = NULL, main = NULL, width = 900, height = 500, units = "px", res = NA, ... )analyze( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, dynamicRange = 80, silence = 0.04, windowLength = 50, step = windowLength/2, overlap = 50, specType = c("spectrum", "reassign", "spectralDerivative")[1], wn = "gaussian", zp = 0, cutFreq = NULL, nFormants = 3, formants = list(), loudness = list(SPL_measured = 70), roughness = list(msType = "1D", windowLength = 25, step = 2, amRes = 5), novelty = list(input = "melspec", kernelLen = 1000), pitchMethods = c("dom", "autocor"), pitchManual = NULL, entropyThres = 0.6, pitchFloor = 75, pitchCeiling = 3500, priorMean = 300, priorSD = 6, priorAdapt = TRUE, nCands = 1, minVoicedCands = NULL, pitchDom = list(domThres = 0.1, domSmooth = 220), pitchAutocor = list(autocorThres = 0.7, autocorSmooth = 7, autocorUpsample = 25, autocorBestPeak = 0.975, interpol = "sinc"), pitchCep = list(cepThres = 0.75, cepZp = 0), pitchSpec = list(specThres = 0.05, specPeak = 0.25, specHNRslope = 0.8, specSmooth = 150, specMerge = 0.1, specSinglePeakCert = 0.4, specRatios = 3), pitchHps = list(hpsNum = 5, hpsThres = 0.1, hpsNorm = 2, hpsPenalty = 2), pitchZc = list(zcThres = 0.1, zcWin = 5), harmHeight = list(harmThres = 3, harmTol = 0.25, harmPerSel = 5), subh = list(method = c("cep", "pitchCands", "harm")[1], nSubh = 5, tol = 0.05, nHarm = 5, harmThres = 12, harmTol = 0.25, amRange = c(10, 200)), flux = list(thres = 0.15, smoothWin = 100), amRange = c(10, 200), fmRange = c(5, 1000/step/2), shortestSyl = 20, shortestPause = 60, interpol = list(win = 75, tol = 0.3, cert = 0.3), pathfinding = c("none", "fast", "slow")[2], annealPars = list(maxit = 5000, temp = 1000), certWeight = 0.5, snakeStep = 0, snakePlot = FALSE, smooth = 1, smoothVars = c("pitch", "dom"), summaryFun = c("mean", "median", "sd"), invalidArgAction = c("adjust", "abort", "ignore")[1], reportEvery = NULL, cores = 1, plot = FALSE, osc = "linear", showLegend = TRUE, savePlots = NULL, pitchPlot = list(col = rgb(0, 0, 1, 0.75), lwd = 3, showPrior = TRUE), extraContour = NULL, ylim = NULL, xlab = "Time", ylab = NULL, main = NULL, width = 900, height = 500, units = "px", res = NA, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
scale |
maximum possible amplitude of input used for normalization of
input vector (only needed if |
from, to
|
if NULL (default), analyzes the whole sound, otherwise from...to (s) |
dynamicRange |
dynamic range, dB. All values more than one dynamicRange under maximum are treated as zero |
silence |
(0 to 1 as proportion of max amplitude) frames with RMS
amplitude below |
windowLength |
length of FFT window, ms (multiple values in a vector produce a multi-resolution spectrogram) |
step |
you can override |
overlap |
overlap between successive FFT frames, % |
specType |
plot the original FFT ('spectrum'), reassigned spectrogram ('reassigned'), or spectral derivative ('spectralDerivative') |
wn |
window type accepted by |
zp |
window length after zero padding, points |
cutFreq |
if specified, spectral descriptives (peakFreq, specCentroid,
specSlope, and quartiles) are calculated only between |
nFormants |
the number of formants to extract per STFT frame (0 = no formant analysis, NULL = as many as possible) |
formants |
a list of arguments passed to
|
loudness |
a list of parameters passed to |
roughness |
a list of parameters passed to
|
novelty |
a list of parameters passed to |
pitchMethods |
methods of pitch estimation to consider for determining pitch contour: 'autocor' = autocorrelation (~PRAAT), 'cep' = cepstral, 'spec' = spectral (~BaNa), 'dom' = lowest dominant frequency band, 'hps' = harmonic product spectrum, NULL = no pitch analysis |
pitchManual |
manually corrected pitch contour. For a single sound,
provide a numeric vector of any length. For multiple sounds, provide a
dataframe with columns "file" and "pitch" (or path to a csv file) as
returned by |
entropyThres |
pitch tracking is only performed for frames with Wiener
entropy below |
pitchFloor, pitchCeiling
|
absolute bounds for pitch candidates (Hz) |
priorMean, priorSD
|
specifies the mean (Hz) and standard deviation
(semitones) of gamma distribution describing our prior knowledge about the
most likely pitch values for this file. For ex., |
priorAdapt |
adaptive second-pass prior: if TRUE, optimal pitch contours
are estimated first with a prior determined by |
nCands |
maximum number of pitch candidates per method, normally 1...4
(except for |
minVoicedCands |
minimum number of pitch candidates that have to be
defined to consider a frame voiced (if NULL, defaults to 2 if |
pitchDom |
a list of control parameters for pitch tracking using the
lowest dominant frequency band or "dom" method; see details and
|
pitchAutocor |
a list of control parameters for pitch tracking using the
autocorrelation or "autocor" method; see details and
|
pitchCep |
a list of control parameters for pitch tracking using the
cepstrum or "cep" method; see details and |
pitchSpec |
a list of control parameters for pitch tracking using the
BaNa or "spec" method; see details and |
pitchHps |
a list of control parameters for pitch tracking using the
harmonic product spectrum or "hps" method; see details and
|
pitchZc |
a list of control parameters for pitch tracking based on zero
crossings in bandpass-filtered audio or "zc" method; see
|
harmHeight |
a list of control parameters for estimating how high
harmonics reach in the spectrum; see details and |
subh |
a list of control parameters for estimating the strength of
subharmonics per frame - that is, spectral energy at integer ratios of f0:
see |
flux |
a list of control parameters for calculating feature-based flux
(not spectral flux) passed to |
amRange |
target range of frequencies for amplitude modulation, Hz: a
vector of length 2 (affects both |
fmRange |
target range of frequencies for analyzing frequency
modulation, Hz ( |
shortestSyl |
the smallest length of a voiced segment (ms) that constitutes a voiced syllable (shorter segments will be replaced by NA, as if voiceless) |
shortestPause |
the smallest gap between voiced syllables (ms): large value = interpolate and merge, small value = treat as separate syllables separated by a voiceless gap |
interpol |
a list of parameters (currently |
pathfinding |
method of finding the optimal path through pitch
candidates: 'none' = best candidate per frame, 'fast' = simple heuristic,
'slow' = annealing. See |
annealPars |
a list of control parameters for postprocessing of
pitch contour with SANN algorithm of |
certWeight |
(0 to 1) in pitch postprocessing, specifies how much we prioritize the certainty of pitch candidates vs. pitch jumps / the internal tension of the resulting pitch curve |
snakeStep |
optimized path through pitch candidates is further
processed to minimize the elastic force acting on pitch contour. To
disable, set |
snakePlot |
if TRUE, plots the snake |
smooth, smoothVars
|
if |
summaryFun |
functions used to summarize each acoustic characteristic, eg "c('mean', 'sd')"; user-defined functions are fine (see examples); NAs are omitted automatically for mean/median/sd/min/max/range/sum, otherwise take care of NAs yourself |
invalidArgAction |
what to do if an argument is invalid or outside the
range in |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
plot |
if TRUE, produces a spectrogram with pitch contour overlaid |
osc |
"none" = no oscillogram; "linear" = on the original scale; "dB" = in decibels |
showLegend |
if TRUE, adds a legend with pitch tracking methods |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
pitchPlot |
a list of graphical parameters for displaying the final
pitch contour. Set to |
extraContour |
name of an output variable to overlap on the pitch
contour plot, eg 'peakFreq' or 'loudness'; can also be a list with extra
graphical parameters, eg |
ylim |
frequency range to plot, kHz (defaults to 0 to Nyquist frequency). NB: still in kHz, even if yScale = bark, mel, or ERB |
xlab, ylab, main
|
plotting parameters |
width, height, units, res
|
parameters passed to
|
... |
other graphical parameters passed to |
Each pitch tracker is controlled by its own list of settings, as follows:
pitchDom (lowest dominant frequency band)domThres (0 to 1) to find the lowest dominant frequency band, we
do short-term FFT and take the lowest frequency with amplitude at least
domThres
domSmooth the width of smoothing interval (Hz) for
finding dom
pitchAutocor (autocorrelation)autocorThres voicing threshold (unitless, ~0 to 1)
autocorSmooth the width of smoothing interval (in bins) for
finding peaks in the autocorrelation function. Defaults to 7 for sampling
rate 44100 and smaller odd numbers for lower values of sampling rate
autocorUpsample upsamples acf to this resolution (Hz) to improve
accuracy in high frequencies
autocorBestPeak amplitude of the
lowest best candidate relative to the absolute max of the acf
pitchCep (cepstrum)cepThres voicing
threshold (unitless, ~0 to 1)
cepZp zero-padding of the spectrum
used for cepstral pitch detection (final length of spectrum after
zero-padding in points, e.g. 2 ^ 13)
pitchSpec (ratio of
harmonics - BaNa algorithm)specThres voicing
threshold (unitless, ~0 to 1)
specPeak,specHNRslope when looking
for putative harmonics in the spectrum, the threshold for peak detection is
calculated as specPeak * (1 - HNR * specHNRslope)
specSmooth the width of window for detecting peaks in the spectrum, Hz
specMerge pitch candidates within specMerge semitones are
merged with boosted certainty
specSinglePeakCert (0 to 1) if F0
is calculated based on a single harmonic ratio (as opposed to several ratios
converging on the same candidate), its certainty is taken to be
specSinglePeakCert
hpsNum the number of times to downsample the
spectrum
hpsThres voicing threshold (unitless, ~0 to 1)
hpsNorm the amount of inflation of hps pitch certainty (0 = none)
hpsPenalty the amount of penalizing hps candidates in low
frequencies (0 = none)
Each of these lists also accepts graphical
parameters that affect how pitch candidates are plotted, eg pitchDom =
list(domThres = .5, col = 'yellow'). Other arguments that are lists of
subroutine-specific settings include:
harmonicHeight
(finding how high harmonics reach in the spectrum)harmThres minimum height of spectral peak, dB
harmPerSel
the number of harmonics per sliding selection
harmTol maximum
tolerated deviation of peak frequency from multiples of f0, proportion of f0
Returns a list with $detailed frame-by-frame descriptives and
a $summary with one row per file, as determined by summaryFun
(e.g., mean / median / SD of each acoustic variable across all STFT
frames). Output measures include:
total duration, s
duration from the beginning of the first
non-silent STFT frame to the end of the last non-silent STFT frame, s (NB:
depends strongly on windowLength and silence settings)
time of the middle of each frame (ms)
frequency (Hz) and depth (0 to 1) of amplitude modulation estimated from a smoothed amplitude envelope
frequency and purity of amplitude
modulation estimated via modulationSpectrum
root mean square of amplitude per frame, calculated as sqrt(mean(frame ^ 2))
same as ampl, but
ignoring silent frames
Cepstral Peak Prominence, dB (a measure of pitch quality, the ratio of the highest peak in the cepstrum to the regression line drawn through it)
lowest dominant frequency band (Hz) (see "Pitch tracking methods / Dominant frequency" in the vignette)
Wiener entropy of the spectrum of the current frame (=spectral flatness). Close to 0: pure tone or tonal sound with nearly all energy in harmonics; close to 1: white noise
Normalized Shannon entropy of the spectrum of the current frame: 0 = pure tone, 1 = white noise
the frequency and bandwidth of the first nFormants formants per STFT frame, as calculated by phonTools::findformants
feature-based flux, the rate of change
in acoustic features such as pitch, HNR, etc. (0 = none, 1 = max); "epoch"
is an audio segment between two peaks of flux that exceed a threshold of
flux = list(thres = ...) (listed in output$detailed only)
frequency of frequency modulation (FM) such as vibrato or jitter, Hz
depth of FM, semitones
purity or dominance of the main FM frequency (fmFreq), 0 to 1
the amount of energy in upper harmonics, namely the ratio of total spectral mass above 1.25 x F0 to the total spectral mass below 1.25 x F0 (dB)
how high harmonics reach in the spectrum, based on the best guess at pitch (or the manually provided pitch values)
harmonics-to-noise ratio (dB), a measure of harmonicity returned by soundgen:::getPitchAutocor (see "Pitch tracking methods / Autocorrelation"). If HNR = 0 dB, there is as much energy in harmonics as in noise
subjective loudness, in sone, corresponding to
the chosen SPL_measured - see getLoudness
spectral novelty - a measure of how variable the spectrum is
on a particular time scale, as estimated by ssm
the frequency with maximum spectral power (Hz)
post-processed pitch contour based on all F0 estimates
the 25th, 50th, and 75th quantiles of the spectrum of voiced frames (Hz)
the amount of amplitude modulation, see modulationSpectrum and Anikin 2025
the center of gravity of the frame’s spectrum, first spectral moment (Hz)
the slope of linear regression fit to the spectrum below cutFreq (dB/kHz)
estimated depth of subharmonics per frame: 0 = none, 1 = as strong as f0. NB: this depends critically on accurate pitch tracking
the ratio of f0 to subharmonics frequency with strength subDep: 2 = period doubling, 3 = f0 / 3, etc.
is the current STFT frame voiced? TRUE / FALSE
Anikin, A. (2025) Acoustic estimation of voice roughness. Attention, Perception, & Psychophysics 87: 1771–1787.
pitch_app getLoudness
segment getRMS
# Detailed documentation: https://cogsci.se/soundgen/acoustic_analysis.html sound = soundgen(sylLen = 300, pitch = c(500, 400, 600), noise = list(time = c(0, 300), value = c(-40, 0)), temperature = 0.001, addSilence = 50) # NB: always have some silence before and after!!! # playme(sound, 16000) a = analyze(sound, samplingRate = 16000, plot = TRUE) str(a$detailed) # frame-by-frame a$summary # summary per sound ## Not run: # For maximum processing speed (just basic spectral descriptives): a = analyze(sound, samplingRate = 16000, plot = FALSE, # no plotting pitchMethods = NULL, # no pitch tracking loudness = NULL, # no loudness analysis novelty = NULL, # no novelty analysis roughness = NULL, # no roughness analysis nFormants = 0 # no formant analysis ) # Take a sound hard to analyze b/c of subharmonics and jitter sound2 = soundgen(sylLen = 900, pitch = list( time = c(0, .3, .8, 1), value = c(300, 900, 400, 2300)), noise = list(time = c(0, 900), value = c(-40, -20)), subDep = 10, jitterDep = 0.5, temperature = 0.001, samplingRate = 44100, pitchSamplingRate = 44100) # playme(sound2, 44100) a2 = analyze(sound2, samplingRate = 44100, priorSD = 24, plot = TRUE, ylim = c(0, 5)) # Compare the available pitch trackers analyze(sound2, 44100, pitchMethods = c('dom', 'autocor', 'spec', 'cep', 'hps', 'zc'), # don't use priors to see weird pitch candidates better priorMean = NA, priorAdapt = FALSE, plot = TRUE, yScale = 'bark') # Fancy plotting options: a = analyze(sound2, samplingRate = 44100, plot = TRUE, xlab = 'Time, ms', colorTheme = 'seewave', yScale = 'ERB', contrast = .5, ylim = c(0, 4), main = 'My plot', pitchMethods = c('dom', 'autocor', 'spec', 'hps', 'cep'), priorMean = NA, # no prior info at all pitchDom = list(col = 'red', domThres = .25), pitchPlot = list(col = 'black', pch = 9, lty = 3, lwd = 3), extraContour = list(x = 'peakFreq', type = 'b', pch = 4, col = 'brown'), osc = 'dB', heights = c(2, 1)) # Analyze an entire folder in one go, saving spectrograms with pitch contours # plus an html file for easy access s2 = analyze('~/Downloads/temp', savePlots = '', # save in the same folder as audio showLegend = TRUE, yScale = 'bark', width = 20, height = 12, units = 'cm', res = 300, ylim = c(0, 5), cores = 4) # use multiple cores to speed up processing s2$summary[, 1:5] # Different options for summarizing the output a = analyze(sound2, 44100, summaryFun = c('mean', 'range')) a$summary # one row per sound # ...with custom summaryFun, eg time of peak relative to duration (0 to 1) timePeak = function(x) which.max(x) / length(x) # without omitting NAs timeTrough = function(x) which.min(x) / length(x) a = analyze(sound2, samplingRate = 16000, summaryFun = c('mean', 'timePeak', 'timeTrough')) colnames(a$summary) # Analyze a selection rather than the whole sound a = analyze(sound, samplingRate = 16000, from = .1, to = .3, plot = TRUE) # Use only a range of frequencies when calculating spectral descriptives # (ignore everything below 100 Hz and above 8000 Hz as irrelevant noise) a = analyze(sound, samplingRate = 16000, cutFreq = c(100, 8000)) ## Amplitude and loudness: analyze() should give the same results as # dedicated functions getRMS() / getLoudness() # Create 1 kHz tone samplingRate = 16000; dur_ms = 50 sound3 = sin(2*pi*1000/samplingRate*(1:(dur_ms/1000*samplingRate))) a1 = analyze(sound3, samplingRate = samplingRate, scale = 1, windowLength = 25, overlap = 50, loudness = list(SPL_measured = 40), pitchMethods = NULL, plot = FALSE) a1$detailed$loudness # loudness per STFT frame (1 sone by definition) getLoudness(sound3, samplingRate = samplingRate, windowLength = 25, overlap = 50, SPL_measured = 40, scale = 1)$loudness a1$detailed$ampl # RMS amplitude per STFT frame getRMS(sound3, samplingRate = samplingRate, windowLength = 25, overlap = 50, scale = 1)$detailed # or even simply: sqrt(mean(sound3 ^ 2)) # The same sound as above, but with half the amplitude a_half = analyze(sound3 / 2, samplingRate = samplingRate, scale = 1, windowLength = 25, overlap = 50, loudness = list(SPL_measured = 40), pitchMethods = NULL, plot = FALSE) a1$detailed$ampl / a_half$detailed$ampl # rms amplitude halved a1$detailed$loudness/ a_half$detailed$loudness # loudness is not a linear function of amplitude # Analyzing ultrasounds (slow but possible, just adjust pitchCeiling) s = soundgen(sylLen = 100, addSilence = 10, pitch = c(25000, 35000, 30000), formants = NA, rolloff = -12, rolloffKHz = 0, pitchSamplingRate = 350000, samplingRate = 350000, windowLength = 5, pitchCeiling = 45000, invalidArgAction = 'ignore', plot = TRUE) # s is a bat-like ultrasound inaudible to humans a = analyze( s, 350000, plot = TRUE, pitchFloor = 10000, pitchCeiling = 90000, priorMean = NA, pitchMethods = c('autocor', 'spec'), # probably shouldn't use pitchMethod = "dom" b/c of likely low-freq noise windowLength = 5, step = 2.5, shortestSyl = 10, shortestPause = 10, # again, very short sounds interpol = list(win = 10), # again, very short sounds smooth = 0.1, # might need less smoothing if very rapid f0 changes nFormants = 0, loudness = NULL, roughness = NULL, novelty = NULL) # NB: ignore formants and loudness estimates for such non-human sounds # download 260 sounds from Anikin & Persson (2017) # http://cogsci.se/publications/anikin-persson_2017_nonlinguistic-vocs/260sounds_wav.zip # unzip them into a folder, say '~/Downloads/temp' myfolder = '~/Downloads/temp' # 260 .wav files live here s = analyze(myfolder) # ~ 10-20 minutes! # s = write.csv(s, paste0(myfolder, '/temp.csv')) # save a backup # Check accuracy: import manually verified pitch values (our "key") # pitchManual # "ground truth" of mean pitch per sound # pitchContour # "ground truth" of complete pitch contours per sound files_manual = paste0(names(pitchManual), '.wav') idx = match(s$file, files_manual) # in case the order is wrong s$key = pitchManual[idx] # Compare manually verified mean pitch with the output of analyze: cor(s$key, s$summary$pitch_median, use = 'pairwise.complete.obs') plot(s$key, s$summary$pitch_median, log = 'xy') abline(a=0, b=1, col='red') # Re-running analyze with manually corrected contours gives correct pitch-related descriptives like amplVoiced and harmonics (NB: you get it "for free" when running pitch_app) s1 = analyze(myfolder, pitchManual = pitchContour) plot(s$summary$harmonics_median, s1$summary$harmonics_median) abline(a=0, b=1, col='red') ## End(Not run)# Detailed documentation: https://cogsci.se/soundgen/acoustic_analysis.html sound = soundgen(sylLen = 300, pitch = c(500, 400, 600), noise = list(time = c(0, 300), value = c(-40, 0)), temperature = 0.001, addSilence = 50) # NB: always have some silence before and after!!! # playme(sound, 16000) a = analyze(sound, samplingRate = 16000, plot = TRUE) str(a$detailed) # frame-by-frame a$summary # summary per sound ## Not run: # For maximum processing speed (just basic spectral descriptives): a = analyze(sound, samplingRate = 16000, plot = FALSE, # no plotting pitchMethods = NULL, # no pitch tracking loudness = NULL, # no loudness analysis novelty = NULL, # no novelty analysis roughness = NULL, # no roughness analysis nFormants = 0 # no formant analysis ) # Take a sound hard to analyze b/c of subharmonics and jitter sound2 = soundgen(sylLen = 900, pitch = list( time = c(0, .3, .8, 1), value = c(300, 900, 400, 2300)), noise = list(time = c(0, 900), value = c(-40, -20)), subDep = 10, jitterDep = 0.5, temperature = 0.001, samplingRate = 44100, pitchSamplingRate = 44100) # playme(sound2, 44100) a2 = analyze(sound2, samplingRate = 44100, priorSD = 24, plot = TRUE, ylim = c(0, 5)) # Compare the available pitch trackers analyze(sound2, 44100, pitchMethods = c('dom', 'autocor', 'spec', 'cep', 'hps', 'zc'), # don't use priors to see weird pitch candidates better priorMean = NA, priorAdapt = FALSE, plot = TRUE, yScale = 'bark') # Fancy plotting options: a = analyze(sound2, samplingRate = 44100, plot = TRUE, xlab = 'Time, ms', colorTheme = 'seewave', yScale = 'ERB', contrast = .5, ylim = c(0, 4), main = 'My plot', pitchMethods = c('dom', 'autocor', 'spec', 'hps', 'cep'), priorMean = NA, # no prior info at all pitchDom = list(col = 'red', domThres = .25), pitchPlot = list(col = 'black', pch = 9, lty = 3, lwd = 3), extraContour = list(x = 'peakFreq', type = 'b', pch = 4, col = 'brown'), osc = 'dB', heights = c(2, 1)) # Analyze an entire folder in one go, saving spectrograms with pitch contours # plus an html file for easy access s2 = analyze('~/Downloads/temp', savePlots = '', # save in the same folder as audio showLegend = TRUE, yScale = 'bark', width = 20, height = 12, units = 'cm', res = 300, ylim = c(0, 5), cores = 4) # use multiple cores to speed up processing s2$summary[, 1:5] # Different options for summarizing the output a = analyze(sound2, 44100, summaryFun = c('mean', 'range')) a$summary # one row per sound # ...with custom summaryFun, eg time of peak relative to duration (0 to 1) timePeak = function(x) which.max(x) / length(x) # without omitting NAs timeTrough = function(x) which.min(x) / length(x) a = analyze(sound2, samplingRate = 16000, summaryFun = c('mean', 'timePeak', 'timeTrough')) colnames(a$summary) # Analyze a selection rather than the whole sound a = analyze(sound, samplingRate = 16000, from = .1, to = .3, plot = TRUE) # Use only a range of frequencies when calculating spectral descriptives # (ignore everything below 100 Hz and above 8000 Hz as irrelevant noise) a = analyze(sound, samplingRate = 16000, cutFreq = c(100, 8000)) ## Amplitude and loudness: analyze() should give the same results as # dedicated functions getRMS() / getLoudness() # Create 1 kHz tone samplingRate = 16000; dur_ms = 50 sound3 = sin(2*pi*1000/samplingRate*(1:(dur_ms/1000*samplingRate))) a1 = analyze(sound3, samplingRate = samplingRate, scale = 1, windowLength = 25, overlap = 50, loudness = list(SPL_measured = 40), pitchMethods = NULL, plot = FALSE) a1$detailed$loudness # loudness per STFT frame (1 sone by definition) getLoudness(sound3, samplingRate = samplingRate, windowLength = 25, overlap = 50, SPL_measured = 40, scale = 1)$loudness a1$detailed$ampl # RMS amplitude per STFT frame getRMS(sound3, samplingRate = samplingRate, windowLength = 25, overlap = 50, scale = 1)$detailed # or even simply: sqrt(mean(sound3 ^ 2)) # The same sound as above, but with half the amplitude a_half = analyze(sound3 / 2, samplingRate = samplingRate, scale = 1, windowLength = 25, overlap = 50, loudness = list(SPL_measured = 40), pitchMethods = NULL, plot = FALSE) a1$detailed$ampl / a_half$detailed$ampl # rms amplitude halved a1$detailed$loudness/ a_half$detailed$loudness # loudness is not a linear function of amplitude # Analyzing ultrasounds (slow but possible, just adjust pitchCeiling) s = soundgen(sylLen = 100, addSilence = 10, pitch = c(25000, 35000, 30000), formants = NA, rolloff = -12, rolloffKHz = 0, pitchSamplingRate = 350000, samplingRate = 350000, windowLength = 5, pitchCeiling = 45000, invalidArgAction = 'ignore', plot = TRUE) # s is a bat-like ultrasound inaudible to humans a = analyze( s, 350000, plot = TRUE, pitchFloor = 10000, pitchCeiling = 90000, priorMean = NA, pitchMethods = c('autocor', 'spec'), # probably shouldn't use pitchMethod = "dom" b/c of likely low-freq noise windowLength = 5, step = 2.5, shortestSyl = 10, shortestPause = 10, # again, very short sounds interpol = list(win = 10), # again, very short sounds smooth = 0.1, # might need less smoothing if very rapid f0 changes nFormants = 0, loudness = NULL, roughness = NULL, novelty = NULL) # NB: ignore formants and loudness estimates for such non-human sounds # download 260 sounds from Anikin & Persson (2017) # http://cogsci.se/publications/anikin-persson_2017_nonlinguistic-vocs/260sounds_wav.zip # unzip them into a folder, say '~/Downloads/temp' myfolder = '~/Downloads/temp' # 260 .wav files live here s = analyze(myfolder) # ~ 10-20 minutes! # s = write.csv(s, paste0(myfolder, '/temp.csv')) # save a backup # Check accuracy: import manually verified pitch values (our "key") # pitchManual # "ground truth" of mean pitch per sound # pitchContour # "ground truth" of complete pitch contours per sound files_manual = paste0(names(pitchManual), '.wav') idx = match(s$file, files_manual) # in case the order is wrong s$key = pitchManual[idx] # Compare manually verified mean pitch with the output of analyze: cor(s$key, s$summary$pitch_median, use = 'pairwise.complete.obs') plot(s$key, s$summary$pitch_median, log = 'xy') abline(a=0, b=1, col='red') # Re-running analyze with manually corrected contours gives correct pitch-related descriptives like amplVoiced and harmonics (NB: you get it "for free" when running pitch_app) s1 = analyze(myfolder, pitchManual = pitchContour) plot(s$summary$harmonics_median, s1$summary$harmonics_median) abline(a=0, b=1, col='red') ## End(Not run)
Starts a shiny app for annotating audio. This is a simplified and faster
version of formant_app intended only for making annotations.
annotation_app(...)annotation_app(...)
... |
presets like |
A list of the last used settings ($settings) plus a data.frame with the annotations. Every time a new annotation is added, the app creates a backup csv file and creates or updates a global object called "my_annot", which contains all the annotations.
## Not run: ann = annotation_app() # runs in default browser such as Firefox or Chrome ann = annotation_app(specType = 'reassigned', windowLength = 5, step = 1) # full list of parameters that can be passed to annotation_app(): # paste0(c(names(input)[which(names(input) %in% rownames(def_form))], # 'spec_xlim', 'spec_ylim', 'spec_colorTheme', 'osc', 'wn'), collapse = ', ') # save the complete output, including the settings used saveRDS(ann, 'my_annotations.rds') # To change system default browser, run something like: options('browser' = '/usr/bin/firefox') # path to the executable on Linux ## End(Not run)## Not run: ann = annotation_app() # runs in default browser such as Firefox or Chrome ann = annotation_app(specType = 'reassigned', windowLength = 5, step = 1) # full list of parameters that can be passed to annotation_app(): # paste0(c(names(input)[which(names(input) %in% rownames(def_form))], # 'spec_xlim', 'spec_ylim', 'spec_colorTheme', 'osc', 'wn'), collapse = ', ') # save the complete output, including the settings used saveRDS(ann, 'my_annotations.rds') # To change system default browser, run something like: options('browser' = '/usr/bin/firefox') # path to the executable on Linux ## End(Not run)
Produces an auditory spectrogram by convolving the sound with a bank of
bandpass filters. The main difference from STFT is that we don't window the
signal and de facto get variable temporal resolution in different frequency
channels, as with a wavelet transform. The key settings are
filterType, nFilters, and yScale, which determine the
type, number, and spacing of the filters, respectively. Gammatone filters
were designed as a simple approximation of human perception - see
gammatone and Slaney 1993 "An Efficient Implementation
of the Patterson–Holdsworth Auditory Filter Bank". Butterworth or Chebyshev
filters are not meant to model perception, but can be useful for quickly
plotting a sound.
audSpectrogram( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, step = 1, dynamicRange = 80, filterType = c("butterworth", "chebyshev", "gammatone")[1], nFilters = 128, nFilters_oct = NULL, filterOrder = if (filterType == "gammatone") 4 else 3, bandwidth = NULL, bandwidthMult = 1, minFreq = 20, maxFreq = NULL, minBandwidth = 10, output = c("audSpec", "audSpec_processed", "filterbank", "filterbank_env", "roughness"), reportEvery = NULL, cores = 1, plot = TRUE, savePlots = NULL, plotFilters = FALSE, osc = c("none", "linear", "dB")[2], heights = c(3, 1), ylim = NULL, yScale = c("bark", "mel", "ERB", "log")[1], contrast = 0.2, brightness = 0, maxPoints = c(1e+05, 5e+05), padWithSilence = TRUE, colorTheme = c("bw", "seewave", "heat.colors", "...")[1], col = NULL, extraContour = NULL, xlab = NULL, ylab = NULL, xaxp = NULL, mar = c(5.1, 4.1, 4.1, 2), main = NULL, grid = NULL, width = 900, height = 500, units = "px", res = NA, ... )audSpectrogram( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, step = 1, dynamicRange = 80, filterType = c("butterworth", "chebyshev", "gammatone")[1], nFilters = 128, nFilters_oct = NULL, filterOrder = if (filterType == "gammatone") 4 else 3, bandwidth = NULL, bandwidthMult = 1, minFreq = 20, maxFreq = NULL, minBandwidth = 10, output = c("audSpec", "audSpec_processed", "filterbank", "filterbank_env", "roughness"), reportEvery = NULL, cores = 1, plot = TRUE, savePlots = NULL, plotFilters = FALSE, osc = c("none", "linear", "dB")[2], heights = c(3, 1), ylim = NULL, yScale = c("bark", "mel", "ERB", "log")[1], contrast = 0.2, brightness = 0, maxPoints = c(1e+05, 5e+05), padWithSilence = TRUE, colorTheme = c("bw", "seewave", "heat.colors", "...")[1], col = NULL, extraContour = NULL, xlab = NULL, ylab = NULL, xaxp = NULL, mar = c(5.1, 4.1, 4.1, 2), main = NULL, grid = NULL, width = 900, height = 500, units = "px", res = NA, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
scale |
maximum possible amplitude of input used for normalization of
input vector (only needed if |
from, to
|
if NULL (default), analyzes the whole sound, otherwise from...to (s) |
step |
step, ms (determines time resolution of the plot, but not of the returned envelopes per channel). step = NULL means no downsampling at all (ncol of output = length of input audio) |
dynamicRange |
dynamic range, dB. All values more than one dynamicRange under maximum are treated as zero |
filterType |
"butterworth" = Butterworth filter
|
nFilters |
the number of filters between |
nFilters_oct |
an alternative way to specify frequency resolution: the number of filters per octave |
filterOrder |
filter order (defaults to 4 for gammatones, 3 otherwise) |
bandwidth |
filter bandwidth, octaves. If NULL, defaults to ERB
bandwidths as in |
bandwidthMult |
a scaling factor for all bandwidths (1 = no effect) |
minFreq, maxFreq
|
the range of frequencies to analyze. If the spectrogram looks empty, try increasing minFreq - the lowest filters are prone to returning very large values |
minBandwidth |
minimum filter bandwidth, Hz (otherwise filters may become too narrow when nFilters is high; has no effect if filterType = 'gammatone') |
output |
a list of measures to return. Defaults to everything, but this takes a lot of RAM, so shorten to what's needed if analyzing many files at once |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
plot |
should a spectrogram be plotted? TRUE / FALSE |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
plotFilters |
if TRUE, plots the filters as central frequencies ± bandwidth/2 |
osc |
"none" = no oscillogram; "linear" = on the original scale; "dB" = in decibels |
heights |
a vector of length two specifying the relative height of the spectrogram and the oscillogram (including time axes labels) |
ylim |
frequency range to plot, kHz (defaults to 0 to Nyquist frequency). NB: still in kHz, even if yScale = bark, mel, or ERB |
yScale |
determines the location of center frequencies of the filters |
contrast |
controls the sharpness or contrast of the image: <0 =
decrease contrast, 0 = no change, >0 increase contrast. Recommended range
approximately (-1, 1). The spectrogram is raised to the power of
|
brightness |
makes the image lighter or darker: <0 = darker, 0 = no change, >0 = lighter, range (-1, 1). The color palette is preserved, so "brightness" works by capping an increasing proportion of image at the lightest or darkest color. To lighten or darken the palette, just change the colors instead |
maxPoints |
the maximum number of "pixels" in the oscillogram (if any) and spectrogram; good for quickly plotting long audio files; defaults to c(1e5, 5e5); does not affect reassigned spectrograms |
padWithSilence |
if TRUE, pads the sound with just enough silence to resolve the edges properly (only the original region is plotted, so the apparent duration doesn't change) |
colorTheme |
black and white ('bw'), as in seewave package ('seewave'),
matlab-type palette ('matlab'), or any palette from
|
col |
actual colors, eg rev(rainbow(100)) - see ?hcl.colors for colors in base R (overrides colorTheme) |
extraContour |
a vector of arbitrary length scaled in Hz (regardless of yScale, but nonlinear yScale also warps the contour) that will be plotted over the spectrogram (eg pitch contour); can also be a list with extra graphical parameters such as lwd, col, etc. (see examples) |
xlab, ylab, main, mar, xaxp
|
graphical parameters for plotting |
grid |
if numeric, adds n = |
width, height, units, res
|
graphical parameters for saving plots passed to
|
... |
other graphical parameters |
Returns a list for each analyzed file, including:
auditory spectrogram with frequencies in rows and time in columns
same but rescaled for plotting
raw output of the filters
roughness per
channel (as many as nFilters)
# synthesize a sound with gradually increasing hissing noise sound = soundgen(sylLen = 200, temperature = 0.001, noise = list(time = c(0, 350), value = c(-40, 0)), formantsNoise = list(f1 = list(freq = 5000, width = 10000)), addSilence = 25) # playme(sound, samplingRate = 16000) # auditory spectrogram as = audSpectrogram(sound, samplingRate = 16000, nFilters = 48) dim(as$audSpec) # compare to FFT-based spectrogram with similar time and frequency resolution fs = spectrogram(sound, samplingRate = 16000, yScale = 'bark', windowLength = 5, step = 1) dim(fs) ## Not run: # add bells and whistles audSpectrogram(sound, samplingRate = 16000, filterType = 'butterworth', nFilters = 128, yScale = 'mel', bandwidth = 1/6, dynamicRange = 150, osc = 'dB', # plot oscillogram in dB heights = c(2, 1), # spectro/osc height ratio contrast = .4, # increase contrast brightness = -.2, # reduce brightness # colorTheme = 'heat.colors', # pick color theme... col = hcl.colors(100, palette = 'Plasma'), # ...or specify the colors cex.lab = .75, cex.axis = .75, # text size and other base graphics pars grid = 5, # to customize, add manually with graphics::grid() ylim = c(0.05, 8), # always in kHz main = 'My auditory spectrogram' # title # + axis labels, etc ) # NB: frequency resolution is controlled by both nFilters and bandwidth audSpectrogram(sound, 16000, nFilters = 15, bandwidth = 1/2) audSpectrogram(sound, 16000, nFilters = 15, bandwidth = 1/10) audSpectrogram(sound, 16000, nFilters = 100, bandwidth = 1/2) audSpectrogram(sound, 16000, nFilters = 100, bandwidth = 1/10) audSpectrogram(sound, 16000, nFilters_oct = 5, bandwidth = 1/10) # remove the oscillogram audSpectrogram(sound, samplingRate = 16000, osc = 'none') # save auditory spectrograms of all audio files in a folder audSpectrogram('~/Downloads/temp', savePlots = '~/Downloads/temp/audSpec', cores = 4) ## End(Not run)# synthesize a sound with gradually increasing hissing noise sound = soundgen(sylLen = 200, temperature = 0.001, noise = list(time = c(0, 350), value = c(-40, 0)), formantsNoise = list(f1 = list(freq = 5000, width = 10000)), addSilence = 25) # playme(sound, samplingRate = 16000) # auditory spectrogram as = audSpectrogram(sound, samplingRate = 16000, nFilters = 48) dim(as$audSpec) # compare to FFT-based spectrogram with similar time and frequency resolution fs = spectrogram(sound, samplingRate = 16000, yScale = 'bark', windowLength = 5, step = 1) dim(fs) ## Not run: # add bells and whistles audSpectrogram(sound, samplingRate = 16000, filterType = 'butterworth', nFilters = 128, yScale = 'mel', bandwidth = 1/6, dynamicRange = 150, osc = 'dB', # plot oscillogram in dB heights = c(2, 1), # spectro/osc height ratio contrast = .4, # increase contrast brightness = -.2, # reduce brightness # colorTheme = 'heat.colors', # pick color theme... col = hcl.colors(100, palette = 'Plasma'), # ...or specify the colors cex.lab = .75, cex.axis = .75, # text size and other base graphics pars grid = 5, # to customize, add manually with graphics::grid() ylim = c(0.05, 8), # always in kHz main = 'My auditory spectrogram' # title # + axis labels, etc ) # NB: frequency resolution is controlled by both nFilters and bandwidth audSpectrogram(sound, 16000, nFilters = 15, bandwidth = 1/2) audSpectrogram(sound, 16000, nFilters = 15, bandwidth = 1/10) audSpectrogram(sound, 16000, nFilters = 100, bandwidth = 1/2) audSpectrogram(sound, 16000, nFilters = 100, bandwidth = 1/10) audSpectrogram(sound, 16000, nFilters_oct = 5, bandwidth = 1/10) # remove the oscillogram audSpectrogram(sound, samplingRate = 16000, osc = 'none') # save auditory spectrograms of all audio files in a folder audSpectrogram('~/Downloads/temp', savePlots = '~/Downloads/temp/audSpec', cores = 4) ## End(Not run)
Filtering in the frequency domain with FFT-iFFT: low-pass, high-pass,
bandpass, and bandstop filters. Similar to ffilter,
but here we use FFT instead of STFT - that is, the entire sound is processed
at once. This works best for relatively short sounds (seconds), but gives us
maximum precision (e.g., for precise notch filtering) and doesn't affect the
attack and decay. NAs are accepted and can be interpolated or preserved in
the output. Because we don't do STFT, arbitrarily short vectors are also fine
as input - for example, we can apply a low-pass filter prior to decimation
when changing the sampling rate without aliasing. Note that, unlike
pitchSmoothPraat, bandpass by default applies an abrupt
cutoff instead of a smooth gaussian filter, but this behavior can be adjusted
with the bw argument.
bandpass( x, samplingRate = NULL, lwr = NULL, upr = NULL, action = c("pass", "stop")[1], dB = Inf, bw = 0, na.rm = TRUE, from = NULL, to = NULL, normalize = FALSE, reportEvery = NULL, cores = 1, saveAudio = NULL, plot = FALSE, savePlots = NULL, width = 900, height = 500, units = "px", res = NA, ... )bandpass( x, samplingRate = NULL, lwr = NULL, upr = NULL, action = c("pass", "stop")[1], dB = Inf, bw = 0, na.rm = TRUE, from = NULL, to = NULL, normalize = FALSE, reportEvery = NULL, cores = 1, saveAudio = NULL, plot = FALSE, savePlots = NULL, width = 900, height = 500, units = "px", res = NA, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
lwr, upr
|
cutoff frequencies, Hz. Specifying just lwr gives a high-pass filter, just upr low-pass filter with action = 'pass' (or vice versa with action = 'stop'). Specifying both lwr and upr a bandpass/bandstop filter, depending on 'action' |
action |
"pass" = preserve the selected frequency range (bandpass), "stop" = remove the selected frequency range (bandstop) |
dB |
a positive number giving the strength of effect in dB (defaults to Inf - complete removal of selected frequencies) |
bw |
bandwidth of the filter cutoffs, Hz. Defaults to 0 (abrupt, step function), a positive number corresponds to the standard deviation of a Gaussian curve, and two numbers set different bandwidths for the lower and upper cutoff points |
na.rm |
if TRUE, NAs are interpolated, otherwise they are preserved in the output |
from, to
|
if NULL (default), analyzes the whole sound, otherwise from...to (s) |
normalize |
if TRUE, resets the output to the original scale (otherwise filtering often reduces the amplitude) |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
saveAudio |
full path to the folder in which to save the processed audio |
plot |
should a spectrogram be plotted? TRUE / FALSE |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
width, height, units, res
|
graphical parameters for saving plots passed to
|
... |
other graphical parameters passed to |
Algorithm: fill in NAs with constant interpolation at the edges and linear interpolation in the middle; perform FFT; set the frequency ranges to be filtered out to 0; perform inverse FFT; set to the original scale; put the NAs back in.
# Filter white noise s1 = fade(c(rnorm(2000, 0, 1)), samplingRate = 16000) # low-pass bandpass(s1, 16000, upr = 2000, plot = TRUE) # high-pass by 40 dB bandpass(s1, 16000, lwr = 2000, dB = 40, plot = TRUE, wl = 1024) # wl is passed to seewave::meanspec for plotting # bandstop bandpass(s1, 16000, lwr = 1000, upr = 1800, action = 'stop', plot = TRUE) # bandpass s2 = bandpass(s1, 16000, lwr = 2000, upr = 2100, plot = TRUE) # playme(rep(s2, 5)) # spectrogram(s2, 16000) # low-pass and interpolate a short vector with some NAs x = rnorm(150, 10) + 3 * sin((1:50) / 5) x[sample(seq_along(x), 50)] = NA plot(x, type = 'l') x_bandp = bandpass(x, samplingRate = 100, upr = 10) points(x_bandp, type = 'l', col = 'blue') ## Not run: # add 20 dB with a Gaussian-shaped filter instead of step function s3 = bandpass(s1, 16000, lwr = 1700, upr = 2100, bw = 200, dB = 20, plot = TRUE) spectrogram(s3, 16000) s4 = bandpass(s1, 16000, lwr = 2000, upr = 4300, bw = c(100, 500), dB = 60, action = 'stop', plot = TRUE) spectrogram(s4, 16000) # precise notch filtering is possible, even in low frequencies whiteNoise = runif(16000, -1, 1) s3 = bandpass(whiteNoise, 16000, lwr = 30, upr = 40, normalize = TRUE, plot = TRUE, xlim = c(0, 500)) playme(rep(s3, 5)) spectrogram(s3, 16000, windowLength = 150, yScale = 'log') # compare the same with STFT s4 = seewave::ffilter(whiteNoise, f = 16000, from = 30, to = 40) spectrogram(s4, 16000, windowLength = 150, yScale = 'log') # (note: works better as wl approaches length(s4)) # high-pass all audio files in a folder bandpass('~/Downloads/temp', saveAudio = '~/Downloads/temp/hp2000/', lwr = 2000, savePlots = '~/Downloads/temp/hp2000/') ## End(Not run)# Filter white noise s1 = fade(c(rnorm(2000, 0, 1)), samplingRate = 16000) # low-pass bandpass(s1, 16000, upr = 2000, plot = TRUE) # high-pass by 40 dB bandpass(s1, 16000, lwr = 2000, dB = 40, plot = TRUE, wl = 1024) # wl is passed to seewave::meanspec for plotting # bandstop bandpass(s1, 16000, lwr = 1000, upr = 1800, action = 'stop', plot = TRUE) # bandpass s2 = bandpass(s1, 16000, lwr = 2000, upr = 2100, plot = TRUE) # playme(rep(s2, 5)) # spectrogram(s2, 16000) # low-pass and interpolate a short vector with some NAs x = rnorm(150, 10) + 3 * sin((1:50) / 5) x[sample(seq_along(x), 50)] = NA plot(x, type = 'l') x_bandp = bandpass(x, samplingRate = 100, upr = 10) points(x_bandp, type = 'l', col = 'blue') ## Not run: # add 20 dB with a Gaussian-shaped filter instead of step function s3 = bandpass(s1, 16000, lwr = 1700, upr = 2100, bw = 200, dB = 20, plot = TRUE) spectrogram(s3, 16000) s4 = bandpass(s1, 16000, lwr = 2000, upr = 4300, bw = c(100, 500), dB = 60, action = 'stop', plot = TRUE) spectrogram(s4, 16000) # precise notch filtering is possible, even in low frequencies whiteNoise = runif(16000, -1, 1) s3 = bandpass(whiteNoise, 16000, lwr = 30, upr = 40, normalize = TRUE, plot = TRUE, xlim = c(0, 500)) playme(rep(s3, 5)) spectrogram(s3, 16000, windowLength = 150, yScale = 'log') # compare the same with STFT s4 = seewave::ffilter(whiteNoise, f = 16000, from = 30, to = 40) spectrogram(s4, 16000, windowLength = 150, yScale = 'log') # (note: works better as wl approaches length(s4)) # high-pass all audio files in a folder bandpass('~/Downloads/temp', saveAudio = '~/Downloads/temp/hp2000/', lwr = 2000, savePlots = '~/Downloads/temp/hp2000/') ## End(Not run)
Generates percussive sounds from clicks through drum-like beats to sliding
tones. The principle is to create a sine wave with rapid frequency modulation
and to add a fade-out. No extra harmonics or formants are added. For this
specific purpose, this is vastly faster and easier than to tinker with
soundgen settings, especially since percussive syllables tend
to be very short.
beat( nSyl = 10, sylLen = 200, pauseLen = 50, pitch = c(200, 10), samplingRate = 16000, fadeOut = TRUE, play = FALSE )beat( nSyl = 10, sylLen = 200, pauseLen = 50, pitch = c(200, 10), samplingRate = 16000, fadeOut = TRUE, play = FALSE )
nSyl |
the number of syllables to generate |
sylLen |
average duration of each syllable, ms |
pauseLen |
average duration of pauses between syllables, ms |
pitch |
fundamental frequency, Hz - a vector or data.frame(time = ..., value = ...) |
samplingRate |
sampling frequency, Hz |
fadeOut |
if TRUE, a linear fade-out is applied to the entire syllable |
play |
if TRUE, plays the synthesized sound using the default player on
your system. If character, passed to |
Returns a non-normalized waveform centered at zero.
playback = c(TRUE, FALSE)[2] # a drum-like sound s = beat(nSyl = 1, sylLen = 200, pitch = c(200, 100), play = playback) # plot(s, type = 'l') # a dry, muted drum s = beat(nSyl = 1, sylLen = 200, pitch = c(200, 10), play = playback) # sci-fi laser guns s = beat(nSyl = 3, sylLen = 300, pitch = c(1000, 50), play = playback) # machine guns s = beat(nSyl = 10, sylLen = 10, pauseLen = 50, pitch = c(2300, 300), play = playback)playback = c(TRUE, FALSE)[2] # a drum-like sound s = beat(nSyl = 1, sylLen = 200, pitch = c(200, 100), play = playback) # plot(s, type = 'l') # a dry, muted drum s = beat(nSyl = 1, sylLen = 200, pitch = c(200, 10), play = playback) # sci-fi laser guns s = beat(nSyl = 3, sylLen = 300, pitch = c(1000, 50), play = playback) # machine guns s = beat(nSyl = 10, sylLen = 10, pauseLen = 50, pitch = c(2300, 300), play = playback)
Computes similarity between two sounds based on comparing their
spectrogram-like representations. If the input is audio, two methods of
producing spectrograms are available: specType = 'linear' calls
powspec for an power spectrogram with frequencies in Hz,
and specType = 'mel' calls melfcc for an auditory
spectrogram with frequencies in Mel. For more customized options, just
produce your spectrograms or feature matrices (time in column, features like
pitch, peak frequency etc in rows) with your favorite function before calling
compareSounds because it also accepts matrices as input. To be
directly comparable, the two matrices are made into matrices of the same
size. In case of differences in sampling rates, only frequencies below the
lower Nyquist frequency or below maxFreq are kept. In case of
differences in duration, the shorter sound is padded with 0 (silence) or NA,
as controlled by arguments padWith, padDir. Then the matrices are
compared using methods like cross-correlation or Dynamic Time Warp.
compareSounds( x, y, samplingRate = NULL, windowLength = 40, overlap = 50, step = NULL, dynamicRange = 80, method = c("cor", "cosine", "diff", "dtw"), specType = c("linear", "mel")[2], specPars = list(), dtwPars = list(), padWith = NA, padDir = c("central", "left", "right")[1], maxFreq = NULL )compareSounds( x, y, samplingRate = NULL, windowLength = 40, overlap = 50, step = NULL, dynamicRange = 80, method = c("cor", "cosine", "diff", "dtw"), specType = c("linear", "mel")[2], specPars = list(), dtwPars = list(), padWith = NA, padDir = c("central", "left", "right")[1], maxFreq = NULL )
x, y
|
either two matrices (spectrograms or feature matrices) or two sounds to be compared (numeric vectors, Wave objects, or paths to wav/mp3 files) |
samplingRate |
if one or both inputs are numeric vectors, specify sampling rate, Hz. A vector of length 2 means the two inputs have different sampling rates, in which case spectrograms are compared only up to the lower Nyquist frequency |
windowLength |
length of FFT window, ms (multiple values in a vector produce a multi-resolution spectrogram) |
overlap |
overlap between successive FFT frames, % |
step |
you can override |
dynamicRange |
parts of the spectra quieter than |
method |
method of comparing mel-transformed spectra of two sounds:
"cor" = Pearson's correlation; "cosine" = cosine similarity; "diff" =
absolute difference between each bin in the two spectrograms; "dtw" =
multivariate Dynamic Time Warp with |
specType |
"linear" = power spectrogram with
|
specPars |
a list of parameters passed to |
dtwPars |
a list of parameters passed to |
padWith |
if the duration of x and y is not identical, the compared
spectrograms are padded with either silence ( |
padDir |
if padding, specify where to add zeros or NAs: before the sound ('left'), after the sound ('right'), or on both sides ('central') |
maxFreq |
parts of the spectra above |
Returns a dataframe with two columns: "method" for the method(s)
used, and "sim" for the similarity between the two sounds calculated with
that method. The range of similarity measures is [-1, 1] for "cor",
[0, 1] for "cosine" and "diff", and (-Inf, Inf) for "dtw".
data(orni, peewit, package = 'seewave') compareSounds(orni, peewit) # spectrogram(orni); playme(orni) # spectrogram(peewit); playme(peewit) ## Not run: s1 = soundgen(formants = 'a', play = TRUE) s2 = soundgen(formants = 'ae', play = TRUE) s3 = soundgen(formants = 'eae', sylLen = 700, play = TRUE) s4 = runif(8000, -1, 1) # white noise compareSounds(s1, s2, samplingRate = 16000) compareSounds(s1, s4, samplingRate = 16000) # the central section of s3 is more similar to s1 than is the beg/eng of s3 compareSounds(s1, s3, samplingRate = 16000, padDir = 'left') compareSounds(s1, s3, samplingRate = 16000, padDir = 'central') # padding with 0 penalizes differences in duration, whereas padding with NA # is like saying we only care about the overlapping part compareSounds(s1, s3, samplingRate = 16000, padWith = 0) compareSounds(s1, s3, samplingRate = 16000, padWith = NA) # comparing linear (Hz) vs mel-spectrograms produces quite different results compareSounds(s1, s3, samplingRate = 16000, specType = 'linear') compareSounds(s1, s3, samplingRate = 16000, specType = 'mel') # pass additional control parameters to dtw and melfcc compareSounds(s1, s3, samplingRate = 16000, specPars = list(nbands = 128), dtwPars = list(dist.method = "Manhattan")) # use feature matrices instead of spectrograms (time in columns, features in rows) a1 = t(as.matrix(analyze(s1, samplingRate = 16000)$detailed)) a1 = a1[4:nrow(a1), ]; a1[is.na(a1)] = 0 a2 = t(as.matrix(analyze(s2, samplingRate = 16000)$detailed)) a2 = a2[4:nrow(a2), ]; a2[is.na(a2)] = 0 a4 = t(as.matrix(analyze(s4, samplingRate = 16000)$detailed)) a4 = a4[4:nrow(a4), ]; a4[is.na(a4)] = 0 compareSounds(a1, a2, method = c('cosine', 'dtw')) compareSounds(a1, a4, method = c('cosine', 'dtw')) # a demo for comparing different similarity metrics target = soundgen(sylLen = 500, formants = 'a', pitch = data.frame(time = c(0, 0.1, 0.9, 1), value = c(100, 150, 135, 100)), temperature = 0.001) spec1 = soundgen:::getMelSpec(target, samplingRate = 16000) parsToTry = list( list(formants = 'i', # wrong pitch = data.frame(time = c(0, 1), # wrong value = c(200, 300))), list(formants = 'i', # wrong pitch = data.frame(time = c(0, 0.1, 0.9, 1), # right value = c(100, 150, 135, 100))), list(formants = 'a', # right pitch = data.frame(time = c(0,1), # wrong value = c(200, 300))), list(formants = 'a', pitch = data.frame(time = c(0, 0.1, 0.9, 1), # right value = c(100, 150, 135, 100))) # right ) sounds = list() for (s in seq_along(parsToTry)) { sounds[[length(sounds) + 1]] = do.call(soundgen, c(parsToTry[[s]], list(temperature = 0.001, sylLen = 500))) } lapply(sounds, playme) method = c('cor', 'cosine', 'diff', 'dtw') df = matrix(NA, nrow = length(parsToTry), ncol = length(method)) colnames(df) = method df = as.data.frame(df) for (i in 1:nrow(df)) { df[i, ] = compareSounds( x = spec1, # faster to calculate spec1 once y = sounds[[i]], samplingRate = 16000, method = method )[, 2] } df$av = rowMeans(df, na.rm = TRUE) # row 1 = wrong pitch & formants, ..., row 4 = right pitch & formants df$formants = c('wrong', 'wrong', 'right', 'right') df$pitch = c('wrong', 'right', 'wrong', 'right') df ## End(Not run)data(orni, peewit, package = 'seewave') compareSounds(orni, peewit) # spectrogram(orni); playme(orni) # spectrogram(peewit); playme(peewit) ## Not run: s1 = soundgen(formants = 'a', play = TRUE) s2 = soundgen(formants = 'ae', play = TRUE) s3 = soundgen(formants = 'eae', sylLen = 700, play = TRUE) s4 = runif(8000, -1, 1) # white noise compareSounds(s1, s2, samplingRate = 16000) compareSounds(s1, s4, samplingRate = 16000) # the central section of s3 is more similar to s1 than is the beg/eng of s3 compareSounds(s1, s3, samplingRate = 16000, padDir = 'left') compareSounds(s1, s3, samplingRate = 16000, padDir = 'central') # padding with 0 penalizes differences in duration, whereas padding with NA # is like saying we only care about the overlapping part compareSounds(s1, s3, samplingRate = 16000, padWith = 0) compareSounds(s1, s3, samplingRate = 16000, padWith = NA) # comparing linear (Hz) vs mel-spectrograms produces quite different results compareSounds(s1, s3, samplingRate = 16000, specType = 'linear') compareSounds(s1, s3, samplingRate = 16000, specType = 'mel') # pass additional control parameters to dtw and melfcc compareSounds(s1, s3, samplingRate = 16000, specPars = list(nbands = 128), dtwPars = list(dist.method = "Manhattan")) # use feature matrices instead of spectrograms (time in columns, features in rows) a1 = t(as.matrix(analyze(s1, samplingRate = 16000)$detailed)) a1 = a1[4:nrow(a1), ]; a1[is.na(a1)] = 0 a2 = t(as.matrix(analyze(s2, samplingRate = 16000)$detailed)) a2 = a2[4:nrow(a2), ]; a2[is.na(a2)] = 0 a4 = t(as.matrix(analyze(s4, samplingRate = 16000)$detailed)) a4 = a4[4:nrow(a4), ]; a4[is.na(a4)] = 0 compareSounds(a1, a2, method = c('cosine', 'dtw')) compareSounds(a1, a4, method = c('cosine', 'dtw')) # a demo for comparing different similarity metrics target = soundgen(sylLen = 500, formants = 'a', pitch = data.frame(time = c(0, 0.1, 0.9, 1), value = c(100, 150, 135, 100)), temperature = 0.001) spec1 = soundgen:::getMelSpec(target, samplingRate = 16000) parsToTry = list( list(formants = 'i', # wrong pitch = data.frame(time = c(0, 1), # wrong value = c(200, 300))), list(formants = 'i', # wrong pitch = data.frame(time = c(0, 0.1, 0.9, 1), # right value = c(100, 150, 135, 100))), list(formants = 'a', # right pitch = data.frame(time = c(0,1), # wrong value = c(200, 300))), list(formants = 'a', pitch = data.frame(time = c(0, 0.1, 0.9, 1), # right value = c(100, 150, 135, 100))) # right ) sounds = list() for (s in seq_along(parsToTry)) { sounds[[length(sounds) + 1]] = do.call(soundgen, c(parsToTry[[s]], list(temperature = 0.001, sylLen = 500))) } lapply(sounds, playme) method = c('cor', 'cosine', 'diff', 'dtw') df = matrix(NA, nrow = length(parsToTry), ncol = length(method)) colnames(df) = method df = as.data.frame(df) for (i in 1:nrow(df)) { df[i, ] = compareSounds( x = spec1, # faster to calculate spec1 once y = sounds[[i]], samplingRate = 16000, method = method )[, 2] } df$av = rowMeans(df, na.rm = TRUE) # row 1 = wrong pitch & formants, ..., row 4 = right pitch & formants df$formants = c('wrong', 'wrong', 'right', 'right') df$pitch = c('wrong', 'right', 'wrong', 'right') df ## End(Not run)
crossFade joins two input vectors (waveforms) by cross-fading. First
it truncates both input vectors, so that ampl1 ends with a zero
crossing and ampl2 starts with a zero crossing, both on an upward
portion of the soundwave. Then it cross-fades both vectors linearly with an
overlap of crossLen or crossLenPoints. If the input vectors are too short for
the specified length of cross-faded region, the two vectors are concatenated
at zero crossings instead of cross-fading. Soundgen uses crossFade for
gluing together epochs with different regimes of pitch effects (see the
vignette on sound generation), but it can also be useful for joining two
separately generated sounds without audible artifacts.
crossFade( ampl1, ampl2, crossLenPoints = 240, crossLen = NULL, samplingRate = NULL, shape = c("lin", "exp", "log", "cos", "logistic", "gaussian")[1], steepness = 1 )crossFade( ampl1, ampl2, crossLenPoints = 240, crossLen = NULL, samplingRate = NULL, shape = c("lin", "exp", "log", "cos", "logistic", "gaussian")[1], steepness = 1 )
ampl1, ampl2
|
two numeric vectors (waveforms) to be joined |
crossLenPoints |
(optional) the length of overlap in points |
crossLen |
the length of overlap in ms (overrides crossLenPoints) |
samplingRate |
the sampling rate of input vectors, Hz (needed only if crossLen is given in ms rather than points) |
shape |
controls the type of fade function: 'lin' = linear, 'exp' = exponential, 'log' = logarithmic, 'cos' = cosine, 'logistic' = logistic S-curve |
steepness |
scaling factor regulating the steepness of fading curves (except for shapes 'lin' and 'cos'): 0 = linear, >1 = steeper than default |
Returns a numeric vector.
sound1 = sin(1:100 / 9) sound2 = sin(7:107 / 3) plot(c(sound1, sound2), type = 'b') # an ugly discontinuity at 100 that will make an audible click sound = crossFade(sound1, sound2, crossLenPoints = 5) plot(sound, type = 'b') # a nice, smooth transition length(sound) # but note that cross-fading costs us ~60 points # because of trimming to zero crossings and then overlapping ## Not run: # Actual sounds, alternative shapes of fade-in/out sound3 = soundgen(formants = 'a', pitch = 200, addSilence = 0, attackLen = c(50, 0)) sound4 = soundgen(formants = 'u', pitch = 200, addSilence = 0, attackLen = c(0, 50)) # simple concatenation (with a click) playme(c(sound3, sound4), 16000) # concatentation from zc to zc (no click, but a rough transition) playme(crossFade(sound3, sound4, crossLen = 0), 16000) # linear crossFade over 35 ms - brief, but smooth playme(crossFade(sound3, sound4, crossLen = 35, samplingRate = 16000), 16000) # s-shaped cross-fade over 300 ms (shortens the sound by ~300 ms) playme(crossFade(sound3, sound4, samplingRate = 16000, crossLen = 300, shape = 'cos'), 16000) ## End(Not run)sound1 = sin(1:100 / 9) sound2 = sin(7:107 / 3) plot(c(sound1, sound2), type = 'b') # an ugly discontinuity at 100 that will make an audible click sound = crossFade(sound1, sound2, crossLenPoints = 5) plot(sound, type = 'b') # a nice, smooth transition length(sound) # but note that cross-fading costs us ~60 points # because of trimming to zero crossings and then overlapping ## Not run: # Actual sounds, alternative shapes of fade-in/out sound3 = soundgen(formants = 'a', pitch = 200, addSilence = 0, attackLen = c(50, 0)) sound4 = soundgen(formants = 'u', pitch = 200, addSilence = 0, attackLen = c(0, 50)) # simple concatenation (with a click) playme(c(sound3, sound4), 16000) # concatentation from zc to zc (no click, but a rough transition) playme(crossFade(sound3, sound4, crossLen = 0), 16000) # linear crossFade over 35 ms - brief, but smooth playme(crossFade(sound3, sound4, crossLen = 35, samplingRate = 16000), 16000) # s-shaped cross-fade over 300 ms (shortens the sound by ~300 ms) playme(crossFade(sound3, sound4, samplingRate = 16000, crossLen = 300, shape = 'cos'), 16000) ## End(Not run)
A list of default values for Shiny app soundgen_app() - mostly the same as the defaults for soundgen(). NB: if defaults change, this has to be updated!!!
defaultsdefaults
An object of class list of length 69.
A dataset containing defaults and ranges of key variables for analyze() and pitch_app(). Adjust as needed.
defaults_analyzedefaults_analyze
A matrix with 58 rows and 4 columns:
default value
lowest permitted value
highest permitted value
increment for adjustment
...
Default plotting settings for each pitch tracker in analyze() and pitch_app(). Adjust as needed.
defaults_analyze_pitchCanddefaults_analyze_pitchCand
A dataframe with 8 rows and 5 columns:
pitch tracking method
color
point character
line width
line type
...
(Experimental) A function for automatically detecting and annotating
nonlinear vocal phenomena (NLP). Algorithm: analyze the audio using
analyze and phasegram, then use the extracted
frame-by-frame descriptives to classify each frame as having no NLP ("none"),
subharmonics ("sh"), sibebands / amplitude modulation ("sb"), or
deterministic chaos ("chaos"). The classification is performed by a
naiveBayes algorithm adapted to autocorrelated time series and
pretrained on a manually annotated corpus of vocalizations. Whenever
possible, check and correct pitch tracks prior to running the algorithm. See
naiveBayes for tips on using adaptive priors and "clumpering"
to account for the fact that NLP typically occur in continuous segments
spanning multiple frames.
detectNLP( x, samplingRate = NULL, predictors = c("d2", "subDep", "amEnvDep", "amMsPurity", "entropy", "HNR", "CPP", "roughness"), thresProb = 0.4, voicelessdToNone = FALSE, train = soundgen::detectNLP_training_nonv, scale = NULL, from = NULL, to = NULL, pitchManual = NULL, pars_analyze = list(windowLength = 50, roughness = list(windowLength = 15, step = 3)), pars_phasegram = list(nonlinStats = "d2"), pars_naiveBayes = list(prior = "static", wlClumper = 3), jumpThres = 14, jumpWindow = 100, reportEvery = NULL, cores = 1, plot = FALSE, savePlots = NULL, main = NULL, xlab = NULL, ylab = NULL, ylim = NULL, width = 900, height = 500, units = "px", res = NA, ... )detectNLP( x, samplingRate = NULL, predictors = c("d2", "subDep", "amEnvDep", "amMsPurity", "entropy", "HNR", "CPP", "roughness"), thresProb = 0.4, voicelessdToNone = FALSE, train = soundgen::detectNLP_training_nonv, scale = NULL, from = NULL, to = NULL, pitchManual = NULL, pars_analyze = list(windowLength = 50, roughness = list(windowLength = 15, step = 3)), pars_phasegram = list(nonlinStats = "d2"), pars_naiveBayes = list(prior = "static", wlClumper = 3), jumpThres = 14, jumpWindow = 100, reportEvery = NULL, cores = 1, plot = FALSE, savePlots = NULL, main = NULL, xlab = NULL, ylab = NULL, ylim = NULL, width = 900, height = 500, units = "px", res = NA, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
predictors |
variables to include in NLP classification. The default is to include all 7 variables in the training corpus. NA values are fine (they do not cause the entire frame to be dropped as long as at least one variable is measured). |
thresProb |
minimum probability of NLP for the frame to be classified as non-"none", which is good for reducing false alarms (<1/nClasses means just go for the highest probability) |
voicelessdToNone |
if TRUE, frames treated as voicelessd are set to "none" (mostly makes sense with manual pitch tracking) |
train |
training corpus, namely the result of running
|
scale |
maximum possible amplitude of input used for normalization of
input vector (only needed if |
from, to
|
if NULL (default), analyzes the whole sound, otherwise from...to (s) |
pitchManual |
manually corrected pitch contour. For a single sound,
provide a numeric vector of any length. For multiple sounds, provide a
dataframe with columns "file" and "pitch" (or path to a csv file) as
returned by |
pars_analyze |
arguments passed to |
pars_phasegram |
arguments passed to |
pars_naiveBayes |
arguments passed to |
jumpThres |
frames in which pitch changes by |
jumpWindow |
the window for calculating the median pitch slope around the analyzed frame, ms |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
plot |
if TRUE, produces a spectrogram with annotated NLP regimes |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
main, xlab, ylab, ...
|
graphical parameters passed to
|
ylim |
frequency range to plot, kHz (defaults to 0 to Nyquist frequency). NB: still in kHz, even if yScale = bark, mel, or ERB |
width, height, units, res
|
parameters passed to
|
Returns a dataframe with frame-by-frame descriptives, posterior probabilities of each NLP type per frame, and the tentative classification (the NLP type with the highest posterior probability, possibly corrected by clumpering). The time step is equal to the larger of the steps passed to analyze() and phasegram().
Returns a list of datasets, one per input file, with acoustic
descriptives per frame (returned by analyze and phasegram),
probabilities of each NLP type per frame, and the putative classification
of NLP per frame.
## Not run: target = soundgen(sylLen = 2000, addSilence = 0, temperature = 1e-2, pitch = c(380, 550, 500, 220), subDep = c(0, 0, 40, 0, 0, 0, 0, 0), amDep = c(0, 0, 0, 0, 80, 0, 0, 0), amFreq = 80, noise = c(-10, rep(-40, 5)), jitterDep = c(0, 0, 0, 0, 0, 3), plot = TRUE, play = TRUE) # classifier trained on manually annotated recordings of human nonverbal # vocalizations nlp = detectNLP(target, 16000, predictors = c('subDep', 'amEnvDep', 'amMsPurity', 'HNR', 'CPP'), plot = TRUE, ylim = c(0, 4)) # classifier trained on synthetic, soundgen()-generated sounds nlp = detectNLP(target, 16000, train = soundgen::detectNLP_training_synth, predictors = c('subDep', 'amEnvDep', 'amMsPurity', 'HNR', 'CPP'), plot = TRUE, ylim = c(0, 4)) head(nlp[, c('time', 'pr')]) table(nlp$pr) plot(nlp$amEnvDep, type = 'l') plot(nlp$subDep, type = 'l') plot(nlp$entropy, type = 'l') plot(nlp$none, type = 'l') points(nlp$sb, type = 'l', col = 'blue') points(nlp$sh, type = 'l', col = 'green') points(nlp$chaos, type = 'l', col = 'red') # detection of pitch jumps s1 = soundgen(sylLen = 1200, temperature = .001, pitch = list( time = c(0, 350, 351, 890, 891, 1200), value = c(140, 230, 460, 330, 220, 200))) playme(s1, 16000) nlp1 = detectNLP(s1, 16000, plot = TRUE, ylim = c(0, 3), predictors = c('subDep', 'amEnvDep', 'amMsPurity', 'HNR', 'CPP'), train = soundgen::detectNLP_training_synth) # process all files in a folder nlp = detectNLP('/home/allgoodguys/Downloads/temp260/', pitchManual = soundgen::pitchContour, cores = 4, plot = TRUE, savePlots = '', ylim = c(0, 3)) ## End(Not run)## Not run: target = soundgen(sylLen = 2000, addSilence = 0, temperature = 1e-2, pitch = c(380, 550, 500, 220), subDep = c(0, 0, 40, 0, 0, 0, 0, 0), amDep = c(0, 0, 0, 0, 80, 0, 0, 0), amFreq = 80, noise = c(-10, rep(-40, 5)), jitterDep = c(0, 0, 0, 0, 0, 3), plot = TRUE, play = TRUE) # classifier trained on manually annotated recordings of human nonverbal # vocalizations nlp = detectNLP(target, 16000, predictors = c('subDep', 'amEnvDep', 'amMsPurity', 'HNR', 'CPP'), plot = TRUE, ylim = c(0, 4)) # classifier trained on synthetic, soundgen()-generated sounds nlp = detectNLP(target, 16000, train = soundgen::detectNLP_training_synth, predictors = c('subDep', 'amEnvDep', 'amMsPurity', 'HNR', 'CPP'), plot = TRUE, ylim = c(0, 4)) head(nlp[, c('time', 'pr')]) table(nlp$pr) plot(nlp$amEnvDep, type = 'l') plot(nlp$subDep, type = 'l') plot(nlp$entropy, type = 'l') plot(nlp$none, type = 'l') points(nlp$sb, type = 'l', col = 'blue') points(nlp$sh, type = 'l', col = 'green') points(nlp$chaos, type = 'l', col = 'red') # detection of pitch jumps s1 = soundgen(sylLen = 1200, temperature = .001, pitch = list( time = c(0, 350, 351, 890, 891, 1200), value = c(140, 230, 460, 330, 220, 200))) playme(s1, 16000) nlp1 = detectNLP(s1, 16000, plot = TRUE, ylim = c(0, 3), predictors = c('subDep', 'amEnvDep', 'amMsPurity', 'HNR', 'CPP'), train = soundgen::detectNLP_training_synth) # process all files in a folder nlp = detectNLP('/home/allgoodguys/Downloads/temp260/', pitchManual = soundgen::pitchContour, cores = 4, plot = TRUE, savePlots = '', ylim = c(0, 3)) ## End(Not run)
The results of running naiveBayes_train on acoustically
analyzed 969 human nonverbal vocalizations (>83K frames). It is used by
detectNLP.
detectNLP_training_nonvdetectNLP_training_nonv
An object of class list of length 9.
The results of running naiveBayes_train on 5000 synthetic
sounds with or without NLP created with soundgen(). It is used by
detectNLP.
detectNLP_training_synthdetectNLP_training_synth
An object of class list of length 9.
Estimates the length of vocal tract based on formant frequencies. If
method = 'meanFormant', vocal tract length (VTL) is calculated
separately for each formant, and then the resulting VTLs are averaged. The
equation used is for a closed-open tube (mouth open) and
for an open-open
or closed-closed tube (eg closed mouth in mmm or open mouth and open glottis
in whispering). If method = 'meanDispersion', formant dispersion is
calculated as the mean distance between formants, and then VTL is calculated
as . If method =
'regression', formant dispersion is estimated using the regression method
described in Reby et al. (2005) and Anikin et al. (2024). For a review of
VTL-related summary measures of formant frequencies, refer to Pisanski et al.
(2014). See also schwa for VTL estimation with additional
information on formant frequencies.
estimateVTL( formants, method = c("regression", "meanDispersion", "meanFormant")[1], interceptZero = TRUE, tube = c("closed-open", "open-open")[1], speedSound = 35400, checkFormat = TRUE, output = c("simple", "detailed")[1], plot = FALSE )estimateVTL( formants, method = c("regression", "meanDispersion", "meanFormant")[1], interceptZero = TRUE, tube = c("closed-open", "open-open")[1], speedSound = 35400, checkFormat = TRUE, output = c("simple", "detailed")[1], plot = FALSE )
formants |
formant frequencies in any format recognized by
|
method |
the method of estimating vocal tract length (see details) |
interceptZero |
if TRUE, forces the regression curve to pass through the origin. This reduces the influence of highly variable lower formants, but we have to commit to a particular model of the vocal tract: closed-open or open-open/closed-closed (method = "regression" only) |
tube |
the vocal tract is assumed to be a cylindrical tube that is either "closed-open" or "open-open" (same as closed-closed) |
speedSound |
speed of sound in warm air, by default 35400 cm/s. Stevens (2000) "Acoustic phonetics", p. 138 |
checkFormat |
if FALSE, only a list of properly formatted formant frequencies is accepted |
output |
"simple" (default) = just the VTL; "detailed" = a list of additional stats (see Value below) |
plot |
if TRUE, plots the regression line whose slope gives formant dispersion (method = "regression" only). Label sizes show the influence of each formant, and the blue line corresponds to each formant being an integer multiple of F1 (as when harmonics are misidentified as formants); the second plot shows how VTL varies depending on the number of formants used |
If output = 'simple' (default), returns the estimated vocal
tract length in cm. If output = 'detailed' and method =
'regression', returns a list with extra stats used for plotting. Namely,
$regressionInfo$infl gives the influence of each observation
calculated as the absolute change in VTL with vs without the observation *
10 + 1 (the size of labels on the first plot). $vtlPerFormant$vtl
gives the VTL as it would be estimated if only the first nFormants
were used.
Reby, D., McComb, K., Cargnelutti, B., Darwin, C., Fitch, W. T., & Clutton-Brock, T. (2005). Red deer stags use formants as assessment cues during intrasexual agonistic interactions. Proceedings of the Royal Society B: Biological Sciences, 272(1566), 941-947.
Pisanski, K., Fraccaro, P. J., Tigue, C. C., O'Connor, J. J., Röder, S., Andrews, P. W., ... & Feinberg, D. R. (2014). Vocal indicators of body size in men and women: a meta-analysis. Animal Behaviour, 95, 89-99.
Anikin, A., Barreda, S. & Reby, D. (2024) A practical guide to calculating vocal tract length and scale-invariant formant patterns. Behavior Research Methods 56, 5588–5604.
estimateVTL(NA) estimateVTL(500) estimateVTL(c(600, 1850, 2800, 3600, 5000), plot = TRUE) estimateVTL(c(600, 1850, 2800, 3600, 5000), plot = TRUE, output = 'detailed') estimateVTL(c(1200, 2000, 2800, 3800, 5400, 6400), tube = 'open-open', interceptZero = FALSE, plot = TRUE) estimateVTL(c(1200, 2000, 2800, 3800, 5400, 6400), tube = 'open-open', interceptZero = TRUE, plot = TRUE) # Multiple measurements are OK estimateVTL( formants = list(f1 = c(540, 600, 550), f2 = 1650, f3 = c(2400, 2550)), plot = TRUE, output = 'detailed') # NB: this is better than averaging formant values. Cf.: estimateVTL( formants = list(f1 = mean(c(540, 600, 550)), f2 = 1650, f3 = mean(c(2400, 2550))), plot = TRUE) # Missing values are OK estimateVTL(c(600, 1850, 3100, NA, 5000), plot = TRUE) estimateVTL(list(f1 = 500, f2 = c(1650, NA, 1400), f3 = 2700), plot = TRUE) # Note that VTL estimates based on the commonly reported 'meanDispersion' # depend only on the first and last formants estimateVTL(c(500, 1400, 2800, 4100), method = 'meanDispersion') estimateVTL(c(500, 1100, 2300, 4100), method = 'meanDispersion') # identical # ...but this is not the case for 'meanFormant' and 'regression' methods estimateVTL(c(500, 1400, 2800, 4100), method = 'meanFormant') estimateVTL(c(500, 1100, 2300, 4100), method = 'meanFormant') # much longer ## Not run: # Compare the results produced by the three methods nIter = 1000 out = data.frame(meanFormant = rep(NA, nIter), meanDispersion = NA, regression = NA) for (i in 1:nIter) { # generate a random formant configuration f = runif(1, 300, 900) + (1:6) * rnorm(6, 1000, 200) out$meanFormant[i] = estimateVTL(f, method = 'meanFormant') out$meanDispersion[i] = estimateVTL(f, method = 'meanDispersion') out$regression[i] = estimateVTL(f, method = 'regression') } pairs(out) cor(out) # 'meanDispersion' is pretty different, while 'meanFormant' and 'regression' # give broadly comparable results ## End(Not run)estimateVTL(NA) estimateVTL(500) estimateVTL(c(600, 1850, 2800, 3600, 5000), plot = TRUE) estimateVTL(c(600, 1850, 2800, 3600, 5000), plot = TRUE, output = 'detailed') estimateVTL(c(1200, 2000, 2800, 3800, 5400, 6400), tube = 'open-open', interceptZero = FALSE, plot = TRUE) estimateVTL(c(1200, 2000, 2800, 3800, 5400, 6400), tube = 'open-open', interceptZero = TRUE, plot = TRUE) # Multiple measurements are OK estimateVTL( formants = list(f1 = c(540, 600, 550), f2 = 1650, f3 = c(2400, 2550)), plot = TRUE, output = 'detailed') # NB: this is better than averaging formant values. Cf.: estimateVTL( formants = list(f1 = mean(c(540, 600, 550)), f2 = 1650, f3 = mean(c(2400, 2550))), plot = TRUE) # Missing values are OK estimateVTL(c(600, 1850, 3100, NA, 5000), plot = TRUE) estimateVTL(list(f1 = 500, f2 = c(1650, NA, 1400), f3 = 2700), plot = TRUE) # Note that VTL estimates based on the commonly reported 'meanDispersion' # depend only on the first and last formants estimateVTL(c(500, 1400, 2800, 4100), method = 'meanDispersion') estimateVTL(c(500, 1100, 2300, 4100), method = 'meanDispersion') # identical # ...but this is not the case for 'meanFormant' and 'regression' methods estimateVTL(c(500, 1400, 2800, 4100), method = 'meanFormant') estimateVTL(c(500, 1100, 2300, 4100), method = 'meanFormant') # much longer ## Not run: # Compare the results produced by the three methods nIter = 1000 out = data.frame(meanFormant = rep(NA, nIter), meanDispersion = NA, regression = NA) for (i in 1:nIter) { # generate a random formant configuration f = runif(1, 300, 900) + (1:6) * rnorm(6, 1000, 200) out$meanFormant[i] = estimateVTL(f, method = 'meanFormant') out$meanDispersion[i] = estimateVTL(f, method = 'meanDispersion') out$regression[i] = estimateVTL(f, method = 'regression') } pairs(out) cor(out) # 'meanDispersion' is pretty different, while 'meanFormant' and 'regression' # give broadly comparable results ## End(Not run)
Applies fade-in and/or fade-out of variable length, shape, and steepness. The resulting effect softens the attack and release of a waveform.
fade( x, fadeIn = 50, fadeOut = 50, fadeIn_points = NULL, fadeOut_points = NULL, samplingRate = NULL, scale = NULL, shape = c("lin", "exp", "log", "cos", "logistic", "gaussian")[1], steepness = 1, reportEvery = NULL, cores = 1, saveAudio = NULL, plot = FALSE, savePlots = NULL, width = 900, height = 500, units = "px", res = NA, ... )fade( x, fadeIn = 50, fadeOut = 50, fadeIn_points = NULL, fadeOut_points = NULL, samplingRate = NULL, scale = NULL, shape = c("lin", "exp", "log", "cos", "logistic", "gaussian")[1], steepness = 1, reportEvery = NULL, cores = 1, saveAudio = NULL, plot = FALSE, savePlots = NULL, width = 900, height = 500, units = "px", res = NA, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
fadeIn, fadeOut
|
length of segments for fading in and out, ms (0 = no fade) |
fadeIn_points, fadeOut_points
|
length of segments for fading in and out,
points (if specified, override |
samplingRate |
sampling rate of |
scale |
maximum possible amplitude of input used for normalization of
input vector (only needed if |
shape |
controls the type of fade function: 'lin' = linear, 'exp' = exponential, 'log' = logarithmic, 'cos' = cosine, 'logistic' = logistic S-curve |
steepness |
scaling factor regulating the steepness of fading curves (except for shapes 'lin' and 'cos'): 0 = linear, >1 = steeper than default |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
saveAudio |
full path to the folder in which to save audio files (one per detected syllable) |
plot |
if TRUE, produces an oscillogram of the waveform after fading |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
width, height, units, res
|
graphical parameters for saving plots passed to
|
... |
other graphical parameters |
Returns a numeric vector of the same length as input
#' # Fading a real sound: say we want fast attack and slow release s = soundgen(attack = 0, windowLength = 10, sylLen = 500, addSilence = 0) # playme(s) s1 = fade(s, fadeIn = 40, fadeOut = 350, samplingRate = 16000, shape = 'cos', plot = TRUE) # playme(s1) # Illustration of fade shapes x = runif(5000, min = -1, max = 1) # make sure to zero-center input!!! # plot(x, type = 'l') y = fade(x, fadeIn_points = 1000, fadeOut_points = 0, plot = TRUE) y = fade(x, fadeIn_points = 1000, fadeOut_points = 1500, shape = 'exp', steepness = 1, plot = TRUE) y = fade(x, fadeIn_points = 1500, fadeOut_points = 500, shape = 'log', steepness = 1, plot = TRUE) y = fade(x, fadeIn_points = 1500, fadeOut_points = 500, shape = 'log', steepness = 3, plot = TRUE) y = fade(x, fadeIn_points = 1500, fadeOut_points = 1500, shape = 'cos', plot = TRUE) y = fade(x, fadeIn_points = 1500, fadeOut_points = 1500, shape = 'logistic', steepness = 1, plot = TRUE) y = fade(x, fadeIn_points = 1500, fadeOut_points = 1500, shape = 'logistic', steepness = 3, plot = TRUE) y = fade(x, fadeIn_points = 1500, fadeOut_points = 1500, shape = 'gaussian', steepness = 1.5, plot = TRUE) ## Not run: fade('~/Downloads/temp', fadeIn = 500, fadeOut = 500, savePlots = '') ## End(Not run)#' # Fading a real sound: say we want fast attack and slow release s = soundgen(attack = 0, windowLength = 10, sylLen = 500, addSilence = 0) # playme(s) s1 = fade(s, fadeIn = 40, fadeOut = 350, samplingRate = 16000, shape = 'cos', plot = TRUE) # playme(s1) # Illustration of fade shapes x = runif(5000, min = -1, max = 1) # make sure to zero-center input!!! # plot(x, type = 'l') y = fade(x, fadeIn_points = 1000, fadeOut_points = 0, plot = TRUE) y = fade(x, fadeIn_points = 1000, fadeOut_points = 1500, shape = 'exp', steepness = 1, plot = TRUE) y = fade(x, fadeIn_points = 1500, fadeOut_points = 500, shape = 'log', steepness = 1, plot = TRUE) y = fade(x, fadeIn_points = 1500, fadeOut_points = 500, shape = 'log', steepness = 3, plot = TRUE) y = fade(x, fadeIn_points = 1500, fadeOut_points = 1500, shape = 'cos', plot = TRUE) y = fade(x, fadeIn_points = 1500, fadeOut_points = 1500, shape = 'logistic', steepness = 1, plot = TRUE) y = fade(x, fadeIn_points = 1500, fadeOut_points = 1500, shape = 'logistic', steepness = 3, plot = TRUE) y = fade(x, fadeIn_points = 1500, fadeOut_points = 1500, shape = 'gaussian', steepness = 1.5, plot = TRUE) ## Not run: fade('~/Downloads/temp', fadeIn = 500, fadeOut = 500, savePlots = '') ## End(Not run)
While the same sounds can be created with soundgen(), this facetious function
produces the same effect more efficiently and with very few control
parameters. With default settings, execution time is ~ 10 ms per second of
audio sampled at 16000 Hz. Principle: creates separate glottal cycles with
harmonics, but no formants. See soundgen for more details.
fart( glottis = c(50, 200), pitch = 65, temperature = 0.25, sylLen = 600, rolloff = -10, samplingRate = 16000, play = FALSE, plot = FALSE )fart( glottis = c(50, 200), pitch = 65, temperature = 0.25, sylLen = 600, rolloff = -10, samplingRate = 16000, play = FALSE, plot = FALSE )
glottis |
anchors for specifying the proportion of a glottal cycle with closed glottis, % (0 = no modification, 100 = closed phase as long as open phase); numeric vector or dataframe specifying time and value (anchor format) |
pitch |
a numeric vector of f0 values in Hz or a dataframe specifying the time (ms or 0 to 1) and value (Hz) of each anchor, hereafter "anchor format". These anchors are used to create a smooth contour of fundamental frequency f0 (pitch) within one syllable |
temperature |
hyperparameter for regulating the amount of stochasticity in sound generation |
sylLen |
syllable length, ms (not vectorized) |
rolloff |
rolloff of harmonics in source spectrum, dB/octave (not vectorized) |
samplingRate |
sampling frequency, Hz |
play |
if TRUE, plays the synthesized sound using the default player on
your system. If character, passed to |
plot |
if TRUE, plots the waveform |
Returns a normalized waveform.
f = fart() # playme(f) ## Not run: while (TRUE) { fart(sylLen = 300, temperature = .5, play = TRUE) Sys.sleep(rexp(1, rate = 1)) } ## End(Not run)f = fart() # playme(f) ## Not run: while (TRUE) { fart(sylLen = 300, temperature = .5, play = TRUE) Sys.sleep(rexp(1, rate = 1)) } ## End(Not run)
Filters a modulation spectrum by removing a certain range of amplitude
modulation (AM) and frequency modulation (FM) frequencies. Conditions can be
specified either separately for AM and FM with amCond = ..., fmCond =
..., implying an OR combination of conditions, or jointly on AM and FM with
jointCond. jointCond is more general, but using
amCond/fmCond is ~100 times faster.
filterMS( ms, amCond = NULL, fmCond = NULL, jointCond = NULL, action = c("remove", "preserve")[1], plot = TRUE )filterMS( ms, amCond = NULL, fmCond = NULL, jointCond = NULL, action = c("remove", "preserve")[1], plot = TRUE )
ms |
a modulation spectrum as returned by
|
amCond, fmCond
|
character strings with valid conditions on amplitude and frequency modulation (see examples) |
jointCond |
character string with a valid joint condition amplitude and frequency modulation |
action |
should the defined AM-FM region be removed ('remove') or preserved, while everything else is removed ('preserve')? |
plot |
if TRUE, plots the filtered modulation spectrum |
Returns the filtered modulation spectrum - a matrix of the original dimensions, real or complex.
ms = modulationSpectrum(soundgen(), samplingRate = 16000, returnComplex = TRUE)$complex # Remove all AM over 25 Hz ms_filt = filterMS(ms, amCond = 'abs(am) > 25') # amCond and fmCond are OR-conditions filterMS(ms, amCond = 'abs(am) > 15', fmCond = 'abs(fm) > 5', action = 'remove') filterMS(ms, amCond = 'abs(am) > 15', fmCond = 'abs(fm) > 5', action = 'preserve') filterMS(ms, amCond = 'abs(am) > 10 & abs(am) < 25', action = 'remove') # jointCond is an AND-condition filterMS(ms, jointCond = 'am * fm < 5', action = 'remove') filterMS(ms, jointCond = 'am^2 + (fm*3)^2 < 200', action = 'preserve') # So: filterMS(ms, jointCond = 'abs(am) > 5 | abs(fm) < 5') # slow but general # ...is the same as: filterMS(ms, amCond = 'abs(am) > 5', fmCond = 'abs(fm) < 5') # fastms = modulationSpectrum(soundgen(), samplingRate = 16000, returnComplex = TRUE)$complex # Remove all AM over 25 Hz ms_filt = filterMS(ms, amCond = 'abs(am) > 25') # amCond and fmCond are OR-conditions filterMS(ms, amCond = 'abs(am) > 15', fmCond = 'abs(fm) > 5', action = 'remove') filterMS(ms, amCond = 'abs(am) > 15', fmCond = 'abs(fm) > 5', action = 'preserve') filterMS(ms, amCond = 'abs(am) > 10 & abs(am) < 25', action = 'remove') # jointCond is an AND-condition filterMS(ms, jointCond = 'am * fm < 5', action = 'remove') filterMS(ms, jointCond = 'am^2 + (fm*3)^2 < 200', action = 'preserve') # So: filterMS(ms, jointCond = 'abs(am) > 5 | abs(fm) < 5') # slow but general # ...is the same as: filterMS(ms, amCond = 'abs(am) > 5', fmCond = 'abs(fm) < 5') # fast
Manipulates the modulation spectrum (MS) of a sound so as to remove certain
frequencies of amplitude modulation (AM) and frequency modulation (FM).
Algorithm: produces a modulation spectrum with
modulationSpectrum, modifies it with filterMS,
converts the modified MS to a spectrogram with msToSpec, and
finally inverts the spectrogram with invertSpectrogram, thus
producing a sound with (approximately) the desired characteristics of the MS.
Note that the last step of inverting the spectrogram introduces some noise,
so the resulting MS is not precisely the same as the intermediate filtered
version. In practice this means that some residual energy will still be
present in the filtered-out frequency range (see examples).
filterSoundByMS( x, samplingRate = NULL, from = NULL, to = NULL, logSpec = FALSE, windowLength = 25, step = NULL, overlap = 80, wn = "hamming", zp = 0, amCond = NULL, fmCond = NULL, jointCond = NULL, action = c("remove", "preserve")[1], initialPhase = c("zero", "random", "spsi")[3], nIter = 50, reportEvery = NULL, cores = 1, play = FALSE, saveAudio = NULL, plot = TRUE, savePlots = NULL, width = 900, height = 500, units = "px", res = NA )filterSoundByMS( x, samplingRate = NULL, from = NULL, to = NULL, logSpec = FALSE, windowLength = 25, step = NULL, overlap = 80, wn = "hamming", zp = 0, amCond = NULL, fmCond = NULL, jointCond = NULL, action = c("remove", "preserve")[1], initialPhase = c("zero", "random", "spsi")[3], nIter = 50, reportEvery = NULL, cores = 1, play = FALSE, saveAudio = NULL, plot = TRUE, savePlots = NULL, width = 900, height = 500, units = "px", res = NA )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
from, to
|
if NULL (default), analyzes the whole sound, otherwise from...to (s) |
logSpec |
if TRUE, the spectrogram is log-transformed prior to taking 2D FFT |
windowLength, step, wn, zp
|
parameters for extracting a spectrogram if
|
overlap |
overlap between successive FFT frames, % |
amCond, fmCond
|
character strings with valid conditions on amplitude and frequency modulation (see examples) |
jointCond |
character string with a valid joint condition amplitude and frequency modulation |
action |
should the defined AM-FM region be removed ('remove') or preserved, while everything else is removed ('preserve')? |
initialPhase |
initial phase estimate: "zero" = set all phases to zero; "random" = Gaussian noise; "spsi" (default) = single-pass spectrogram inversion (Beauregard et al., 2015) |
nIter |
the number of iterations of the GL algorithm (Griffin & Lim, 1984), 0 = don't run |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
play |
if TRUE, plays back the reconstructed audio |
saveAudio |
full (!) path to folder for saving the processed audio; NULL = don't save, ” = same as input folder (NB: overwrites the originals!) |
plot |
if TRUE, produces a triple plot: original MS, filtered MS, and the MS of the output sound |
savePlots |
if a valid path is specified, a plot is saved in this folder (defaults to NA) |
width, height, units, res
|
parameters passed to
|
Returns the filtered audio as a numeric vector normalized to
[-1, 1] with the same sampling rate as input.
# Create a sound to be filtered s = soundgen(pitch = rnorm(n = 20, mean = 200, sd = 25), amFreq = 25, amDep = 50, samplingRate = 16000, addSilence = 50, plot = TRUE, osc = TRUE) # playme(s, 16000) # Filter s_filt = filterSoundByMS(s, samplingRate = 16000, amCond = 'abs(am) > 15', fmCond = 'abs(fm) > 5', nIter = 10, # increase nIter for best results! action = 'remove', plot = TRUE) # playme(s_filt, samplingRate = 16000) ## Not run: # Process all files in a folder, save filtered audio and plots s_filt = filterSoundByMS('~/Downloads/temp2', saveAudio = '~/Downloads/temp2/ms', savePlots = '', amCond = 'abs(am) > 15', fmCond = 'abs(fm) > 5', action = 'remove', nIter = 10) # Download an example - a bit of speech (sampled at 16000 Hz) download.file('http://cogsci.se/soundgen/audio/speechEx.wav', destfile = '~/Downloads/speechEx.wav') # modify as needed target = '~/Downloads/speechEx.wav' samplingRate = tuneR::readWave(target)@samp.rate playme(target) spectrogram(target, osc = TRUE) # Remove AM above 3 Hz from a bit of speech (remove most temporal details) s_filt1 = filterSoundByMS(target, amCond = 'abs(am) > 3', action = 'remove', nIter = 15) playme(s_filt1, samplingRate) spectrogram(s_filt1, samplingRate = samplingRate, osc = TRUE) # Intelligigble when AM in 5-25 Hz is preserved: s_filt2 = filterSoundByMS(target, amCond = 'abs(am) > 5 & abs(am) < 25', action = 'preserve', nIter = 15) playme(s_filt2, samplingRate) spectrogram(s_filt2, samplingRate = samplingRate, osc = TRUE) # Remove slow AM/FM (prosody) to achieve a "robotic" voice s_filt3 = filterSoundByMS(target, jointCond = 'am^2 + (fm*3)^2 < 300', nIter = 15) playme(s_filt3, samplingRate) spectrogram(s_filt3, samplingRate = samplingRate, osc = TRUE) ## An alternative manual workflow w/o calling filterSoundByMS() # This way you can modify the MS directly and more flexibly # than with the filterMS() function called by filterSoundByMS() # (optional) Check that the target spectrogram can be successfully inverted spec = spectrogram(s, 16000, windowLength = 50, step = NULL, overlap = 80, wn = 'hanning', osc = TRUE, padWithSilence = FALSE) s_rev = invertSpectrogram(spec, samplingRate = 16000, windowLength = 50, overlap = 80, wn = 'hamming', play = FALSE) # playme(s_rev, 16000) # should be close to the original spectrogram(s_rev, 16000, osc = TRUE) # Get modulation spectrum starting from the sound... ms = modulationSpectrum(s, samplingRate = 16000, windowLength = 25, overlap = 80, wn = 'hanning', amRes = NULL, maxDur = Inf, logSpec = FALSE, power = NA, returnComplex = TRUE, plot = FALSE)$complex # ... or starting from the spectrogram: # ms = specToMS(spec) plotMS(abs(ms)) # this is the original MS # Filter as needed - for ex., remove AM > 10 Hz and FM > 3 cycles/kHz # (removes f0, preserves formants) am = as.numeric(colnames(ms)) fm = as.numeric(rownames(ms)) idx_row = which(abs(fm) > 3) idx_col = which(abs(am) > 10) ms_filt = ms ms_filt[idx_row, ] = 0 ms_filt[, idx_col] = 0 plotMS(abs(ms_filt)) # this is the filtered MS # Convert back to a spectrogram spec_filt = msToSpec(ms_filt) image(t(log(abs(spec_filt)))) # Invert the spectrogram s_filt = invertSpectrogram(abs(spec_filt), samplingRate = 16000, windowLength = 25, overlap = 80, wn = 'hanning') # NB: use the same settings as in "spec = spectrogram(s, ...)" above # Compare with the original playme(s, 16000) spectrogram(s, 16000, osc = TRUE) playme(s_filt, 16000) spectrogram(s_filt, 16000, osc = TRUE) ms_new = modulationSpectrum(s_filt, samplingRate = 16000, windowLength = 25, overlap = 80, wn = 'hanning', maxDur = Inf, plot = TRUE, returnComplex = TRUE)$complex image(x = as.numeric(colnames(ms_new)), y = as.numeric(rownames(ms_new)), z = t(log(abs(ms_new)))) plot(as.numeric(colnames(ms)), log(abs(ms[nrow(ms) / 2, ])), type = 'l') points(as.numeric(colnames(ms_new)), log(ms_new[nrow(ms_new) / 2, ]), type = 'l', col = 'red', lty = 3) # AM peaks at 25 Hz are removed, but inverting the spectrogram adds a lot of noise ## End(Not run)# Create a sound to be filtered s = soundgen(pitch = rnorm(n = 20, mean = 200, sd = 25), amFreq = 25, amDep = 50, samplingRate = 16000, addSilence = 50, plot = TRUE, osc = TRUE) # playme(s, 16000) # Filter s_filt = filterSoundByMS(s, samplingRate = 16000, amCond = 'abs(am) > 15', fmCond = 'abs(fm) > 5', nIter = 10, # increase nIter for best results! action = 'remove', plot = TRUE) # playme(s_filt, samplingRate = 16000) ## Not run: # Process all files in a folder, save filtered audio and plots s_filt = filterSoundByMS('~/Downloads/temp2', saveAudio = '~/Downloads/temp2/ms', savePlots = '', amCond = 'abs(am) > 15', fmCond = 'abs(fm) > 5', action = 'remove', nIter = 10) # Download an example - a bit of speech (sampled at 16000 Hz) download.file('http://cogsci.se/soundgen/audio/speechEx.wav', destfile = '~/Downloads/speechEx.wav') # modify as needed target = '~/Downloads/speechEx.wav' samplingRate = tuneR::readWave(target)@samp.rate playme(target) spectrogram(target, osc = TRUE) # Remove AM above 3 Hz from a bit of speech (remove most temporal details) s_filt1 = filterSoundByMS(target, amCond = 'abs(am) > 3', action = 'remove', nIter = 15) playme(s_filt1, samplingRate) spectrogram(s_filt1, samplingRate = samplingRate, osc = TRUE) # Intelligigble when AM in 5-25 Hz is preserved: s_filt2 = filterSoundByMS(target, amCond = 'abs(am) > 5 & abs(am) < 25', action = 'preserve', nIter = 15) playme(s_filt2, samplingRate) spectrogram(s_filt2, samplingRate = samplingRate, osc = TRUE) # Remove slow AM/FM (prosody) to achieve a "robotic" voice s_filt3 = filterSoundByMS(target, jointCond = 'am^2 + (fm*3)^2 < 300', nIter = 15) playme(s_filt3, samplingRate) spectrogram(s_filt3, samplingRate = samplingRate, osc = TRUE) ## An alternative manual workflow w/o calling filterSoundByMS() # This way you can modify the MS directly and more flexibly # than with the filterMS() function called by filterSoundByMS() # (optional) Check that the target spectrogram can be successfully inverted spec = spectrogram(s, 16000, windowLength = 50, step = NULL, overlap = 80, wn = 'hanning', osc = TRUE, padWithSilence = FALSE) s_rev = invertSpectrogram(spec, samplingRate = 16000, windowLength = 50, overlap = 80, wn = 'hamming', play = FALSE) # playme(s_rev, 16000) # should be close to the original spectrogram(s_rev, 16000, osc = TRUE) # Get modulation spectrum starting from the sound... ms = modulationSpectrum(s, samplingRate = 16000, windowLength = 25, overlap = 80, wn = 'hanning', amRes = NULL, maxDur = Inf, logSpec = FALSE, power = NA, returnComplex = TRUE, plot = FALSE)$complex # ... or starting from the spectrogram: # ms = specToMS(spec) plotMS(abs(ms)) # this is the original MS # Filter as needed - for ex., remove AM > 10 Hz and FM > 3 cycles/kHz # (removes f0, preserves formants) am = as.numeric(colnames(ms)) fm = as.numeric(rownames(ms)) idx_row = which(abs(fm) > 3) idx_col = which(abs(am) > 10) ms_filt = ms ms_filt[idx_row, ] = 0 ms_filt[, idx_col] = 0 plotMS(abs(ms_filt)) # this is the filtered MS # Convert back to a spectrogram spec_filt = msToSpec(ms_filt) image(t(log(abs(spec_filt)))) # Invert the spectrogram s_filt = invertSpectrogram(abs(spec_filt), samplingRate = 16000, windowLength = 25, overlap = 80, wn = 'hanning') # NB: use the same settings as in "spec = spectrogram(s, ...)" above # Compare with the original playme(s, 16000) spectrogram(s, 16000, osc = TRUE) playme(s_filt, 16000) spectrogram(s_filt, 16000, osc = TRUE) ms_new = modulationSpectrum(s_filt, samplingRate = 16000, windowLength = 25, overlap = 80, wn = 'hanning', maxDur = Inf, plot = TRUE, returnComplex = TRUE)$complex image(x = as.numeric(colnames(ms_new)), y = as.numeric(rownames(ms_new)), z = t(log(abs(ms_new)))) plot(as.numeric(colnames(ms)), log(abs(ms[nrow(ms) / 2, ])), type = 'l') points(as.numeric(colnames(ms_new)), log(ms_new[nrow(ms_new) / 2, ]), type = 'l', col = 'red', lty = 3) # AM peaks at 25 Hz are removed, but inverting the spectrogram adds a lot of noise ## End(Not run)
Finds inflections in discrete time series such as pitch contours. When there
are no missing values and no thresholds, this can be accomplished with a fast
one-liner like which(diff(diff(x) > 0) != 0) + 1. Missing values are
interpolated by repeating the first and last non-missing values at the head
and tail, respectively, and by linear interpolation in the middle. Setting a
threshold means that small "wiggling" no longer counts. To use an analogy
with ocean waves, smoothing (low-pass filtering) removes the ripples and only
leaves the slow roll, while thresholding preserves only waves that are
sufficiently high, whatever their period.
findInflections(x, thres = NULL, step = NULL, plot = FALSE, main = "")findInflections(x, thres = NULL, step = NULL, plot = FALSE, main = "")
x |
numeric vector with or without NAs |
thres |
minimum vertical distance between two extrema for them to count as two independent inflections |
step |
distance between values in s (only needed for plotting) |
plot |
if TRUE, produces a simple plot |
main |
plot title |
Returns a vector of indices giving the location of inflections.
x = sin(2 * pi * (1:100) / 15) * seq(1, 5, length.out = 100) idx_na = c(1:4, 6, 7, 14, 25, 30:36, 39, 40, 42, 45:50, 57, 59, 62, 66, 71:79, 98) x[idx_na] = NA soundgen:::findInflections(x, plot = TRUE) soundgen:::findInflections(x, thres = 5, plot = TRUE) for (i in 1:10) { temp = soundgen:::getRandomWalk(len = runif(1, 10, 100), rw_range = 10, rw_smoothing = runif(1, 0, 1)) soundgen:::findInflections(temp, thres = 1, plot = TRUE) invisible(readline(prompt="Press [enter] to continue")) }x = sin(2 * pi * (1:100) / 15) * seq(1, 5, length.out = 100) idx_na = c(1:4, 6, 7, 14, 25, 30:36, 39, 40, 42, 45:50, 57, 59, 62, 66, 71:79, 98) x[idx_na] = NA soundgen:::findInflections(x, plot = TRUE) soundgen:::findInflections(x, thres = 5, plot = TRUE) for (i in 1:10) { temp = soundgen:::getRandomWalk(len = runif(1, 10, 100), rw_range = 10, rw_smoothing = runif(1, 0, 1)) soundgen:::findInflections(temp, thres = 1, plot = TRUE) invisible(readline(prompt="Press [enter] to continue")) }
This function flags frames with apparent pith jumps (frequency jumps, voice
breaks), defined as relatively large and sudden changes in voice pitch or
some other frequency measure (peak frequency, a formant frequency, etc). It
is called by detectNLP. Algorithm: a frame is considered to
contain a frequency jump if the absolute slope at this frame exceeds the
average slope over ±jumpWindow around it by more than
jumpThres. Note that the slope is considered per second rather than
per time step - that is, taking into account the sampling rate of the
frequency track. Thus, it's not just the change from frame to frame that
defines what is considered a jump, but a change that differs from the trend
in the surrounding frames (see examples). If several consecutive frames
contain apparent jumps, only the greatest of them is preserved.
findJumps( pitch, step, jumpThres = 8, jumpWindow = 80, plot = FALSE, xlab = "Time, ms", ylab = "f0, Hz", ... )findJumps( pitch, step, jumpThres = 8, jumpWindow = 80, plot = FALSE, xlab = "Time, ms", ylab = "f0, Hz", ... )
pitch |
vector of frequencies per frame, Hz |
step |
time step between frames, ms |
jumpThres |
frames in which pitch changes by |
jumpWindow |
the window for calculating the median pitch slope around the analyzed frame, ms |
plot |
if TRUE, plots the pitch contour with putative frequency jumps marked by arrows |
xlab, ylab, ...
|
graphical parameters passed to |
Returns a boolean vector of the same length as pitch, where
TRUE values correspond to frames with detected pitch jumps.
pitch = getSmoothContour(anchors = list( time = c(0, 350, 351, 890, 891, 1200), value = c(140, 230, 460, 330, 220, 200)), len = 40) step = 25 pj = findJumps(pitch, step, plot = TRUE) # convert frame indices to time in ms step = 25 which(pj) * step # or consider pj's to occur midway between the two frames which(pj) * step - step / 2 # even very rapid changes are not considered jumps if they match # the surrounding trend pitch = getSmoothContour(anchors = list( time = c(0, 350, 351, 700), value = c(340, 710, 850, 1200)), len = 20) findJumps(pitch, step, plot = TRUE) diff(HzToSemitones(pitch)) * (1000 / step) / 12 # the slope at frame 10 (10.4 oct/s) exceeds the jumpThres (8 oct/s), but not # 10.4 minus the average slope around frame 10 (~3 oct/s, so 10 - 3 < 8)pitch = getSmoothContour(anchors = list( time = c(0, 350, 351, 890, 891, 1200), value = c(140, 230, 460, 330, 220, 200)), len = 40) step = 25 pj = findJumps(pitch, step, plot = TRUE) # convert frame indices to time in ms step = 25 which(pj) * step # or consider pj's to occur midway between the two frames which(pj) * step - step / 2 # even very rapid changes are not considered jumps if they match # the surrounding trend pitch = getSmoothContour(anchors = list( time = c(0, 350, 351, 700), value = c(340, 710, 850, 1200)), len = 20) findJumps(pitch, step, plot = TRUE) diff(HzToSemitones(pitch)) * (1000 / step) / 12 # the slope at frame 10 (10.4 oct/s) exceeds the jumpThres (8 oct/s), but not # 10.4 minus the average slope around frame 10 (~3 oct/s, so 10 - 3 < 8)
A bare-bones, very fast function to find local maxima (peaks) in a numeric vector.
findPeaks(x, wl = 3, thres = NULL)findPeaks(x, wl = 3, thres = NULL)
x |
numeric vector |
wl |
rolling window over which we look for maxima: central value ± floor(wl/2), eg ±1 if wl=3 |
thres |
required absolute value of each peak |
Returns a vector with indices of local maxima
x = rnorm(100) findPeaks(x, wl = 3) findPeaks(x, wl = 3, thres = 1) findPeaks(x, wl = 5) idx = findPeaks(x, wl = 5, thres = 1) plot(x, type = 'b'); abline(h = 1, lty = 3) points(idx, x[idx], col = 'blue', pch = 8)x = rnorm(100) findPeaks(x, wl = 3) findPeaks(x, wl = 3, thres = 1) findPeaks(x, wl = 5) idx = findPeaks(x, wl = 5, thres = 1) plot(x, type = 'b'); abline(h = 1, lty = 3) points(idx, x[idx], col = 'blue', pch = 8)
Applies a compressor - that is, flattens the amplitude envelope of a waveform, reducing the difference in amplitude between loud and quiet sections. This is achieved by dividing the waveform by some function of its smoothed amplitude envelope (Hilbert, peak or root mean square).
flatEnv( x, samplingRate = NULL, scale = NULL, compression = 1, method = c("hil", "rms", "peak")[1], windowLength = 50, windowLength_points = NULL, killDC = FALSE, dynamicRange = 40, reportEvery = NULL, cores = 1, saveAudio = NULL, plot = FALSE, savePlots = NULL, col = "blue", width = 900, height = 500, units = "px", res = NA, ... ) compressor( x, samplingRate = NULL, scale = NULL, compression = 1, method = c("hil", "rms", "peak")[1], windowLength = 50, windowLength_points = NULL, killDC = FALSE, dynamicRange = 40, reportEvery = NULL, cores = 1, saveAudio = NULL, plot = FALSE, savePlots = NULL, col = "blue", width = 900, height = 500, units = "px", res = NA, ... )flatEnv( x, samplingRate = NULL, scale = NULL, compression = 1, method = c("hil", "rms", "peak")[1], windowLength = 50, windowLength_points = NULL, killDC = FALSE, dynamicRange = 40, reportEvery = NULL, cores = 1, saveAudio = NULL, plot = FALSE, savePlots = NULL, col = "blue", width = 900, height = 500, units = "px", res = NA, ... ) compressor( x, samplingRate = NULL, scale = NULL, compression = 1, method = c("hil", "rms", "peak")[1], windowLength = 50, windowLength_points = NULL, killDC = FALSE, dynamicRange = 40, reportEvery = NULL, cores = 1, saveAudio = NULL, plot = FALSE, savePlots = NULL, col = "blue", width = 900, height = 500, units = "px", res = NA, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
scale |
maximum possible amplitude of input used for normalization of
input vector (only needed if |
compression |
the amount of compression to apply: 0 = none, 1 = maximum |
method |
hil = Hilbert envelope, rms = root mean square amplitude, peak = peak amplitude per window |
windowLength |
the length of smoothing window, ms |
windowLength_points |
the length of smoothing window, points. If
specified, overrides |
killDC |
if TRUE, dynamically removes DC offset or similar deviations of average waveform from zero (see examples) |
dynamicRange |
parts of sound quieter than |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
saveAudio |
full path to the folder in which to save the compressed sound(s) |
plot |
if TRUE, plots the original sound, the smoothed envelope, and the compressed sound |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
col |
the color of amplitude contours |
width, height, units, res
|
graphical parameters for saving plots passed to
|
... |
other graphical parameters passed to |
If the input is a single audio (file, Wave, or numeric vector), returns the compressed waveform as a numeric vector with the original sampling rate and scale. If the input is a folder with several audio files, returns a list of compressed waveforms, one for each file.
a = rnorm(500) * seq(1, 0, length.out = 500) b = flatEnv(a, 1000, plot = TRUE, windowLength_points = 5) # too short c = flatEnv(a, 1000, plot = TRUE, windowLength_points = 450) # too long d = flatEnv(a, 1000, plot = TRUE, windowLength_points = 100) # about right ## Not run: s = soundgen(sylLen = 1000, ampl = c(0, -40, 0), plot = TRUE) # playme(s) s_flat1 = flatEnv(s, 16000, dynamicRange = 60, plot = TRUE, windowLength = 50, method = 'hil') s_flat2 = flatEnv(s, 16000, dynamicRange = 60, plot = TRUE, windowLength = 10, method = 'rms') s_flat3 = flatEnv(s, 16000, dynamicRange = 60, plot = TRUE, windowLength = 10, method = 'peak') # playme(s_flat2) # Remove DC offset s1 = c(rep(0, 50), runif(1000, -1, 1), rep(0, 50)) + seq(.3, 1, length.out = 1100) s2 = flatEnv(s1, 16000, plot = TRUE, windowLength_points = 50, killDC = FALSE) s3 = flatEnv(s1, 16000, plot = TRUE, windowLength_points = 50, killDC = TRUE) # Compress and save all audio files in a folder s4 = flatEnv('~/Downloads/temp', method = 'peak', compression = .5, saveAudio = '~/Downloads/temp/compressed', savePlots = '~/Downloads/temp/compressed', col = 'green', lwd = 5) osc(s4[[1]]) ## End(Not run)a = rnorm(500) * seq(1, 0, length.out = 500) b = flatEnv(a, 1000, plot = TRUE, windowLength_points = 5) # too short c = flatEnv(a, 1000, plot = TRUE, windowLength_points = 450) # too long d = flatEnv(a, 1000, plot = TRUE, windowLength_points = 100) # about right ## Not run: s = soundgen(sylLen = 1000, ampl = c(0, -40, 0), plot = TRUE) # playme(s) s_flat1 = flatEnv(s, 16000, dynamicRange = 60, plot = TRUE, windowLength = 50, method = 'hil') s_flat2 = flatEnv(s, 16000, dynamicRange = 60, plot = TRUE, windowLength = 10, method = 'rms') s_flat3 = flatEnv(s, 16000, dynamicRange = 60, plot = TRUE, windowLength = 10, method = 'peak') # playme(s_flat2) # Remove DC offset s1 = c(rep(0, 50), runif(1000, -1, 1), rep(0, 50)) + seq(.3, 1, length.out = 1100) s2 = flatEnv(s1, 16000, plot = TRUE, windowLength_points = 50, killDC = FALSE) s3 = flatEnv(s1, 16000, plot = TRUE, windowLength_points = 50, killDC = TRUE) # Compress and save all audio files in a folder s4 = flatEnv('~/Downloads/temp', method = 'peak', compression = .5, saveAudio = '~/Downloads/temp/compressed', savePlots = '~/Downloads/temp/compressed', col = 'green', lwd = 5) osc(s4[[1]]) ## End(Not run)
Flattens the spectrum of a sound by smoothing in the frequency domain. Can be
used for removing formants without modifying pitch contour or voice quality
(the balance of harmonic and noise components), followed by the addition of a
new spectral envelope (cf. transplantFormants). Algorithm:
makes a spectrogram, flattens the real part of the smoothed spectrum of each
STFT frame, and transforms back into time domain with inverse STFT (see also
addFormants).
flatSpectrum( x, samplingRate = NULL, freqWindow = NULL, dynamicRange = 80, windowLength = 50, step = NULL, overlap = 90, wn = "gaussian", zp = 0, play = FALSE, saveAudio = NULL, reportEvery = NULL, cores = 1 )flatSpectrum( x, samplingRate = NULL, freqWindow = NULL, dynamicRange = 80, windowLength = 50, step = NULL, overlap = 90, wn = "gaussian", zp = 0, play = FALSE, saveAudio = NULL, reportEvery = NULL, cores = 1 )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
freqWindow |
the width of smoothing window, Hz. Defaults to median
pitch estimated by |
dynamicRange |
dynamic range, dB. All values more than one dynamicRange under maximum are treated as zero |
windowLength |
length of FFT window, ms (multiple values in a vector produce a multi-resolution spectrogram) |
step |
you can override |
overlap |
overlap between successive FFT frames, % |
wn |
window type accepted by |
zp |
window length after zero padding, points |
play |
if TRUE, plays the processed audio |
saveAudio |
full (!) path to folder for saving the processed audio; NULL = don't save, ” = same as input folder (NB: overwrites the originals!) |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
Returns a numeric vector with the same sampling rate as the input.
addFormants transplantFormants
sound_aii = soundgen(formants = 'aii') # playme(sound_aii, 16000) seewave::meanspec(sound_aii, f = 16000, dB = 'max0') sound_flat = flatSpectrum(sound_aii, freqWindow = 150, samplingRate = 16000) # playme(sound_flat, 16000) seewave::meanspec(sound_flat, f = 16000, dB = 'max0') # harmonics are still there, but formants are gone and can be replaced ## Not run: # Now let's make a sheep say "aii" data(sheep, package = 'seewave') # import a recording from seewave playme(sheep) sheep_flat = flatSpectrum(sheep) playme(sheep_flat, [email protected]) seewave::spec(sheep_flat, f = [email protected], dB = 'max0') # So far we have a sheep bleating with a flat spectrum; # now let's add new formants sheep_aii = addFormants(sheep_flat, samplingRate = [email protected], formants = 'aii', lipRad = -3) # negative lipRad to counter unnatural flat source playme(sheep_aii, [email protected]) spectrogram(sheep_aii, [email protected]) seewave::spec(sheep_aii, f = [email protected], dB = 'max0') ## End(Not run)sound_aii = soundgen(formants = 'aii') # playme(sound_aii, 16000) seewave::meanspec(sound_aii, f = 16000, dB = 'max0') sound_flat = flatSpectrum(sound_aii, freqWindow = 150, samplingRate = 16000) # playme(sound_flat, 16000) seewave::meanspec(sound_flat, f = 16000, dB = 'max0') # harmonics are still there, but formants are gone and can be replaced ## Not run: # Now let's make a sheep say "aii" data(sheep, package = 'seewave') # import a recording from seewave playme(sheep) sheep_flat = flatSpectrum(sheep) playme(sheep_flat, sheep@samp.rate) seewave::spec(sheep_flat, f = sheep@samp.rate, dB = 'max0') # So far we have a sheep bleating with a flat spectrum; # now let's add new formants sheep_aii = addFormants(sheep_flat, samplingRate = sheep@samp.rate, formants = 'aii', lipRad = -3) # negative lipRad to counter unnatural flat source playme(sheep_aii, sheep@samp.rate) spectrogram(sheep_aii, sheep@samp.rate) seewave::spec(sheep_aii, f = sheep@samp.rate, dB = 'max0') ## End(Not run)
Starts a shiny app for manually correcting formant measurements. For more
tips, see pitch_app and http://cogsci.se/soundgen.html.
formant_app(...)formant_app(...)
... |
presets like |
Suggested workflow: load one or several audio files (wav/mp3), preferably not longer than a minute or so. Select a region of interest in the spectrogram - for example, a sustained vowel with clear and relatively steady formants. Double-click within the selection to create a new annotation (you may add a text label if needed). If you are satisfied with the automatically calculated formant frequencies, proceed to the next region of interest. If not, there are 4 ways to adjust them: (1) type in the correct number in one of the formant boxes in the top right corner; (2) click a spectrogram within selection (pick the formant number to adjust by clicking the formant boxes); (3) single-click the spectrum to use the cursor's position, or (4) double-click the spectrum to use the nearest spectral peak. When done with a file, move on to the next one in the queue. Use the orange button to download the results. To continue work, upload the output file from the previous session together with the audio files (you can rename it, but keep the .csv extension). Use hotkeys (eg spacebar to play/stop) and avoid working with very large files.
A list of the last used settings ($settings) plus a data.frame with the formant measurements. Every time a new annotation is added, the app creates a backup csv file and creates or updates a global object called "my_formants", which contains all the annotations.
## Not run: f = formant_app() # runs in default browser such as Firefox or Chrome f1 = formant_app(specType = 'reassigned', windowLength = 5, step = 1) # full list of parameters that can be passed to formant_app(): # paste0(c(names(input)[which(names(input) %in% rownames(def_form))], # 'spectrum_xlim', 'spec_ylim', 'spec_colorTheme', 'osc', 'wn', 'wn_lpc', # 'vtl_method', 'speedSound', 'coeffs', 'interceptZero', 'tube'), collapse = ', ') # run the app with previously used settings f2 = do.call(formant_app, f1$settings) # save the complete output, including the settings used saveRDS(f2, 'my_formant_analysis.rds') # To change system default browser, run something like: options('browser' = '/usr/bin/firefox') # path to the executable on Linux ## End(Not run)## Not run: f = formant_app() # runs in default browser such as Firefox or Chrome f1 = formant_app(specType = 'reassigned', windowLength = 5, step = 1) # full list of parameters that can be passed to formant_app(): # paste0(c(names(input)[which(names(input) %in% rownames(def_form))], # 'spectrum_xlim', 'spec_ylim', 'spec_colorTheme', 'osc', 'wn', 'wn_lpc', # 'vtl_method', 'speedSound', 'coeffs', 'interceptZero', 'tube'), collapse = ', ') # run the app with previously used settings f2 = do.call(formant_app, f1$settings) # save the complete output, including the settings used saveRDS(f2, 'my_formant_analysis.rds') # To change system default browser, run something like: options('browser' = '/usr/bin/firefox') # path to the executable on Linux ## End(Not run)
Takes a matrix of numeric values and smoothes it by convolution with a symmetric Gaussian window function.
gaussianSmooth2D( m, kernelSize = 5, kernelSD = 0.5, action = c("blur", "unblur")[1], plotKernel = FALSE )gaussianSmooth2D( m, kernelSize = 5, kernelSD = 0.5, action = c("blur", "unblur")[1], plotKernel = FALSE )
m |
input matrix (numeric, on any scale, doesn't have to be square) |
kernelSize |
the size of the Gaussian kernel, in points |
kernelSD |
the SD of the Gaussian kernel relative to its size (.5 = the edge is two SD's away) |
action |
'blur' = kernel-weighted average, 'unblur' = subtract kernel-weighted average |
plotKernel |
if TRUE, plots the kernel |
Returns a numeric matrix of the same dimensions as input.
s = spectrogram(soundgen(), samplingRate = 16000, windowLength = 10, output = 'original', plot = FALSE) s = log(s + .001) # image(s) s1 = gaussianSmooth2D(s, kernelSize = 5, plotKernel = TRUE) # image(s1) ## Not run: # more smoothing in time than in frequency s2 = gaussianSmooth2D(s, kernelSize = c(5, 15)) image(s2) # vice versa - more smoothing in frequency s3 = gaussianSmooth2D(s, kernelSize = c(25, 3)) image(s3) # sharpen the image by deconvolution with the kernel s4 = gaussianSmooth2D(s1, kernelSize = 5, action = 'unblur') image(s4) s5 = gaussianSmooth2D(s, kernelSize = c(15, 1), action = 'unblur') image(s5) ## End(Not run)s = spectrogram(soundgen(), samplingRate = 16000, windowLength = 10, output = 'original', plot = FALSE) s = log(s + .001) # image(s) s1 = gaussianSmooth2D(s, kernelSize = 5, plotKernel = TRUE) # image(s1) ## Not run: # more smoothing in time than in frequency s2 = gaussianSmooth2D(s, kernelSize = c(5, 15)) image(s2) # vice versa - more smoothing in frequency s3 = gaussianSmooth2D(s, kernelSize = c(25, 3)) image(s3) # sharpen the image by deconvolution with the kernel s4 = gaussianSmooth2D(s1, kernelSize = 5, action = 'unblur') image(s4) s5 = gaussianSmooth2D(s, kernelSize = c(15, 1), action = 'unblur') image(s5) ## End(Not run)
Generates noise of length len and with spectrum defined by rolloff
parameters OR by a specified filter spectralEnvelope. This function is
called internally by soundgen, but it may be more convenient to
call it directly when synthesizing non-biological noises defined by specific
spectral and amplitude envelopes rather than formants: the wind, whistles,
impact noises, etc. See fart and beat for
similarly simplified functions for tonal non-biological sounds.
generateNoise( len, rolloffNoise = 0, noiseFlatSpec = 1200, rolloffNoiseExp = 0, spectralEnvelope = NULL, noise = NULL, temperature = 0.1, attackLen = 10, windowLength_points = 1024, samplingRate = 16000, overlap = 75, dynamicRange = 80, smoothing = list(), invalidArgAction = c("adjust", "abort", "ignore")[1], play = FALSE )generateNoise( len, rolloffNoise = 0, noiseFlatSpec = 1200, rolloffNoiseExp = 0, spectralEnvelope = NULL, noise = NULL, temperature = 0.1, attackLen = 10, windowLength_points = 1024, samplingRate = 16000, overlap = 75, dynamicRange = 80, smoothing = list(), invalidArgAction = c("adjust", "abort", "ignore")[1], play = FALSE )
len |
length of output |
rolloffNoise, noiseFlatSpec
|
linear rolloff of the excitation source for
the noise component, |
rolloffNoiseExp |
exponential rolloff of the excitation source for the noise component, dB/oct (anchor format) applied above 0 Hz |
spectralEnvelope |
(optional): as an alternative to using rolloffNoise, we can provide the exact filter - a vector of non-negative numbers specifying the desired spectrum on a linear scale up to Nyquist frequency (samplingRate / 2). The length doesn't matter as it can be interpolated internally to windowLength_points/2. A matrix specifying the filter for each STFT step is also accepted. The easiest way to obtain spectralEnvelope is to call soundgen:::getSpectralEnvelope or to use the spectrum / spectrogram of a recorded sound |
noise |
loudness of turbulent noise (0 dB = as loud as the periodic (voiced) component, negative values = quieter) such as aspiration, hissing, etc (anchor format) |
temperature |
hyperparameter for regulating the amount of stochasticity in sound generation |
attackLen |
duration of fade-in / fade-out at each end of syllables and noise (ms): a vector of length 1 (symmetric) or 2 (separately for fade-in and fade-out) |
windowLength_points |
the length of fft window, points |
samplingRate |
sampling frequency, Hz |
overlap |
FFT window overlap, %. For allowed values, see
|
dynamicRange |
dynamic range, dB. Harmonics and noise more than dynamicRange under maximum amplitude are discarded to save computational resources |
smoothing |
a list of parameters passed to
|
invalidArgAction |
what to do if an argument is invalid or outside the
range in |
play |
if TRUE, plays the synthesized sound using the default player on
your system. If character, passed to |
Algorithm: paints a spectrogram with desired characteristics, sets phase to zero, and generates a time sequence via inverse FFT.
# .5 s of white noise samplingRate = 16000 noise1 = generateNoise(len = samplingRate * .5, samplingRate = samplingRate) # playme(noise1, samplingRate) # seewave::meanspec(noise1, f = samplingRate) # Percussion (run a few times to notice stochasticity due to temperature = .25) noise2 = generateNoise(len = samplingRate * .15, noise = c(0, -80), rolloffNoise = c(4, -6), attackLen = 5, temperature = .25) noise3 = generateNoise(len = samplingRate * .25, noise = c(0, -40), rolloffNoise = c(4, -20), attackLen = 5, temperature = .25) # playme(c(noise2, noise3), samplingRate) ## Not run: playback = list(TRUE, FALSE, 'aplay', 'vlc')[[1]] # 1.2 s of noise with rolloff changing from 0 to -12 dB above 2 kHz noise = generateNoise(len = samplingRate * 1.2, rolloffNoise = c(0, -12), noiseFlatSpec = 2000, samplingRate = samplingRate, play = playback) # spectrogram(noise, samplingRate, osc = TRUE) # Similar, but using the dataframe format to specify a more complicated # contour for rolloffNoise: noise = generateNoise(len = samplingRate * 1.2, rolloffNoise = data.frame(time = c(0, .3, 1), value = c(-12, 0, -12)), noiseFlatSpec = 2000, samplingRate = samplingRate, play = playback) # spectrogram(noise, samplingRate, osc = TRUE) # To create a sibilant [s], specify a single strong, broad formant at ~7 kHz: windowLength_points = 1024 spectralEnvelope = soundgen:::getSpectralEnvelope( nr = windowLength_points / 2, nc = 1, samplingRate = samplingRate, formants = list('f1' = data.frame(time = 0, freq = 7000, amp = 50, width = 2000))) noise = generateNoise(len = samplingRate, samplingRate = samplingRate, spectralEnvelope = as.numeric(spectralEnvelope), play = playback) # plot(spectralEnvelope, type = 'l') # Low-frequency, wind-like noise spectralEnvelope = soundgen:::getSpectralEnvelope( nr = windowLength_points / 2, nc = 1, lipRad = 0, samplingRate = samplingRate, formants = list('f1' = data.frame( time = 0, freq = 150, amp = 30, width = 90))) noise = generateNoise(len = samplingRate, samplingRate = samplingRate, spectralEnvelope = as.numeric(spectralEnvelope), play = playback) # Manual filter, e.g. for a kettle-like whistle (narrow-band noise) spectralEnvelope = c(rep(0, 100), 120, rep(0, 100)) # any length is fine # plot(spectralEnvelope, type = 'b') # notch filter at Nyquist / 2, here 4 kHz noise = generateNoise(len = samplingRate, spectralEnvelope = spectralEnvelope, samplingRate = samplingRate, play = playback) # Compare to a similar sound created with soundgen() # (aperiodic noise only, a single formant at 4 kHz) noise_s = soundgen(pitch = NULL, noise = data.frame(time = c(0, 1000), value = c(0, 0)), formants = list(f1 = data.frame(freq = 4000, amp = 80, width = 20)), play = playback) # Use the spectral envelope of an existing recording (bleating of a sheep) # (see also the same example with tonal source in ?addFormants) data(sheep, package = 'seewave') # import a recording from seewave sound_orig = as.numeric(sheep@left) samplingRate = [email protected] # playme(sound_orig, samplingRate) # extract the original spectrogram windowLength = c(5, 10, 50, 100)[1] # try both narrow-band (eg 100 ms) # to get "harmonics" and wide-band (5 ms) to get only formants spectralEnvelope = spectrogram(sound_orig, windowLength = windowLength, samplingRate = samplingRate, output = 'original', padWithSilence = FALSE) sound_noise = generateNoise(len = length(sound_orig), spectralEnvelope = spectralEnvelope, rolloffNoise = 0, samplingRate = samplingRate, play = playback) # playme(sound_noise, samplingRate) # The spectral envelope is similar to the original recording. Compare: par(mfrow = c(1, 2)) seewave::meanspec(sound_orig, f = samplingRate, dB = 'max0') seewave::meanspec(sound_noise, f = samplingRate, dB = 'max0') par(mfrow = c(1, 1)) # However, the excitation source is now white noise # (which sounds like noise if windowLength is ~5-10 ms, # but becomes more and more like the original at longer window lengths) ## End(Not run)# .5 s of white noise samplingRate = 16000 noise1 = generateNoise(len = samplingRate * .5, samplingRate = samplingRate) # playme(noise1, samplingRate) # seewave::meanspec(noise1, f = samplingRate) # Percussion (run a few times to notice stochasticity due to temperature = .25) noise2 = generateNoise(len = samplingRate * .15, noise = c(0, -80), rolloffNoise = c(4, -6), attackLen = 5, temperature = .25) noise3 = generateNoise(len = samplingRate * .25, noise = c(0, -40), rolloffNoise = c(4, -20), attackLen = 5, temperature = .25) # playme(c(noise2, noise3), samplingRate) ## Not run: playback = list(TRUE, FALSE, 'aplay', 'vlc')[[1]] # 1.2 s of noise with rolloff changing from 0 to -12 dB above 2 kHz noise = generateNoise(len = samplingRate * 1.2, rolloffNoise = c(0, -12), noiseFlatSpec = 2000, samplingRate = samplingRate, play = playback) # spectrogram(noise, samplingRate, osc = TRUE) # Similar, but using the dataframe format to specify a more complicated # contour for rolloffNoise: noise = generateNoise(len = samplingRate * 1.2, rolloffNoise = data.frame(time = c(0, .3, 1), value = c(-12, 0, -12)), noiseFlatSpec = 2000, samplingRate = samplingRate, play = playback) # spectrogram(noise, samplingRate, osc = TRUE) # To create a sibilant [s], specify a single strong, broad formant at ~7 kHz: windowLength_points = 1024 spectralEnvelope = soundgen:::getSpectralEnvelope( nr = windowLength_points / 2, nc = 1, samplingRate = samplingRate, formants = list('f1' = data.frame(time = 0, freq = 7000, amp = 50, width = 2000))) noise = generateNoise(len = samplingRate, samplingRate = samplingRate, spectralEnvelope = as.numeric(spectralEnvelope), play = playback) # plot(spectralEnvelope, type = 'l') # Low-frequency, wind-like noise spectralEnvelope = soundgen:::getSpectralEnvelope( nr = windowLength_points / 2, nc = 1, lipRad = 0, samplingRate = samplingRate, formants = list('f1' = data.frame( time = 0, freq = 150, amp = 30, width = 90))) noise = generateNoise(len = samplingRate, samplingRate = samplingRate, spectralEnvelope = as.numeric(spectralEnvelope), play = playback) # Manual filter, e.g. for a kettle-like whistle (narrow-band noise) spectralEnvelope = c(rep(0, 100), 120, rep(0, 100)) # any length is fine # plot(spectralEnvelope, type = 'b') # notch filter at Nyquist / 2, here 4 kHz noise = generateNoise(len = samplingRate, spectralEnvelope = spectralEnvelope, samplingRate = samplingRate, play = playback) # Compare to a similar sound created with soundgen() # (aperiodic noise only, a single formant at 4 kHz) noise_s = soundgen(pitch = NULL, noise = data.frame(time = c(0, 1000), value = c(0, 0)), formants = list(f1 = data.frame(freq = 4000, amp = 80, width = 20)), play = playback) # Use the spectral envelope of an existing recording (bleating of a sheep) # (see also the same example with tonal source in ?addFormants) data(sheep, package = 'seewave') # import a recording from seewave sound_orig = as.numeric(sheep@left) samplingRate = sheep@samp.rate # playme(sound_orig, samplingRate) # extract the original spectrogram windowLength = c(5, 10, 50, 100)[1] # try both narrow-band (eg 100 ms) # to get "harmonics" and wide-band (5 ms) to get only formants spectralEnvelope = spectrogram(sound_orig, windowLength = windowLength, samplingRate = samplingRate, output = 'original', padWithSilence = FALSE) sound_noise = generateNoise(len = length(sound_orig), spectralEnvelope = spectralEnvelope, rolloffNoise = 0, samplingRate = samplingRate, play = playback) # playme(sound_noise, samplingRate) # The spectral envelope is similar to the original recording. Compare: par(mfrow = c(1, 2)) seewave::meanspec(sound_orig, f = samplingRate, dB = 'max0') seewave::meanspec(sound_noise, f = samplingRate, dB = 'max0') par(mfrow = c(1, 1)) # However, the excitation source is now white noise # (which sounds like noise if windowLength is ~5-10 ms, # but becomes more and more like the original at longer window lengths) ## End(Not run)
Returns the duration of one or more audio files (mostly useful for running on
an entire folder). If threshold is set, it also removes the leading
and trailing silences or near-silences, thus returning the duration of
relatively loud central fragments of each sound. Silences are located based
on the amplitude of root mean square (RMS) amplitude with
getRMS. Note that the threshold is set relative to the observed
maximum RMS, just as in analyze. This means that even very
quiet sounds are not treated as nothing but silence.
getDuration( x, samplingRate = NULL, silence = 0.01, rms = list(windowLength = 20, step = 5), reportEvery = NULL, cores = 1 )getDuration( x, samplingRate = NULL, silence = 0.01, rms = list(windowLength = 20, step = 5), reportEvery = NULL, cores = 1 )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
silence |
leading and trailing sections quieter than this proportion of
maximum RMS amplitude are removed when calculating
|
rms |
a list of control parameters passed to |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
Returns duration (s) and duration_noSilence (duration
without leading and trailing silences).
s = c(rep(0, 550), runif(400, -1, 1), rep(0, 50)) osc(s, samplingRate = 1000) # true duration_noSilence is 400 ms getDuration(s, samplingRate = 1000, silence = .01) getDuration(s, samplingRate = 1000, silence = .1, rms = list(windowLength = 5, step = 1)) ## Not run: d = getDuration('~/Downloads/temp') hist(d$duration - d$duration_noSilence) ## End(Not run)s = c(rep(0, 550), runif(400, -1, 1), rep(0, 50)) osc(s, samplingRate = 1000) # true duration_noSilence is 400 ms getDuration(s, samplingRate = 1000, silence = .01) getDuration(s, samplingRate = 1000, silence = .1, rms = list(windowLength = 5, step = 1)) ## Not run: d = getDuration('~/Downloads/temp') hist(d$duration - d$duration_noSilence) ## End(Not run)
Returns Wiener or Shannon entropy of an input vector such as the spectrum of a sound. Non-positive input values are converted to a small positive number (convertNonPositive). If all elements are zero, returns NA.
getEntropy( x, type = c("wiener", "shannon")[1], normalize = FALSE, convertNonPositive = 1e-10 )getEntropy( x, type = c("wiener", "shannon")[1], normalize = FALSE, convertNonPositive = 1e-10 )
x |
vector of positive floats |
type |
'shannon' for Shannon (information) entropy, 'wiener' for Wiener entropy |
normalize |
if TRUE, Shannon entropy is normalized by the length of input vector to range from 0 to 1. It has no affect on Wiener entropy |
convertNonPositive |
all non-positive values are converted to
|
# Here are four simplified power spectra, each with 9 frequency bins: s = list( c(rep(0, 4), 1, rep(0, 4)), # a single peak in spectrum c(0, 0, 1, 0, 0, .75, 0, 0, .5), # perfectly periodic, with 3 harmonics rep(0, 9), # a silent frame rep(1, 9) # white noise ) # Wiener entropy is ~0 for periodic, NA for silent, 1 for white noise sapply(s, function(x) round(getEntropy(x), 2)) # Shannon entropy is ~0 for periodic with a single harmonic, moderate for # periodic with multiple harmonics, NA for silent, highest for white noise sapply(s, function(x) round(getEntropy(x, type = 'shannon'), 2)) # Normalized Shannon entropy - same but forced to be 0 to 1 sapply(s, function(x) round(getEntropy(x, type = 'shannon', normalize = TRUE), 2))# Here are four simplified power spectra, each with 9 frequency bins: s = list( c(rep(0, 4), 1, rep(0, 4)), # a single peak in spectrum c(0, 0, 1, 0, 0, .75, 0, 0, .5), # perfectly periodic, with 3 harmonics rep(0, 9), # a silent frame rep(1, 9) # white noise ) # Wiener entropy is ~0 for periodic, NA for silent, 1 for white noise sapply(s, function(x) round(getEntropy(x), 2)) # Shannon entropy is ~0 for periodic with a single harmonic, moderate for # periodic with multiple harmonics, NA for silent, highest for white noise sapply(s, function(x) round(getEntropy(x, type = 'shannon'), 2)) # Normalized Shannon entropy - same but forced to be 0 to 1 sapply(s, function(x) round(getEntropy(x, type = 'shannon', normalize = TRUE), 2))
Returns the smoothed amplitude envelope of a waveform on the original scale. Unlike seewave::env, this function always returns an envelope of the same length as the original sound, regardless of the amount of smoothing.
getEnv( sound, windowLength_points, method = c("rms", "hil", "peak", "raw", "mean")[1] )getEnv( sound, windowLength_points, method = c("rms", "hil", "peak", "raw", "mean")[1] )
sound |
numeric vector |
windowLength_points |
the length of smoothing window, in points |
method |
'peak' for peak amplitude per window, 'rms' for root mean square amplitude, 'mean' for mean (for DC offset removal), 'hil' for Hilbert, 'raw' for low-pass filtering the actual sound |
a = rnorm(500) * seq(1, 0, length.out = 500) windowLength_points = 50 scale = max(abs(a)) plot(a, type = 'l', ylim = c(-scale, scale)) points(soundgen:::getEnv(a, windowLength_points, 'rms'), type = 'l', col = 'red') points(soundgen:::getEnv(a, windowLength_points, 'peak'), type = 'l', col = 'green') points(soundgen:::getEnv(a, windowLength_points, 'hil'), type = 'l', col = 'blue') points(soundgen:::getEnv(a, windowLength_points, 'mean'), type = 'l', lty = 3, lwd = 3)a = rnorm(500) * seq(1, 0, length.out = 500) windowLength_points = 50 scale = max(abs(a)) plot(a, type = 'l', ylim = c(-scale, scale)) points(soundgen:::getEnv(a, windowLength_points, 'rms'), type = 'l', col = 'red') points(soundgen:::getEnv(a, windowLength_points, 'peak'), type = 'l', col = 'green') points(soundgen:::getEnv(a, windowLength_points, 'hil'), type = 'l', col = 'blue') points(soundgen:::getEnv(a, windowLength_points, 'mean'), type = 'l', lty = 3, lwd = 3)
Calculates the harmonics-to-noise ratio (HNR) - that is, the ratio between
the intensity (root mean square amplitude) of the harmonic component and the
intensity of the noise component. Normally called by analyze.
getHNR( x = NULL, samplingRate = NA, acf_x = NULL, lag.min = 2, lag.max = length(x), interpol = c("none", "parab", "spline", "sinc")[4], wn = "hanning", idx_max = NULL )getHNR( x = NULL, samplingRate = NA, acf_x = NULL, lag.min = 2, lag.max = length(x), interpol = c("none", "parab", "spline", "sinc")[4], wn = "hanning", idx_max = NULL )
x |
time series (a numeric vector) |
samplingRate |
sampling rate |
acf_x |
pre-computed autocorrelation function of input |
lag.min, lag.max
|
minimum and maximum lag to consider when looking for peaks in the ACF; lag.min = samplingRate/pitchCeiling, lag.max = samplingRate/pitchFloor |
interpol |
method of improving the frequency resolution by interpolating the ACF: "none" = don't interpolate; "parab" = parabolic interpolation on three points (local peak and its neighbors); "spline" = spline interpolation; "sinc" = sin(x)/x interpolation to a continuous function followed by a search for local peaks using Brent's method |
wn |
window applied to |
idx_max |
(internal) the index of the peak to investigate, if already estimated |
A list of three components: f0 = frequency corresponding to the peak of the autocorrelation function; max_acf = amplitude of the peak of the autocorrelation function on a scale of (0, 1); HNR = 10 * log10(x / (1 - max_acf)).
Boersma, P. (1993). Accurate short-term analysis of the fundamental frequency and the harmonics-to-noise ratio of a sampled sound. In Proceedings of the institute of phonetic sciences (Vol. 17, No. 1193, pp. 97-110).
signal = sin(2 * pi * 150 * (1:16000)/16000) signal = signal / sqrt(mean(signal^2)) noise = rnorm(16000) noise = noise / sqrt(mean(noise^2)) SNR = 40 s = signal + noise * 10^(-SNR/20) soundgen:::getHNR(s, 16000, lag.min = 16000/1000, lag.max = 16000/75, interpol = 'none') soundgen:::getHNR(s, 16000, lag.min = 16000/1000, lag.max = 16000/75, interpol = 'parab') soundgen:::getHNR(s, 16000, lag.min = 16000/1000, lag.max = 16000/75, interpol = 'spline') soundgen:::getHNR(s, 16000, lag.min = 16000/1000, lag.max = 16000/75, interpol = 'sinc')signal = sin(2 * pi * 150 * (1:16000)/16000) signal = signal / sqrt(mean(signal^2)) noise = rnorm(16000) noise = noise / sqrt(mean(noise^2)) SNR = 40 s = signal + noise * 10^(-SNR/20) soundgen:::getHNR(s, 16000, lag.min = 16000/1000, lag.max = 16000/75, interpol = 'none') soundgen:::getHNR(s, 16000, lag.min = 16000/1000, lag.max = 16000/75, interpol = 'parab') soundgen:::getHNR(s, 16000, lag.min = 16000/1000, lag.max = 16000/75, interpol = 'spline') soundgen:::getHNR(s, 16000, lag.min = 16000/1000, lag.max = 16000/75, interpol = 'sinc')
Takes a continuous random walk and converts it to continuous epochs of repeated values 0/1/2, each at least minLength points long. 0/1/2 correspond to different noise regimes: 0 = no noise, 1 = subharmonics, 2 = subharmonics and jitter/shimmer.
getIntegerRandomWalk( rw, nonlinBalance = 50, minLength = 50, q1 = NULL, q2 = NULL, plot = FALSE )getIntegerRandomWalk( rw, nonlinBalance = 50, minLength = 50, q1 = NULL, q2 = NULL, plot = FALSE )
rw |
a random walk generated by |
nonlinBalance |
a number between 0 to 100: 0 = returns all zeros; 100 = returns all twos |
minLength |
the mimimum length of each epoch |
q1, q2
|
cutoff points for transitioning from regime 0 to 1 (q1) or from regime 1 to 2 (q2). See noiseThresholdsDict for defaults |
plot |
if TRUE, plots the random walk underlying nonlinear regimes |
Returns a vector of integers (0/1/2) of the same length as rw.
rw = getRandomWalk(len = 100, rw_range = 100, rw_smoothing = .2) r = getIntegerRandomWalk(rw, nonlinBalance = 75, minLength = 10, plot = TRUE) r = getIntegerRandomWalk(rw, nonlinBalance = 15, q1 = 30, q2 = 70, minLength = 10, plot = TRUE)rw = getRandomWalk(len = 100, rw_range = 100, rw_smoothing = .2) r = getIntegerRandomWalk(rw, nonlinBalance = 75, minLength = 10, plot = TRUE) r = getIntegerRandomWalk(rw, nonlinBalance = 15, q1 = 30, q2 = 70, minLength = 10, plot = TRUE)
Estimates subjective loudness per frame, in sone. Based on EMBSD speech
quality measure, particularly the matlab code in Yang (1999) and Timoney et
al. (2004). Note that there are many ways to estimate loudness and many other
factors, ignored by this model, that could influence subjectively experienced
loudness. Please treat the output with a healthy dose of skepticism! Also
note that the absolute value of calculated loudness critically depends on the
chosen "measured" sound pressure level (SPL). getLoudness estimates
how loud a sound will be experienced if it is played back at an SPL of
SPL_measured dB. The most meaningful way to use the output is to
compare the loudness of several sounds analyzed with identical settings or of
different segments within the same recording.
getLoudness( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, windowLength = 50, step = NULL, overlap = 50, SPL_measured = 70, Pref = 2e-05, spreadSpectrum = TRUE, summaryFun = c("mean", "median", "sd"), reportEvery = NULL, cores = 1, plot = FALSE, savePlots = NULL, main = NULL, ylim = NULL, width = 900, height = 500, units = "px", res = NA, mar = c(5.1, 4.1, 4.1, 4.1), ... )getLoudness( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, windowLength = 50, step = NULL, overlap = 50, SPL_measured = 70, Pref = 2e-05, spreadSpectrum = TRUE, summaryFun = c("mean", "median", "sd"), reportEvery = NULL, cores = 1, plot = FALSE, savePlots = NULL, main = NULL, ylim = NULL, width = 900, height = 500, units = "px", res = NA, mar = c(5.1, 4.1, 4.1, 4.1), ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
scale |
maximum possible amplitude of input used for normalization of
input vector (only needed if |
from, to
|
if NULL (default), analyzes the whole sound, otherwise from...to (s) |
windowLength |
length of FFT window, ms (multiple values in a vector produce a multi-resolution spectrogram) |
step |
you can override |
overlap |
overlap between successive FFT frames, % |
SPL_measured |
sound pressure level at which the sound is presented, dB |
Pref |
reference pressure, Pa (currently has no effect on the estimate) |
spreadSpectrum |
if TRUE, applies a spreading function to account for frequency masking |
summaryFun |
functions used to summarize each acoustic characteristic, eg "c('mean', 'sd')"; user-defined functions are fine (see examples); NAs are omitted automatically for mean/median/sd/min/max/range/sum, otherwise take care of NAs yourself |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
plot |
should a spectrogram be plotted? TRUE / FALSE |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
main |
plot title |
ylim |
frequency range to plot, kHz (defaults to 0 to Nyquist frequency). NB: still in kHz, even if yScale = bark, mel, or ERB |
width, height, units, res
|
graphical parameters for saving plots passed to
|
mar |
margins of the spectrogram |
... |
other plotting parameters passed to |
Algorithm: calibrates the sound to the desired SPL (Timoney et al., 2004),
extracts a spectrogram with powspec, converts to bark
scale with (audspec), spreads the spectrum to account
for frequency masking across the critical bands (Yang, 1999), converts dB to
phon by using standard equal loudness curves (ISO 226), converts phon to sone
(Timoney et al., 2004), sums across all critical bands, and applies a
correction coefficient to standardize output. Calibrated so as to return a
loudness of 1 sone for a 1 kHz pure tone with SPL of 40 dB.
Returns a list:
spectrum in bark-sone (one per file): a matrix of loudness values in sone, with frequency on the bark scale in rows and time (STFT frames) in columns
a vector of loudness in sone per STFT frame (one per file)
a dataframe of summary loudness measures (one row per file)
ISO 226 as implemented by Jeff Tackett (2005) on https://www.mathworks.com/matlabcentral/fileexchange/ 7028-iso-226-equal-loudness-level-contour-signal
Timoney, J., Lysaght, T., Schoenwiesner, M., & MacManus, L. (2004). Implementing loudness models in matlab.
Yang, W. (1999). Enhanced Modified Bark Spectral Distortion (EMBSD): An Objective Speech Quality Measure Based on Audible Distortion and Cognitive Model. Temple University.
sounds = list( white_noise = runif(8000, -1, 1), white_noise2 = runif(8000, -1, 1) / 2, # ~6 dB quieter pure_tone_1KHz = sin(2*pi*1000/16000*(1:8000)) # pure tone at 1 kHz ) l = getLoudness( x = sounds, samplingRate = 16000, scale = 1, windowLength = 20, step = NULL, overlap = 50, SPL_measured = 40, Pref = 2e-5, plot = FALSE) l$summary # white noise (sound 1) is twice as loud as pure tone at 1 KHz (sound 3), # and note that the same white noise with lower amplitude has lower loudness # (provided that "scale" is specified) # compare: lapply(sounds, range) ## Not run: s = soundgen() # playme(s) l1 = getLoudness(s, samplingRate = 16000, SPL_measured = 70) l1$summary # The estimated loudness in sone depends on target SPL l2 = getLoudness(s, samplingRate = 16000, SPL_measured = 40) l2$summary # ...but not (much) on windowLength and samplingRate l3 = getLoudness(s, samplingRate = 16000, SPL_measured = 40, windowLength = 50) l3$summary # input can be an audio file... getLoudness('~/Downloads/temp/032_ut_anger_30-m-roar-curse.wav') ...or a folder with multiple audio files getLoudness('~/Downloads/temp2', plot = FALSE)$summary # Compare: analyze('~/Downloads/temp2', pitchMethods = NULL, plot = FALSE, silence = 0)$summary$loudness_mean # (per STFT frame; should be similar if silence = 0, because # otherwise analyze() discards frames considered silent) # custom summaryFun ran = function(x) diff(range(x)) getLoudness('~/Downloads/temp2', plot = FALSE, summaryFun = c('mean', 'ran'))$summary ## End(Not run)sounds = list( white_noise = runif(8000, -1, 1), white_noise2 = runif(8000, -1, 1) / 2, # ~6 dB quieter pure_tone_1KHz = sin(2*pi*1000/16000*(1:8000)) # pure tone at 1 kHz ) l = getLoudness( x = sounds, samplingRate = 16000, scale = 1, windowLength = 20, step = NULL, overlap = 50, SPL_measured = 40, Pref = 2e-5, plot = FALSE) l$summary # white noise (sound 1) is twice as loud as pure tone at 1 KHz (sound 3), # and note that the same white noise with lower amplitude has lower loudness # (provided that "scale" is specified) # compare: lapply(sounds, range) ## Not run: s = soundgen() # playme(s) l1 = getLoudness(s, samplingRate = 16000, SPL_measured = 70) l1$summary # The estimated loudness in sone depends on target SPL l2 = getLoudness(s, samplingRate = 16000, SPL_measured = 40) l2$summary # ...but not (much) on windowLength and samplingRate l3 = getLoudness(s, samplingRate = 16000, SPL_measured = 40, windowLength = 50) l3$summary # input can be an audio file... getLoudness('~/Downloads/temp/032_ut_anger_30-m-roar-curse.wav') ...or a folder with multiple audio files getLoudness('~/Downloads/temp2', plot = FALSE)$summary # Compare: analyze('~/Downloads/temp2', pitchMethods = NULL, plot = FALSE, silence = 0)$summary$loudness_mean # (per STFT frame; should be similar if silence = 0, because # otherwise analyze() discards frames considered silent) # custom summaryFun ran = function(x) diff(range(x)) getLoudness('~/Downloads/temp2', plot = FALSE, summaryFun = c('mean', 'ran'))$summary ## End(Not run)
A less precise, but very quick method of pitch tracking based on measuring
zero-crossing rate in low-pass-filtered audio. Recommended for processing
long recordings with typical pitch values well below the first formant
frequency, such as speech. Calling this function is considerably faster than
using the same pitch-tracking method in analyze. Note that,
unlike analyze(), it returns the times of individual zero crossings
(hopefully corresponding to glottal cycles) instead of pitch values at fixed
time intervals.
getPitchZc( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, pitchFloor = 50, pitchCeiling = 400, zcThres = 0.1, zcWin = 5, silence = 0.04, envWin = 5, summaryFun = c("mean", "sd"), reportEvery = NULL )getPitchZc( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, pitchFloor = 50, pitchCeiling = 400, zcThres = 0.1, zcWin = 5, silence = 0.04, envWin = 5, summaryFun = c("mean", "sd"), reportEvery = NULL )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
scale |
maximum possible amplitude of input used for normalization of
input vector (only needed if |
from, to
|
if NULL (default), analyzes the whole sound, otherwise from...to (s) |
pitchFloor, pitchCeiling
|
absolute bounds for pitch candidates (Hz) |
zcThres |
pitch candidates with certainty below this value are treated
as noise and set to NA (0 = anything goes, 1 = pitch must be perfectly
stable over |
zcWin |
certainty in pitch candidates depends on how stable pitch is
over |
silence |
minimum root mean square (RMS) amplitude, below which pitch candidates are set to NA (NULL = don't consider RMS amplitude) |
envWin |
window length for calculating RMS envelope, ms |
summaryFun |
functions used to summarize each acoustic characteristic;
see |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
Algorithm: the audio is bandpass-filtered from pitchFloor to
pitchCeiling, and the timing of all zero crossings is saved. This is
not enough, however, because aperiodic sounds like white noise also have
plenty of zero crossings. Accordingly, an attempt is made to detect voiced
segments (or steady musical tones, etc.) by looking for stable regions, with
several zero-crossings at relatively regular intervals (see parameters
zcThres and zcWin). Very quiet parts of audio are also treated
as not having a pitch.
Returns a dataframe containing
time stamps of all zero crossings except the last one, after bandpass-filtering
pitch calculated from the time between consecutive zero crossings
certainty in each pitch candidate calculated from local pitch stability, 0 to 1
data(sheep, package = 'seewave') # spectrogram(sheep) zc = getPitchZc(sheep, pitchCeiling = 250) plot(zc$detailed[, c('time', 'pitch')], type = 'b') # Convert to a standard pitch contour sampled at regular time intervals: pitch = getSmoothContour( anchors = data.frame(time = zc$detailed$time, value = zc$detailed$pitch), len = 1000, NA_to_zero = FALSE, discontThres = 0) spectrogram(sheep, extraContour = pitch, ylim = c(0, 2)) ## Not run: # process all files in a folder zc = getPitchZc('~/Downloads/temp') zc$summary ## End(Not run)data(sheep, package = 'seewave') # spectrogram(sheep) zc = getPitchZc(sheep, pitchCeiling = 250) plot(zc$detailed[, c('time', 'pitch')], type = 'b') # Convert to a standard pitch contour sampled at regular time intervals: pitch = getSmoothContour( anchors = data.frame(time = zc$detailed$time, value = zc$detailed$pitch), len = 1000, NA_to_zero = FALSE, discontThres = 0) spectrogram(sheep, extraContour = pitch, ylim = c(0, 2)) ## Not run: # process all files in a folder zc = getPitchZc('~/Downloads/temp') zc$summary ## End(Not run)
Prior for adjusting the estimated pitch certainties in analyze.
For ex., if primarily working with speech, we could prioritize pitch
candidates in the expected pitch range (100-1000 Hz) and decrease our
confidence in candidates with very high or very low frequency as unlikely but
still remotely possible. You can think of this as a "soft" alternative to
setting absolute pitch floor and ceiling. Algorithm: the multiplier for each
pitch candidate is the density of prior distribution with mean = priorMean
(Hz) and sd = priorSD (semitones) normalized so max = 1 over [pitchFloor,
pitchCeiling]. Useful for previewing the prior given to
analyze.
getPrior( priorMean, priorSD, distribution = c("normal", "gamma")[1], pitchFloor = 75, pitchCeiling = 3000, len = 100, plot = TRUE, pitchCands = NULL, ... )getPrior( priorMean, priorSD, distribution = c("normal", "gamma")[1], pitchFloor = 75, pitchCeiling = 3000, len = 100, plot = TRUE, pitchCands = NULL, ... )
priorMean, priorSD
|
specifies the mean (Hz) and standard deviation
(semitones) of gamma distribution describing our prior knowledge about the
most likely pitch values for this file. For ex., |
distribution |
the shape of prior distribution on the musical scale: 'normal' (mode = priorMean) or 'gamma' (skewed to lower frequencies) |
pitchFloor, pitchCeiling
|
absolute bounds for pitch candidates (Hz) |
len |
the required length of output vector (resolution) |
plot |
if TRUE, plots the prior |
pitchCands |
a matrix of pitch candidate frequencies (for internal soundgen use) |
... |
additional graphical parameters passed on to plot() |
Returns a numeric vector of certainties of length len if
pitchCands is NULL and a numeric matrix of the same dimensions as
pitchCands otherwise.
soundgen:::getPrior(priorMean = 150, # Hz priorSD = 2) # semitones soundgen:::getPrior(150, 6) s = soundgen:::getPrior(450, 24, pitchCeiling = 6000) plot(s, type = 'l')soundgen:::getPrior(priorMean = 150, # Hz priorSD = 2) # semitones soundgen:::getPrior(150, 6) s = soundgen:::getPrior(450, 24, pitchCeiling = 6000) plot(s, type = 'l')
Generates a random walk with flexible control over its range, trend, and smoothness. It works by calling stats::rnorm at each step and taking a cumulative sum of the generated values. Smoothness is controlled by initially generating a shorter random walk and upsampling.
getRandomWalk( len, rw_range = 1, rw_smoothing = 0.2, method = c("linear", "spline")[2], trend = 0 )getRandomWalk( len, rw_range = 1, rw_smoothing = 0.2, method = c("linear", "spline")[2], trend = 0 )
len |
an integer specifying the required length of random walk. If len is 1, returns a single draw from a gamma distribution with mean=1 and sd=rw_range |
rw_range |
the upper bound of the generated random walk (the lower bound is set to 0) |
rw_smoothing |
specifies the amount of smoothing, basically the number of points used to construct the rw as a proportion of len, from 0 (no smoothing) to 1 (maximum smoothing to a straight line) |
method |
specifies the method of smoothing: either linear interpolation ('linear', see stats::approx) or cubic splines ('spline', see stats::spline) |
trend |
mean of generated normal distribution (vectors are also acceptable, as long as their length is an integer multiple of len). If positive, the random walk has an overall upwards trend (good values are between 0 and 0.5 or -0.5). Trend = c(1,-1) gives a roughly bell-shaped rw with an upward and a downward curve. Larger absolute values of trend produce less and less random behavior |
Returns a numeric vector of length len and range from 0 to rw_range.
plot(getRandomWalk(len = 1000, rw_range = 5, rw_smoothing = 0)) plot(getRandomWalk(len = 1000, rw_range = 5, rw_smoothing = .2)) plot(getRandomWalk(len = 1000, rw_range = 5, rw_smoothing = .95)) plot(getRandomWalk(len = 1000, rw_range = 5, rw_smoothing = .99)) plot(getRandomWalk(len = 1000, rw_range = 5, rw_smoothing = 1)) plot(getRandomWalk(len = 1000, rw_range = 15, rw_smoothing = .2, trend = c(.1, -.1))) plot(getRandomWalk(len = 1000, rw_range = 15, rw_smoothing = .2, trend = c(15, -1)))plot(getRandomWalk(len = 1000, rw_range = 5, rw_smoothing = 0)) plot(getRandomWalk(len = 1000, rw_range = 5, rw_smoothing = .2)) plot(getRandomWalk(len = 1000, rw_range = 5, rw_smoothing = .95)) plot(getRandomWalk(len = 1000, rw_range = 5, rw_smoothing = .99)) plot(getRandomWalk(len = 1000, rw_range = 5, rw_smoothing = 1)) plot(getRandomWalk(len = 1000, rw_range = 15, rw_smoothing = .2, trend = c(.1, -.1))) plot(getRandomWalk(len = 1000, rw_range = 15, rw_smoothing = .2, trend = c(15, -1)))
Calculates root mean square (RMS) amplitude in overlapping windows, providing an envelope of RMS amplitude - a measure of sound intensity. Longer windows provide smoother, more robust estimates; shorter windows and more overlap improve temporal resolution, but they also increase processing time and make the contour less smooth.
getRMS( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, windowLength = 50, step = NULL, overlap = 70, stereo = c("left", "right", "average", "both")[1], killDC = FALSE, normalize = TRUE, windowDC = 200, summaryFun = "mean", reportEvery = NULL, cores = 1, plot = FALSE, savePlots = NULL, main = NULL, xlab = "", ylab = "", type = "b", col = "green", lwd = 2, width = 900, height = 500, units = "px", res = NA, ... )getRMS( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, windowLength = 50, step = NULL, overlap = 70, stereo = c("left", "right", "average", "both")[1], killDC = FALSE, normalize = TRUE, windowDC = 200, summaryFun = "mean", reportEvery = NULL, cores = 1, plot = FALSE, savePlots = NULL, main = NULL, xlab = "", ylab = "", type = "b", col = "green", lwd = 2, width = 900, height = 500, units = "px", res = NA, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
scale |
maximum possible amplitude of input used for normalization of
input vector (only needed if |
from, to
|
if NULL (default), analyzes the whole sound, otherwise from...to (s) |
windowLength |
length of FFT window, ms (multiple values in a vector produce a multi-resolution spectrogram) |
step |
you can override |
overlap |
overlap between successive FFT frames, % |
stereo |
'left' = only left channel, 'right' = only right channel, 'average' = take the mean of the two channels, 'both' = return RMS for both channels separately |
killDC |
if TRUE, removed DC offset (see also |
normalize |
if TRUE, the RMS amplitude is returned as proportion of
the maximum possible amplitude as given by |
windowDC |
the window for calculating DC offset, ms |
summaryFun |
functions used to summarize each acoustic characteristic;
see |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
plot |
if TRUE, plot a contour of RMS amplitude |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
xlab, ylab, main
|
general graphical parameters |
type, col, lwd
|
graphical parameters pertaining to the RMS envelope |
width, height, units, res
|
graphical parameters for saving plots passed to
|
... |
other graphical parameters |
Note that you can also get similar estimates per frame from
analyze on a normalized scale of 0 to 1, but getRMS is
much faster, operates on the original scale, and plots the amplitude contour.
If you need RMS for the entire sound instead of per frame, you can simply
calculate it as sqrt(mean(x^2)), where x is your waveform.
Having RMS estimates per frame gives more flexibility: RMS per sound can be
calculated as the mean / median / max of RMS values per frame.
Returns a list containing:
a list of RMS amplitudes per frame for each sound, on the scale of input; names give time stamps for the center of each frame, in ms.
a dataframe with summary measures, one row per sound
s = soundgen() + .25 # with added DC offset # osc(s) r = getRMS(s, samplingRate = 16000, from = .05, windowLength = 40, overlap = 50, killDC = TRUE, plot = TRUE, type = 'l', lty = 2, main = 'RMS envelope') r # short window = jagged envelope r = getRMS(s, samplingRate = 16000, windowLength = 5, overlap = 0, killDC = TRUE, plot = TRUE, col = 'blue', pch = 13, main = 'RMS envelope') # stereo wave_stereo = tuneR::Wave( left = runif(1000, -1, 1) * 16000, right = runif(1000, -1, 1) / 3 * 16000, bit = 16, samp.rate = 4000) getRMS(wave_stereo)$summary getRMS(wave_stereo, stereo = 'right')$summary getRMS(wave_stereo, stereo = 'average')$summary getRMS(wave_stereo, from = .05, stereo = 'both', plot = TRUE)$summary ## Not run: r = getRMS('~/Downloads/temp', savePlots = '~/Downloads/temp/plots') r$summary # Compare: analyze('~/Downloads/temp', pitchMethods = NULL, plot = FALSE)$ampl_mean # (per STFT frame, but should be very similar) User-defined summary functions: ran = function(x) diff(range(x)) meanSD = function(x) { paste0('mean = ', round(mean(x), 2), '; sd = ', round(sd(x), 2)) } getRMS('~/Downloads/temp', summaryFun = c('mean', 'ran', 'meanSD'))$summary ## End(Not run)s = soundgen() + .25 # with added DC offset # osc(s) r = getRMS(s, samplingRate = 16000, from = .05, windowLength = 40, overlap = 50, killDC = TRUE, plot = TRUE, type = 'l', lty = 2, main = 'RMS envelope') r # short window = jagged envelope r = getRMS(s, samplingRate = 16000, windowLength = 5, overlap = 0, killDC = TRUE, plot = TRUE, col = 'blue', pch = 13, main = 'RMS envelope') # stereo wave_stereo = tuneR::Wave( left = runif(1000, -1, 1) * 16000, right = runif(1000, -1, 1) / 3 * 16000, bit = 16, samp.rate = 4000) getRMS(wave_stereo)$summary getRMS(wave_stereo, stereo = 'right')$summary getRMS(wave_stereo, stereo = 'average')$summary getRMS(wave_stereo, from = .05, stereo = 'both', plot = TRUE)$summary ## Not run: r = getRMS('~/Downloads/temp', savePlots = '~/Downloads/temp/plots') r$summary # Compare: analyze('~/Downloads/temp', pitchMethods = NULL, plot = FALSE)$ampl_mean # (per STFT frame, but should be very similar) User-defined summary functions: ran = function(x) diff(range(x)) meanSD = function(x) { paste0('mean = ', round(mean(x), 2), '; sd = ', round(sd(x), 2)) } getRMS('~/Downloads/temp', summaryFun = c('mean', 'ran', 'meanSD'))$summary ## End(Not run)
Harmonics are generated as separate sine waves. But we don't want each
harmonic to be equally strong, so we normally specify some rolloff function
that describes the loss of energy in upper harmonics relative to the
fundamental frequency (f0). getRolloff provides flexible
control over this rolloff function, going beyond simple exponential decay
(rolloff). Use quadratic terms to modify the behavior of a few lower
harmonics, rolloffOct to adjust the rate of decay per
octave, and rolloffKHz for rolloff correction depending on
f0. Plot the output with different parameter values and see examples below
and the vignette to get a feel for how to use getRolloff
effectively.
getRolloff( pitch_per_gc = c(440), nHarmonics = NULL, rolloff = -6, rolloffOct = 0, rolloffParab = 0, rolloffParabHarm = 3, rolloffParabCeiling = NULL, rolloffKHz = 0, baseline = 200, dynamicRange = 80, samplingRate = 16000, plot = FALSE )getRolloff( pitch_per_gc = c(440), nHarmonics = NULL, rolloff = -6, rolloffOct = 0, rolloffParab = 0, rolloffParabHarm = 3, rolloffParabCeiling = NULL, rolloffKHz = 0, baseline = 200, dynamicRange = 80, samplingRate = 16000, plot = FALSE )
pitch_per_gc |
a vector of f0 per glottal cycle, Hz |
nHarmonics |
maximum number of harmonics to generate (very weak
harmonics with amplitude < |
rolloff |
basic rolloff from lower to upper harmonics, db/octave
(exponential decay). All rolloff parameters are in anchor format. See
|
rolloffOct |
basic rolloff changes from lower to upper harmonics
(regardless of f0) by |
rolloffParab |
an optional quadratic term affecting only the first
|
rolloffParabHarm |
the number of harmonics affected by
|
rolloffParabCeiling |
quadratic adjustment is applied only up to
|
rolloffKHz |
rolloff changes linearly with f0 by |
baseline |
The "neutral" f0, at which no adjustment of rolloff
takes place regardless of |
dynamicRange |
dynamic range, dB. Harmonics and noise more than dynamicRange under maximum amplitude are discarded to save computational resources |
samplingRate |
sampling rate (needed to stop at Nyquist frequency and for plotting purposes) |
plot |
if TRUE, produces a plot |
Returns a matrix of amplitude multiplication factors for adjusting the amplitude of harmonics relative to f0 (1 = no adjustment, 0 = silent). Each row of output contains one harmonic, and each column contains one glottal cycle.
# steady exponential rolloff of -12 dB per octave rolloff = getRolloff(pitch_per_gc = 150, rolloff = -12, rolloffOct = 0, rolloffKHz = 0, plot = TRUE) # the rate of rolloff slows down by 1 dB each octave rolloff = getRolloff(pitch_per_gc = 150, rolloff = -12, rolloffOct = 1, rolloffKHz = 0, plot = TRUE) # rolloff can be made to depend on f0 using rolloffKHz rolloff = getRolloff(pitch_per_gc = c(150, 400, 800), rolloffOct = 0, rolloffKHz = -3, plot = TRUE) # without the correction for f0 (rolloffKHz), # high-pitched sounds have the same rolloff as low-pitched sounds, # producing unnaturally strong high-frequency harmonics rolloff = getRolloff(pitch_per_gc = c(150, 400, 800), rolloffOct = 0, rolloffKHz = 0, plot = TRUE) # parabolic adjustment of lower harmonics rolloff = getRolloff(pitch_per_gc = 350, rolloffParab = 0, rolloffParabHarm = 2, plot = TRUE) # rolloffParabHarm = 1 affects only f0 rolloff = getRolloff(pitch_per_gc = 150, rolloffParab = 30, rolloffParabHarm = 1, plot = TRUE) # rolloffParabHarm=2 or 3 affects only h1 rolloff = getRolloff(pitch_per_gc = 150, rolloffParab = 30, rolloffParabHarm = 2, plot = TRUE) # rolloffParabHarm = 4 affects h1 and h2, etc rolloff = getRolloff(pitch_per_gc = 150, rolloffParab = 30, rolloffParabHarm = 4, plot = TRUE) # negative rolloffParab weakens lower harmonics rolloff = getRolloff(pitch_per_gc = 150, rolloffParab = -20, rolloffParabHarm = 7, plot = TRUE) # only harmonics below 2000 Hz are affected rolloff = getRolloff(pitch_per_gc = c(150, 600), rolloffParab = -20, rolloffParabCeiling = 2000, plot = TRUE) # dynamic rolloff (varies over time) rolloff = getRolloff(pitch_per_gc = c(150, 250), rolloff = c(-12, -18, -24), plot = TRUE) rolloff = getRolloff(pitch_per_gc = c(150, 250), rolloffParab = 40, rolloffParabHarm = 1:5, plot = TRUE) ## Not run: # Note: getRolloff() is called internally by soundgen() # using the data.frame format for all vectorized parameters # Compare: s1 = soundgen(sylLen = 1000, pitch = 250, rolloff = c(-24, -2, -18), plot = TRUE) s2 = soundgen(sylLen = 1000, pitch = 250, rolloff = data.frame(time = c(0, .2, 1), value = c(-24, -2, -18)), plot = TRUE) # Also works for rolloffOct, rolloffParab, etc: s3 = soundgen(sylLen = 1000, pitch = 250, rolloffParab = 20, rolloffParabHarm = 1:15, plot = TRUE) ## End(Not run)# steady exponential rolloff of -12 dB per octave rolloff = getRolloff(pitch_per_gc = 150, rolloff = -12, rolloffOct = 0, rolloffKHz = 0, plot = TRUE) # the rate of rolloff slows down by 1 dB each octave rolloff = getRolloff(pitch_per_gc = 150, rolloff = -12, rolloffOct = 1, rolloffKHz = 0, plot = TRUE) # rolloff can be made to depend on f0 using rolloffKHz rolloff = getRolloff(pitch_per_gc = c(150, 400, 800), rolloffOct = 0, rolloffKHz = -3, plot = TRUE) # without the correction for f0 (rolloffKHz), # high-pitched sounds have the same rolloff as low-pitched sounds, # producing unnaturally strong high-frequency harmonics rolloff = getRolloff(pitch_per_gc = c(150, 400, 800), rolloffOct = 0, rolloffKHz = 0, plot = TRUE) # parabolic adjustment of lower harmonics rolloff = getRolloff(pitch_per_gc = 350, rolloffParab = 0, rolloffParabHarm = 2, plot = TRUE) # rolloffParabHarm = 1 affects only f0 rolloff = getRolloff(pitch_per_gc = 150, rolloffParab = 30, rolloffParabHarm = 1, plot = TRUE) # rolloffParabHarm=2 or 3 affects only h1 rolloff = getRolloff(pitch_per_gc = 150, rolloffParab = 30, rolloffParabHarm = 2, plot = TRUE) # rolloffParabHarm = 4 affects h1 and h2, etc rolloff = getRolloff(pitch_per_gc = 150, rolloffParab = 30, rolloffParabHarm = 4, plot = TRUE) # negative rolloffParab weakens lower harmonics rolloff = getRolloff(pitch_per_gc = 150, rolloffParab = -20, rolloffParabHarm = 7, plot = TRUE) # only harmonics below 2000 Hz are affected rolloff = getRolloff(pitch_per_gc = c(150, 600), rolloffParab = -20, rolloffParabCeiling = 2000, plot = TRUE) # dynamic rolloff (varies over time) rolloff = getRolloff(pitch_per_gc = c(150, 250), rolloff = c(-12, -18, -24), plot = TRUE) rolloff = getRolloff(pitch_per_gc = c(150, 250), rolloffParab = 40, rolloffParabHarm = 1:5, plot = TRUE) ## Not run: # Note: getRolloff() is called internally by soundgen() # using the data.frame format for all vectorized parameters # Compare: s1 = soundgen(sylLen = 1000, pitch = 250, rolloff = c(-24, -2, -18), plot = TRUE) s2 = soundgen(sylLen = 1000, pitch = 250, rolloff = data.frame(time = c(0, .2, 1), value = c(-24, -2, -18)), plot = TRUE) # Also works for rolloffOct, rolloffParab, etc: s3 = soundgen(sylLen = 1000, pitch = 250, rolloffParab = 20, rolloffParabHarm = 1:15, plot = TRUE) ## End(Not run)
Returns a smooth contour based on an arbitrary number of anchors. Used by
soundgen for generating intonation contour, mouth opening, etc.
This function is mostly intended to be used internally by soundgen, more
precisely to construct (upsample) smooth curves from a number of anchors. For
general upsampling or downsampling of audio, use resample. Note
that pitch contours are treated as a special case: values are log-transformed
prior to smoothing, so that with 2 anchors we get a linear transition on a
log scale (as if we were operating with musical notes rather than frequencies
in Hz). Pitch plots have two Y axes: one showing Hz and the other showing
musical notation.
getSmoothContour( anchors = data.frame(time = c(0, 1), value = c(0, 1)), len = NULL, thisIsPitch = FALSE, normalizeTime = TRUE, interpol = c("approx", "spline", "loess")[3], loessSpan = NULL, discontThres = 0.05, jumpThres = 0.01, valueFloor = NULL, valueCeiling = NULL, plot = FALSE, xlim = NULL, ylim = NULL, xlab = "Time, ms", ylab = ifelse(thisIsPitch, "Frequency, Hz", "Amplitude"), main = ifelse(thisIsPitch, "Pitch contour", ""), samplingRate = 16000, voiced = NULL, contourLabel = NULL, NA_to_zero = TRUE, ... )getSmoothContour( anchors = data.frame(time = c(0, 1), value = c(0, 1)), len = NULL, thisIsPitch = FALSE, normalizeTime = TRUE, interpol = c("approx", "spline", "loess")[3], loessSpan = NULL, discontThres = 0.05, jumpThres = 0.01, valueFloor = NULL, valueCeiling = NULL, plot = FALSE, xlim = NULL, ylim = NULL, xlab = "Time, ms", ylab = ifelse(thisIsPitch, "Frequency, Hz", "Amplitude"), main = ifelse(thisIsPitch, "Pitch contour", ""), samplingRate = 16000, voiced = NULL, contourLabel = NULL, NA_to_zero = TRUE, ... )
anchors |
a numeric vector of values or a list/dataframe with one column
(value) or two columns (time and value). |
len |
the required length of the output contour. If NULL, it will be
calculated based on the maximum time value (in ms) and |
thisIsPitch |
(boolean) is this a pitch contour? If true, log-transforms before smoothing and plots in both Hz and musical notation |
normalizeTime |
if TRUE, normalizes anchors$time values to range from 0 to 1 |
interpol |
method of interpolation between anchors: "approx" = linear
with |
loessSpan |
controls the amount of smoothing when interpolating between
anchors with |
discontThres |
if two anchors are closer in time than
|
jumpThres |
if anchors are closer than |
valueFloor, valueCeiling
|
lowser/upper bounds for the contour |
plot |
(boolean) produce a plot? |
xlim, ylim, xlab, ylab, main
|
plotting options |
samplingRate |
sampling rate used to convert time values to points (Hz) |
voiced, contourLabel
|
graphical pars for plotting breathing contours (see examples below) |
NA_to_zero |
if TRUE, all NAs are replaced with zero |
... |
other plotting options passed to |
Returns a numeric vector of length len.
# long format: anchors are a dataframe a = getSmoothContour(anchors = data.frame( time = c(50, 137, 300), value = c(0.03, 0.78, 0.5)), normalizeTime = FALSE, voiced = 200, valueFloor = 0, plot = TRUE, main = '', samplingRate = 16000) # breathing # short format: anchors are a vector (equal time steps assumed) a = getSmoothContour(anchors = c(350, 800, 600), len = 5500, thisIsPitch = TRUE, plot = TRUE, samplingRate = 3500) # pitch # a single anchor gives constant value a = getSmoothContour(anchors = 800, len = 500, thisIsPitch = TRUE, plot = TRUE, samplingRate = 500) # two pitch anchors give loglinear F0 change a = getSmoothContour(anchors = c(220, 440), len = 500, thisIsPitch = TRUE, plot = TRUE, samplingRate = 500) ## Two closely spaced anchors produce a pitch jump # one loess for the entire contour a1 = getSmoothContour(anchors = list(time = c(0, .15, .2, .7, 1), value = c(360, 116, 550, 700, 610)), len = 500, thisIsPitch = TRUE, plot = TRUE, samplingRate = 500) # two segments with a linear transition a2 = getSmoothContour(anchors = list(time = c(0, .15, .17, .7, 1), value = c(360, 116, 550, 700, 610)), len = 500, thisIsPitch = TRUE, plot = TRUE, samplingRate = 500) # two segments with an abrupt jump a3 = getSmoothContour(anchors = list(time = c(0, .15, .155, .7, 1), value = c(360, 116, 550, 700, 610)), len = 500, thisIsPitch = TRUE, plot = TRUE, samplingRate = 500) # compare: plot(a2) plot(a3) # NB: the segment before the jump is upsampled to compensate ## Control the amount of smoothing getSmoothContour(c(1, 3, 9, 10, 9, 9, 2), len = 100, plot = TRUE, loessSpan = NULL) # default amount of smoothing (depends on dur) getSmoothContour(c(1, 3, 9, 10, 9, 9, 2), len = 100, plot = TRUE, loessSpan = .85) # more smoothing than default getSmoothContour(c(1, 3, 9, 10, 9, 9, 2), len = 100, plot = TRUE, loessSpan = .5) # less smoothing getSmoothContour(c(1, 3, 9, 10, 9, 9, 2), len = 100, plot = TRUE, interpol = 'approx') # linear interpolation (no smoothing) ## Upsample preserving leading and trailing NAs anchors = data.frame(time = c(1, 4, 5, 7, 10, 20, 23, 25, 30), value = c(NA, NA, 10, 15, 12, NA, 17, 15, NA)) plot(anchors, type = 'b') anchors_ups = getSmoothContour( anchors, len = 200, interpol = 'approx', # only approx can propagate NAs NA_to_zero = FALSE, # preserve NAs discontThres = 0) # don't break into sub-contours plot(anchors_ups, type = 'b')# long format: anchors are a dataframe a = getSmoothContour(anchors = data.frame( time = c(50, 137, 300), value = c(0.03, 0.78, 0.5)), normalizeTime = FALSE, voiced = 200, valueFloor = 0, plot = TRUE, main = '', samplingRate = 16000) # breathing # short format: anchors are a vector (equal time steps assumed) a = getSmoothContour(anchors = c(350, 800, 600), len = 5500, thisIsPitch = TRUE, plot = TRUE, samplingRate = 3500) # pitch # a single anchor gives constant value a = getSmoothContour(anchors = 800, len = 500, thisIsPitch = TRUE, plot = TRUE, samplingRate = 500) # two pitch anchors give loglinear F0 change a = getSmoothContour(anchors = c(220, 440), len = 500, thisIsPitch = TRUE, plot = TRUE, samplingRate = 500) ## Two closely spaced anchors produce a pitch jump # one loess for the entire contour a1 = getSmoothContour(anchors = list(time = c(0, .15, .2, .7, 1), value = c(360, 116, 550, 700, 610)), len = 500, thisIsPitch = TRUE, plot = TRUE, samplingRate = 500) # two segments with a linear transition a2 = getSmoothContour(anchors = list(time = c(0, .15, .17, .7, 1), value = c(360, 116, 550, 700, 610)), len = 500, thisIsPitch = TRUE, plot = TRUE, samplingRate = 500) # two segments with an abrupt jump a3 = getSmoothContour(anchors = list(time = c(0, .15, .155, .7, 1), value = c(360, 116, 550, 700, 610)), len = 500, thisIsPitch = TRUE, plot = TRUE, samplingRate = 500) # compare: plot(a2) plot(a3) # NB: the segment before the jump is upsampled to compensate ## Control the amount of smoothing getSmoothContour(c(1, 3, 9, 10, 9, 9, 2), len = 100, plot = TRUE, loessSpan = NULL) # default amount of smoothing (depends on dur) getSmoothContour(c(1, 3, 9, 10, 9, 9, 2), len = 100, plot = TRUE, loessSpan = .85) # more smoothing than default getSmoothContour(c(1, 3, 9, 10, 9, 9, 2), len = 100, plot = TRUE, loessSpan = .5) # less smoothing getSmoothContour(c(1, 3, 9, 10, 9, 9, 2), len = 100, plot = TRUE, interpol = 'approx') # linear interpolation (no smoothing) ## Upsample preserving leading and trailing NAs anchors = data.frame(time = c(1, 4, 5, 7, 10, 20, 23, 25, 30), value = c(NA, NA, 10, 15, 12, NA, 17, 15, NA)) plot(anchors, type = 'b') anchors_ups = getSmoothContour( anchors, len = 200, interpol = 'approx', # only approx can propagate NAs NA_to_zero = FALSE, # preserve NAs discontThres = 0) # don't break into sub-contours plot(anchors_ups, type = 'b')
Prepares a spectral envelope for filtering a sound to add formants, lip radiation, and some stochastic component regulated by temperature. Formants are specified as a list containing time, frequency, amplitude, and width values for each formant (see examples). See vignette('sound_generation', package = 'soundgen') for more information.
getSpectralEnvelope( nr, nc, formants = NA, formantDep = 1, formantWidth = 1, lipRad = 6, noseRad = 4, mouth = NA, mouthOpenThres = 0.2, openMouthBoost = 0, vocalTract = NULL, temperature = 0.05, formDrift = 0.3, formDisp = 0.2, formantDepStoch = 1, smoothLinearFactor = 1, formantCeiling = 2, samplingRate = 16000, speedSound = 35400, smoothing = list(), output = c("simple", "detailed")[1], plot = FALSE, duration = NULL, colorTheme = c("bw", "seewave", "...")[1], col = NULL, xlab = "Time", ylab = "Frequency, kHz", ... )getSpectralEnvelope( nr, nc, formants = NA, formantDep = 1, formantWidth = 1, lipRad = 6, noseRad = 4, mouth = NA, mouthOpenThres = 0.2, openMouthBoost = 0, vocalTract = NULL, temperature = 0.05, formDrift = 0.3, formDisp = 0.2, formantDepStoch = 1, smoothLinearFactor = 1, formantCeiling = 2, samplingRate = 16000, speedSound = 35400, smoothing = list(), output = c("simple", "detailed")[1], plot = FALSE, duration = NULL, colorTheme = c("bw", "seewave", "...")[1], col = NULL, xlab = "Time", ylab = "Frequency, kHz", ... )
nr |
the number of frequency bins = windowLength_points/2, where windowLength_points is the size of window for Fourier transform |
nc |
the number of time steps for Fourier transform |
formants |
a character string like "aaui" referring to default presets
for speaker "M1"; a vector of formant frequencies; or a list of formant
times, frequencies, amplitudes, and bandwidths, with a single value of each
for static or multiple values of each for moving formants. |
formantDep |
scale factor of formant amplitude (1 = no change relative
to amplitudes in |
formantWidth |
scale factor of formant bandwidth (1 = no change) |
lipRad |
the effect of lip radiation on source spectrum, dB/oct (the default of +6 dB/oct produces a high-frequency boost when the mouth is open) |
noseRad |
the effect of radiation through the nose on source spectrum,
dB/oct (the alternative to |
mouth |
mouth opening (0 to 1, 0.5 = neutral, i.e. no modification) (anchor format) |
mouthOpenThres |
open the lips (switch from nose radiation to lip
radiation) when the mouth is open |
openMouthBoost |
amplify the voice when the mouth is open by
|
vocalTract |
the length of vocal tract, cm. Used for calculating formant
dispersion (for adding extra formants) and formant transitions as the mouth
opens and closes. If |
temperature |
hyperparameter for regulating the amount of stochasticity in sound generation |
formDrift |
scale factor regulating the effect of temperature on the depth of random drift of all formants (user-defined and stochastic): the higher, the more formants drift at a given temperature |
formDisp |
scale factor regulating the effect of temperature on the irregularity of the dispersion of stochastic formants: the higher, the more unevenly stochastic formants are spaced at a given temperature |
formantDepStoch |
multiplication factor for the amplitude of additional formants added above the highest specified formant (0 = none, 1 = default) |
smoothLinearFactor |
regulates smoothing of formant anchors (0 to +Inf)
as they are upsampled to the number of fft steps |
formantCeiling |
frequency to which stochastic formants are calculated, in multiples of the Nyquist frequency; increase up to ~10 for long vocal tracts to avoid losing energy in the upper part of the spectrum |
samplingRate |
sampling frequency, Hz |
speedSound |
speed of sound in warm air, cm/s. Stevens (2000) "Acoustic phonetics", p. 138 |
smoothing |
a list of parameters passed to
|
output |
"simple" returns just the spectral filter, while "detailed" also returns a data.frame of formant frequencies over time (needed for internal purposes such as formant locking) |
plot |
if TRUE, produces a plot of the spectral envelope |
duration |
duration of the sound, ms (for plotting purposes only) |
colorTheme |
black and white ('bw'), as in seewave package ('seewave'), or another color theme (e.g. 'heat.colors') |
col |
actual colors, eg rev(rainbow(100)) - see ?hcl.colors for colors in base R (overrides colorTheme) |
xlab, ylab
|
labels of axes |
... |
other graphical parameters passed on to |
Returns a spectral filter: a matrix with frequency bins in rows and time steps in columns. Accordingly, rownames of the output give central frequency of each bin (in kHz), while colnames give time stamps (in ms if duration is specified, otherwise 0 to 1).
# [a] with only F1-F3 visible, with no stochasticity e = getSpectralEnvelope(nr = 512, nc = 50, duration = 300, formants = soundgen:::convertStringToFormants('a'), temperature = 0, plot = TRUE, col = heat.colors(150)) # image(t(e)) # to plot the output on a linear scale instead of dB # some "wiggling" of specified formants plus extra formants on top e = getSpectralEnvelope(nr = 512, nc = 50, formants = c(860, 1430, 2900), temperature = 0.1, formantDepStoch = 1, plot = TRUE) # a schwa based on variable length of vocal tract e = getSpectralEnvelope(nr = 512, nc = 100, formants = NA, vocalTract = list(time = c(0, .4, 1), value = c(13, 18, 17)), temperature = .1, plot = TRUE) # no formants at all, only lip radiation e = getSpectralEnvelope(nr = 512, nc = 50, lipRad = 6, formants = NA, temperature = 0, plot = FALSE) plot(e[, 1], type = 'l') # linear scale plot(20 * log10(e[, 1]), type = 'l') # dB scale - 6 dB/oct # mouth opening e = getSpectralEnvelope(nr = 512, nc = 50, vocalTract = 16, plot = TRUE, lipRad = 6, noseRad = 4, mouth = data.frame(time = c(0, .5, 1), value = c(0, 0, .5))) # scale formant amplitude and/or bandwidth e1 = getSpectralEnvelope(nr = 512, nc = 50, formants = soundgen:::convertStringToFormants('a'), formantWidth = 1, formantDep = 1) # defaults e2 = getSpectralEnvelope(nr = 512, nc = 50, formants = soundgen:::convertStringToFormants('a'), formantWidth = 1.5, formantDep = 1.5) plot(as.numeric(rownames(e2)), 20 * log10(e2[, 1]), type = 'l', xlab = 'KHz', ylab = 'dB', col = 'red', lty = 2) points(as.numeric(rownames(e1)), 20 * log10(e1[, 1]), type = 'l') # manual specification of formants e3 = getSpectralEnvelope( nr = 512, nc = 50, samplingRate = 16000, plot = TRUE, formants = list( f1 = list(freq = c(900, 500), amp = c(30, 35), width = c(80, 50)), f2 = list(freq = c(1900, 2500), amp = c(25, 30), width = 100), f3 = list(freq = 3400, amp = 30, width = 120) )) # extra zero-pole pair (doesn't affect estimated VTL and thus the extra # formants added on top) e4 = getSpectralEnvelope( nr = 512, nc = 50, samplingRate = 16000, plot = TRUE, formants = list( f1 = list(freq = c(900, 500), amp = c(30, 35), width = c(80, 50)), f1.5 = list(freq = 1300, amp = -15), f1.7 = list(freq = 1500, amp = 15), f2 = list(freq = c(1900, 2500), amp = c(25, 30), width = 100), f3 = list(freq = 3400, amp = 30, width = 120) )) plot(as.numeric(rownames(e4)), 20 * log10(e3[, ncol(e3)]), type = 'l', xlab = 'KHz', ylab = 'dB') points(as.numeric(rownames(e4)), 20 * log10(e4[, ncol(e4)]), type = 'l', col = 'red', lty = 2)# [a] with only F1-F3 visible, with no stochasticity e = getSpectralEnvelope(nr = 512, nc = 50, duration = 300, formants = soundgen:::convertStringToFormants('a'), temperature = 0, plot = TRUE, col = heat.colors(150)) # image(t(e)) # to plot the output on a linear scale instead of dB # some "wiggling" of specified formants plus extra formants on top e = getSpectralEnvelope(nr = 512, nc = 50, formants = c(860, 1430, 2900), temperature = 0.1, formantDepStoch = 1, plot = TRUE) # a schwa based on variable length of vocal tract e = getSpectralEnvelope(nr = 512, nc = 100, formants = NA, vocalTract = list(time = c(0, .4, 1), value = c(13, 18, 17)), temperature = .1, plot = TRUE) # no formants at all, only lip radiation e = getSpectralEnvelope(nr = 512, nc = 50, lipRad = 6, formants = NA, temperature = 0, plot = FALSE) plot(e[, 1], type = 'l') # linear scale plot(20 * log10(e[, 1]), type = 'l') # dB scale - 6 dB/oct # mouth opening e = getSpectralEnvelope(nr = 512, nc = 50, vocalTract = 16, plot = TRUE, lipRad = 6, noseRad = 4, mouth = data.frame(time = c(0, .5, 1), value = c(0, 0, .5))) # scale formant amplitude and/or bandwidth e1 = getSpectralEnvelope(nr = 512, nc = 50, formants = soundgen:::convertStringToFormants('a'), formantWidth = 1, formantDep = 1) # defaults e2 = getSpectralEnvelope(nr = 512, nc = 50, formants = soundgen:::convertStringToFormants('a'), formantWidth = 1.5, formantDep = 1.5) plot(as.numeric(rownames(e2)), 20 * log10(e2[, 1]), type = 'l', xlab = 'KHz', ylab = 'dB', col = 'red', lty = 2) points(as.numeric(rownames(e1)), 20 * log10(e1[, 1]), type = 'l') # manual specification of formants e3 = getSpectralEnvelope( nr = 512, nc = 50, samplingRate = 16000, plot = TRUE, formants = list( f1 = list(freq = c(900, 500), amp = c(30, 35), width = c(80, 50)), f2 = list(freq = c(1900, 2500), amp = c(25, 30), width = 100), f3 = list(freq = 3400, amp = 30, width = 120) )) # extra zero-pole pair (doesn't affect estimated VTL and thus the extra # formants added on top) e4 = getSpectralEnvelope( nr = 512, nc = 50, samplingRate = 16000, plot = TRUE, formants = list( f1 = list(freq = c(900, 500), amp = c(30, 35), width = c(80, 50)), f1.5 = list(freq = 1300, amp = -15), f1.7 = list(freq = 1500, amp = 15), f2 = list(freq = c(1900, 2500), amp = c(25, 30), width = 100), f3 = list(freq = 3400, amp = 30, width = 120) )) plot(as.numeric(rownames(e4)), 20 * log10(e3[, ncol(e3)]), type = 'l', xlab = 'KHz', ylab = 'dB') points(as.numeric(rownames(e4)), 20 * log10(e4[, ncol(e4)]), type = 'l', col = 'red', lty = 2)
Tracks the unpredictability of spectro-temporal changes in a sound over time,
returning continuous contours of Shannon surprisal ($info), Bayesian
surprise ($kl for Kullback-Leibler divergence), and
autocorrelation-based surprisal ($surprisal). This is an attempt to
track auditory salience over time - that is, to identify parts of a sound
that are likely to involuntarily attract the listeners' attention.
getSurprisal( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, winSurp = 2000, input = c("audSpec", "env", "melspec", "spectrogram", "pspec")[1], takeLog = TRUE, audSpec_pars = list(nFilters = 8, step = 15, minFreq = 60), spec_pars = list(windowLength = 20, step = 20), env_pars = list(windowLength = 40, step = 20), melfcc_pars = list(windowLength = 20, step = 20, maxfreq = NULL, nbands = NULL), method = c("acf", "np")[1], sameLagAllFreqs = FALSE, weightByAmpl = TRUE, weightByPrecision = TRUE, onlyPeakAutocor = TRUE, rescale = FALSE, summaryFun = "mean", reportEvery = NULL, cores = 1, plot = TRUE, savePlots = NULL, osc = c("none", "linear", "dB")[2], heights = c(3, 1), ylim = NULL, contrast = 0.2, brightness = 0, maxPoints = c(1e+05, 5e+05), padWithSilence = TRUE, colorTheme = c("bw", "seewave", "heat.colors", "...")[1], col = NULL, extraContour = NULL, xlab = NULL, ylab = NULL, xaxp = NULL, mar = c(5.1, 4.1, 4.1, 2), main = NULL, grid = NULL, width = 900, height = 500, units = "px", res = NA, ... )getSurprisal( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, winSurp = 2000, input = c("audSpec", "env", "melspec", "spectrogram", "pspec")[1], takeLog = TRUE, audSpec_pars = list(nFilters = 8, step = 15, minFreq = 60), spec_pars = list(windowLength = 20, step = 20), env_pars = list(windowLength = 40, step = 20), melfcc_pars = list(windowLength = 20, step = 20, maxfreq = NULL, nbands = NULL), method = c("acf", "np")[1], sameLagAllFreqs = FALSE, weightByAmpl = TRUE, weightByPrecision = TRUE, onlyPeakAutocor = TRUE, rescale = FALSE, summaryFun = "mean", reportEvery = NULL, cores = 1, plot = TRUE, savePlots = NULL, osc = c("none", "linear", "dB")[2], heights = c(3, 1), ylim = NULL, contrast = 0.2, brightness = 0, maxPoints = c(1e+05, 5e+05), padWithSilence = TRUE, colorTheme = c("bw", "seewave", "heat.colors", "...")[1], col = NULL, extraContour = NULL, xlab = NULL, ylab = NULL, xaxp = NULL, mar = c(5.1, 4.1, 4.1, 2), main = NULL, grid = NULL, width = 900, height = 500, units = "px", res = NA, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
scale |
maximum possible amplitude of input used for normalization of
input vector (only needed if |
from, to
|
if NULL (default), analyzes the whole sound, otherwise from...to (s) |
winSurp |
surprisal analysis window, ms (Inf = from sound onset) |
input |
|
takeLog |
if TRUE, the input is log-transformed prior to calculating
surprisal. Negative values are treated as in |
audSpec_pars, spec_pars, melfcc_pars, env_pars
|
a list of parameters
passed to |
method |
(for $surprisal only, has no effect on $info and $kl)
|
sameLagAllFreqs |
(only for method = 'acf') if TRUE, the bestLag is calculated by averaging the ACFs of all channels, and the same bestLag is used to calculate the surprisal in each frequency channel (we expect the same "rhythm" for all frequencies); if FALSE, the bestLag is calculated separately for each frequency channel (we can track different "rhythms" at different frequencies) |
weightByAmpl |
if TRUE, ACFs and surprisal are weighted by max amplitude per frequency channel |
weightByPrecision |
if TRUE, surprisal is weighted by the current autocorrelation, so deviations from a previous pattern are more surprising if this pattern is strong |
onlyPeakAutocor |
if TRUE, only peaks of ACFs are considered (so bestLag can never be 1, and the first change after a string of static values results in surprisal = NA) |
rescale |
if TRUE, surprisal is normalized from |
summaryFun |
functions used to summarize each acoustic characteristic, eg "c('mean', 'sd')"; user-defined functions are fine (see examples); NAs are omitted automatically for mean/median/sd/min/max/range/sum, otherwise take care of NAs yourself |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
plot |
if TRUE, plots the auditory spectrogram and the
|
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
osc |
"none" = no oscillogram; "linear" = on the original scale; "dB" = in decibels |
heights |
a vector of length two specifying the relative height of the spectrogram and the oscillogram (including time axes labels) |
ylim |
frequency range to plot, kHz (defaults to 0 to Nyquist frequency). NB: still in kHz, even if yScale = bark, mel, or ERB |
contrast |
controls the sharpness or contrast of the image: <0 =
decrease contrast, 0 = no change, >0 increase contrast. Recommended range
approximately (-1, 1). The spectrogram is raised to the power of
|
brightness |
makes the image lighter or darker: <0 = darker, 0 = no change, >0 = lighter, range (-1, 1). The color palette is preserved, so "brightness" works by capping an increasing proportion of image at the lightest or darkest color. To lighten or darken the palette, just change the colors instead |
maxPoints |
the maximum number of "pixels" in the oscillogram (if any) and spectrogram; good for quickly plotting long audio files; defaults to c(1e5, 5e5); does not affect reassigned spectrograms |
padWithSilence |
if TRUE, pads the sound with just enough silence to resolve the edges properly (only the original region is plotted, so the apparent duration doesn't change) |
colorTheme |
black and white ('bw'), as in seewave package ('seewave'),
matlab-type palette ('matlab'), or any palette from
|
col |
actual colors, eg rev(rainbow(100)) - see ?hcl.colors for colors in base R (overrides colorTheme) |
extraContour |
a vector of arbitrary length scaled in Hz (regardless of yScale, but nonlinear yScale also warps the contour) that will be plotted over the spectrogram (eg pitch contour); can also be a list with extra graphical parameters such as lwd, col, etc. (see examples) |
xlab, ylab, main, mar, xaxp
|
graphical parameters for plotting |
grid |
if numeric, adds n = |
width, height, units, res
|
graphical parameters for saving plots passed to
|
... |
other graphical parameters |
Algorithm: the sound is transformed into some spectrogram-like representation (e.g., an auditory spectrogram, a mel-warped STFT spectrogram, etc.) or an RMS amplitude envelope. Using just the envelope is very fast, but then we discard all spectral information. For each frequency channel, a sliding window is analyzed to compare the actually observed final value with its expected value. There are many ways to extrapolate / predict time series and thus perform this comparison. The resulting per-channel surprisal contours are aggregated by taking their mean - optionally, weighted by the maximum amplitude of each frequency channel across the analysis window. Because increases in loudness are known to be important predictors of auditory salience, loudness per frame is also returned, as well as the product of its positive changes and surprisal.
Returns a list with surprisal statistics per frame ($detailed) and per file ($summary). Calculated measures:
subjective loudness in sone, as per
getLoudness
surprisal calculated as the change in autocorrelation or as the nonlinear prediction error
the product of surprisal and the first derivative of loudness with respect to time, treating negative values of dLoudness as zero
Shannon information calculated as -log(p), where p = density of Gaussian distribution at the next observation
windowed Shannon information: same as "info", but after applying a half-Gaussian taper that prioritizes more recent observations
Bayesian log-surprisal: Kullback–Leibler divergence between the Gaussian distributions per frequency channel before vs. after observing the next datapoint
windowed Bayesian log-surprisal
Under
$detailed, the function also returns several "_mat" objects that
give the same statistics with a separate value for each time-frequency bin,
as well as the best lag used to calculate autocorrelation (see examples).
# A quick example s = soundgen(nSyl = 2, sylLen = 50, pauseLen = 25, addSilence = 15) surp = getSurprisal(s, samplingRate = 16000) surp ## Not run: # A couple of more meaningful examples ## Example 1: a temporal deviant s0 = soundgen(nSyl = 8, sylLen = 150, pauseLen = c(rep(200, 7), 450), pitch = c(200, 150), temperature = .05, plot = FALSE) sound = c(rep(0, 4000), addVectors(rnorm(16000 * 3.5, 0, .02), s0, insertionPoint = 4000), rep(0, 4000)) spectrogram(sound, 16000, yScale = 'ERB') # long window (Inf = from the beginning) surp = getSurprisal(sound, 16000, winSurp = Inf) # Which frequency-time bins are surprising? filled.contour(x = as.numeric(colnames(surp$detailed$surprisal_mat)) / 1000, y = as.numeric(rownames(surp$detailed$surprisal_mat)), z = t(surp$detailed$surprisal_mat), xlab = 'Time, s', ylab = 'Frequency, kHz') hist(surp$detailed$bestLag, xlab = 'Period, s') abline(v = .35, lty = 3, lwd = 3, col = 'blue') # true period = 350 ms filled.contour(x = as.numeric(colnames(surp$detailed$bestLag)) / 1000, y = as.numeric(rownames(surp$detailed$bestLag)), z = t(surp$detailed$bestLag), xlab = 'Time, s', ylab = 'Frequency, kHz') # just use the amplitude envelope instead of an auditory spectrogram surp = getSurprisal(sound, 16000, winSurp = Inf, input = 'env') # increase spectral and temporal resolution (very slow) surp = getSurprisal(sound, 16000, winSurp = 2000, audSpec_pars = list(nFilters = 50, step = 10, yScale = 'bark', bandwidth = 1/4)) # weight by increase in loudness spectrogram(sound, 16000, extraContour = surp$detailed$surprisalLoudness / max(surp$detailed$surprisalLoudness, na.rm = TRUE) * 8000) par(mfrow = c(3, 1)) plot(surp$detailed$surprisal, type = 'l', xlab = '', ylab = '', main = 'surprisal') abline(h = 0, lty = 2) plot(surp$detailed$dLoudness, type = 'l', xlab = '', ylab = '', main = 'd-loudness') abline(h = 0, lty = 2) plot(surp$detailed$surprisalLoudness, type = 'l', xlab = '', ylab = '', main = 'surprisal * d-loudness') par(mfrow = c(1, 1)) # short window = amnesia (every event is equally surprising) getSurprisal(sound, 16000, winSurp = 250) # add bells and whistles surp = getSurprisal(sound, samplingRate = 16000, yScale = 'mel', osc = 'dB', # plot oscillogram in dB heights = c(2, 1), # spectro/osc height ratio brightness = -.1, # reduce brightness # colorTheme = 'heat.colors', # pick color theme... col = rev(hcl.colors(30, palette = 'Viridis')), # ...or specify the colors cex.lab = .75, cex.axis = .75, # text size and other base graphics pars ylim = c(0, 5), # always in kHz main = 'Audiogram with surprisal contour', # title extraContour = list(col = 'blue', lty = 2, lwd = 2) # + axis labels, etc ) ## Example 2: a spectral deviant s1 = soundgen( nSyl = 11, sylLen = 150, invalidArgAction = 'ignore', formants = NULL, lipRad = 0, # so all syls have the same envelope pauseLen = 90, pitch = c(1000, 750), rolloff = -20, pitchGlobal = c(rep(0, 5), 18, rep(0, 5)), temperature = .01, pitchCeiling = 7000, plot = TRUE, windowLength = 35) surp = getSurprisal(s1, 16000, winSurp = 1500) filled.contour(x = as.numeric(colnames(surp$detailed$surprisal_mat)) / 1000, y = as.numeric(rownames(surp$detailed$surprisal_mat)), z = t(surp$detailed$surprisal_mat), xlab = 'Time, s', ylab = 'Frequency, kHz') # deviant surprising both at 1 kHz (expected tone omitted) and at the new freq surp = getSurprisal(s1, 16000, winSurp = 1500, input = 'env') # doesn't work - need spectral info s2 = soundgen( nSyl = 11, sylLen = 150, invalidArgAction = 'ignore', formants = NULL, lipRad = 0, # so all syls have the same envelope pauseLen = 90, pitch = c(200, 150), rolloff = -20, pitchGlobal = c(rep(18, 5), 0, rep(18, 5)), temperature = .01, plot = TRUE, windowLength = 35, yScale = 'ERB') surp = getSurprisal(s2, 16000, winSurp = 1500) ## Example 3: different rhythms in different frequency bins s6_1 = soundgen(nSyl = 23, sylLen = 100, pauseLen = 50, pitch = 1200, rolloffExact = 1, invalidArgAction = 'ignore', plot = TRUE) s6_2 = soundgen(nSyl = 10, sylLen = 250, pauseLen = 100, pitch = 400, rolloffExact = 1, invalidArgAction = 'ignore', plot = TRUE) s6_3 = soundgen(nSyl = 5, sylLen = 400, pauseLen = 200, pitch = 3400, rolloffExact = 1, invalidArgAction = 'ignore', plot = TRUE) s6 = addVectors(s6_1, s6_2) s6 = addVectors(s6, s6_3) surp = getSurprisal(s6, 16000, winSurp = Inf, sameLagAllFreqs = TRUE, audSpec_pars = list(nFilters = 32)) surp = getSurprisal(s6, 16000, winSurp = Inf, sameLagAllFreqs = FALSE, audSpec_pars = list(nFilters = 32)) # learns all 3 rhythms filled.contour(x = as.numeric(colnames(surp$detailed$surprisal_mat)) / 1000, y = as.numeric(rownames(surp$detailed$surprisal_mat)), z = t(surp$detailed$surprisal_mat), xlab = 'Time, s', ylab = 'Frequency, kHz') ## Example 4: different time scales s8 = soundgen(nSyl = 4, sylLen = 75, pauseLen = 50) s8 = rep(c(s8, rep(0, 2000)), 8) getSurprisal(s8, 16000, input = 'env', winSurp = Inf) # ACF picks up first the fast rhythm, then after a few cycles switches to # the slow rhythm # Custom input: produce a nice spectrogram first, then feed it into ssm() sp = spectrogram(s0, 16000, windowLength = 10, step = 10, contrast = .3, output = 'processed') # return the modified spectrogram colnames(sp) = as.numeric(colnames(sp)) / 1000 # convert ms to s getSurprisal(s0, 16000, input = sp, takeLog = FALSE) # Custom input: use acoustic features returned by analyze() an = analyze(s0, 16000, windowLength = 20) input_an = t(an$detailed[, 4:ncol(an$detailed)]) # or select pitch, HNR, ... input_an = t(apply(input_an, 1, scale)) # z-transform all variables input_an[is.na(input_an)] = 0 # get rid of NAs colnames(input_an) = an$detailed$time / 1000 # time stamps in s rownames(input_an) = 1:nrow(input_an) image(t(input_an)) # not a spectrogram, just a feature matrix getSurprisal(s0, 16000, input = input_an, takeLog = FALSE) # analyze all sounds in a folder surp = getSurprisal('~/Downloads/temp/', savePlots = '~/Downloads/temp/surp') surp$summary ## End(Not run)# A quick example s = soundgen(nSyl = 2, sylLen = 50, pauseLen = 25, addSilence = 15) surp = getSurprisal(s, samplingRate = 16000) surp ## Not run: # A couple of more meaningful examples ## Example 1: a temporal deviant s0 = soundgen(nSyl = 8, sylLen = 150, pauseLen = c(rep(200, 7), 450), pitch = c(200, 150), temperature = .05, plot = FALSE) sound = c(rep(0, 4000), addVectors(rnorm(16000 * 3.5, 0, .02), s0, insertionPoint = 4000), rep(0, 4000)) spectrogram(sound, 16000, yScale = 'ERB') # long window (Inf = from the beginning) surp = getSurprisal(sound, 16000, winSurp = Inf) # Which frequency-time bins are surprising? filled.contour(x = as.numeric(colnames(surp$detailed$surprisal_mat)) / 1000, y = as.numeric(rownames(surp$detailed$surprisal_mat)), z = t(surp$detailed$surprisal_mat), xlab = 'Time, s', ylab = 'Frequency, kHz') hist(surp$detailed$bestLag, xlab = 'Period, s') abline(v = .35, lty = 3, lwd = 3, col = 'blue') # true period = 350 ms filled.contour(x = as.numeric(colnames(surp$detailed$bestLag)) / 1000, y = as.numeric(rownames(surp$detailed$bestLag)), z = t(surp$detailed$bestLag), xlab = 'Time, s', ylab = 'Frequency, kHz') # just use the amplitude envelope instead of an auditory spectrogram surp = getSurprisal(sound, 16000, winSurp = Inf, input = 'env') # increase spectral and temporal resolution (very slow) surp = getSurprisal(sound, 16000, winSurp = 2000, audSpec_pars = list(nFilters = 50, step = 10, yScale = 'bark', bandwidth = 1/4)) # weight by increase in loudness spectrogram(sound, 16000, extraContour = surp$detailed$surprisalLoudness / max(surp$detailed$surprisalLoudness, na.rm = TRUE) * 8000) par(mfrow = c(3, 1)) plot(surp$detailed$surprisal, type = 'l', xlab = '', ylab = '', main = 'surprisal') abline(h = 0, lty = 2) plot(surp$detailed$dLoudness, type = 'l', xlab = '', ylab = '', main = 'd-loudness') abline(h = 0, lty = 2) plot(surp$detailed$surprisalLoudness, type = 'l', xlab = '', ylab = '', main = 'surprisal * d-loudness') par(mfrow = c(1, 1)) # short window = amnesia (every event is equally surprising) getSurprisal(sound, 16000, winSurp = 250) # add bells and whistles surp = getSurprisal(sound, samplingRate = 16000, yScale = 'mel', osc = 'dB', # plot oscillogram in dB heights = c(2, 1), # spectro/osc height ratio brightness = -.1, # reduce brightness # colorTheme = 'heat.colors', # pick color theme... col = rev(hcl.colors(30, palette = 'Viridis')), # ...or specify the colors cex.lab = .75, cex.axis = .75, # text size and other base graphics pars ylim = c(0, 5), # always in kHz main = 'Audiogram with surprisal contour', # title extraContour = list(col = 'blue', lty = 2, lwd = 2) # + axis labels, etc ) ## Example 2: a spectral deviant s1 = soundgen( nSyl = 11, sylLen = 150, invalidArgAction = 'ignore', formants = NULL, lipRad = 0, # so all syls have the same envelope pauseLen = 90, pitch = c(1000, 750), rolloff = -20, pitchGlobal = c(rep(0, 5), 18, rep(0, 5)), temperature = .01, pitchCeiling = 7000, plot = TRUE, windowLength = 35) surp = getSurprisal(s1, 16000, winSurp = 1500) filled.contour(x = as.numeric(colnames(surp$detailed$surprisal_mat)) / 1000, y = as.numeric(rownames(surp$detailed$surprisal_mat)), z = t(surp$detailed$surprisal_mat), xlab = 'Time, s', ylab = 'Frequency, kHz') # deviant surprising both at 1 kHz (expected tone omitted) and at the new freq surp = getSurprisal(s1, 16000, winSurp = 1500, input = 'env') # doesn't work - need spectral info s2 = soundgen( nSyl = 11, sylLen = 150, invalidArgAction = 'ignore', formants = NULL, lipRad = 0, # so all syls have the same envelope pauseLen = 90, pitch = c(200, 150), rolloff = -20, pitchGlobal = c(rep(18, 5), 0, rep(18, 5)), temperature = .01, plot = TRUE, windowLength = 35, yScale = 'ERB') surp = getSurprisal(s2, 16000, winSurp = 1500) ## Example 3: different rhythms in different frequency bins s6_1 = soundgen(nSyl = 23, sylLen = 100, pauseLen = 50, pitch = 1200, rolloffExact = 1, invalidArgAction = 'ignore', plot = TRUE) s6_2 = soundgen(nSyl = 10, sylLen = 250, pauseLen = 100, pitch = 400, rolloffExact = 1, invalidArgAction = 'ignore', plot = TRUE) s6_3 = soundgen(nSyl = 5, sylLen = 400, pauseLen = 200, pitch = 3400, rolloffExact = 1, invalidArgAction = 'ignore', plot = TRUE) s6 = addVectors(s6_1, s6_2) s6 = addVectors(s6, s6_3) surp = getSurprisal(s6, 16000, winSurp = Inf, sameLagAllFreqs = TRUE, audSpec_pars = list(nFilters = 32)) surp = getSurprisal(s6, 16000, winSurp = Inf, sameLagAllFreqs = FALSE, audSpec_pars = list(nFilters = 32)) # learns all 3 rhythms filled.contour(x = as.numeric(colnames(surp$detailed$surprisal_mat)) / 1000, y = as.numeric(rownames(surp$detailed$surprisal_mat)), z = t(surp$detailed$surprisal_mat), xlab = 'Time, s', ylab = 'Frequency, kHz') ## Example 4: different time scales s8 = soundgen(nSyl = 4, sylLen = 75, pauseLen = 50) s8 = rep(c(s8, rep(0, 2000)), 8) getSurprisal(s8, 16000, input = 'env', winSurp = Inf) # ACF picks up first the fast rhythm, then after a few cycles switches to # the slow rhythm # Custom input: produce a nice spectrogram first, then feed it into ssm() sp = spectrogram(s0, 16000, windowLength = 10, step = 10, contrast = .3, output = 'processed') # return the modified spectrogram colnames(sp) = as.numeric(colnames(sp)) / 1000 # convert ms to s getSurprisal(s0, 16000, input = sp, takeLog = FALSE) # Custom input: use acoustic features returned by analyze() an = analyze(s0, 16000, windowLength = 20) input_an = t(an$detailed[, 4:ncol(an$detailed)]) # or select pitch, HNR, ... input_an = t(apply(input_an, 1, scale)) # z-transform all variables input_an[is.na(input_an)] = 0 # get rid of NAs colnames(input_an) = an$detailed$time / 1000 # time stamps in s rownames(input_an) = 1:nrow(input_an) image(t(input_an)) # not a spectrogram, just a feature matrix getSurprisal(s0, 16000, input = input_an, takeLog = FALSE) # analyze all sounds in a folder surp = getSurprisal('~/Downloads/temp/', savePlots = '~/Downloads/temp/surp') surp$summary ## End(Not run)
Typical relative frequencies of the first four formants measured in dF units (average spacing between formants, or formant dispersion) above or below schwa based on estimated VTL in American English, from Hillenbrand (1995), who measured F1-F4 in ~1.5K recordings (139 speakers, 12 vowels from each). Audio and formant measurements are freely available online: https://homepages.wmich.edu/~hillenbr/voweldata.html. The dataset below is the result of modeling Hillenbrand's data with brms: mvbind(F1rel, F2rel) ~ vowel + (vowel|speaker). It shows the most credible location of each vowel centroid in the F1Rel-F2Rel space.
hillenbrandhillenbrand
An object of class data.frame with 12 rows and 5 columns.
A dataframe of 12 observations and 5 columns: "vowel" = vowel (American
English), "F1Rel" to "F4Rel" = formant frequencies in dF relative to their
neutral, equidistant positions in a perfectly cylindrical vocal tract. See
schwa - this is what schwa() returns as $ff_relative_dF
Hillenbrand, J., Getty, L. A., Clark, M. J., & Wheeler, K. (1995). Acoustic characteristics of American English vowels. The Journal of the Acoustical society of America, 97(5), 3099-3111.
plot(hillenbrand$F1Rel, hillenbrand$F2Rel, type = 'n') text(hillenbrand$F1Rel, hillenbrand$F2Rel, labels = hillenbrand$vowel)plot(hillenbrand$F1Rel, hillenbrand$F2Rel, type = 'n') text(hillenbrand$F1Rel, hillenbrand$F2Rel, labels = hillenbrand$vowel)
Converts from Hz to the number of Equivalent Rectangular Bandwidths (ERBs) below input frequency. See https://www2.ling.su.se/staff/hartmut/bark.htm and https://en.wikipedia.org/wiki/Equivalent_rectangular_bandwidth
HzToERB(x, method = c("linear", "quadratic")[1]) ERBToHz(x, method = c("linear", "quadratic")[1])HzToERB(x, method = c("linear", "quadratic")[1]) ERBToHz(x, method = c("linear", "quadratic")[1])
x |
vector or matrix of frequencies |
method |
approximation to use: "linear" = Glasberg & Moore (1990), "quadratic" = Moore & Glasberg (1983) |
ERBToHz(): Convert ERB rate to Hz
Moore, B. C., & Glasberg, B. R. (1983). Suggested formulae for calculating auditory-filter bandwidths and excitation patterns. The journal of the acoustical society of America, 74(3), 750-753.
Glasberg, B. R., & Moore, B. C. (1990). Derivation of auditory filter shapes from notched-noise data. Hearing research, 47(1-2), 103-138.
HzToERB(c(-20, 20, 100, 440, 1000, NA)) f = 20:20000 erb_lin = HzToERB(f, 'linear') erb_quadratic = HzToERB(f, 'quadratic') plot(f, erb_lin, log = 'x', type = 'l') points(f, erb_quadratic, col = 'blue', type = 'l') freqs_Hz = c(-20, 20, 100, 440, 1000, 20000, NA) e_lin = HzToERB(freqs_Hz, 'linear') ERBToHz(e_lin, 'linear') e_quad = HzToERB(freqs_Hz, 'quadratic') ERBToHz(e_quad, 'quadratic') # compare with the bark scale: barks = HzToOther(f, 'bark') points(f, barks / max(barks) * max(erb_lin), col = 'red', type = 'l', lty = 2)HzToERB(c(-20, 20, 100, 440, 1000, NA)) f = 20:20000 erb_lin = HzToERB(f, 'linear') erb_quadratic = HzToERB(f, 'quadratic') plot(f, erb_lin, log = 'x', type = 'l') points(f, erb_quadratic, col = 'blue', type = 'l') freqs_Hz = c(-20, 20, 100, 440, 1000, 20000, NA) e_lin = HzToERB(freqs_Hz, 'linear') ERBToHz(e_lin, 'linear') e_quad = HzToERB(freqs_Hz, 'quadratic') ERBToHz(e_quad, 'quadratic') # compare with the bark scale: barks = HzToOther(f, 'bark') points(f, barks / max(barks) * max(erb_lin), col = 'red', type = 'l', lty = 2)
Converts from Hz to musical notation like A4 - note A of the fourth octave above C0 (16.35 Hz).
HzToNotes(x, showCents = FALSE, A4 = 440) notesToHz(x, A4 = 440)HzToNotes(x, showCents = FALSE, A4 = 440) notesToHz(x, A4 = 440)
x |
vector or matrix of frequencies or notes |
showCents |
if TRUE, show cents to the nearest notes (cent = 1/100 of a semitone) |
A4 |
frequency of note A in the fourth octave (modern standard ISO 16 or concert pitch = 440 Hz) |
notesToHz(): Convert notes to Hz
HzToNotes(c(440, 293, 115, 16.35, 4)) notesToHz(c("A4", "D4", "A#2", "C0", "C-2")) HzToNotes(c(440, 415, 80, 81), showCents = TRUE) # 80 Hz is almost exactly midway (+49 cents) between D#2 and E2 # Baroque tuning A415, half a semitone flat relative to concert pitch A440 HzToNotes(c(440, 415, 16.35), A4 = 415) notesToHz(c("A4", "D4", "A#2", "C0", "C-2"), A4 = 415)HzToNotes(c(440, 293, 115, 16.35, 4)) notesToHz(c("A4", "D4", "A#2", "C0", "C-2")) HzToNotes(c(440, 415, 80, 81), showCents = TRUE) # 80 Hz is almost exactly midway (+49 cents) between D#2 and E2 # Baroque tuning A415, half a semitone flat relative to concert pitch A440 HzToNotes(c(440, 415, 16.35), A4 = 415) notesToHz(c("A4", "D4", "A#2", "C0", "C-2"), A4 = 415)
Converts betwen Hz and ERB, bark, mel, log, semitones relative to a reference frequency, or musical notes. Accepts vectors and missing values.
HzToOther( x, scale = c("ERB", "bark", "mel", "log", "semitones", "notes")[1], ... ) otherToHz( x, scale = c("ERB", "bark", "mel", "log", "semitones", "notes")[1], ... )HzToOther( x, scale = c("ERB", "bark", "mel", "log", "semitones", "notes")[1], ... ) otherToHz( x, scale = c("ERB", "bark", "mel", "log", "semitones", "notes")[1], ... )
x |
vector or matrix of frequencies |
scale |
target scale: "bark" = Zwicker's critical bandwidth scale
calculated as in Wang et al. 1992 (see
https://en.wikipedia.org/wiki/Bark_scale), "mel" = O'Shaughnessy's original
formula (https://en.wikipedia.org/wiki/Mel_scale), "ERB" = Equivalent
Rectangular Bandwidth rate (see |
... |
other arguments passed on to the scale-specific function |
HzToSemitones HzToNotes
HzToERB
x = c(-20, 20, 100, 440, 1000, NA) HzToOther(x, 'ERB') HzToOther(x, 'ERB', 'quadratic') HzToOther(x, 'bark') HzToOther(x, 'mel') HzToOther(x, 'log') HzToOther(x, 'semitones', ref = 16) HzToOther(x, 'notes', showCents = TRUE) # ...and back to Hz x = c(0:10, NA) otherToHz(x, 'ERB') otherToHz(x, 'ERB', method = 'quadratic') otherToHz(HzToOther(c(100, 440, 2000), 'ERB'), 'ERB') otherToHz(x, 'bark') otherToHz(HzToOther(c(100, 440, 2000), 'bark'), 'bark') otherToHz(x, 'mel') otherToHz(HzToOther(c(100, 440, 2000), 'mel'), 'mel') otherToHz(x, 'log') otherToHz(x, 'semitones') HzToOther(c(440, 210, 880), 'semitones', ref = 440) otherToHz(HzToOther(c(440, 210, 880), 'semitones'), 'semitones') otherToHz(c('A4', 'C#6', 'blabla', NA), 'notes')x = c(-20, 20, 100, 440, 1000, NA) HzToOther(x, 'ERB') HzToOther(x, 'ERB', 'quadratic') HzToOther(x, 'bark') HzToOther(x, 'mel') HzToOther(x, 'log') HzToOther(x, 'semitones', ref = 16) HzToOther(x, 'notes', showCents = TRUE) # ...and back to Hz x = c(0:10, NA) otherToHz(x, 'ERB') otherToHz(x, 'ERB', method = 'quadratic') otherToHz(HzToOther(c(100, 440, 2000), 'ERB'), 'ERB') otherToHz(x, 'bark') otherToHz(HzToOther(c(100, 440, 2000), 'bark'), 'bark') otherToHz(x, 'mel') otherToHz(HzToOther(c(100, 440, 2000), 'mel'), 'mel') otherToHz(x, 'log') otherToHz(x, 'semitones') HzToOther(c(440, 210, 880), 'semitones', ref = 440) otherToHz(HzToOther(c(440, 210, 880), 'semitones'), 'semitones') otherToHz(c('A4', 'C#6', 'blabla', NA), 'notes')
Converts between Hz and semitones above C-5 (~0.5109875 Hz) or another reference frequency. This may not seem very useful, but note that this gives us a nice logarithmic scale for generating natural pitch transitions. Accepts vectors and missing values.
HzToSemitones(x, ref = 0.5109875) semitonesToHz(x, ref = 0.5109875)HzToSemitones(x, ref = 0.5109875) semitonesToHz(x, ref = 0.5109875)
x |
A vector or matrix of frequencies |
ref |
frequency of the reference value (defaults to C-5, 0.51 Hz) |
s = HzToSemitones(c(440, 293, 115)) # to convert to musical notation notesDict$note[1 + round(s)] # note the "1 +": semitones ABOVE C-5, i.e. notesDict[1, ] is C-5 # Any reference tone can be specified. For ex., for semitones above C0, use: HzToSemitones(440, ref = 16.35) # TIP: see notesDict for a table of Hz frequencies to musical notation semitonesToHz(c(117, 105, 60))s = HzToSemitones(c(440, 293, 115)) # to convert to musical notation notesDict$note[1 + round(s)] # note the "1 +": semitones ABOVE C-5, i.e. notesDict[1, ] is C-5 # Any reference tone can be specified. For ex., for semitones above C0, use: HzToSemitones(440, ref = 16.35) # TIP: see notesDict for a table of Hz frequencies to musical notation semitonesToHz(c(117, 105, 60))
Transforms a spectrogram into a time series with inverse STFT. The problem is that an ordinary spectrogram preserves only the magnitude (modulus) of the complex STFT, while the phase is lost, and without phase it is impossible to reconstruct the original audio accurately. So there are a number of algorithms for "guessing" the phase that would produce an audio whose magnitude spectrogram is very similar to the target spectrogram. Useful for certain filtering operations that modify the magnitude spectrogram followed by inverse STFT, such as filtering in the spectrotemporal modulation domain.
invertSpectrogram( spec, samplingRate, windowLength, overlap, step = NULL, wn = "hanning", specType = c("abs", "log", "dB")[1], initialPhase = c("zero", "random", "spsi")[3], nIter = 50, normalize = TRUE, play = TRUE, verbose = FALSE, plotError = TRUE )invertSpectrogram( spec, samplingRate, windowLength, overlap, step = NULL, wn = "hanning", specType = c("abs", "log", "dB")[1], initialPhase = c("zero", "random", "spsi")[3], nIter = 50, normalize = TRUE, play = TRUE, verbose = FALSE, plotError = TRUE )
spec |
the spectrogram that is to be transform to a time series: numeric matrix with frequency bins in rows and time frames in columns |
samplingRate |
sampling rate of |
windowLength |
length of FFT window, ms (multiple values in a vector produce a multi-resolution spectrogram) |
overlap |
overlap between successive FFT frames, % |
step |
you can override |
wn |
window type accepted by |
specType |
the scale of target spectroram: 'abs' = absolute, 'log' = log-transformed, 'dB' = in decibels |
initialPhase |
initial phase estimate: "zero" = set all phases to zero; "random" = Gaussian noise; "spsi" (default) = single-pass spectrogram inversion (Beauregard et al., 2015) |
nIter |
the number of iterations of the GL algorithm (Griffin & Lim, 1984), 0 = don't run |
normalize |
if TRUE, normalizes the output to range from -1 to +1 |
play |
if TRUE, plays back the reconstructed audio |
verbose |
if TRUE, prints estimated time left every 10% of GL iterations |
plotError |
if TRUE, produces a scree plot of squared error over GL iterations (useful for choosing 'nIter') |
Algorithm: takes the spectrogram, makes an initial guess at the phase (zero, noise, or a more intelligent estimate by the SPSI algorithm), fine-tunes over 'nIter' iterations with the GL algorithm, reconstructs the complex spectrogram using the best phase estimate, and performs inverse STFT. The single-pass spectrogram inversion (SPSI) algorithm is implemented as described in Beauregard et al. (2015) following the python code at https://github.com/lonce/SPSI_Python. The Griffin-Lim (GL) algorithm is based on Griffin & Lim (1984).
Returns the reconstructed audio as a numeric vector.
Griffin, D., & Lim, J. (1984). Signal estimation from modified short-time Fourier transform. IEEE Transactions on Acoustics, Speech, and Signal Processing, 32(2), 236-243.
Beauregard, G. T., Harish, M., & Wyse, L. (2015, July). Single pass spectrogram inversion. In 2015 IEEE International Conference on Digital Signal Processing (DSP) (pp. 427-431). IEEE.
# Create a spectrogram samplingRate = 16000 windowLength = 40 overlap = 75 wn = 'gaussian' s = soundgen(samplingRate = samplingRate, addSilence = 100) spec = spectrogram(s, samplingRate = samplingRate, wn = wn, windowLength = windowLength, step = NULL, overlap = overlap, padWithSilence = FALSE, output = 'original') # Invert the spectrogram, attempting to guess the phase # Note that samplingRate, wn, windowLength, and overlap must be the same as # in the original (ie you have to know how the spectrogram was created) s_new = invertSpectrogram(spec, samplingRate = samplingRate, windowLength = windowLength, overlap = overlap, wn = wn, initialPhase = 'spsi', nIter = 100, specType = 'abs', play = FALSE) # Verify the quality of audio reconstruction # playme(s, samplingRate); playme(s_new, samplingRate)# Create a spectrogram samplingRate = 16000 windowLength = 40 overlap = 75 wn = 'gaussian' s = soundgen(samplingRate = samplingRate, addSilence = 100) spec = spectrogram(s, samplingRate = samplingRate, wn = wn, windowLength = windowLength, step = NULL, overlap = overlap, padWithSilence = FALSE, output = 'original') # Invert the spectrogram, attempting to guess the phase # Note that samplingRate, wn, windowLength, and overlap must be the same as # in the original (ie you have to know how the spectrogram was created) s_new = invertSpectrogram(spec, samplingRate = samplingRate, windowLength = windowLength, overlap = overlap, wn = wn, initialPhase = 'spsi', nIter = 100, specType = 'abs', play = FALSE) # Verify the quality of audio reconstruction # playme(s, samplingRate); playme(s_new, samplingRate)
Attempts to find settings for soundgen that will reproduce an
existing sound. The principle is to mutate control parameters, trying to
improve fit to target. The currently implemented optimization algorithm is
simple hill climbing. Disclaimer: this function is experimental and may or
may not work for particular tasks. It is intended as a supplement to - not
replacement of - manual optimization. See vignette('sound_generation',
package = 'soundgen') for more information.
matchPars( target, samplingRate = NULL, pars = NULL, init = NULL, probMutation = 0.25, stepVariance = 0.1, maxIter = 50, minExpectedDelta = 0.001, compareSoundsPars = list(), verbose = TRUE )matchPars( target, samplingRate = NULL, pars = NULL, init = NULL, probMutation = 0.25, stepVariance = 0.1, maxIter = 50, minExpectedDelta = 0.001, compareSoundsPars = list(), verbose = TRUE )
target |
the sound we want to reproduce using soundgen: path to a .wav file or numeric vector |
samplingRate |
sampling rate of |
pars |
arguments to |
init |
a list of initial values for the optimized parameters |
probMutation |
the probability of a parameter mutating per iteration |
stepVariance |
scale factor for calculating the size of mutations |
maxIter |
maximum number of mutated sounds produced without improving the fit to target |
minExpectedDelta |
minimum improvement in fit to target required to accept the new sound candidate |
compareSoundsPars |
a list of control parameters passed to
|
verbose |
if TRUE, plays back the accepted candidate at each iteration and reports the outcome |
Returns a list of length 2: $history contains the tried
parameter values together with their fit to target ($history$sim),
and $pars contains a list of the final - hopefully the best -
parameter settings.
## Not run: target = soundgen(sylLen = 600, pitch = c(300, 200), rolloff = -15, play = TRUE, plot = TRUE) # we hope to reproduce this sound # Match pars based on acoustic analysis alone, without any optimization. # This *MAY* match temporal structure, pitch, and stationary formants m1 = matchPars(target = target, samplingRate = 16000, maxIter = 0, # no optimization, only acoustic analysis verbose = TRUE) cand1 = do.call(soundgen, c(m1$pars, list( temperature = 0.001, play = TRUE, plot = TRUE))) # Try to improve the match by optimizing rolloff # (this may take a few minutes to run, and the results may vary) m2 = matchPars(target = target, samplingRate = 16000, pars = 'rolloff', maxIter = 100, verbose = TRUE) # rolloff should be moving from default (-9) to target (-15): sapply(m2$history, function(x) x$pars$rolloff) cand2 = do.call(soundgen, c(m2$pars, list(play = TRUE, plot = TRUE))) ## End(Not run)## Not run: target = soundgen(sylLen = 600, pitch = c(300, 200), rolloff = -15, play = TRUE, plot = TRUE) # we hope to reproduce this sound # Match pars based on acoustic analysis alone, without any optimization. # This *MAY* match temporal structure, pitch, and stationary formants m1 = matchPars(target = target, samplingRate = 16000, maxIter = 0, # no optimization, only acoustic analysis verbose = TRUE) cand1 = do.call(soundgen, c(m1$pars, list( temperature = 0.001, play = TRUE, plot = TRUE))) # Try to improve the match by optimizing rolloff # (this may take a few minutes to run, and the results may vary) m2 = matchPars(target = target, samplingRate = 16000, pars = 'rolloff', maxIter = 100, verbose = TRUE) # rolloff should be moving from default (-9) to target (-15): sapply(m2$history, function(x) x$pars$rolloff) cand2 = do.call(soundgen, c(m2$pars, list(play = TRUE, plot = TRUE))) ## End(Not run)
Produces a modulation spectrum of waveform(s) or audio file(s). It begins
with some spectrogram-like time-frequency representation and analyzes the
modulation of the envelope in each frequency band. if specSource =
'audSpec', the sound is passed through a bank of bandpass filters with
audSpectrogram. If specSource = 'STFT', we begin with an
ordinary spectrogram produced with a Short-Time Fourier Transform. If
msType = '2D', the modulation spectrum is a 2D Fourier transform of
the spectrogram-like representation, with temporal modulation along the X
axis and spectral modulation along the Y axis. A good visual analogy is
decomposing the spectrogram into a sum of ripples of various frequencies and
directions. If msType = '1D', the modulation spectrum is a matrix
containing 1D Fourier transforms of each frequency band in the spectrogram,
so the result again has modulation frequencies along the X axis, but the Y
axis now shows the frequency of each analyzed band. Roughness is calculated
as the proportion of the modulation spectrum within roughRange of
temporal modulation frequencies or some weighted version thereof. The
frequency of amplitude modulation (amMsFreq, Hz) is calculated as the highest
peak in the smoothed AM function, and its purity (amMsPurity, dB) as the
ratio of this peak to the median AM over amRange. For relatively short
and steady sounds, set amRes = NULL and analyze the entire sound. For
longer sounds and when roughness or AM vary over time, set amRes to
get multiple measurements over time (see examples). For multiple inputs, such
as a list of waveforms or path to a folder with audio files, the ensemble of
modulation spectra can be interpolated to the same spectral and temporal
resolution and averaged (if averageMS = TRUE).
modulationSpectrum( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, msType = c("1D", "2D")[2], specSource = c("STFT", "audSpec")[1], windowLength = 15, step = 1, wn = "hanning", zp = 0, audSpec_pars = list(filterType = "butterworth", nFilters = 32, bandwidth = 1/24, yScale = "bark", dynamicRange = 120), amRes = 5, maxDur = 5, specMethod = c("spec", "meanspec")[2], logSpec = FALSE, logMPS = FALSE, power = 1, normalize = TRUE, roughRange = c(30, 150), roughMean = NULL, roughSD = NULL, roughMinFreq = 1, amRange = c(10, 200), returnMS = TRUE, returnComplex = FALSE, summaryFun = c("mean", "median", "sd"), averageMS = FALSE, reportEvery = NULL, cores = 1, plot = TRUE, savePlots = NULL, logWarpX = NULL, logWarpY = NULL, quantiles = c(0.5, 0.8, 0.9), kernelSize = 5, kernelSD = 0.5, colorTheme = c("bw", "seewave", "heat.colors", "...")[1], col = NULL, main = NULL, xlab = "Hz", ylab = NULL, xlim = NULL, ylim = NULL, width = 900, height = 500, units = "px", res = NA, ... )modulationSpectrum( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, msType = c("1D", "2D")[2], specSource = c("STFT", "audSpec")[1], windowLength = 15, step = 1, wn = "hanning", zp = 0, audSpec_pars = list(filterType = "butterworth", nFilters = 32, bandwidth = 1/24, yScale = "bark", dynamicRange = 120), amRes = 5, maxDur = 5, specMethod = c("spec", "meanspec")[2], logSpec = FALSE, logMPS = FALSE, power = 1, normalize = TRUE, roughRange = c(30, 150), roughMean = NULL, roughSD = NULL, roughMinFreq = 1, amRange = c(10, 200), returnMS = TRUE, returnComplex = FALSE, summaryFun = c("mean", "median", "sd"), averageMS = FALSE, reportEvery = NULL, cores = 1, plot = TRUE, savePlots = NULL, logWarpX = NULL, logWarpY = NULL, quantiles = c(0.5, 0.8, 0.9), kernelSize = 5, kernelSD = 0.5, colorTheme = c("bw", "seewave", "heat.colors", "...")[1], col = NULL, main = NULL, xlab = "Hz", ylab = NULL, xlim = NULL, ylim = NULL, width = 900, height = 500, units = "px", res = NA, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
scale |
maximum possible amplitude of input used for normalization of
input vector (only needed if |
from, to
|
if NULL (default), analyzes the whole sound, otherwise from...to (s) |
msType |
'2D' = two-dimensional Fourier transform of a spectrogram; '1D' = separately calculated spectrum of each frequency band |
specSource |
'STFT' = Short-Time Fourier Transform; 'audSpec' = a bank
of bandpass filters (see |
windowLength, step, wn, zp
|
parameters for extracting a spectrogram if
|
audSpec_pars |
parameters for extracting an auditory spectrogram if
|
amRes |
target resolution of amplitude modulation, Hz. If |
maxDur |
sounds longer than |
specMethod |
the function to call when calculating the spectrum of each
frequency band (only used when |
logSpec |
if TRUE, the spectrogram is log-transformed prior to taking 2D FFT |
logMPS |
if TRUE, the modulation spectrum is log-transformed prior to calculating roughness |
power |
raise modulation spectrum to this power (eg power = 2 for ^2, or "power spectrum") |
normalize |
if TRUE, the modulation spectrum of each analyzed fragment
|
roughRange |
the range of temporal modulation frequencies that constitute the "roughness" zone, Hz |
roughMean, roughSD
|
the mean (Hz) and standard deviation (semitones) of
a lognormal distribution used to weight roughness estimates. If either is
null, roughness is calculated simply as the proportion of spectrum within
|
roughMinFreq |
frequencies below roughMinFreq (Hz) are ignored when calculating roughness (ie the estimated roughness increases if we disregard very low-frequency modulation, which is often strong) |
amRange |
the range of temporal modulation frequencies that we are interested in as "amplitude modulation" (AM), Hz |
returnMS |
if FALSE, only roughness is returned (much faster). Careful with exporting the modulation spectra of a lot of sounds at once as this requires a lot of RAM |
returnComplex |
if TRUE, returns a complex modulation spectrum (without normalization and warping) |
summaryFun |
functions used to summarize each acoustic characteristic, eg "c('mean', 'sd')"; user-defined functions are fine (see examples); NAs are omitted automatically for mean/median/sd/min/max/range/sum, otherwise take care of NAs yourself |
averageMS |
if TRUE, the modulation spectra of all inputs are averaged into a single output; if FALSE, a separate MS is returned for each input |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
plot |
if TRUE, plots the modulation spectrum of each sound (see
|
savePlots |
if a valid path is specified, a plot is saved in this folder (defaults to NA) |
logWarpX, logWarpY
|
numeric vector of length 2: c(sigma, base) of pseudolog-warping the modulation spectrum, as in function pseudo_log_trans() from the "scales" package |
quantiles |
labeled contour values, % (e.g., "50" marks regions that contain 50% of the sum total of the entire modulation spectrum) |
kernelSize |
the size of Gaussian kernel used for smoothing (1 = no smoothing) |
kernelSD |
the SD of Gaussian kernel used for smoothing, relative to its size |
colorTheme |
black and white ('bw'), as in seewave package ('seewave'),
matlab-type palette ('matlab'), or any palette from
|
col |
actual colors, eg rev(rainbow(100)) - see ?hcl.colors for colors in base R (overrides colorTheme) |
xlab, ylab, main, xlim, ylim
|
graphical parameters |
width, height, units, res
|
parameters passed to
|
... |
other graphical parameters passed on to |
Returns a list with the following components:
$summary dataframe with summaries of roughness, amMsFreq, and
amMsPurity
$original modulation spectrum prior to blurring and log-warping,
but after squaring if power = TRUE, a matrix of nonnegative values.
Colnames are temporal modulation frequencies (Hz). Rownames are spectral
modulation frequencies (cycles/kHz) if msType = '2D' and frequencies
of filters or spectrograms bands (kHz) if msType = '1D'.
$original_list a list of modulation spectra for each analyzed
fragment (is amRes is not NULL)
$modulation_spectrogram a spectrogram-like representation showing
how the modulation spectrum changes over time
$processed modulation spectrum after blurring and log-warping
$complex untransformed complex modulation spectrum (returned
only if returnComplex = TRUE)
$roughness proportion of the modulation spectrum within
roughRange of temporal modulation frequencies or a weighted average
thereof if roughMean and roughSD are defined, % - a vector if
amRes is numeric and the sound is long enough, otherwise a single number
$roughness_list a list containing frequencies, amplitudes, and
roughness values for each analyzed frequency band (1D) or frequency
modulation band (2D)
roughness_spectrogram a spectrogram showing roughness instead of
amplitude per time-frequency bin
$amMsFreq frequency of the highest peak, within amRange, of
the folded AM function (average AM across all FM bins for both negative and
positive AM frequencies), where a peak is a local maximum over amRes
Hz. Like roughness, amMsFreq and amMsPurity can be single
numbers or vectors, depending on whether the sound is analyzed as a whole or
in chunks
$amMsPurity ratio of the peak at amMsFreq to the median AM over
amRange, dB
$ampl Room Mean Square amplitude of each analyzed fragment
Singh, N. C., & Theunissen, F. E. (2003). Modulation spectra of natural sounds and ethological theories of auditory processing. The Journal of the Acoustical Society of America, 114(6), 3394-3411.
Anikin, A. (2025) Acoustic estimation of voice roughness. Attention, Perception, & Psychophysics 87: 1771–1787.
plotMS spectrogram
audSpectrogram analyze
# White noise ms = modulationSpectrum(rnorm(16000), samplingRate = 16000, logSpec = FALSE, power = TRUE, amRes = NULL) # analyze the entire sound, giving a single roughness value str(ms) # Harmonic sound s = soundgen(pitch = 440, amFreq = 100, amDep = 50) ms = modulationSpectrum(s, samplingRate = 16000, amRes = NULL) ms[c('roughness', 'amMsFreq', 'amMsPurity')] # a single value for each ms1 = modulationSpectrum(s, samplingRate = 16000, amRes = 5) ms1[c('roughness', 'amMsFreq', 'amMsPurity')] # measured over time (low values of amRes mean more precision, so we analyze # longer segments and get fewer values per sound) # Embellish ms = modulationSpectrum(s, samplingRate = 16000, logMPS = TRUE, xlab = 'Temporal modulation, Hz', ylab = 'Spectral modulation, 1/kHz', colorTheme = 'matlab', main = 'Modulation spectrum', lty = 3) # Plot a modulation spectrogram (the peak at 100 Hz shows AM) spectrogram(s, 16000, specManual = ms$modulation_spectrogram, ylab = 'Modulation frequency, kHz', main = 'Modulation spectrogram') # Plot a roughness spectrogram spectrogram(s, 16000, specManual = ms$roughness_spectrogram, yScale = 'ERB', main = 'Roughness spectrogram') # 1D instead of 2D modulationSpectrum(s, 16000, msType = '1D', quantiles = NULL, col = soundgen:::jet.col(50)) ## Not run: # A long sound with varying AM and a bit of chaos at the end s_long = soundgen(sylLen = 3500, pitch = c(250, 320, 280), amFreq = c(30, 55), amDep = c(20, 60, 40), jitterDep = c(0, 0, 2)) playme(s_long) ms = modulationSpectrum(s_long, 16000) # plot AM over time plot(x = seq(1, 1500, length.out = length(ms$amMsFreq)), y = ms$amMsFreq, cex = 10^(ms$amMsPurity/20) * 10, xlab = 'Time, ms', ylab = 'AM frequency, Hz') # plot roughness over time spectrogram(s_long, 16000, ylim = c(0, 4), extraContour = list(x = ms$roughness / max(ms$roughness) * 4000, col = 'blue')) # As with spectrograms, there is a tradeoff in time-frequency resolution s = soundgen(pitch = 500, amFreq = 50, amDep = 100, sylLen = 500, samplingRate = 44100, plot = TRUE) # playme(s, samplingRate = 44100) ms = modulationSpectrum(s, samplingRate = 44100, windowLength = 50, step = 50, amRes = NULL) # poor temporal resolution ms = modulationSpectrum(s, samplingRate = 44100, windowLength = 5, step = 1, amRes = NULL) # poor frequency resolution ms = modulationSpectrum(s, samplingRate = 44100, windowLength = 15, step = 3, amRes = NULL) # a reasonable compromise # Start with an auditory spectrogram instead of STFT modulationSpectrum(s, 44100, specSource = 'audSpec', xlim = c(-100, 100)) modulationSpectrum(s, 44100, specSource = 'audSpec', logWarpX = c(10, 2), xlim = c(-500, 500), audSpec_pars = list(nFilters = 32, filterType = 'gammatone', bandwidth = NULL)) # customize the plot ms = modulationSpectrum(s, samplingRate = 44100, windowLength = 15, step = 2, amRes = NULL, kernelSize = 17, # more smoothing xlim = c(-70, 70), ylim = c(0, 4), # zoom in on the central region quantiles = c(.25, .5, .8), # customize contour lines col = rev(rainbow(100)), # alternative palette logWarpX = c(10, 2), # pseudo-log transform power = 2) # ^2 # Note the peaks at FM = 2/kHz (from "pitch = 500") and AM = 50 Hz (from # "amFreq = 50") # Input can be a wav/mp3 file ms = modulationSpectrum('~/Downloads/temp/16002_Faking_It_Large_clear.wav') # Input can be path to folder with audio files. Each file is processed # separately, and the output can contain an MS per file... ms1 = modulationSpectrum('~/Downloads/temp', kernelSize = 11, plot = FALSE, averageMS = FALSE) ms1$summary names(ms1$original) # a separate MS per file # ...or a single MS can be calculated: ms2 = modulationSpectrum('~/Downloads/temp', kernelSize = 11, plot = FALSE, averageMS = TRUE) plotMS(ms2$original) ms2$summary # Input can also be a list of waveforms (numeric vectors) ss = vector('list', 10) for (i in seq_along(ss)) { ss[[i]] = soundgen(sylLen = runif(1, 100, 1000), temperature = .4, pitch = runif(3, 400, 600)) } # lapply(ss, playme) # MS of the first sound ms1 = modulationSpectrum(ss[[1]], samplingRate = 16000, scale = 1) # average MS of all 10 sounds ms2 = modulationSpectrum(ss, samplingRate = 16000, scale = 1, averageMS = TRUE, plot = FALSE) plotMS(ms2$original) # A sound with ~3 syllables per second and only downsweeps in F0 contour s = soundgen(nSyl = 8, sylLen = 200, pauseLen = 100, pitch = c(300, 200)) # playme(s) ms = modulationSpectrum(s, samplingRate = 16000, maxDur = .5, xlim = c(-25, 25), colorTheme = 'seewave', power = 2) # note the asymmetry b/c of downsweeps # "power = 2" returns squared modulation spectrum - note that this affects # the roughness measure! ms$roughness # compare: modulationSpectrum(s, samplingRate = 16000, maxDur = .5, xlim = c(-25, 25), colorTheme = 'seewave', power = 1)$roughness # much higher roughness # Plotting with or without log-warping the modulation spectrum: ms = modulationSpectrum(soundgen(), samplingRate = 16000, plot = TRUE) ms = modulationSpectrum(soundgen(), samplingRate = 16000, logWarpX = c(2, 2), plot = TRUE) # logWarp and kernelSize have no effect on roughness # because it is calculated before these transforms: modulationSpectrum(s, samplingRate = 16000, logWarpX = c(1, 10))$roughness modulationSpectrum(s, samplingRate = 16000, logWarpX = NA)$roughness modulationSpectrum(s, samplingRate = 16000, kernelSize = 17)$roughness # Log-transform the spectrogram prior to 2D FFT (affects roughness): modulationSpectrum(s, samplingRate = 16000, logSpec = FALSE)$roughness modulationSpectrum(s, samplingRate = 16000, logSpec = TRUE)$roughness # Use a lognormal weighting function to calculate roughness # (instead of just % in roughRange) modulationSpectrum(s, 16000, roughRange = NULL, roughMean = 75, roughSD = 3)$roughness modulationSpectrum(s, 16000, roughRange = NULL, roughMean = 100, roughSD = 12)$roughness # truncate weights outside roughRange modulationSpectrum(s, 16000, roughRange = c(30, 150), roughMean = 100, roughSD = 1000)$roughness # very large SD modulationSpectrum(s, 16000, roughRange = c(30, 150), roughMean = NULL)$roughness # same as above b/c SD --> Inf # Complex modulation spectrum with phase preserved ms = modulationSpectrum(soundgen(), samplingRate = 16000, returnComplex = TRUE) plotMS(abs(ms$complex)) # note the symmetry # compare: plotMS(ms$original) ## End(Not run)# White noise ms = modulationSpectrum(rnorm(16000), samplingRate = 16000, logSpec = FALSE, power = TRUE, amRes = NULL) # analyze the entire sound, giving a single roughness value str(ms) # Harmonic sound s = soundgen(pitch = 440, amFreq = 100, amDep = 50) ms = modulationSpectrum(s, samplingRate = 16000, amRes = NULL) ms[c('roughness', 'amMsFreq', 'amMsPurity')] # a single value for each ms1 = modulationSpectrum(s, samplingRate = 16000, amRes = 5) ms1[c('roughness', 'amMsFreq', 'amMsPurity')] # measured over time (low values of amRes mean more precision, so we analyze # longer segments and get fewer values per sound) # Embellish ms = modulationSpectrum(s, samplingRate = 16000, logMPS = TRUE, xlab = 'Temporal modulation, Hz', ylab = 'Spectral modulation, 1/kHz', colorTheme = 'matlab', main = 'Modulation spectrum', lty = 3) # Plot a modulation spectrogram (the peak at 100 Hz shows AM) spectrogram(s, 16000, specManual = ms$modulation_spectrogram, ylab = 'Modulation frequency, kHz', main = 'Modulation spectrogram') # Plot a roughness spectrogram spectrogram(s, 16000, specManual = ms$roughness_spectrogram, yScale = 'ERB', main = 'Roughness spectrogram') # 1D instead of 2D modulationSpectrum(s, 16000, msType = '1D', quantiles = NULL, col = soundgen:::jet.col(50)) ## Not run: # A long sound with varying AM and a bit of chaos at the end s_long = soundgen(sylLen = 3500, pitch = c(250, 320, 280), amFreq = c(30, 55), amDep = c(20, 60, 40), jitterDep = c(0, 0, 2)) playme(s_long) ms = modulationSpectrum(s_long, 16000) # plot AM over time plot(x = seq(1, 1500, length.out = length(ms$amMsFreq)), y = ms$amMsFreq, cex = 10^(ms$amMsPurity/20) * 10, xlab = 'Time, ms', ylab = 'AM frequency, Hz') # plot roughness over time spectrogram(s_long, 16000, ylim = c(0, 4), extraContour = list(x = ms$roughness / max(ms$roughness) * 4000, col = 'blue')) # As with spectrograms, there is a tradeoff in time-frequency resolution s = soundgen(pitch = 500, amFreq = 50, amDep = 100, sylLen = 500, samplingRate = 44100, plot = TRUE) # playme(s, samplingRate = 44100) ms = modulationSpectrum(s, samplingRate = 44100, windowLength = 50, step = 50, amRes = NULL) # poor temporal resolution ms = modulationSpectrum(s, samplingRate = 44100, windowLength = 5, step = 1, amRes = NULL) # poor frequency resolution ms = modulationSpectrum(s, samplingRate = 44100, windowLength = 15, step = 3, amRes = NULL) # a reasonable compromise # Start with an auditory spectrogram instead of STFT modulationSpectrum(s, 44100, specSource = 'audSpec', xlim = c(-100, 100)) modulationSpectrum(s, 44100, specSource = 'audSpec', logWarpX = c(10, 2), xlim = c(-500, 500), audSpec_pars = list(nFilters = 32, filterType = 'gammatone', bandwidth = NULL)) # customize the plot ms = modulationSpectrum(s, samplingRate = 44100, windowLength = 15, step = 2, amRes = NULL, kernelSize = 17, # more smoothing xlim = c(-70, 70), ylim = c(0, 4), # zoom in on the central region quantiles = c(.25, .5, .8), # customize contour lines col = rev(rainbow(100)), # alternative palette logWarpX = c(10, 2), # pseudo-log transform power = 2) # ^2 # Note the peaks at FM = 2/kHz (from "pitch = 500") and AM = 50 Hz (from # "amFreq = 50") # Input can be a wav/mp3 file ms = modulationSpectrum('~/Downloads/temp/16002_Faking_It_Large_clear.wav') # Input can be path to folder with audio files. Each file is processed # separately, and the output can contain an MS per file... ms1 = modulationSpectrum('~/Downloads/temp', kernelSize = 11, plot = FALSE, averageMS = FALSE) ms1$summary names(ms1$original) # a separate MS per file # ...or a single MS can be calculated: ms2 = modulationSpectrum('~/Downloads/temp', kernelSize = 11, plot = FALSE, averageMS = TRUE) plotMS(ms2$original) ms2$summary # Input can also be a list of waveforms (numeric vectors) ss = vector('list', 10) for (i in seq_along(ss)) { ss[[i]] = soundgen(sylLen = runif(1, 100, 1000), temperature = .4, pitch = runif(3, 400, 600)) } # lapply(ss, playme) # MS of the first sound ms1 = modulationSpectrum(ss[[1]], samplingRate = 16000, scale = 1) # average MS of all 10 sounds ms2 = modulationSpectrum(ss, samplingRate = 16000, scale = 1, averageMS = TRUE, plot = FALSE) plotMS(ms2$original) # A sound with ~3 syllables per second and only downsweeps in F0 contour s = soundgen(nSyl = 8, sylLen = 200, pauseLen = 100, pitch = c(300, 200)) # playme(s) ms = modulationSpectrum(s, samplingRate = 16000, maxDur = .5, xlim = c(-25, 25), colorTheme = 'seewave', power = 2) # note the asymmetry b/c of downsweeps # "power = 2" returns squared modulation spectrum - note that this affects # the roughness measure! ms$roughness # compare: modulationSpectrum(s, samplingRate = 16000, maxDur = .5, xlim = c(-25, 25), colorTheme = 'seewave', power = 1)$roughness # much higher roughness # Plotting with or without log-warping the modulation spectrum: ms = modulationSpectrum(soundgen(), samplingRate = 16000, plot = TRUE) ms = modulationSpectrum(soundgen(), samplingRate = 16000, logWarpX = c(2, 2), plot = TRUE) # logWarp and kernelSize have no effect on roughness # because it is calculated before these transforms: modulationSpectrum(s, samplingRate = 16000, logWarpX = c(1, 10))$roughness modulationSpectrum(s, samplingRate = 16000, logWarpX = NA)$roughness modulationSpectrum(s, samplingRate = 16000, kernelSize = 17)$roughness # Log-transform the spectrogram prior to 2D FFT (affects roughness): modulationSpectrum(s, samplingRate = 16000, logSpec = FALSE)$roughness modulationSpectrum(s, samplingRate = 16000, logSpec = TRUE)$roughness # Use a lognormal weighting function to calculate roughness # (instead of just % in roughRange) modulationSpectrum(s, 16000, roughRange = NULL, roughMean = 75, roughSD = 3)$roughness modulationSpectrum(s, 16000, roughRange = NULL, roughMean = 100, roughSD = 12)$roughness # truncate weights outside roughRange modulationSpectrum(s, 16000, roughRange = c(30, 150), roughMean = 100, roughSD = 1000)$roughness # very large SD modulationSpectrum(s, 16000, roughRange = c(30, 150), roughMean = NULL)$roughness # same as above b/c SD --> Inf # Complex modulation spectrum with phase preserved ms = modulationSpectrum(soundgen(), samplingRate = 16000, returnComplex = TRUE) plotMS(abs(ms$complex)) # note the symmetry # compare: plotMS(ms$original) ## End(Not run)
Takes two formulas for synthesizing two target sounds with
soundgen and produces a number of intermediate forms (morphs),
attempting to go from one target sound to the other in a specified number of
equal steps. Normally you will want to set temperature very low; the
tempEffects argument is not supported.
morph( formula1, formula2, nMorphs, playMorphs = TRUE, savePath = NA, samplingRate = 16000 )morph( formula1, formula2, nMorphs, playMorphs = TRUE, savePath = NA, samplingRate = 16000 )
formula1, formula2
|
lists of parameters for calling
|
nMorphs |
the number of morphs to produce, including target sounds |
playMorphs |
if TRUE, the morphs will be played |
savePath |
if it is the path to an existing directory, morphs will be saved there as individual .wav files (defaults to NA) |
samplingRate |
sampling rate of output, Hz. NB: overrides the values in
|
A list of two sublists ($formulas and $sounds), each
of length nMorphs. For ex., the formula for the second hybrid is
m$formulas[[2]], and the waveform is m$sounds[[2]]
## Not run: # write two formulas or copy-paste them from soundgen_app() or presets: playback = c(TRUE, FALSE)[1] # [a] to barking m = morph(formula1 = list(repeatBout = 2), # equivalently: formula1 = 'soundgen(repeatBout = 2)', formula2 = presets$Misc$Dog_bark, nMorphs = 5, playMorphs = playback) # use $formulas to access formulas for each morph, $sounds for waveforms # m$formulas[[4]] # playme(m$sounds[[3]]) # morph intonation and vowel quality m = morph( 'soundgen(pitch = c(300, 250, 400), formants = c(350, 2900, 3600, 4700))', 'soundgen(pitch = c(300, 700, 500, 300), formants = c(800, 1250, 3100, 4500))', nMorphs = 5, playMorphs = playback ) # from a grunt of disgust to a moan of pleasure m = morph( formula1 = 'soundgen(sylLen = 180, pitch = c(160, 160, 120), rolloff = -12, nonlinBalance = 70, subDep = 15, jitterDep = 2, formants = c(550, 1200, 2100, 4300, 4700, 6500, 7300), noise = data.frame(time = c(0, 180, 270), value = c(-25, -25, -40)), rolloffNoise = 0)', formula2 = 'soundgen(sylLen = 320, pitch = c(340, 330, 300), rolloff = c(-18, -16, -30), ampl = c(0, -10), formants = c(950, 1700, 3700), noise = data.frame(time = c(0, 300, 440), value = c(-35, -25, -65)), mouth = c(.4, .5), rolloffNoise = -5, attackLen = 30)', nMorphs = 8, playMorphs = playback ) # from scream_010 to moan_515b # (see online demos at http://cogsci.se/soundgen/humans/humans.html) m = morph( formula1 = "soundgen( sylLen = 490, pitch = list(time = c(0, 80, 250, 370, 490), value = c(1000, 2900, 3200, 2900, 1000)), rolloff = c(-5, 0, -25), rolloffKHz = 0, temperature = 0.001, jitterDep = c(.5, 1, 0), shimmerDep = c(5, 15, 0), formants = c(1100, 2300, 3100, 4000, 5300, 6200), mouth = c(.3, .5, .6, .5, .3))", formula2 = "soundgen(sylLen = 520, pitch = c(300, 310, 300), ampl = c(0, -30), temperature = 0.001, rolloff = c(-18, -25), jitterDep = .05, shimmerDep = 2, formants = list(f1 = c(700, 900), f2 = c(1600, 1400), f3 = c(3600, 3500), f4 = c(4300, 4200)), mouth = c(.5, .3), noise = data.frame(time = c(0, 400, 660), value = c(-20, -10, -60)), rolloffNoise = c(-5, -15))", nMorphs = 5, playMorphs = playback ) ## End(Not run)## Not run: # write two formulas or copy-paste them from soundgen_app() or presets: playback = c(TRUE, FALSE)[1] # [a] to barking m = morph(formula1 = list(repeatBout = 2), # equivalently: formula1 = 'soundgen(repeatBout = 2)', formula2 = presets$Misc$Dog_bark, nMorphs = 5, playMorphs = playback) # use $formulas to access formulas for each morph, $sounds for waveforms # m$formulas[[4]] # playme(m$sounds[[3]]) # morph intonation and vowel quality m = morph( 'soundgen(pitch = c(300, 250, 400), formants = c(350, 2900, 3600, 4700))', 'soundgen(pitch = c(300, 700, 500, 300), formants = c(800, 1250, 3100, 4500))', nMorphs = 5, playMorphs = playback ) # from a grunt of disgust to a moan of pleasure m = morph( formula1 = 'soundgen(sylLen = 180, pitch = c(160, 160, 120), rolloff = -12, nonlinBalance = 70, subDep = 15, jitterDep = 2, formants = c(550, 1200, 2100, 4300, 4700, 6500, 7300), noise = data.frame(time = c(0, 180, 270), value = c(-25, -25, -40)), rolloffNoise = 0)', formula2 = 'soundgen(sylLen = 320, pitch = c(340, 330, 300), rolloff = c(-18, -16, -30), ampl = c(0, -10), formants = c(950, 1700, 3700), noise = data.frame(time = c(0, 300, 440), value = c(-35, -25, -65)), mouth = c(.4, .5), rolloffNoise = -5, attackLen = 30)', nMorphs = 8, playMorphs = playback ) # from scream_010 to moan_515b # (see online demos at http://cogsci.se/soundgen/humans/humans.html) m = morph( formula1 = "soundgen( sylLen = 490, pitch = list(time = c(0, 80, 250, 370, 490), value = c(1000, 2900, 3200, 2900, 1000)), rolloff = c(-5, 0, -25), rolloffKHz = 0, temperature = 0.001, jitterDep = c(.5, 1, 0), shimmerDep = c(5, 15, 0), formants = c(1100, 2300, 3100, 4000, 5300, 6200), mouth = c(.3, .5, .6, .5, .3))", formula2 = "soundgen(sylLen = 520, pitch = c(300, 310, 300), ampl = c(0, -30), temperature = 0.001, rolloff = c(-18, -25), jitterDep = .05, shimmerDep = 2, formants = list(f1 = c(700, 900), f2 = c(1600, 1400), f3 = c(3600, 3500), f4 = c(4300, 4200)), mouth = c(.5, .3), noise = data.frame(time = c(0, 400, 660), value = c(-20, -10, -60)), rolloffNoise = c(-5, -15))", nMorphs = 5, playMorphs = playback ) ## End(Not run)
Takes a complex MS and transforms it to a complex spectrogram with proper row (frequency) and column (time) labels.
msToSpec(ms, windowLength = NULL, step = NULL)msToSpec(ms, windowLength = NULL, step = NULL)
ms |
target modulation spectrum (matrix of complex numbers) |
windowLength |
length of FFT window, ms (multiple values in a vector produce a multi-resolution spectrogram) |
step |
you can override |
Returns a spectrogram - a numeric matrix of complex numbers of the same dimensions as ms.
s = soundgen(sylLen = 250, amFreq = 25, amDep = 50, pitch = 250, samplingRate = 16000) spec = spectrogram(s, samplingRate = 16000, windowLength = 25, step = 5) ms = specToMS(spec) plotMS(log(Mod(ms)), quantiles = NULL, col = soundgen:::jet.col(100)) spec_new = msToSpec(ms) spectrogram(s, specManual = Mod(spec_new)) ## Not run: # or plot manually image(x = as.numeric(colnames(spec_new)), y = as.numeric(rownames(spec_new)), z = t(log(abs(spec_new))), xlab = 'Time, ms', ylab = 'Frequency, kHz') ## End(Not run)s = soundgen(sylLen = 250, amFreq = 25, amDep = 50, pitch = 250, samplingRate = 16000) spec = spectrogram(s, samplingRate = 16000, windowLength = 25, step = 5) ms = specToMS(spec) plotMS(log(Mod(ms)), quantiles = NULL, col = soundgen:::jet.col(100)) spec_new = msToSpec(ms) spectrogram(s, specManual = Mod(spec_new)) ## Not run: # or plot manually image(x = as.numeric(colnames(spec_new)), y = as.numeric(rownames(spec_new)), z = t(log(abs(spec_new))), xlab = 'Time, ms', ylab = 'Frequency, kHz') ## End(Not run)
An implementation of a Naive Bayes classifier adapted to autocorrelated time
series such as the type of nonlinear vocal phenomena in consecutive audio
frames. All predictors must be continuous, and the outcome must be
categorical. Cases with missing values are not deleted because the posterior
probabilities of each outcome class can be calculated from different
combinations of predictors on a case-by-case basis. Two optional
modifications of a standard Naive Bayes algorithm can be made: (1)
classifications can be "clumped" at the final stage, ensuring that every run
or "epoch" of a particular predicted class is at least minLength steps
long, and (2) priors can be continuously adapted based on the likelihood
function of the preceding wlPrior observations if prior =
'dynamic'.
naiveBayes( formula, train, test = train, prior = c("flat", "static", "dynamic")[2], wlPrior = 3, wlClumper = NULL, runBack = TRUE, plot = FALSE )naiveBayes( formula, train, test = train, prior = c("flat", "static", "dynamic")[2], wlPrior = 3, wlClumper = NULL, runBack = TRUE, plot = FALSE )
formula |
model formula of the type outcome ~ predictor1 + predictor2 + ... (no interactions) |
train |
either the training dataframe or the output of
|
test |
the test dataframe. This data is used to make predictions - that is, outcome class probabilities given the values of predictors |
prior |
"flat" = all classes are equally likely a prior, "static" = use
class probabilities in the training dataset, "dynamic" = update prior
probabilities from weighted likelihoods of |
wlPrior |
the length of a Gaussian window used for updating dynamic priors |
wlClumper |
the minimum expected number of observations of the same class before the class can change |
runBack |
if TRUE, the dynamic prior is calculated both forward and
backward and averaged (only has an effect f |
plot |
if TRUE, produces diagnostic plots |
Returns the test dataframe with new columns: "pr" = the
predicted class membership, "[class]" = posterior probabilities per class,
"like_[class]" = log-likelihoods, "prior_[class]" = log-priors,
"priorF_[class]" / "priorB_[class]" = forward / backward log-priors per
class.
set.seed(151) ## create some fake data df = data.frame(group = rep(c( rep('A', 150), rep('B', 50), rep('A', 120), rep('A', 100), rep('B', 30), rep('A', 90) ), 3)) df$group = as.factor(df$group) df$x1 = rnorm(nrow(df), mean = ifelse(df$group == 'A', 3, 6), sd = 2) df$x2 = rnorm(nrow(df), mean = ifelse(df$group == 'A', 2, -1), sd = 2) boxplot(x1 ~ group, df) boxplot(x2 ~ group, df) ## train the classifier mod_train = naiveBayes_train(group ~ x1 + x2, data = df) mod_train ## test on new data generated by the same process test = data.frame(group = rep(c( rep('A', 90), rep('B', 40), rep('A', 150), rep('B', 40), rep('A', 130), rep('B', 30) ), 2)) test$group = as.factor(test$group) test$x1 = rnorm(nrow(test), mean = ifelse(test$group == 'A', 3, 6), sd = 2) test$x2 = rnorm(nrow(test), mean = ifelse(test$group == 'A', 2, -1), sd = 2) # flat priors (same prior probability for each class) nb_flat = naiveBayes(group ~ x1 + x2, train = mod_train, test = test, prior = 'flat', plot = TRUE) # same as passing 'train' directly to the model, w/o calling naiveBayes_train(): nb_flat = naiveBayes(group ~ x1 + x2, train = df, test = test, prior = 'flat') table(nb_flat$group, nb_flat$pr) mean(nb_flat$group == nb_flat$pr) # 84% correct # static priors (use original class proportions as prior class probabilities) nb_static = naiveBayes(group ~ x1 + x2, train = mod_train, test = test, prior = 'static', wlClumper = NULL, plot = TRUE) table(nb_static$group, nb_static$pr) mean(nb_static$group == nb_static$pr) # 87% correct # specify custom static priors mod_train2 = mod_train mod_train$table mod_train2$table = list(A = .1, B = .9) # sum to 1 nb_static2 = naiveBayes(group ~ x1 + x2, train = mod_train2, test = test, prior = 'static', wlClumper = NULL, plot = TRUE) mean(nb_static2$group == nb_static2$pr) # 61% correct # if we expect autocorrelation, ie class X is more likely a priori if the # last few observations were also likely to be class X, we can use dynamic # priors and/or clumper the predicted classes (the latter imposes strong # constraints on the predictions, but may be worth it if the data is known to # be strongly "clumpered", ie if we know classes occur in long'ish runs) nb1 = naiveBayes(group ~ x1 + x2, train = mod_train, test = test, prior = 'dynamic', wlPrior = 10, plot = TRUE) table(nb1$group, nb1$pr) mean(nb1$group == nb1$pr) # 94% correct nb2 = naiveBayes(group ~ x1 + x2, train = mod_train, test = test, prior = 'static', wlClumper = 10, plot = TRUE) table(nb2$group, nb2$pr) mean(nb2$group == nb2$pr) # 89% correct nb3 = naiveBayes(group ~ x1 + x2, train = mod_train, test = test, prior = 'dynamic', wlPrior = 10, wlClumper = 10, plot = TRUE) table(nb3$group, nb3$pr) mean(nb3$group == nb3$pr) # 98% correct # NAs in the data are not a problem test1 = test test1$x1[sample(1:nrow(test1), 100)] = NA test1$x2[sample(1:nrow(test1), 10)] = NA summary(test1) nb4 = naiveBayes(group ~ x1 + x2, train = mod_train, test = test, prior = 'dynamic', wlPrior = 10, plot = TRUE) table(nb4$group, nb4$pr) mean(nb4$group == nb4$pr) # still 94% correctset.seed(151) ## create some fake data df = data.frame(group = rep(c( rep('A', 150), rep('B', 50), rep('A', 120), rep('A', 100), rep('B', 30), rep('A', 90) ), 3)) df$group = as.factor(df$group) df$x1 = rnorm(nrow(df), mean = ifelse(df$group == 'A', 3, 6), sd = 2) df$x2 = rnorm(nrow(df), mean = ifelse(df$group == 'A', 2, -1), sd = 2) boxplot(x1 ~ group, df) boxplot(x2 ~ group, df) ## train the classifier mod_train = naiveBayes_train(group ~ x1 + x2, data = df) mod_train ## test on new data generated by the same process test = data.frame(group = rep(c( rep('A', 90), rep('B', 40), rep('A', 150), rep('B', 40), rep('A', 130), rep('B', 30) ), 2)) test$group = as.factor(test$group) test$x1 = rnorm(nrow(test), mean = ifelse(test$group == 'A', 3, 6), sd = 2) test$x2 = rnorm(nrow(test), mean = ifelse(test$group == 'A', 2, -1), sd = 2) # flat priors (same prior probability for each class) nb_flat = naiveBayes(group ~ x1 + x2, train = mod_train, test = test, prior = 'flat', plot = TRUE) # same as passing 'train' directly to the model, w/o calling naiveBayes_train(): nb_flat = naiveBayes(group ~ x1 + x2, train = df, test = test, prior = 'flat') table(nb_flat$group, nb_flat$pr) mean(nb_flat$group == nb_flat$pr) # 84% correct # static priors (use original class proportions as prior class probabilities) nb_static = naiveBayes(group ~ x1 + x2, train = mod_train, test = test, prior = 'static', wlClumper = NULL, plot = TRUE) table(nb_static$group, nb_static$pr) mean(nb_static$group == nb_static$pr) # 87% correct # specify custom static priors mod_train2 = mod_train mod_train$table mod_train2$table = list(A = .1, B = .9) # sum to 1 nb_static2 = naiveBayes(group ~ x1 + x2, train = mod_train2, test = test, prior = 'static', wlClumper = NULL, plot = TRUE) mean(nb_static2$group == nb_static2$pr) # 61% correct # if we expect autocorrelation, ie class X is more likely a priori if the # last few observations were also likely to be class X, we can use dynamic # priors and/or clumper the predicted classes (the latter imposes strong # constraints on the predictions, but may be worth it if the data is known to # be strongly "clumpered", ie if we know classes occur in long'ish runs) nb1 = naiveBayes(group ~ x1 + x2, train = mod_train, test = test, prior = 'dynamic', wlPrior = 10, plot = TRUE) table(nb1$group, nb1$pr) mean(nb1$group == nb1$pr) # 94% correct nb2 = naiveBayes(group ~ x1 + x2, train = mod_train, test = test, prior = 'static', wlClumper = 10, plot = TRUE) table(nb2$group, nb2$pr) mean(nb2$group == nb2$pr) # 89% correct nb3 = naiveBayes(group ~ x1 + x2, train = mod_train, test = test, prior = 'dynamic', wlPrior = 10, wlClumper = 10, plot = TRUE) table(nb3$group, nb3$pr) mean(nb3$group == nb3$pr) # 98% correct # NAs in the data are not a problem test1 = test test1$x1[sample(1:nrow(test1), 100)] = NA test1$x2[sample(1:nrow(test1), 10)] = NA summary(test1) nb4 = naiveBayes(group ~ x1 + x2, train = mod_train, test = test, prior = 'dynamic', wlPrior = 10, plot = TRUE) table(nb4$group, nb4$pr) mean(nb4$group == nb4$pr) # still 94% correct
Returns conditional means and standard deviations per class as well as a
table with the global proportions of each class in the dataset. This is
mostly useful because the output can be passed on to naiveBayes
to save time if naiveBayes() is called in a loop with the same training
dataset.
naiveBayes_train(formula, data)naiveBayes_train(formula, data)
formula |
outcome ~ predictor1 + predictor1 + ... |
data |
training dataset |
Removes noise by spectral substraction. If a recording is affected by a
steady noise with a relatively stable amplitude and spectrum (e.g.,
microphone hiss, crickets, MRI buzz, etc.), its spectrum can be simply
subtracted from the signal. Algorithm: STFT to produce a spectrogram, divide
by normalized noise spectrum, inverse STFT to reconstitute the signal. Most
of the work is done by addFormants.
noiseRemoval( x, samplingRate = NULL, scale = NULL, noise, dB = 6, specificity = 1, windowLength = 50, step = windowLength/2, dynamicRange = 120, normalize = c("max", "orig", "none")[2], reportEvery = NULL, cores = 1, play = FALSE, saveAudio = NULL, plot = FALSE, savePlots = NULL, width = 900, height = 500, units = "px", res = NA, ... )noiseRemoval( x, samplingRate = NULL, scale = NULL, noise, dB = 6, specificity = 1, windowLength = 50, step = windowLength/2, dynamicRange = 120, normalize = c("max", "orig", "none")[2], reportEvery = NULL, cores = 1, play = FALSE, saveAudio = NULL, plot = FALSE, savePlots = NULL, width = 900, height = 500, units = "px", res = NA, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
scale |
maximum possible amplitude of input used for normalization of
input vector (only needed if |
noise |
a numeric vector of length two specifying the location of pure
noise in input audio (in s); a matrix representing pure noise as a spectrum
with frequency bins in rows; any input accepted by
|
dB |
if NULL (default), the spectral envelope is applied on the original scale; otherwise, it is set to range from 1 to 10 ^ (dB / 20) |
specificity |
a way to sharpen or blur the noise spectrum (we take noise spectrum ^ specificity) : 1 = no change, >1 = sharper (the loudest noise frequencies are preferentially removed), <1 = blurred (even quiet noise frequencies are removed) |
windowLength |
length of FFT window, ms (multiple values in a vector produce a multi-resolution spectrogram) |
step |
you can override |
dynamicRange |
dynamic range, dB. All values more than one dynamicRange under maximum are treated as zero |
normalize |
if TRUE, scales input prior to FFT |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
play |
if TRUE, plays the synthesized sound using the default player on
your system. If character, passed to |
saveAudio |
path + filename for saving the output, e.g. '~/Downloads/temp.wav'. If NULL = doesn't save |
plot |
should a spectrogram be plotted? TRUE / FALSE |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
width, height, units, res
|
graphical parameters for saving plots passed to
|
... |
other graphical parameters |
Returns the denoised audio
s = soundgen(noise = list(time = c(-100, 400), value = -20), formantsNoise = list(f1 = list(freq = 3000, width = 25)), addSilence = 50, temperature = .001, plot = TRUE) # Option 1: use part of the recording as noise profile s1 = noiseRemoval(s, samplingRate = 16000, noise = c(0.05, 0.15), dB = 40, plot = TRUE) # Option 2: use a separate recording as noise profile noise = soundgen(pitch = NA, noise = 0, formantsNoise = list(f1 = list(freq = 3000, width = 25))) spectrogram(noise, 16000) s2 = noiseRemoval(s, samplingRate = 16000, noise = noise, dB = 40, plot = TRUE) # Option 3: provide noise spectrum as a matrix spec_noise = spectrogram( noise, samplingRate = 16000, output = 'original', plot = FALSE) s3 = noiseRemoval(s, samplingRate = 16000, noise = spec_noise, dB = 40, plot = TRUE) ## Not run: # play with gain and sensitivity noiseRemoval(s, samplingRate = 16000, noise = c(0.05, 0.15), dB = 60, specificity = 2, plot = TRUE) # remove noise only from a section of the audio noiseRemoval(s, samplingRate = 16000, from = .3, to = .4, noise = c(0.05, 0.15), dB = 60, plot = TRUE, play = TRUE) ## End(Not run)s = soundgen(noise = list(time = c(-100, 400), value = -20), formantsNoise = list(f1 = list(freq = 3000, width = 25)), addSilence = 50, temperature = .001, plot = TRUE) # Option 1: use part of the recording as noise profile s1 = noiseRemoval(s, samplingRate = 16000, noise = c(0.05, 0.15), dB = 40, plot = TRUE) # Option 2: use a separate recording as noise profile noise = soundgen(pitch = NA, noise = 0, formantsNoise = list(f1 = list(freq = 3000, width = 25))) spectrogram(noise, 16000) s2 = noiseRemoval(s, samplingRate = 16000, noise = noise, dB = 40, plot = TRUE) # Option 3: provide noise spectrum as a matrix spec_noise = spectrogram( noise, samplingRate = 16000, output = 'original', plot = FALSE) s3 = noiseRemoval(s, samplingRate = 16000, noise = spec_noise, dB = 40, plot = TRUE) ## Not run: # play with gain and sensitivity noiseRemoval(s, samplingRate = 16000, noise = c(0.05, 0.15), dB = 60, specificity = 2, plot = TRUE) # remove noise only from a section of the audio noiseRemoval(s, samplingRate = 16000, from = .3, to = .4, noise = c(0.05, 0.15), dB = 60, plot = TRUE, play = TRUE) ## End(Not run)
Predicts new points in a time series. The functionality is provided by
nonLinearPrediction. This function is just a
simple wrapper "for dummies" that reconstructs the phase space under the
hood, including the choice of time lag, embedding dimensions, etc. It can
also predict not one but many points in a single step.
nonlinPred( x, nPoints = 1, time.lag = NULL, embedding.dim = NULL, max.embedding.dim = 15, threshold = 0.95, max.relative.change = 0.1, radius = NULL, radius.increment = NULL, plot = FALSE )nonlinPred( x, nPoints = 1, time.lag = NULL, embedding.dim = NULL, max.embedding.dim = 15, threshold = 0.95, max.relative.change = 0.1, radius = NULL, radius.increment = NULL, plot = FALSE )
x |
numeric vector |
nPoints |
number of points to predict, ideally not more than length(x) / 2 (the function is called recursively to predict longer sequences, but don't expect miracles) |
time.lag |
time lag for constructing Takens vectors. Defaults to the
time to the first exponential decay of mutual information. See
|
embedding.dim |
the number of dimensions of the phase space. Defaults to
an estimate based on
|
max.embedding.dim, threshold, max.relative.change
|
parameters used to
estimate the optimal number of embedding dimensions - see
|
radius, radius.increment
|
the radius used for detecting neighbors in the
phase space and its increment in case no neighbors are found - see
|
plot |
if TRUE, plots the original time series and the predictions |
Returns a numeric vector on the same scale as input x.
x = c(rep(1, 3), rep(0, 4), rep(1, 3), rep(0, 4), rep(1, 3), 0, 0) nonlinPred(x, 5, plot = TRUE) nonlinPred(sin(1:25), 22, plot = TRUE) x = soundgen(sylLen = 50, addSilence = 0)[250:450] nonlinPred(x, 100, plot = TRUE) nonlinPred(c(rnorm(5), NA, rnorm(3))) nonlinPred(1:4) nonlinPred(1:6) ## Not run: s1 = soundgen(sylLen = 500, pitch = rnorm(5, 200, 20), addSilence = 0, plot = TRUE) playme(s1) length(s1) # we can predict output that is longer than the original time series by # predicting a bit at a time and using the output as the new input s2 = nonlinPred(s1, 16000) spectrogram(c(s1, s2)) playme(c(s1, s2)) ## End(Not run)x = c(rep(1, 3), rep(0, 4), rep(1, 3), rep(0, 4), rep(1, 3), 0, 0) nonlinPred(x, 5, plot = TRUE) nonlinPred(sin(1:25), 22, plot = TRUE) x = soundgen(sylLen = 50, addSilence = 0)[250:450] nonlinPred(x, 100, plot = TRUE) nonlinPred(c(rnorm(5), NA, rnorm(3))) nonlinPred(1:4) nonlinPred(1:6) ## Not run: s1 = soundgen(sylLen = 500, pitch = rnorm(5, 200, 20), addSilence = 0, plot = TRUE) playme(s1) length(s1) # we can predict output that is longer than the original time series by # predicting a bit at a time and using the output as the new input s2 = nonlinPred(s1, 16000) spectrogram(c(s1, s2)) playme(c(s1, s2)) ## End(Not run)
Normalizes the amplitude of all wav/mp3 files in a folder based on their peak or RMS amplitude or subjective loudness. This is good for playback experiments, which require that all sounds should have similar intensity or loudness.
normalizeFolder( myfolder, type = c("peak", "rms", "loudness")[1], maxAmp = 0, summaryFun = "mean", windowLength = 50, step = NULL, overlap = 70, killDC = FALSE, windowDC = 200, saveAudio = NULL, reportEvery = NULL )normalizeFolder( myfolder, type = c("peak", "rms", "loudness")[1], maxAmp = 0, summaryFun = "mean", windowLength = 50, step = NULL, overlap = 70, killDC = FALSE, windowDC = 200, saveAudio = NULL, reportEvery = NULL )
myfolder |
full path to folder containing input audio files |
type |
normalize so the output files has the same peak amplitude ('peak'), root mean square amplitude ('rms'), or subjective loudness in sone ('loudness') |
maxAmp |
maximum amplitude in dB (0 = max possible, -10 = 10 dB below max possible, etc.) |
summaryFun |
should the output files have the same mean / median / max etc rms amplitude or loudness? (summaryFun has no effect if type = 'peak') |
windowLength |
length of FFT window, ms (multiple values in a vector produce a multi-resolution spectrogram) |
step |
you can override |
overlap |
overlap between successive FFT frames, % |
killDC |
if TRUE, removed DC offset (see also |
windowDC |
the window for calculating DC offset, ms |
saveAudio |
full path to where the normalized files should be saved (defaults to 'myfolder/normalized') |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
Algorithm: first all files are rescaled to have the same peak amplitude of
maxAmp dB. If type = 'peak', the process ends here. If
type = 'rms', there are two additional steps. First the original RMS
amplitude of all files is calculated per frame by getRMS. The
"quietest" sound with the lowest summary RMS value is not modified, so its
peak amplitude remains maxAmp dB. All the remaining sounds are
rescaled linearly, so that their summary RMS values becomes the same as that
of the "quietest" sound, and their peak amplitudes become smaller,
<maxAmp. Finally, if type = 'loudness', the subjective
loudness of each sound is estimated by getLoudness, which
assumes frequency sensitivity typical of human hearing. The following
normalization procedure is similar to that for type = 'rms'.
## Not run: # put a few short audio files in a folder, eg '~/Downloads/temp' getRMS('~/Downloads/temp', summaryFun = 'mean')$summary # different normalizeFolder('~/Downloads/temp', type = 'rms', summaryFun = 'mean', saveAudio = '~/Downloads/temp/normalized') getRMS('~/Downloads/temp/normalized', summaryFun = 'mean')$summary # same # If the saved audio files are treated as stereo with one channel missing, # try reconverting with ffmpeg (saving is handled by tuneR::writeWave) ## End(Not run)## Not run: # put a few short audio files in a folder, eg '~/Downloads/temp' getRMS('~/Downloads/temp', summaryFun = 'mean')$summary # different normalizeFolder('~/Downloads/temp', type = 'rms', summaryFun = 'mean', saveAudio = '~/Downloads/temp/normalized') getRMS('~/Downloads/temp/normalized', summaryFun = 'mean')$summary # same # If the saved audio files are treated as stereo with one channel missing, # try reconverting with ffmpeg (saving is handled by tuneR::writeWave) ## End(Not run)
A dataframe of 192 rows and 2 columns: "note" and "freq" (Hz). Range: C-5 (0.51 Hz) to B10 (31608.53 Hz)
notesDictnotesDict
An object of class data.frame with 192 rows and 2 columns.
This customized wrapper for optim attempts to optimize
the parameters of segment or analyze by comparing
the results with a manually annotated "key". This optimization function uses
a single measurement per audio file (e.g., median pitch or the number of
syllables). For other purposes, you may want to adapt the optimization
function so that the key specifies the exact timing of syllables, their
median length, frame-by-frame pitch values, or any other characteristic that
you want to optimize for. The general idea remains the same, however: we want
to tune function parameters to fit our type of audio and research priorities.
The default settings of segment and analyze have
been optimized for human non-linguistic vocalizations.
optimizePars( myfolder, key, myfun, pars, bounds = NULL, fitnessPar, fitnessFun = function(x) 1 - cor(x, key, use = "pairwise.complete.obs"), nIter = 10, init = NULL, initSD = 0.2, control = list(maxit = 50, reltol = 0.01, trace = 0), otherPars = list(plot = FALSE), mygrid = NULL, verbose = TRUE )optimizePars( myfolder, key, myfun, pars, bounds = NULL, fitnessPar, fitnessFun = function(x) 1 - cor(x, key, use = "pairwise.complete.obs"), nIter = 10, init = NULL, initSD = 0.2, control = list(maxit = 50, reltol = 0.01, trace = 0), otherPars = list(plot = FALSE), mygrid = NULL, verbose = TRUE )
myfolder |
path to where the .wav files live |
key |
a vector containing the "correct" measurement that we are aiming to reproduce |
myfun |
the function being optimized: either 'segment' or 'analyze' (in quotes) |
pars |
names of arguments to |
bounds |
a list setting the lower and upper boundaries for possible
values of optimized parameters. For ex., if we optimize |
fitnessPar |
the name of output variable that we are comparing with the key, e.g. 'nBursts' or 'pitch_median' |
fitnessFun |
the function used to evaluate how well the output of
|
nIter |
repeat the optimization several times to check convergence |
init |
initial values of optimized parameters (if NULL, the default
values are taken from the definition of |
initSD |
each optimization begins with a random seed, and
|
control |
a list of control parameters passed on to
|
otherPars |
a list of additional arguments to |
mygrid |
a dataframe with one column per parameter to optimize, with
each row specifying the values to try. If not NULL, |
verbose |
if TRUE, reports the values of parameters evaluated and fitness |
If your sounds are very different from human non-linguistic vocalizations, you may want to change the default values of other arguments to speed up convergence. Adapt the code to enforce suitable constraints, depending on your data.
Returns a matrix with one row per iteration with fitness in the first column and the best values of each of the optimized parameters in the remaining columns.
## Not run: # Download 260 sounds from the supplements in Anikin & Persson (2017) # - see http://cogsci.se/publications.html # Unzip them into a folder, say '~/Downloads/temp' myfolder = '~/Downloads/temp260' # 260 .wav files live here # Optimization of SEGMENTATION # Import manual counts of syllables in 260 sounds from # Anikin & Persson (2017) (our "key") key = segmentManual # a vector of 260 integers # Run optimization loop several times with random initial values # to check convergence # NB: with 260 sounds and default settings, this might take ~20 min per iteration! res = optimizePars(myfolder = myfolder, myfun = 'segment', key = key, pars = c('shortestSyl', 'shortestPause'), fitnessPar = 'nBursts', otherPars = list(method = 'env'), nIter = 3, control = list(maxit = 50, reltol = .01, trace = 0)) # Examine the results print(res) for (c in 2:ncol(res)) { plot(res[, c], res[, 1], main = colnames(res)[c]) } pars = as.list(res[1, 2:ncol(res)]) # top candidate (best pars) s = do.call(segment, c(myfolder, pars)) # segment with best pars cor(key, as.numeric(s[, fitnessPar])) boxplot(as.numeric(s[, fitnessPar]) ~ as.integer(key), xlab='key') abline(a=0, b=1, col='red') # Try a grid with particular parameter values instead of formal optimization res = optimizePars(myfolder = myfolder, myfun = 'segment', key = segmentManual, pars = c('shortestSyl', 'shortestPause'), fitnessPar = 'nBursts', otherPars = list(method = 'env'), mygrid = expand.grid(shortestSyl = c(30, 40), shortestPause = c(30, 40, 50))) 1 - res$fit # correlations with key # Optimization of PITCH TRACKING (takes several hours!) key = as.numeric(log(pitchManual)) res = optimizePars( myfolder = myfolder, myfun = 'analyze', key = key, # log-scale better for pitch pars = c('windowLength', 'silence'), bounds = list(low = c(5, 0), high = c(200, .2)), fitnessPar = 'pitch_median', nIter = 2, otherPars = list(plot = FALSE, loudness = NULL, novelty = NULL, roughness = NULL, nFormants = 0), fitnessFun = function(x) { 1 - cor(log(x), key, use = 'pairwise.complete.obs') * (1 - mean(is.na(x) & is.finite(key))) # penalize failing to detect f0 }) ## End(Not run)## Not run: # Download 260 sounds from the supplements in Anikin & Persson (2017) # - see http://cogsci.se/publications.html # Unzip them into a folder, say '~/Downloads/temp' myfolder = '~/Downloads/temp260' # 260 .wav files live here # Optimization of SEGMENTATION # Import manual counts of syllables in 260 sounds from # Anikin & Persson (2017) (our "key") key = segmentManual # a vector of 260 integers # Run optimization loop several times with random initial values # to check convergence # NB: with 260 sounds and default settings, this might take ~20 min per iteration! res = optimizePars(myfolder = myfolder, myfun = 'segment', key = key, pars = c('shortestSyl', 'shortestPause'), fitnessPar = 'nBursts', otherPars = list(method = 'env'), nIter = 3, control = list(maxit = 50, reltol = .01, trace = 0)) # Examine the results print(res) for (c in 2:ncol(res)) { plot(res[, c], res[, 1], main = colnames(res)[c]) } pars = as.list(res[1, 2:ncol(res)]) # top candidate (best pars) s = do.call(segment, c(myfolder, pars)) # segment with best pars cor(key, as.numeric(s[, fitnessPar])) boxplot(as.numeric(s[, fitnessPar]) ~ as.integer(key), xlab='key') abline(a=0, b=1, col='red') # Try a grid with particular parameter values instead of formal optimization res = optimizePars(myfolder = myfolder, myfun = 'segment', key = segmentManual, pars = c('shortestSyl', 'shortestPause'), fitnessPar = 'nBursts', otherPars = list(method = 'env'), mygrid = expand.grid(shortestSyl = c(30, 40), shortestPause = c(30, 40, 50))) 1 - res$fit # correlations with key # Optimization of PITCH TRACKING (takes several hours!) key = as.numeric(log(pitchManual)) res = optimizePars( myfolder = myfolder, myfun = 'analyze', key = key, # log-scale better for pitch pars = c('windowLength', 'silence'), bounds = list(low = c(5, 0), high = c(200, .2)), fitnessPar = 'pitch_median', nIter = 2, otherPars = list(plot = FALSE, loudness = NULL, novelty = NULL, roughness = NULL, nFormants = 0), fitnessFun = function(x) { 1 - cor(log(x), key, use = 'pairwise.complete.obs') * (1 - mean(is.na(x) & is.finite(key))) # penalize failing to detect f0 }) ## End(Not run)
Plots the oscillogram (waveform) of a sound on a linear or logarithmic scale
(in dB). To get a dB scale, centers and normalizes the sound, then takes a
logarithm of the positive part and a flipped negative part, which is
analogous to "Waveform (dB)" view in Audacity. For more plotting options,
check oscillo.
osc( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, dynamicRange = 80, dB = FALSE, returnWave = FALSE, reportEvery = NULL, cores = 1, plot = TRUE, savePlots = NULL, main = NULL, xlab = NULL, ylab = NULL, ylim = NULL, bty = "n", midline = TRUE, maxPoints = 10000, width = 900, height = 500, units = "px", res = NA, ... )osc( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, dynamicRange = 80, dB = FALSE, returnWave = FALSE, reportEvery = NULL, cores = 1, plot = TRUE, savePlots = NULL, main = NULL, xlab = NULL, ylab = NULL, ylim = NULL, bty = "n", midline = TRUE, maxPoints = 10000, width = 900, height = 500, units = "px", res = NA, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
scale |
maximum possible amplitude of input used for normalization of
input vector (only needed if |
from, to
|
if NULL (default), analyzes the whole sound, otherwise from...to (s) |
dynamicRange |
dynamic range, dB. All values more than one dynamicRange under maximum are treated as zero |
dB |
if TRUE, plots on a dB instead of linear scale |
returnWave |
if TRUE, returns a log-transformed waveform as a numeric vector |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
plot |
if TRUE, plots the oscillogram |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
main |
plot title |
xlab, ylab
|
axis labels |
ylim |
override default amplitude scale for non-centered sounds |
bty |
box type (see '?par') |
midline |
if TRUE, draws a line at 0 dB |
maxPoints |
the maximum number of points to plot (speeds up the plotting of long audio files, but beware of antialiasing) |
width, height, units, res
|
graphical parameters for saving plots passed to
|
... |
Other graphical parameters passed on to 'plot()' |
If returnWave = TRUE, returns the input waveform on the
original or dB scale: a vector with range from '-dynamicRange' to
'dynamicRange'.
sound = sin(1:2000/10) * getSmoothContour(anchors = c(1, .01, .5), len = 2000) # Oscillogram on a linear scale without bells and whistles, just base R plot(sound, type = 'l') # Oscillogram options with soundgen osc(sound) # linear osc(sound, dB = TRUE) # dB # For numeric vectors, indicate samplingRate and scale (max amplitude) osc(sound, samplingRate = 1000, scale = 100, dB = TRUE) # Embellish and customize the plot o = osc(sound, samplingRate = 1000, dB = TRUE, midline = FALSE, main = 'My waveform', col = 'blue', returnWave = TRUE) abline(h = -80, col = 'orange', lty = 3) o[1:10] # the waveform in dB ## Not run: # Wave object data(sheep, package = 'seewave') osc(sheep, dB = TRUE) # Plot a section osc(sheep, from = .5, to = 1.2) # for long files, reduce the resolution to plot quickly (careful: if the # resolution is too low, antialiasing may cause artifacts) osc(sheep, dB = TRUE, maxPoints = 2500) osc(sheep, samplingRate = 5000, maxPoints = 100) # files several minutes long can be plotted in under a second osc('~/Downloads/speechEx.wav', maxPoints = 20000) # saves oscillograms of all audio files in a folder osc('~/Downloads/temp2', savePlots = '') ## End(Not run)sound = sin(1:2000/10) * getSmoothContour(anchors = c(1, .01, .5), len = 2000) # Oscillogram on a linear scale without bells and whistles, just base R plot(sound, type = 'l') # Oscillogram options with soundgen osc(sound) # linear osc(sound, dB = TRUE) # dB # For numeric vectors, indicate samplingRate and scale (max amplitude) osc(sound, samplingRate = 1000, scale = 100, dB = TRUE) # Embellish and customize the plot o = osc(sound, samplingRate = 1000, dB = TRUE, midline = FALSE, main = 'My waveform', col = 'blue', returnWave = TRUE) abline(h = -80, col = 'orange', lty = 3) o[1:10] # the waveform in dB ## Not run: # Wave object data(sheep, package = 'seewave') osc(sheep, dB = TRUE) # Plot a section osc(sheep, from = .5, to = 1.2) # for long files, reduce the resolution to plot quickly (careful: if the # resolution is too low, antialiasing may cause artifacts) osc(sheep, dB = TRUE, maxPoints = 2500) osc(sheep, samplingRate = 5000, maxPoints = 100) # files several minutes long can be plotted in under a second osc('~/Downloads/speechEx.wav', maxPoints = 20000) # saves oscillograms of all audio files in a folder osc('~/Downloads/temp2', savePlots = '') ## End(Not run)
A dataset containing defaults and ranges of key variables for soundgen() and soundgen_app(). Adjust as needed.
permittedValuespermittedValues
A matrix with 58 rows and 4 columns:
default value
lowest permitted value
highest permitted value
increment for adjustment
...
Produces a phasegram of a sound or another time series, which is a collection of Poincare sections cut through phase portraits of consecutive frames. The x axis is time, just as in a spectrogram, the y axis is a slice through the phase portrait, and the color shows the density of trajectories at each point of the phase portrait.
phasegram( x, samplingRate = NULL, from = NULL, to = NULL, windowLength = 10, step = windowLength/2, timeLag = NULL, theilerWindow = NULL, nonlinStats = c("ed", "d2", "ml", "sur"), pars_ed = list(max.embedding.dim = 15), pars_d2 = list(min.embedding.dim = 2, min.radius = 0.001, n.points.radius = 20), pars_ml = list(min.embedding.dim = 2, radius = 0.001), pars_sur = list(FUN = nonlinearTseries::timeAsymmetry, K = 1), bw = 0.01, bins = 5/bw, reportEvery = NULL, cores = 1, rasterize = FALSE, plot = TRUE, savePlots = NULL, colorTheme = c("bw", "seewave", "heat.colors", "...")[1], col = NULL, xlab = "Time", ylab = "", main = NULL, width = 900, height = 500, units = "px", res = NA, ... )phasegram( x, samplingRate = NULL, from = NULL, to = NULL, windowLength = 10, step = windowLength/2, timeLag = NULL, theilerWindow = NULL, nonlinStats = c("ed", "d2", "ml", "sur"), pars_ed = list(max.embedding.dim = 15), pars_d2 = list(min.embedding.dim = 2, min.radius = 0.001, n.points.radius = 20), pars_ml = list(min.embedding.dim = 2, radius = 0.001), pars_sur = list(FUN = nonlinearTseries::timeAsymmetry, K = 1), bw = 0.01, bins = 5/bw, reportEvery = NULL, cores = 1, rasterize = FALSE, plot = TRUE, savePlots = NULL, colorTheme = c("bw", "seewave", "heat.colors", "...")[1], col = NULL, xlab = "Time", ylab = "", main = NULL, width = 900, height = 500, units = "px", res = NA, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
from, to
|
if NULL (default), analyzes the whole sound, otherwise from...to (s) |
windowLength |
the length of each frame analyzed separately (ms) |
step |
time step between consecutive frames (ms) |
timeLag |
time lag between the original and time-shifted version of each
frame that together represent the phase portrait (ms). Defaults to the
number of steps beyond which the mutual information function reaches its
minimum or, if that fails, the steps until mutual information experiences
the first exponential decay - see |
theilerWindow |
time lag between two points that are considered locally
independent and can be treated as neighbors in the reconstructed phase
space. defaults to the first minimum or, if unavailable, the first zero of
the autocorrelation function (or, failing that, to |
nonlinStats |
nonlinear statistics to report: "ed" = the optimal number of embedding dimensions, "d2" = correlation dimension D2, "ml" = maximum Lyapunov exponent, "sur" = the results of surrogate data testing for stochasticity. These are calculated using the functionality of the package nonlinearTseries, which is seriously slow, so the default is just to get the phasegram itself |
pars_ed |
a list of control parameters passed to
|
pars_d2 |
a list of control parameters passed to
|
pars_ml |
a list of control parameters passed to
|
pars_sur |
a list of control parameters passed to
|
bw |
standard deviation of the smoothing kernel, as in
|
bins |
the number of bins along the Y axis after rasterizing (has no
effect if |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
rasterize |
if FALSE, only plots and returns Poincare sections on the original scale (most graphical parameters will then have no effect); if TRUE, rasterizes the phasegram matrix and plots it with more graphical parameters |
plot |
should a spectrogram be plotted? TRUE / FALSE |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
colorTheme |
black and white ('bw'), as in seewave package ('seewave'),
matlab-type palette ('matlab'), or any palette from
|
col |
actual colors, eg rev(rainbow(100)) - see ?hcl.colors for colors in base R (overrides colorTheme) |
xlab, ylab, main
|
graphical parameters passed to
soundgen:::filled.contour.mod (if |
width, height, units, res
|
graphical parameters for saving plots passed to
|
... |
other graphical parameters passed to soundgen:::filled.contour.mod
(if |
Algorithm: the input sound is normalized to [-1, 1] and divided into
consecutive frames windowLength ms long without multiplying by any
windowing function (unlike in STFT). For each frame, a phase portrait is
obtained by time-shifting the frame by timeLag ms. A Poincare section
is taken through the phase portrait (currently at a fixed angle, namely the
default in poincareMap), giving the
intersection points of trajectories with this bisecting line. The density of
intersections is estimated with a smoothing kernel of bandwidth bw (as
an alternative to using histogram bins). The density distributions per frame
are stacked together into a phasegram (output: "orig"). The ranges of phase
portraits depend on the amplitude of signal in each frame. The resulting
phasegram can optionally be rasterized to smooth it for plotting (output:
"rasterized").
Returns a list of three components: "orig" = the full phasegram;
"rasterized" = a rasterized version. For both, $time is the middle of each
frame (ms), $x is the coordinate along a Poincare section (since the audio
is normalized, the scale is [-1, 1]), and $y is the density of
intersections of system trajectories with the Poincare section. The third
component is $descriptives, which gives the result of nonlinear analysis
per frame. Currently implemented: shannon = Shannon entropy of Poincare
sections, nPeaks = log-number of peaks in the density distribution of
Poincare sections, ml = maximum Lyapunov exponent (positive values suggest
chaos), ed = optimal number of embedding dimensions (shows the complexity
of the reconstructed attractor), d2 = correlation dimension, sur =
probability of stochasticity according to surrogate data testing (0 =
deterministic, 1 = stochastic).
Herbst, C. T., Herzel, H., Švec, J. G., Wyman, M. T., & Fitch, W. T. (2013). Visualization of system dynamics using phasegrams. Journal of the Royal Society Interface, 10(85), 20130288.
Huffaker, R., Huffaker, R. G., Bittelli, M., & Rosa, R. (2017). Nonlinear time series analysis with R. Oxford University Press.
target = soundgen(sylLen = 300, pitch = c(350, 420, 420, 410, 340) * 3, subDep = c(0, 0, 60, 50, 0, 0) / 2, addSilence = 0, plot = TRUE) # Nonlinear statistics are also returned (slow - disable by setting # nonlinStats = NULL if these are not needed) ph = phasegram(target, 16000, nonlinStats = NULL) ## Not run: ph = phasegram(target, 16000, windowLength = 20, step = 20, rasterize = TRUE, bw = .01, bins = 150) ph$descriptives # Unfortunately, phasegrams are greatly affected by noise. Compare: target2 = soundgen(sylLen = 300, pitch = c(350, 420, 420, 410, 340) * 3, subDep = c(0, 0, 60, 50, 0, 0), noise = -30, jitterDep = .4, rolloff = -5, addSilence = 0, plot = TRUE) ph2 = phasegram(target2, 16000, nonlinStats = NULL) # low-pass filtering may help a bit target2_lowpass = bandpass(target2, 16000, upr = 2500) phasegram(target2_lowpass, 16000, nonlinStats = NULL) s2 = soundgen(sylLen = 3000, addSilence = 0, temperature = 1e-6, pitch = c(380, 550, 500, 220), subDep = c(0, 0, 40, 0, 0, 0, 0, 0), amDep = c(0, 0, 0, 0, 80, 0, 0, 0), amFreq = 80, jitterDep = c(0, 0, 0, 0, 0, 3), plot = TRUE, yScale = 'bark') phasegram(s2, 16000, windowLength = 10, nonlinStats = NULL, bw = .001) phasegram(s2, 16000, windowLength = 10, nonlinStats = NULL, bw = .02) ## End(Not run)target = soundgen(sylLen = 300, pitch = c(350, 420, 420, 410, 340) * 3, subDep = c(0, 0, 60, 50, 0, 0) / 2, addSilence = 0, plot = TRUE) # Nonlinear statistics are also returned (slow - disable by setting # nonlinStats = NULL if these are not needed) ph = phasegram(target, 16000, nonlinStats = NULL) ## Not run: ph = phasegram(target, 16000, windowLength = 20, step = 20, rasterize = TRUE, bw = .01, bins = 150) ph$descriptives # Unfortunately, phasegrams are greatly affected by noise. Compare: target2 = soundgen(sylLen = 300, pitch = c(350, 420, 420, 410, 340) * 3, subDep = c(0, 0, 60, 50, 0, 0), noise = -30, jitterDep = .4, rolloff = -5, addSilence = 0, plot = TRUE) ph2 = phasegram(target2, 16000, nonlinStats = NULL) # low-pass filtering may help a bit target2_lowpass = bandpass(target2, 16000, upr = 2500) phasegram(target2_lowpass, 16000, nonlinStats = NULL) s2 = soundgen(sylLen = 3000, addSilence = 0, temperature = 1e-6, pitch = c(380, 550, 500, 220), subDep = c(0, 0, 40, 0, 0, 0, 0, 0), amDep = c(0, 0, 0, 0, 80, 0, 0, 0), amFreq = 80, jitterDep = c(0, 0, 0, 0, 0, 3), plot = TRUE, yScale = 'bark') phasegram(s2, 16000, windowLength = 10, nonlinStats = NULL, bw = .001) phasegram(s2, 16000, windowLength = 10, nonlinStats = NULL, bw = .02) ## End(Not run)
Conversion between phon and sone loudness scales. Source: Timoney, J., Lysaght, T., Schoenwiesner, M., & MacManus, L. (2004). Implementing loudness models in matlab.
phon2sone(phon) sone2phon(sone)phon2sone(phon) sone2phon(sone)
phon |
loudness level, phon (vectorized) |
sone |
loudness in sones (vectorized) |
phon = seq(0, 120, 2) sone = soundgen:::phon2sone(phon) plot(phon, sone, type = 'b') plot(phon, log2(sone), type = 'b') phon2 = soundgen:::sone2phon(sone) plot(phon, phon2); abline(0, 1)phon = seq(0, 120, 2) sone = soundgen:::phon2sone(phon) plot(phon, sone, type = 'b') plot(phon, log2(sone), type = 'b') phon2 = soundgen:::sone2phon(sone) plot(phon, phon2); abline(0, 1)
Starts a shiny app for manually editing pitch contours. The settings in the
panels on the left correspond to arguments to analyze - see
'?analyze' and the vignette on acoustic analysis for help and examples. You
can verify the pitch contours first, and then feed them back into
analyze (see examples).
pitch_app(...)pitch_app(...)
... |
presets like |
A list with the last used settings ($settings) plus the output of
analyze() for each file from the last file queue with two additional
columns: "time" and "pitch". NB: only the results of the most recent file
queue are returned, so don't press "Load audio" repeatedly if you need the
output returned to R (the csv file with results should still be saved
correctly). When proceeding to the next file in the cue, two types of
backups are created. (1) A global object called "my_pitch" is created or
updated. This list becomes visible when the app is terminated, and it
contains the usual outputs of analyze() ($detailed and $summary) plus lists
of manually corrected voiced and voiceless frames. (2) The app saves to
disk a .csv file with one row per audio file. Apart from the usual
descriptives from analyze(), there are two additional columns: "time" with
time stamps (the midpoint of each STFT frame, ms) and "pitch" with the
manually corrected pitch values for each frame (Hz). When the orange
"Download results" button is clicked, a context menu pops up offering to
terminate the app - if that happens, the results are also returned directly
into R. To process pitch contours further in R, work directly with
my_pitch[[myfile]]$time and my_pitch[[myfile]]$pitch or, if
loading the csv file, do something like:
a = read.csv('~/Downloads/output.csv', stringsAsFactors = FALSE)
pitch = as.numeric(unlist(strsplit(a$pitch, ',')))
mean(pitch, na.rm = TRUE); sd(pitch, na.rm = TRUE)
Suggested workflow
Start by setting the basic analysis settings such as pitchFloor, pitchCeiling, silence, etc. Then click "Load audio" to upload one or several audio files (wav/mp3). Long files will be very slow, so please cut your audio into manageable chunks (ideally <10 s). If Shiny complains that maximum upload size is exceeded, you can increase it, say to 30 MB, with 'options(shiny.maxRequestSize = 30 * 1024^2)'. Once the audio has been uploaded to the browser, fine-tune the analysis settings as needed, edit the pitch contour in the first file to your satisfaction, then click "Next" to proceed to the next file, etc. Remember that setting a reasonable prior is often faster than adjusting the contour one anchor at a time. When done, click "Save results". If working with many files, you might want to save the results occasionally in case the app crashes (although you should still be able to recover your data if it does - see below).
How to edit pitch contours
Left-click to add a new anchor, double-click to remove it or unvoice the frame. Each time you make a change, the entire pitch contour is re-fit, so making a change in one frame can affect the path through candidates in adjacent frames. You can control this behavior by changing the settings in Out/Path and Out/Smoothing. If correctly configured, the app corrects the contour with only a few manual values - you shouldn't need to manually edit every single frame. For longer files, you can zoom in/out and navigate within the file. You can also select a region to voice/unvoice or shift it as a whole or to set a prior based on selected frequency range.
Recovering lost data
Every time you click "next" or "last" to move in between files in the queue, the output you've got so far is saved in a backup file called "temp.csv", and the "my_pitch" global object is updated. If the app crashes or is closed without saving the results, this backup file preserves your data. To recover it, access this file manually on disk or simply restart pitch_app() - a dialog box will pop up and ask whether you wank to append the old data to the new one. Path to backup file: "R_installation_folder/soundgen/shiny/pitch_app/www/temp.csv", for example, "/home/allgoodguys/R/x86_64-pc-linux-gnu-library/3.6/soundgen/shiny/pitch_app/www/temp.csv"
## Not run: # Recommended workflow for analyzing a lot of short audio files path_to_audio = '~/Downloads/temp' # our audio lives here # STEP 1: extract manually corrected pitch contours my_pitch = pitch_app() # runs in default browser such as Firefox or Chrome # To change system default browser, run something like: options('browser' = '/usr/bin/firefox') # path to the executable on Linux # You can pass presets with your preferred parameter values: my_pitch = pitch_app(windowLength = 20, step = 10, pitchMethods = c('dom', 'autocor', 'cep'), ylim = c(0.1, 3)) # full list of parameters that can be passed to pitch_app(): # paste0(c(names(input)[which(names(input) %in% rownames(defaults_analyze))], # 'pitchMethods', 'summaryFun', 'summaryFun_text', 'pathfinding', 'spec_ylim', # 'spec_colorTheme', 'osc', 'wn'), collapse = ', ') # Object "my_pitch" contains the output, notably the time-pitch matrix plot(my_pitch[[1]]$detailed$time, my_pitch[[1]]$detailed$pitch, type = 'b', xlab = 'Time, ms', ylab = 'Pitch, Hz') # Run the app with previously used settings my_pitch2 = do.call(pitch_app, my_pitch$settings) # save the complete output, including the settings used saveRDS(my_pitch2, 'my_pitch_analysis.rds') # STEP 2: run analyze() with manually corrected pitch contours to obtain # accurate descriptives like the proportion of energy in harmonics above f0, # etc. This also gives you formants and loudness estimates (disabled in # pitch_app to speed things up) df2 = analyze(path_to_audio, pitchMethods = 'autocor', # only needed for HNR nFormants = 5, # now we can measure formants as well pitchManual = my_pitch # or, if loading the output of pitch_app() from the disk: # pitchManual = '~/Downloads/output.csv' # pitchManual = '~/path_to_some_folder/my_pitch_contours.rds # etc ) # STEP 3: add other acoustic descriptors, for ex. df3 = segment(path_to_audio) # STEP 4: merge df2, df3, df4, ... in R or a spreadsheet editor to have all # acoustic descriptives together # To verify your pitch contours and/or edit them later, copy output.csv to # the folder with your audio, run pitch_app(), and load the audio + csv # together. The saved pitch contours are treated as manual anchors ## End(Not run)## Not run: # Recommended workflow for analyzing a lot of short audio files path_to_audio = '~/Downloads/temp' # our audio lives here # STEP 1: extract manually corrected pitch contours my_pitch = pitch_app() # runs in default browser such as Firefox or Chrome # To change system default browser, run something like: options('browser' = '/usr/bin/firefox') # path to the executable on Linux # You can pass presets with your preferred parameter values: my_pitch = pitch_app(windowLength = 20, step = 10, pitchMethods = c('dom', 'autocor', 'cep'), ylim = c(0.1, 3)) # full list of parameters that can be passed to pitch_app(): # paste0(c(names(input)[which(names(input) %in% rownames(defaults_analyze))], # 'pitchMethods', 'summaryFun', 'summaryFun_text', 'pathfinding', 'spec_ylim', # 'spec_colorTheme', 'osc', 'wn'), collapse = ', ') # Object "my_pitch" contains the output, notably the time-pitch matrix plot(my_pitch[[1]]$detailed$time, my_pitch[[1]]$detailed$pitch, type = 'b', xlab = 'Time, ms', ylab = 'Pitch, Hz') # Run the app with previously used settings my_pitch2 = do.call(pitch_app, my_pitch$settings) # save the complete output, including the settings used saveRDS(my_pitch2, 'my_pitch_analysis.rds') # STEP 2: run analyze() with manually corrected pitch contours to obtain # accurate descriptives like the proportion of energy in harmonics above f0, # etc. This also gives you formants and loudness estimates (disabled in # pitch_app to speed things up) df2 = analyze(path_to_audio, pitchMethods = 'autocor', # only needed for HNR nFormants = 5, # now we can measure formants as well pitchManual = my_pitch # or, if loading the output of pitch_app() from the disk: # pitchManual = '~/Downloads/output.csv' # pitchManual = '~/path_to_some_folder/my_pitch_contours.rds # etc ) # STEP 3: add other acoustic descriptors, for ex. df3 = segment(path_to_audio) # STEP 4: merge df2, df3, df4, ... in R or a spreadsheet editor to have all # acoustic descriptives together # To verify your pitch contours and/or edit them later, copy output.csv to # the folder with your audio, run pitch_app(), and load the audio + csv # together. The saved pitch contours are treated as manual anchors ## End(Not run)
A dataframe of 260 rows and two columns: "file" for filename in the corpus (Anikin & Persson, 2017) and "pitch" for pitch values per frame. The corpus can be downloaded from http://cogsci.se/publications.html
pitchContourpitchContour
An object of class data.frame with 260 rows and 2 columns.
Provides common descriptives of time series such as pitch contours, including measures of average / range / variability / slope / inflections etc. Several degrees of smoothing can be applied consecutively. The summaries are produced on the original and log-transformed scales, so this is meant to be used on frequency-related variables in Hz.
pitchDescriptives( x, step = NULL, timeUnit, smoothBW = c(NA, 10, 1), inflThres = 0.2, extraSummaryFun = c(), ref = 16.35, plot = FALSE )pitchDescriptives( x, step = NULL, timeUnit, smoothBW = c(NA, 10, 1), inflThres = 0.2, extraSummaryFun = c(), ref = 16.35, plot = FALSE )
x |
input: numeric vector, a list of time stamps and values in rows, a
dataframe with one row per file and time/pitch values stored as characters
(as exported by |
step |
distance between values in s (only needed if input is a vector) |
timeUnit |
specify whether the time stamps (if any) are in ms or s |
smoothBW |
a vector of bandwidths (Hz) for consecutive smoothing of
input using |
inflThres |
minimum difference (in semitones) between consecutive
extrema to consider them inflections; to apply a different threshold at
each smoothing level, provide |
extraSummaryFun |
additional summary function(s) that take a numeric vector with some NAs and return a single number, eg c('myFun1', 'myFun2') |
ref |
reference value for transforming Hz to semitones, defaults to C0 (16.35 Hz) |
plot |
if TRUE, plots the inflections for manual verification |
Returns a dataframe with columns containing summaries of one or multiple inputs (one input per row). The descriptives are as follows:
total duration, s
duration after omitting leading and trailing NAs
proportion of input with non-NA value, eg proportion of voiced frames if the input is pitch
the first and last values on the original scale and in octaves above C0 (16.3516 Hz)
average and extreme values on the original scale
same in octaves above C0
the location of minimum and maximum relative to durDefined, 0 to 1
range and standard deviation on the original scale and in semitones
coefficient of variation = sd/mean (provided for historical reasons)
mean slope in Hz/s or semitones/s (NB: does not depend on duration or missing values)
mean absolute slope (modulus, ie rising and falling sections no longer cancel out)
the steepest slope
x = c(NA, NA, 405, 441, 459, 459, 460, 462, 462, 458, 458, 445, 458, 451, 444, 444, 430, 416, 409, 403, 403, 389, 375, NA, NA, NA, NA, NA, NA, NA, NA, NA, 183, 677, 677, 846, 883, 886, 924, 938, 883, 946, 846, 911, 826, 826, 788, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, 307, 307, 368, 377, 383, 383, 383, 380, 377, 377, 377, 374, 374, 375, 375, 375, 375, 368, 371, 374, 375, 361, 375, 389, 375, 375, 375, 375, 375, 314, 169, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, 238, 285, 361, 374, 375, 375, 375, 375, 375, 389, 403, 389, 389, 375, 375, 389, 375, 348, 361, 375, 348, 348, 361, 348, 342, 361, 361, 361, 365, 365, 361, 966, 966, 966, 959, 959, 946, 1021, 1021, 1026, 1086, 1131, 1131, 1146, 1130, 1172, 1240, 1172, 1117, 1103, 1026, 1026, 966, 919, 946, 882, 832, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA) plot(x, type = 'b') ci95 = function(x) diff(quantile(na.omit(x), probs = c(.025, .975))) pd = pitchDescriptives( x, step = .025, timeUnit = 's', smoothBW = c(NA, 10, 1), # original + smoothed at 10 Hz and 1 Hz inflThres = c(NA, .2, .2), # different for each level of smoothing extraSummaryFun = 'ci95', # user-defined, here 95% coverage interval plot = TRUE ) pd ## Not run: # a single file data(sheep, package = 'seewave') a = analyze(sheep) pd1 = pitchDescriptives(a$detailed[, c('time', 'pitch')], timeUnit = 'ms', inflThres = NA, plot = TRUE) pd2 = pitchDescriptives(a$detailed[, c('time', 'pitch')], timeUnit = 'ms', inflThres = c(0.1, 0.1, .5), plot = TRUE) # multiple files returned by analyze() an = analyze('~/Downloads/temp') pd = pitchDescriptives(an$detailed, timeUnit = 'ms') pd # multiple files returned by pitch_app() pd = pitchDescriptives( '~/Downloads/pitch_manual_1708.csv', timeUnit = 'ms', smoothBW = c(NA, 2), inflThres = .25) # a single file, exported from Praat par(mfrow = c(3, 1)) pd = pitchDescriptives( '~/Downloads/F-Hin-Om_jana.wav_F0contour.txt', timeUnit = 's', smoothBW = c(NA, 25, 2), inflThres = .25, plot = TRUE) par(mfrow = c(1, 1)) ## End(Not run)x = c(NA, NA, 405, 441, 459, 459, 460, 462, 462, 458, 458, 445, 458, 451, 444, 444, 430, 416, 409, 403, 403, 389, 375, NA, NA, NA, NA, NA, NA, NA, NA, NA, 183, 677, 677, 846, 883, 886, 924, 938, 883, 946, 846, 911, 826, 826, 788, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, 307, 307, 368, 377, 383, 383, 383, 380, 377, 377, 377, 374, 374, 375, 375, 375, 375, 368, 371, 374, 375, 361, 375, 389, 375, 375, 375, 375, 375, 314, 169, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, 238, 285, 361, 374, 375, 375, 375, 375, 375, 389, 403, 389, 389, 375, 375, 389, 375, 348, 361, 375, 348, 348, 361, 348, 342, 361, 361, 361, 365, 365, 361, 966, 966, 966, 959, 959, 946, 1021, 1021, 1026, 1086, 1131, 1131, 1146, 1130, 1172, 1240, 1172, 1117, 1103, 1026, 1026, 966, 919, 946, 882, 832, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA) plot(x, type = 'b') ci95 = function(x) diff(quantile(na.omit(x), probs = c(.025, .975))) pd = pitchDescriptives( x, step = .025, timeUnit = 's', smoothBW = c(NA, 10, 1), # original + smoothed at 10 Hz and 1 Hz inflThres = c(NA, .2, .2), # different for each level of smoothing extraSummaryFun = 'ci95', # user-defined, here 95% coverage interval plot = TRUE ) pd ## Not run: # a single file data(sheep, package = 'seewave') a = analyze(sheep) pd1 = pitchDescriptives(a$detailed[, c('time', 'pitch')], timeUnit = 'ms', inflThres = NA, plot = TRUE) pd2 = pitchDescriptives(a$detailed[, c('time', 'pitch')], timeUnit = 'ms', inflThres = c(0.1, 0.1, .5), plot = TRUE) # multiple files returned by analyze() an = analyze('~/Downloads/temp') pd = pitchDescriptives(an$detailed, timeUnit = 'ms') pd # multiple files returned by pitch_app() pd = pitchDescriptives( '~/Downloads/pitch_manual_1708.csv', timeUnit = 'ms', smoothBW = c(NA, 2), inflThres = .25) # a single file, exported from Praat par(mfrow = c(3, 1)) pd = pitchDescriptives( '~/Downloads/F-Hin-Om_jana.wav_F0contour.txt', timeUnit = 's', smoothBW = c(NA, 25, 2), inflThres = .25, plot = TRUE) par(mfrow = c(1, 1)) ## End(Not run)
A vector of manually verified pitch values per sound in the corpus of 590 human non-linguistic emotional vocalizations from Anikin & Persson (2017). The corpus can be downloaded from http://cogsci.se/publications.html
pitchManualpitchManual
An object of class numeric of length 260.
Smoothes an intonation (pitch) contour with a low-pass filter, as in Praat
(http://www.fon.hum.uva.nl/praat/). Algorithm: interpolates missing values
(voiceless frames), performs FFT to obtain the spectrum, multiplies by a
Gaussian filter, performs an inverse FFT, and fills the missing values back
in. The bandwidth parameter is about half the cutoff frequency (ie
some frequencies will still be present up to ~2 * bandwidth)
pitchSmoothPraat(pitch, bandwidth, samplingRate, plot = FALSE)pitchSmoothPraat(pitch, bandwidth, samplingRate, plot = FALSE)
pitch |
numeric vector of pitch values (NA = voiceless) |
bandwidth |
the bandwidth of low-pass filter, Hz (high = less smoothing, close to zero = more smoothing) |
samplingRate |
the number of pitch values per second |
plot |
if TRUE, plots the original and smoothed pitch contours |
pitch = c(NA, NA, 405, 441, 459, 459, 460, 462, 462, 458, 458, 445, 458, 451, 444, 444, 430, 416, 409, 403, 403, 389, 375, NA, NA, NA, NA, NA, NA, NA, NA, NA, 183, 677, 677, 846, 883, 886, 924, 938, 883, 946, 846, 911, 826, 826, 788, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, 307, 307, 368, 377, 383, 383, 383, 380, 377, 377, 377, 374, 374, 375, 375, 375, 375, 368, 371, 374, 375, 361, 375, 389, 375, 375, 375, 375, 375, 314, 169, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, 238, 285, 361, 374, 375, 375, 375, 375, 375, 389, 403, 389, 389, 375, 375, 389, 375, 348, 361, 375, 348, 348, 361, 348, 342, 361, 361, 361, 365, 365, 361, 966, 966, 966, 959, 959, 946, 1021, 1021, 1026, 1086, 1131, 1131, 1146, 1130, 1172, 1240, 1172, 1117, 1103, 1026, 1026, 966, 919, 946, 882, 832, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA) pitchSmoothPraat(pitch, bandwidth = 10, samplingRate = 40, plot = TRUE) pitchSmoothPraat(pitch, bandwidth = 2, samplingRate = 40, plot = TRUE)pitch = c(NA, NA, 405, 441, 459, 459, 460, 462, 462, 458, 458, 445, 458, 451, 444, 444, 430, 416, 409, 403, 403, 389, 375, NA, NA, NA, NA, NA, NA, NA, NA, NA, 183, 677, 677, 846, 883, 886, 924, 938, 883, 946, 846, 911, 826, 826, 788, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, 307, 307, 368, 377, 383, 383, 383, 380, 377, 377, 377, 374, 374, 375, 375, 375, 375, 368, 371, 374, 375, 361, 375, 389, 375, 375, 375, 375, 375, 314, 169, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA, 238, 285, 361, 374, 375, 375, 375, 375, 375, 389, 403, 389, 389, 375, 375, 389, 375, 348, 361, 375, 348, 348, 361, 348, 342, 361, 361, 361, 365, 365, 361, 966, 966, 966, 959, 959, 946, 1021, 1021, 1026, 1086, 1131, 1131, 1146, 1130, 1172, 1240, 1172, 1117, 1103, 1026, 1026, 966, 919, 946, 882, 832, NA, NA, NA, NA, NA, NA, NA, NA, NA, NA) pitchSmoothPraat(pitch, bandwidth = 10, samplingRate = 40, plot = TRUE) pitchSmoothPraat(pitch, bandwidth = 2, samplingRate = 40, plot = TRUE)
Plays one or more sounds: wav/mp3 file(s), Wave objects, or numeric vectors.
This is a simple wrapper for the functionality provided by
play. Recommended players on Linux: "play" from the
"vox" library (default), "aplay".
playme(x, samplingRate = 16000, player = NULL, from = NULL, to = NULL)playme(x, samplingRate = 16000, player = NULL, from = NULL, to = NULL)
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
player |
the name of player to use, eg "aplay", "play", "vlc", etc.
Defaults to "play" on Linux, "afplay" on MacOS, and tuneR default on
Windows. In case of errors, try setting another default player for
|
from, to
|
play a selected time range (s) |
## Not run: # Play an audio file: playme('pathToMyAudio/audio.wav') # Create and play a numeric vector: f0_Hz = 440 sound = sin(2 * pi * f0_Hz * (1:16000) / 16000) playme(sound, 16000) playme(sound, 16000, from = .1, to = .5) # play from 100 to 500 ms # In case of errors, look into tuneR::play(). For ex., you might need to # specify which player to use: playme(sound, 16000, player = 'aplay') # To avoid doing it all the time, set the default player: tuneR::setWavPlayer('aplay') playme(sound, 16000) # should now work without specifying the player ## End(Not run)## Not run: # Play an audio file: playme('pathToMyAudio/audio.wav') # Create and play a numeric vector: f0_Hz = 440 sound = sin(2 * pi * f0_Hz * (1:16000) / 16000) playme(sound, 16000) playme(sound, 16000, from = .1, to = .5) # play from 100 to 500 ms # In case of errors, look into tuneR::play(). For ex., you might need to # specify which player to use: playme(sound, 16000, player = 'aplay') # To avoid doing it all the time, set the default player: tuneR::setWavPlayer('aplay') playme(sound, 16000) # should now work without specifying the player ## End(Not run)
Plots a single modulation spectrum returned by
modulationSpectrum. The result is the same as the plot produced
by modulationSpectrum, but calling plotMS is handy for
processed modulation spectra - for instance, for plotting the difference
between the modulation spectra of two sounds or groups of sounds.
plotMS( ms, X = as.numeric(colnames(ms)), Y = as.numeric(rownames(ms)), quantiles = c(0.5, 0.8, 0.9), colorTheme = c("bw", "seewave", "heat.colors", "...")[1], col = NULL, logWarpX = NULL, logWarpY = NULL, main = NULL, xlab = "Hz", ylab = "1/kHz", xlim = NULL, ylim = NULL, audio = NULL, extraY = TRUE, ... )plotMS( ms, X = as.numeric(colnames(ms)), Y = as.numeric(rownames(ms)), quantiles = c(0.5, 0.8, 0.9), colorTheme = c("bw", "seewave", "heat.colors", "...")[1], col = NULL, logWarpX = NULL, logWarpY = NULL, main = NULL, xlab = "Hz", ylab = "1/kHz", xlim = NULL, ylim = NULL, audio = NULL, extraY = TRUE, ... )
ms |
modulation spectrum - a matrix with temporal modulation in columns
and spectral modulation in rows, as returned by
|
X, Y
|
rownames and colnames of |
quantiles |
labeled contour values, % (e.g., "50" marks regions that contain 50% of the sum total of the entire modulation spectrum) |
colorTheme |
black and white ('bw'), as in seewave package ('seewave'),
matlab-type palette ('matlab'), or any palette from
|
col |
actual colors, eg rev(rainbow(100)) - see ?hcl.colors for colors in base R (overrides colorTheme) |
logWarpX, logWarpY
|
numeric vector of length 2: c(sigma, base) of pseudolog-warping the modulation spectrum, as in function pseudo_log_trans() from the "scales" package |
xlab, ylab, main, xlim, ylim
|
graphical parameters |
audio |
(internal) a list of audio attributes |
extraY |
if TRUE, another Y-axis is plotted on the right showing 1000/Y |
... |
other graphical parameters passed on to |
ms1 = modulationSpectrum(runif(4000), samplingRate = 16000, plot = TRUE) plotMS(ms1$processed) # identical to above # compare two modulation spectra ms2 = modulationSpectrum(soundgen(sylLen = 100, addSilence = 0), samplingRate = 16000) # ensure the two matrices have the same dimensions ms2_resized = soundgen:::interpolMatrix(ms2$original, nr = nrow(ms1$original), nc = ncol(ms1$original)) # plot the difference plotMS(log(ms1$original / ms2_resized), quantile = NULL, col = colorRampPalette(c('blue', 'yellow')) (50))ms1 = modulationSpectrum(runif(4000), samplingRate = 16000, plot = TRUE) plotMS(ms1$processed) # identical to above # compare two modulation spectra ms2 = modulationSpectrum(soundgen(sylLen = 100, addSilence = 0), samplingRate = 16000) # ensure the two matrices have the same dimensions ms2_resized = soundgen:::interpolMatrix(ms2$original, nr = nrow(ms1$original), nc = ncol(ms1$original)) # plot the difference plotMS(log(ms1$original / ms2_resized), quantile = NULL, col = colorRampPalette(c('blue', 'yellow')) (50))
A library of presets for easy generation of a few nice sounds.
presetspresets
A list of length 4.
Exaggerates or flattens the intonation by performing a dynamic pitch shift,
changing pitch excursion from its original median value without changing the
formants. This is a particular case of pitch shifting, which is performed
with shiftPitch. The result is likely to be improved if
manually corrected pitch contours are provided. Depending on the nature of
audio, the settings that control pitch shifting may also need to be
fine-tuned with the shiftPitch_pars argument.
prosody( x, samplingRate = NULL, multProsody, analyze_pars = list(), shiftPitch_pars = list(), pitchManual = NULL, play = FALSE, saveAudio = NULL, reportEvery = NULL, cores = 1, plot = FALSE, savePlots = NULL, width = 900, height = 500, units = "px", res = NA, ... )prosody( x, samplingRate = NULL, multProsody, analyze_pars = list(), shiftPitch_pars = list(), pitchManual = NULL, play = FALSE, saveAudio = NULL, reportEvery = NULL, cores = 1, plot = FALSE, savePlots = NULL, width = 900, height = 500, units = "px", res = NA, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
multProsody |
multiplier of pitch excursion from median (on a logarithmic or musical scale): >1 = exaggerate intonation, 1 = no change, <1 = flatten, 0 = completely flat at the original median pitch |
analyze_pars |
a list of parameters to pass to |
shiftPitch_pars |
a list of parameters to pass to
|
pitchManual |
manually corrected pitch contour. For a single sound,
provide a numeric vector of any length. For multiple sounds, provide a
dataframe with columns "file" and "pitch" (or path to a csv file) as
returned by |
play |
if TRUE, plays the processed audio |
saveAudio |
full (!) path to folder for saving the processed audio; NULL = don't save, ” = same as input folder (NB: overwrites the originals!) |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
plot |
should a spectrogram be plotted? TRUE / FALSE |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
width, height, units, res
|
graphical parameters for saving plots passed to
|
... |
other graphical parameters |
If the input is a single audio (file, Wave, or numeric vector), returns the processed waveform as a numeric vector with the original sampling rate and scale. If the input is a folder with several audio files, returns a list of processed waveforms, one for each file.
s = soundgen(sylLen = 200, pitch = c(150, 220), addSilence = 50, plot = TRUE, yScale = 'log') # playme(s) s1 = prosody(s, 16000, multProsody = 2, analyze_pars = list(windowLength = 30, step = 15), shiftPitch_pars = list(windowLength = 20, step = 5, freqWindow = 300), plot = TRUE) # playme(s1) # spectrogram(s1, 16000, yScale = 'log') ## Not run: # Flat intonation - remove all frequency modulation s2 = prosody(s, 16000, multProsody = 0, analyze_pars = list(windowLength = 30, step = 15), shiftPitch_pars = list(windowLength = 20, step = 1, freqWindow = 500), plot = TRUE) playme(s2) spectrogram(s2, 16000, yScale = 'log') # Download an example - a bit of speech (sampled at 16000 Hz) download.file('http://cogsci.se/soundgen/audio/speechEx.wav', destfile = '~/Downloads/temp1/speechEx.wav') target = '~/Downloads/temp1/speechEx.wav' samplingRate = tuneR::readWave(target)@samp.rate spectrogram(target, yScale = 'log') playme(target) s3 = prosody(target, multProsody = 1.5, analyze_pars = list(windowLength = 30, step = 15), shiftPitch_pars = list(freqWindow = 400, propagation = 'adaptive')) spectrogram(s3, tuneR::readWave(target)@samp.rate, yScale = 'log') playme(s3) # process all audio files in a folder s4 = prosody('~/Downloads/temp', multProsody = 2, savePlots = '', saveAudio = '~/Downloads/temp/prosody') str(s4) # returns a list with audio (+ saves it to disk) ## End(Not run)s = soundgen(sylLen = 200, pitch = c(150, 220), addSilence = 50, plot = TRUE, yScale = 'log') # playme(s) s1 = prosody(s, 16000, multProsody = 2, analyze_pars = list(windowLength = 30, step = 15), shiftPitch_pars = list(windowLength = 20, step = 5, freqWindow = 300), plot = TRUE) # playme(s1) # spectrogram(s1, 16000, yScale = 'log') ## Not run: # Flat intonation - remove all frequency modulation s2 = prosody(s, 16000, multProsody = 0, analyze_pars = list(windowLength = 30, step = 15), shiftPitch_pars = list(windowLength = 20, step = 1, freqWindow = 500), plot = TRUE) playme(s2) spectrogram(s2, 16000, yScale = 'log') # Download an example - a bit of speech (sampled at 16000 Hz) download.file('http://cogsci.se/soundgen/audio/speechEx.wav', destfile = '~/Downloads/temp1/speechEx.wav') target = '~/Downloads/temp1/speechEx.wav' samplingRate = tuneR::readWave(target)@samp.rate spectrogram(target, yScale = 'log') playme(target) s3 = prosody(target, multProsody = 1.5, analyze_pars = list(windowLength = 30, step = 15), shiftPitch_pars = list(freqWindow = 400, propagation = 'adaptive')) spectrogram(s3, tuneR::readWave(target)@samp.rate, yScale = 'log') playme(s3) # process all audio files in a folder s4 = prosody('~/Downloads/temp', multProsody = 2, savePlots = '', saveAudio = '~/Downloads/temp/prosody') str(s4) # returns a list with audio (+ saves it to disk) ## End(Not run)
Provides a nicely formatted "estimated time left" in loops plus a summary upon completion.
reportTime( i, time_start, nIter = NULL, reportEvery = NULL, jobs = NULL, prefix = "" )reportTime( i, time_start, nIter = NULL, reportEvery = NULL, jobs = NULL, prefix = "" )
i |
current iteration |
time_start |
time when the loop started running |
nIter |
total number of iterations |
reportEvery |
report progress every n iterations |
jobs |
vector of length |
prefix |
a string to print before "Done...", eg "Chain 1: " |
time_start = proc.time() nIter = 100 for (i in 1:nIter) { Sys.sleep(i ^ 1.02 / 10000) reportTime(i, time_start, nIter, jobs = (1:100) ^ 1.02, prefix = 'Chain 1: ') } ## Not run: # Unknown number of iterations: time_start = proc.time() for (i in 1:20) { Sys.sleep(i ^ 2 / 10000) reportTime(i = i, time_start = time_start, jobs = (1:20) ^ 2, reportEvery = 5) } # when analyzing a bunch of audio files, their size is a good estimate # of how long each will take to process time_start = proc.time() filenames = list.files('~/Downloads/temp', pattern = "*.wav|.mp3", full.names = TRUE) filesizes = file.info(filenames)$size for (i in seq_along(filenames)) { # ...do what you have to do with each file... reportTime(i = i, time_start = time_start, nIter = length(filenames), jobs = filesizes) } ## End(Not run)time_start = proc.time() nIter = 100 for (i in 1:nIter) { Sys.sleep(i ^ 1.02 / 10000) reportTime(i, time_start, nIter, jobs = (1:100) ^ 1.02, prefix = 'Chain 1: ') } ## Not run: # Unknown number of iterations: time_start = proc.time() for (i in 1:20) { Sys.sleep(i ^ 2 / 10000) reportTime(i = i, time_start = time_start, jobs = (1:20) ^ 2, reportEvery = 5) } # when analyzing a bunch of audio files, their size is a good estimate # of how long each will take to process time_start = proc.time() filenames = list.files('~/Downloads/temp', pattern = "*.wav|.mp3", full.names = TRUE) filesizes = file.info(filenames)$size for (i in seq_along(filenames)) { # ...do what you have to do with each file... reportTime(i = i, time_start = time_start, nIter = length(filenames), jobs = filesizes) } ## End(Not run)
Changes the sampling rate without introducing artefacts like aliasing. Best
for relatively short vectors that require special care (eg pitch contours
that contain NAs, which need to be dropped or preserved) as the algorithm is
too slow for long sounds. Algorithm: to downsample, applies a low-pass
filter, then decimates with approx; to upsample, performs linear
interpolation with approx, then applies a low-pass filter. NAs can be
interpolated or preserved in the output. The length of output is determined,
in order of precedence, by len / mult / samplingRate_new. For simple
vector operations, this is very similar to approx, but the leading and
trailing NAs are also preserved (see examples).
resample( x, samplingRate = NULL, samplingRate_new = NULL, mult = NULL, len = NULL, lowPass = TRUE, na.rm = FALSE, reportEvery = NULL, cores = 1, saveAudio = NULL, plot = FALSE, savePlots = NULL, width = 900, height = 500, units = "px", res = NA, ... )resample( x, samplingRate = NULL, samplingRate_new = NULL, mult = NULL, len = NULL, lowPass = TRUE, na.rm = FALSE, reportEvery = NULL, cores = 1, saveAudio = NULL, plot = FALSE, savePlots = NULL, width = 900, height = 500, units = "px", res = NA, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
samplingRate_new |
an alternative to |
mult |
multiplier of sampling rate: new sampling rate = old sampling rate x mult, so 1 = no effect, >1 = upsample, <1 = downsample |
len |
if specified, overrides mult and samplingRate_new and simply
returns a vector of length |
lowPass |
if TRUE, applies a low-pass filter before decimating or after upsampling to avoid aliasing |
na.rm |
if TRUE, NAs are interpolated, otherwise they are preserved in the output |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
saveAudio |
full path to the folder in which to save audio files (one per detected syllable) |
plot |
should a spectrogram be plotted? TRUE / FALSE |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
width, height, units, res
|
graphical parameters for saving plots passed to
|
... |
other graphical parameters |
## Example 1: a short vector with NAs x = c(NA, 1, 2, 3, NA, NA, 6, 7, 8, NA) # upsample resample(x, mult = 3.5, lowPass = FALSE, plot = TRUE) # just approx resample(x, mult = 3.5, lowPass = TRUE, plot = TRUE) # low-pass + approx resample(x, mult = 3.5, lowPass = FALSE, na.rm = TRUE, plot = TRUE) # downsample resample(x, mult = 0.5, lowPass = TRUE, plot = TRUE) resample(x, mult = 0.5, na.rm = TRUE, plot = TRUE) resample(x, len = 5, na.rm = TRUE, plot = TRUE) # same # The most important TIP: use resample() for audio files and the internal # soundgen:::.resample(list(sound = ...)) for simple vector operations because # it's >1000 times faster. For example: soundgen:::.resample(list(sound = x), mult = 3.5, lowPass = FALSE) ## Example 2: a sound silence = rep(0, 10) samplingRate = 1000 fr = seq(100, 300, length.out = 400) x = c(silence, sin(cumsum(fr) * 2 * pi / samplingRate), silence) spectrogram(x, samplingRate) # downsample x1 = resample(x, mult = 1 / 2.5) spectrogram(x1, samplingRate / 2.5) # no aliasing # cf: x1bad = resample(x, mult = 1 / 2.5, lowPass = FALSE) spectrogram(x1bad, samplingRate / 2.5) # aliasing # upsample x2 = resample(x, mult = 3) spectrogram(x2, samplingRate * 3) # nothing above the old Nyquist # cf: x2bad = resample(x, mult = 3, lowPass = FALSE) spectrogram(x2bad, samplingRate * 3) # high-frequency artefacts ## Not run: # Example 3: resample all audio files in a folder to 8000 Hz resample('~/Downloads/temp', saveAudio = '~/Downloads/temp/sr8000/', samplingRate_new = 8000, savePlots = '~/Downloads/temp/sr8000/') ## End(Not run)## Example 1: a short vector with NAs x = c(NA, 1, 2, 3, NA, NA, 6, 7, 8, NA) # upsample resample(x, mult = 3.5, lowPass = FALSE, plot = TRUE) # just approx resample(x, mult = 3.5, lowPass = TRUE, plot = TRUE) # low-pass + approx resample(x, mult = 3.5, lowPass = FALSE, na.rm = TRUE, plot = TRUE) # downsample resample(x, mult = 0.5, lowPass = TRUE, plot = TRUE) resample(x, mult = 0.5, na.rm = TRUE, plot = TRUE) resample(x, len = 5, na.rm = TRUE, plot = TRUE) # same # The most important TIP: use resample() for audio files and the internal # soundgen:::.resample(list(sound = ...)) for simple vector operations because # it's >1000 times faster. For example: soundgen:::.resample(list(sound = x), mult = 3.5, lowPass = FALSE) ## Example 2: a sound silence = rep(0, 10) samplingRate = 1000 fr = seq(100, 300, length.out = 400) x = c(silence, sin(cumsum(fr) * 2 * pi / samplingRate), silence) spectrogram(x, samplingRate) # downsample x1 = resample(x, mult = 1 / 2.5) spectrogram(x1, samplingRate / 2.5) # no aliasing # cf: x1bad = resample(x, mult = 1 / 2.5, lowPass = FALSE) spectrogram(x1bad, samplingRate / 2.5) # aliasing # upsample x2 = resample(x, mult = 3) spectrogram(x2, samplingRate * 3) # nothing above the old Nyquist # cf: x2bad = resample(x, mult = 3, lowPass = FALSE) spectrogram(x2bad, samplingRate * 3) # high-frequency artefacts ## Not run: # Example 3: resample all audio files in a folder to 8000 Hz resample('~/Downloads/temp', saveAudio = '~/Downloads/temp/sr8000/', samplingRate_new = 8000, savePlots = '~/Downloads/temp/sr8000/') ## End(Not run)
Adds reverberation and/or echo to a sound. Algorithm for reverb: adds time-shifted copies of the signal weighted by a decay function, which is analogous to convoluting the input with a parametric model of some hypothetical impulse response function. In simple terms: we specify how much and when the sound rebounds back (as from a wall) and add these time-shifted copies to the original, optionally with some spectral filtering.
reverb( x, samplingRate = NULL, echoDelay = 200, echoLevel = -20, reverbDelay = 70, reverbSpread = 130, reverbLevel = -25, reverbDensity = 50, reverbType = "gaussian", filter = list(), dynamicRange = 80, output = c("audio", "detailed")[1], play = FALSE, reportEvery = NULL, cores = 1, saveAudio = NULL )reverb( x, samplingRate = NULL, echoDelay = 200, echoLevel = -20, reverbDelay = 70, reverbSpread = 130, reverbLevel = -25, reverbDensity = 50, reverbType = "gaussian", filter = list(), dynamicRange = 80, output = c("audio", "detailed")[1], play = FALSE, reportEvery = NULL, cores = 1, saveAudio = NULL )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
echoDelay |
the delay at which the echo appears, ms |
echoLevel |
the rate at which the echo weakens at each repetition, dB |
reverbDelay |
the time of maximum reverb density, ms |
reverbSpread |
standard deviation of reverb spread around time
|
reverbLevel |
the maximum amplitude of reverb, dB below input |
reverbDensity |
the number of echos or "voices" added |
reverbType |
so far only "gaussian" has been implemented |
filter |
(optional) a spectral filter to apply to the created reverb and
echo (see |
dynamicRange |
the precision with which the reverb and echo are calculated, dB |
output |
"audio" = returns just the processed audio, "detailed" = returns a list with reverb window, the added reverb/echo, etc. |
play |
if TRUE, plays the processed audio |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
saveAudio |
full (!) path to folder for saving the processed audio; NULL = don't save, ” = same as input folder (NB: overwrites the originals!) |
s = soundgen() s_rev = reverb(s, 16000) # playme(s_rev) ## Not run: # double echo, no reverb s1 = reverb(s, samplingRate = 16000, reverbLevel = NULL, echoDelay = c(250, 800), echoLevel = c(-15, -25)) playme(s1) spectrogram(s1, 16000, osc = TRUE, ylim = c(0, 4)) # only reverb (indoors) s2 = reverb(s, samplingRate = 16000, echoDelay = NULL, reverbDelay = 70, reverbSpread = 130, reverbLevel = -20, reverbDensity = 20) playme(s2) spectrogram(s2, 16000, osc = TRUE, ylim = c(0, 4)) # reverb (caves) s3 = reverb(s, samplingRate = 16000, echoDelay = NULL, reverbDelay = 600, reverbSpread = 1500, reverbLevel = -10, reverbDensity = 100) playme(s3) spectrogram(s3, 16000, osc = TRUE, ylim = c(0, 4)) # both echo and reverb with high frequencies emphasized s4 = reverb(s, samplingRate = 16000, echoDelay = 250, echoLevel = -20, reverbDelay = 70, reverbSpread = 120, reverbLevel = -25, reverbDensity = 50, filter = list(formants = NULL, lipRad = 3)) playme(s4) spectrogram(s4, 16000, osc = TRUE, ylim = c(0, 4)) # add reverb to a recording s5 = reverb('~/Downloads/temp260/ut_fear_57-m-tone.wav', echoDelay = 850, echoLevel = -40) # playme(s5, 44100) # add reverb to all files in a folder, save the result reverb('~/Downloads/temp2', saveAudio = '~/Downloads/temp2/rvb') ## End(Not run)s = soundgen() s_rev = reverb(s, 16000) # playme(s_rev) ## Not run: # double echo, no reverb s1 = reverb(s, samplingRate = 16000, reverbLevel = NULL, echoDelay = c(250, 800), echoLevel = c(-15, -25)) playme(s1) spectrogram(s1, 16000, osc = TRUE, ylim = c(0, 4)) # only reverb (indoors) s2 = reverb(s, samplingRate = 16000, echoDelay = NULL, reverbDelay = 70, reverbSpread = 130, reverbLevel = -20, reverbDensity = 20) playme(s2) spectrogram(s2, 16000, osc = TRUE, ylim = c(0, 4)) # reverb (caves) s3 = reverb(s, samplingRate = 16000, echoDelay = NULL, reverbDelay = 600, reverbSpread = 1500, reverbLevel = -10, reverbDensity = 100) playme(s3) spectrogram(s3, 16000, osc = TRUE, ylim = c(0, 4)) # both echo and reverb with high frequencies emphasized s4 = reverb(s, samplingRate = 16000, echoDelay = 250, echoLevel = -20, reverbDelay = 70, reverbSpread = 120, reverbLevel = -25, reverbDensity = 50, filter = list(formants = NULL, lipRad = 3)) playme(s4) spectrogram(s4, 16000, osc = TRUE, ylim = c(0, 4)) # add reverb to a recording s5 = reverb('~/Downloads/temp260/ut_fear_57-m-tone.wav', echoDelay = 850, echoLevel = -40) # playme(s5, 44100) # add reverb to all files in a folder, save the result reverb('~/Downloads/temp2', saveAudio = '~/Downloads/temp2/rvb') ## End(Not run)
This function performs several conceptually related types of conversion of
formant frequencies in relation to the neutral schwa sound based on the
one-tube model of the vocal tract. This is useful for speaker normalization
because absolute formant frequencies measured in Hz depend strongly on
overall vocal tract length (VTL). For example, adult men vs. children or
grizzly bears vs. dog puppies have very different formant spaces in Hz, but
it is possible to define a VTL-normalized formant space that is applicable to
all species and sizes. Case 1: if we know vocal tract length (VTL) but not
formant frequencies, schwa() estimates formants corresponding to a
neutral schwa sound in this vocal tract, assuming that it is perfectly
cylindrical. Case 2: if we know the frequencies of a few lower formants,
schwa() estimates the deviation of observed formant frequencies from
the neutral values expected in a perfectly cylindrical vocal tract (based on
the VTL as specified or as estimated from formant dispersion). Case 3: if we
want to generate a sound with particular relative formant frequencies (e.g.
high F1 and low F2 relative to the schwa for this vocal tract),
schwa() calculates the corresponding formant frequencies in Hz. See
examples below for an illustration of these three suggested uses.
schwa( formants = NULL, vocalTract = NULL, formants_relative = NULL, nForm = 8, interceptZero = TRUE, tube = c("closed-open", "open-open")[1], speedSound = 35400, plot = FALSE )schwa( formants = NULL, vocalTract = NULL, formants_relative = NULL, nForm = 8, interceptZero = TRUE, tube = c("closed-open", "open-open")[1], speedSound = 35400, plot = FALSE )
formants |
a numeric vector of observed (measured) formant frequencies, Hz |
vocalTract |
the length of vocal tract, cm |
formants_relative |
a numeric vector of target relative formant frequencies, % deviation from schwa (see examples) |
nForm |
the number of formants to estimate (integer) |
interceptZero |
if TRUE, forces the regression curve to pass through the origin. This reduces the influence of highly variable lower formants, but we have to commit to a particular model of the vocal tract: closed-open or open-open/closed-closed (method = "regression" only) |
tube |
the vocal tract is assumed to be a cylindrical tube that is either "closed-open" or "open-open" (same as closed-closed) |
speedSound |
speed of sound in warm air, cm/s. Stevens (2000) "Acoustic phonetics", p. 138 |
plot |
if TRUE, plots vowel quality in speaker-normalized F1-F2 space |
Algorithm: the expected formant dispersion is given by for a closed-open
tube (mouth open) and for an open-open or closed-closed tube. F1 is schwa is
expected at half the value of formant dispersion. See e.g. Stevens (2000)
"Acoustic phonetics", p. 139. Basically, we estimate vocal tract length and
see if each formant is higher or lower than expected for this vocal tract.
For this to work, we have to know either the frequencies of enough formants
(not just the first two) or the true length of the vocal tract. See also
estimateVTL on the algorithm for estimating formant dispersion
if VTL is not known (note that schwa calls estimateVTL
with the option method = 'regression').
Returns a list with the following components:
VTL as provided by the user, cm
VTL estimated based on formants frequencies provided by the user, cm
average distance between formants, Hz
formant frequencies as provided by the user, Hz
formant frequencies corresponding to a neutral schwa sound in this vocal tract, Hz
formant frequencies corresponding to the user-provided relative formant frequencies, Hz
deviation of formant frequencies from those expected for a schwa, % (e.g. if the first ff_relative is -25, it means that F1 is 25% lower than expected for a schwa in this vocal tract)
deviation of formant frequencies from those
expected for a schwa, semitones. Like ff_relative, this metric is
invariant to vocal tract length, but the variance tends to be greater for
lower vs. higher formants
deviation of formant frequencies from those expected
for a schwa, proportion of formant spacing (dF). Unlike ff_relative
and ff_relative_semitones, this metric has similar variance for
lower and higher formants
Stevens, K. N. (2000). Acoustic phonetics (Vol. 30). MIT press.
Anikin, A., Barreda, S. & Reby, D. (2024) A practical guide to calculating vocal tract length and scale-invariant formant patterns. Behavior Research Methods 56, 5588–5604.
## CASE 1: known VTL # If vocal tract length is known, we calculate expected formant frequencies schwa(vocalTract = 17.5) schwa(vocalTract = 13, nForm = 5) schwa(vocalTract = 13, nForm = 5, tube = 'open-open') ## CASE 2: known (observed) formant frequencies # Let's take formant frequencies in four vocalizations, namely # (/a/, /i/, /mmm/, /roar/) by the same male speaker: formants_a = c(860, 1430, 2900, NA, 5200) # NAs are OK - here F4 is unknown s_a = schwa(formants = formants_a, plot = TRUE) s_a # We get an estimate of VTL (s_a$vtl_apparent), # same as with estimateVTL(formants_a) # We also get theoretical schwa formants: s_a$ff_schwa # And we get the difference (% and semitones) in observed vs expected # formant frequencies: s_a[c('ff_relative', 'ff_relative_semitones')] # [a]: F1 much higher than expected, F2 slightly lower (see plot) formants_i = c(300, 2700, 3400, 4400, 5300, 6400) s_i = schwa(formants = formants_i, plot = TRUE) s_i # The apparent VTL is slightly smaller (14.5 cm) # [i]: very low F1, very high F2 formants_mmm = c(1200, 2000, 2800, 3800, 5400, 6400) schwa(formants_mmm, tube = 'closed-closed', plot = TRUE) # ~schwa, but with a closed mouth formants_roar = c(550, 1000, 1460, 2280, 3350, 4300, 4900, 5800, 6900, 7900) s_roar = schwa(formants = formants_roar, plot = TRUE) s_roar # Note the enormous apparent VTL (22.5 cm!) # (lowered larynx and rounded lips exaggerate the apparent size) # s_roar$ff_relative: high F1 and low F2-F4 schwa(formants = formants_roar[1:4], plot = TRUE) # based on F1-F4, apparent VTL is almost 28 cm! # Since the lowest formants are the most salient, # the apparent size is exaggerated even further # If you know VTL, a few lower formants are enough to get # a good estimate of the relative formant values: schwa(formants = formants_roar[1:4], vocalTract = 19, plot = TRUE) # NB: in this case theoretical and relative formants are calculated # based on user-provided VTL (vtl_measured) rather than vtl_apparent ## CASE 3: from relative to absolute formant frequencies # Say we want to generate a vowel sound with F1 20% below schwa # and F2 40% above schwa, with VTL = 15 cm s = schwa(formants_relative = c(-20, 40), vocalTract = 15, plot = TRUE) # s$ff_schwa gives formant frequencies for a schwa, while # s$ff_theoretical gives formant frequencies for a sound with # target relative formant values (low F1, high F2) schwa(formants = s$ff_theoretical)## CASE 1: known VTL # If vocal tract length is known, we calculate expected formant frequencies schwa(vocalTract = 17.5) schwa(vocalTract = 13, nForm = 5) schwa(vocalTract = 13, nForm = 5, tube = 'open-open') ## CASE 2: known (observed) formant frequencies # Let's take formant frequencies in four vocalizations, namely # (/a/, /i/, /mmm/, /roar/) by the same male speaker: formants_a = c(860, 1430, 2900, NA, 5200) # NAs are OK - here F4 is unknown s_a = schwa(formants = formants_a, plot = TRUE) s_a # We get an estimate of VTL (s_a$vtl_apparent), # same as with estimateVTL(formants_a) # We also get theoretical schwa formants: s_a$ff_schwa # And we get the difference (% and semitones) in observed vs expected # formant frequencies: s_a[c('ff_relative', 'ff_relative_semitones')] # [a]: F1 much higher than expected, F2 slightly lower (see plot) formants_i = c(300, 2700, 3400, 4400, 5300, 6400) s_i = schwa(formants = formants_i, plot = TRUE) s_i # The apparent VTL is slightly smaller (14.5 cm) # [i]: very low F1, very high F2 formants_mmm = c(1200, 2000, 2800, 3800, 5400, 6400) schwa(formants_mmm, tube = 'closed-closed', plot = TRUE) # ~schwa, but with a closed mouth formants_roar = c(550, 1000, 1460, 2280, 3350, 4300, 4900, 5800, 6900, 7900) s_roar = schwa(formants = formants_roar, plot = TRUE) s_roar # Note the enormous apparent VTL (22.5 cm!) # (lowered larynx and rounded lips exaggerate the apparent size) # s_roar$ff_relative: high F1 and low F2-F4 schwa(formants = formants_roar[1:4], plot = TRUE) # based on F1-F4, apparent VTL is almost 28 cm! # Since the lowest formants are the most salient, # the apparent size is exaggerated even further # If you know VTL, a few lower formants are enough to get # a good estimate of the relative formant values: schwa(formants = formants_roar[1:4], vocalTract = 19, plot = TRUE) # NB: in this case theoretical and relative formants are calculated # based on user-provided VTL (vtl_measured) rather than vtl_apparent ## CASE 3: from relative to absolute formant frequencies # Say we want to generate a vowel sound with F1 20% below schwa # and F2 40% above schwa, with VTL = 15 cm s = schwa(formants_relative = c(-20, 40), vocalTract = 15, plot = TRUE) # s$ff_schwa gives formant frequencies for a schwa, while # s$ff_theoretical gives formant frequencies for a sound with # target relative formant values (low F1, high F2) schwa(formants = s$ff_theoretical)
Finds syllables and bursts separated by background noise in long recordings (up to 1-2 hours of audio per file). Syllables are defined as continuous segments that seem to be different from noise based on amplitude and/or spectral similarity thresholds. Bursts are defined as local maxima in signal envelope that are high enough both in absolute terms (relative to the global maximum) and with respect to the surrounding region (relative to local minima). See vignette('acoustic_analysis', package = 'soundgen') for details.
segment( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, shortestSyl = 40, shortestPause = 40, method = c("env", "spec", "mel")[3], propNoise = NULL, SNR = NULL, noiseLevelStabWeight = c(1, 0.25), windowLength = 40, step = windowLength/5, overlap = 80, reverbPars = list(reverbDelay = 70, reverbSpread = 130, reverbLevel = -35, reverbDensity = 50), interburst = NULL, peakToTrough = SNR + 3, troughLocation = c("left", "right", "both", "either")[4], summaryFun = c("median", "sd"), maxDur = 30, ptvStep = NULL, ptvTime = 0.5, ptvFreq = 1, reportEvery = NULL, cores = 1, plot = FALSE, savePlots = NULL, saveAudio = NULL, addSilence = 50, main = NULL, xlab = "", ylab = "Signal, dB", showLegend = FALSE, width = 900, height = 500, units = "px", res = NA, maxPoints = c(1e+05, 5e+05), specPlot = list(colorTheme = "bw"), contourPlot = list(lty = 1, lwd = 2, col = "green"), sylPlot = list(lty = 1, lwd = 2, col = "blue"), burstPlot = list(pch = 8, cex = 3, col = "red"), ... )segment( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, shortestSyl = 40, shortestPause = 40, method = c("env", "spec", "mel")[3], propNoise = NULL, SNR = NULL, noiseLevelStabWeight = c(1, 0.25), windowLength = 40, step = windowLength/5, overlap = 80, reverbPars = list(reverbDelay = 70, reverbSpread = 130, reverbLevel = -35, reverbDensity = 50), interburst = NULL, peakToTrough = SNR + 3, troughLocation = c("left", "right", "both", "either")[4], summaryFun = c("median", "sd"), maxDur = 30, ptvStep = NULL, ptvTime = 0.5, ptvFreq = 1, reportEvery = NULL, cores = 1, plot = FALSE, savePlots = NULL, saveAudio = NULL, addSilence = 50, main = NULL, xlab = "", ylab = "Signal, dB", showLegend = FALSE, width = 900, height = 500, units = "px", res = NA, maxPoints = c(1e+05, 5e+05), specPlot = list(colorTheme = "bw"), contourPlot = list(lty = 1, lwd = 2, col = "green"), sylPlot = list(lty = 1, lwd = 2, col = "blue"), burstPlot = list(pch = 8, cex = 3, col = "red"), ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
scale |
maximum possible amplitude of input used for normalization of
input vector (only needed if |
from, to
|
if NULL (default), analyzes the whole sound, otherwise from...to (s) |
shortestSyl |
minimum acceptable length of syllables, ms |
shortestPause |
minimum acceptable break between syllables, ms (syllables separated by shorter pauses are merged) |
method |
the signal used to search for syllables: 'env' = Hilbert-transformed amplitude envelope, 'spec' = spectrogram, 'mel' = mel-transformed spectrogram (see tuneR::melfcc) |
propNoise |
the proportion of non-zero sound assumed to represent background noise, 0 to 1 (note that complete silence is not considered, so padding with silence won't affect the algorithm). Set to 0 to skip correcting SNR by background noise level |
SNR |
expected signal-to-noise ratio (dB above noise), which determines
the threshold for syllable detection. The meaning of "dB" here is
approximate since the "signal" may be different from sound intensity,
depending on the |
noiseLevelStabWeight |
a vector of length 2 specifying the relative weights of the overall signal level vs. stability when attempting to automatically locate the regions that represent noise. Increasing the weight of stability tends to accentuate the beginning and end of each syllable. |
windowLength |
length of FFT window, ms (multiple values in a vector produce a multi-resolution spectrogram) |
step |
you can override |
overlap |
overlap between successive FFT frames, % |
reverbPars |
parameters passed on to |
interburst |
minimum time between two consecutive bursts (ms). Defaults
to the average detected |
peakToTrough |
to qualify as a burst, a local maximum has to be at least
|
troughLocation |
should local maxima be compared to the trough on the left and/or right of it? Values: 'left', 'right', 'both', 'either' |
summaryFun |
functions used to summarize each acoustic characteristic;
see |
maxDur |
long files are split into chunks |
ptvStep, ptvTime, ptvFreq
|
the instantaneous proportion of time
vocalizing (PTV) is calculated by producing a binary (sound on/off) contour
with a step of |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
plot |
if TRUE, produces a segmentation plot |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
saveAudio |
full path to the folder in which to save audio files (one per detected syllable) |
addSilence |
if syllables are saved as separate audio files, they can be padded with some silence (ms) |
xlab, ylab, main
|
main plotting parameters |
showLegend |
if TRUE, shows a legend for thresholds |
width, height, units, res
|
parameters passed to
|
maxPoints |
the maximum number of "pixels" in the oscillogram (if any) and spectrogram; good for quickly plotting long audio files; defaults to c(1e5, 5e5); does not affect reassigned spectrograms |
specPlot |
a list of graphical parameters for displaying the spectrogram
(if |
contourPlot |
a list of graphical parameters for displaying the signal contour used to detect syllables (see details) |
sylPlot |
a list of graphical parameters for displaying the syllables |
burstPlot |
a list of graphical parameters for displaying the bursts |
... |
other graphical parameters passed to graphics::plot |
Algorithm: for each chunk at most maxDur long, first the audio
recording is partitioned into signal and noise regions: the quietest and most
stable regions are located, and noise threshold is defined from a
user-specified proportion of noise in the recording (propNoise) or, if
propNoise = NULL, from the lowest local maximum in the density
function of a weighted product of amplitude and stability (that is, we assume
that quiet and stable regions are likely to represent noise). Once we know
what the noise looks like - in terms of its typical amplitude and/or spectrum
- we derive signal contour as its difference from noise at each time point.
If method = 'env', this is Hilbert transform minus noise, and if
method = 'spec' or 'mel', this is the inverse of cosine similarity
between the spectrum of each frame and the estimated spectrum of noise
weighted by amplitude. By default, signal-to-noise ratio (SNR) is estimated
as half-median of above-noise signal, but it is recommended that this
parameter is adjusted by hand to suit the purposes of segmentation, as it is
the key setting that controls the balance between false negatives (missing
faint signals) and false positives (hallucinating signals that are actually
noise). Note also that effects of echo or reverberation can be taken into
account: syllable detection threshold may be raised following powerful
acoustic bursts with the help of the reverbPars argument. At the final
stage, continuous "islands" SNR dB above noise level are detected as
syllables, and "peaks" on the islands are detected as bursts. The algorithm
is very flexible, but the parameters may be hard to optimize by hand. If you
have an annotated sample of the sort of audio you are planning to analyze,
with syllables and/or bursts counted manually, you can use it for automatic
optimization of control parameters (see optimizePars).
Returns a list with the following components:
location and duration of each syllable and the pause before it (ms) plus the PTV calculated for each pause-syllable pair
the time and amplitude of each burst plus the pause before it (ms)
a summary of temporal descriptives per file, including PTV = sum of all syllable durations / total duration of audio
the spectrum of background noise
contours of
instantaneous proportion of time vocalizing: time = time in ms, on = 1 if
this frame is part of a syllable and 0 otherwise, ptv_lowpass = "on" after
applying a low-pass filter over ptvFreq Hz, ptv_conv = "on" after
convolution with a half-Gaussian filter with SD = ptvTime
a dataframe containing the time and value of the contour used to segment the sound (some form of envelope or the difference of spectrum from background noise, depending on the method)
sound = soundgen(nSyl = 4, sylLen = 100, pauseLen = 70, attackLen = 20, amplGlobal = c(0, -20), pitch = c(368, 284), temperature = .001) # add noise so SNR decreases from 20 to 0 dB from syl1 to syl4 sound = sound + runif(length(sound), -10 ^ (-20 / 20), 10 ^ (-20 / 20)) # osc(sound, samplingRate = 16000, dB = TRUE) # spectrogram(sound, samplingRate = 16000, osc = TRUE) # playme(sound, samplingRate = 16000) s = segment(sound, samplingRate = 16000, plot = TRUE) str(s) # customizing the plot segment(sound, samplingRate = 16000, plot = TRUE, sylPlot = list(lty = 2, col = 'gray20'), burstPlot = list(pch = 16, col = 'blue'), specPlot = list(col = rev(heat.colors(50))), xlab = 'Some custom label', cex.lab = 1.2, showLegend = TRUE, main = 'My awesome plot') # plot the PTV contour (proportion of time vocalizing) plot(s$ptv$time, s$ptv$on, type = 'l', xlab = 'Time, ms', ylab = 'Prop. time voc.') points(s$ptv$time, s$ptv$ptv_conv, type = 'l', col = 'blue') points(s$ptv$time, s$ptv$ptv_lowpass, type = 'l', col = 'red') s$summary$ptv; mean(s$ptv$ptv_conv); mean(s$ptv$ptv_lowpass) # similar ## Not run: # set SNR manually to control detection threshold s = segment(sound, samplingRate = 16000, SNR = 1, plot = TRUE) # simple intensity threshold (anything >5 dB is signal) segment(sound, 16000, method = 'env', SNR = 5, plot = TRUE, # very little smoothing for maximally precise timing windowLength = 5, step = 1, # don't correct SNR based on estimated background noise propNoise = 0, # don't use dynamic thresholds to cancel reverb reverbPars = NULL ) # different ways to calculate instantaneous PTV s2 = segment(sound, 16000, ptvTime = 2, ptvFreq = 5) s3 = segment(sound, 16000, ptvTime = 0.05, ptvFreq = 0.5) plot(s2$ptv$time, s2$ptv$on, type = 'l', xlab = 'Time, ms', ylab = 'Prop. time voc.') points(s2$ptv$time, s2$ptv$ptv_conv, type = 'l', col = 'blue') points(s2$ptv$time, s2$ptv$ptv_lowpass, type = 'l', col = 'yellow') points(s3$ptv$time, s3$ptv$ptv_conv, type = 'l', col = 'purple') points(s3$ptv$time, s3$ptv$ptv_lowpass, type = 'l', col = 'orange') # Download 260 sounds from the supplements to Anikin & Persson (2017) at # http://cogsci.se/publications.html # unzip them into a folder, say '~/Downloads/temp' myfolder = '~/Downloads/temp260' # 260 .wav files live here s = segment(myfolder, propNoise = .05, SNR = 3) # Check accuracy: import a manual count of syllables (our "key") key = segmentManual # a vector of 260 integers trial = as.numeric(s$summary$nBursts) cor(key, trial, use = 'pairwise.complete.obs') boxplot(trial ~ as.integer(key), xlab='key') abline(a=0, b=1, col='red') # or look at the detected syllables instead of bursts: cor(key, s$summary$nSyl, use = 'pairwise.complete.obs') ## End(Not run)sound = soundgen(nSyl = 4, sylLen = 100, pauseLen = 70, attackLen = 20, amplGlobal = c(0, -20), pitch = c(368, 284), temperature = .001) # add noise so SNR decreases from 20 to 0 dB from syl1 to syl4 sound = sound + runif(length(sound), -10 ^ (-20 / 20), 10 ^ (-20 / 20)) # osc(sound, samplingRate = 16000, dB = TRUE) # spectrogram(sound, samplingRate = 16000, osc = TRUE) # playme(sound, samplingRate = 16000) s = segment(sound, samplingRate = 16000, plot = TRUE) str(s) # customizing the plot segment(sound, samplingRate = 16000, plot = TRUE, sylPlot = list(lty = 2, col = 'gray20'), burstPlot = list(pch = 16, col = 'blue'), specPlot = list(col = rev(heat.colors(50))), xlab = 'Some custom label', cex.lab = 1.2, showLegend = TRUE, main = 'My awesome plot') # plot the PTV contour (proportion of time vocalizing) plot(s$ptv$time, s$ptv$on, type = 'l', xlab = 'Time, ms', ylab = 'Prop. time voc.') points(s$ptv$time, s$ptv$ptv_conv, type = 'l', col = 'blue') points(s$ptv$time, s$ptv$ptv_lowpass, type = 'l', col = 'red') s$summary$ptv; mean(s$ptv$ptv_conv); mean(s$ptv$ptv_lowpass) # similar ## Not run: # set SNR manually to control detection threshold s = segment(sound, samplingRate = 16000, SNR = 1, plot = TRUE) # simple intensity threshold (anything >5 dB is signal) segment(sound, 16000, method = 'env', SNR = 5, plot = TRUE, # very little smoothing for maximally precise timing windowLength = 5, step = 1, # don't correct SNR based on estimated background noise propNoise = 0, # don't use dynamic thresholds to cancel reverb reverbPars = NULL ) # different ways to calculate instantaneous PTV s2 = segment(sound, 16000, ptvTime = 2, ptvFreq = 5) s3 = segment(sound, 16000, ptvTime = 0.05, ptvFreq = 0.5) plot(s2$ptv$time, s2$ptv$on, type = 'l', xlab = 'Time, ms', ylab = 'Prop. time voc.') points(s2$ptv$time, s2$ptv$ptv_conv, type = 'l', col = 'blue') points(s2$ptv$time, s2$ptv$ptv_lowpass, type = 'l', col = 'yellow') points(s3$ptv$time, s3$ptv$ptv_conv, type = 'l', col = 'purple') points(s3$ptv$time, s3$ptv$ptv_lowpass, type = 'l', col = 'orange') # Download 260 sounds from the supplements to Anikin & Persson (2017) at # http://cogsci.se/publications.html # unzip them into a folder, say '~/Downloads/temp' myfolder = '~/Downloads/temp260' # 260 .wav files live here s = segment(myfolder, propNoise = .05, SNR = 3) # Check accuracy: import a manual count of syllables (our "key") key = segmentManual # a vector of 260 integers trial = as.numeric(s$summary$nBursts) cor(key, trial, use = 'pairwise.complete.obs') boxplot(trial ~ as.integer(key), xlab='key') abline(a=0, b=1, col='red') # or look at the detected syllables instead of bursts: cor(key, s$summary$nSyl, use = 'pairwise.complete.obs') ## End(Not run)
A vector of the number of syllables in the corpus of 260 human non-linguistic emotional vocalizations from Anikin & Persson (2017). The corpus can be downloaded from http://cogsci.se/publications.html
segmentManualsegmentManual
An object of class numeric of length 260.
Raises or lowers formants (resonance frequencies), changing the voice quality
or timbre of the sound without changing its pitch, statically or dynamically.
Note that this is only possible when the fundamental frequency f0 is lower
than the formant frequencies. For best results, freqWindow should be
no lower than f0 and no higher than formant bandwidths. Obviously, this is
impossible for many signals, so just try a few reasonable values, like ~200
Hz for speech. If freqWindow is not specified, soundgen sets it to the
average detected f0, which is slow.
shiftFormants( x, multFormants, samplingRate = NULL, freqWindow = NULL, dynamicRange = 80, windowLength = 50, step = NULL, overlap = 75, wn = "gaussian", interpol = c("approx", "spline")[1], normalize = c("max", "orig", "none")[2], play = FALSE, saveAudio = NULL, reportEvery = NULL, cores = 1, ... )shiftFormants( x, multFormants, samplingRate = NULL, freqWindow = NULL, dynamicRange = 80, windowLength = 50, step = NULL, overlap = 75, wn = "gaussian", interpol = c("approx", "spline")[1], normalize = c("max", "orig", "none")[2], play = FALSE, saveAudio = NULL, reportEvery = NULL, cores = 1, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
multFormants |
1 = no change, >1 = raise formants (eg 1.1 = 10% up, 2 =
one octave up), <1 = lower formants. Anchor format accepted (see
|
samplingRate |
sampling rate of |
freqWindow |
the width of spectral smoothing window, Hz. Defaults to detected f0 |
dynamicRange |
dynamic range, dB. All values more than one dynamicRange under maximum are treated as zero |
windowLength |
length of FFT window, ms (multiple values in a vector produce a multi-resolution spectrogram) |
step |
you can override |
overlap |
overlap between successive FFT frames, % |
wn |
window type accepted by |
interpol |
the method for interpolating scaled spectra |
normalize |
"orig" = same as input (default), "max" = maximum possible peak amplitude, "none" = no normalization |
play |
if TRUE, plays the synthesized sound using the default player on
your system. If character, passed to |
saveAudio |
full path to the folder in which to save audio files (one per detected syllable) |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
... |
other graphical parameters |
Algorithm: phase vocoder. In the frequency domain, we separate the complex
spectrum of each STFT frame into two parts. The "receiver" is the flattened
or smoothed complex spectrum, where smoothing is achieved by obtaining a
smoothed magnitude envelope (the amount of smoothing is controlled by
freqWindow) and then dividing the complex spectrum by this envelope.
This basically removes the formants from the signal. The second component,
"donor", is a scaled and interpolated version of the same smoothed magnitude
envelope as above - these are the formants shifted up or down. Warping can be
easily implemented instead of simple scaling if nonlinear spectral
transformations are required. We then multiply the "receiver" and "donor"
spectrograms and reconstruct the audio with iSTFT.
s = soundgen(sylLen = 200, ampl = c(0,-10), pitch = c(250, 350), rolloff = c(-9, -15), noise = -40, formants = 'aii', addSilence = 50) # playme(s) s1 = shiftFormants(s, samplingRate = 16000, multFormants = 1.25, freqWindow = 200) # playme(s1) ## Not run: data(sheep, package = 'seewave') # import a recording from seewave playme(sheep) spectrogram(sheep) # Lower formants by 4 semitones or ~20% = 2 ^ (-4 / 12) sheep1 = shiftFormants(sheep, multFormants = 2 ^ (-4 / 12), freqWindow = 150) playme(sheep1, [email protected]) spectrogram(sheep1, [email protected]) orig = seewave::meanspec(sheep, wl = 128, plot = FALSE) shifted = seewave::meanspec(sheep1, wl = 128, f = [email protected], plot = FALSE) plot(orig[, 1], log(orig[, 2]), type = 'l') points(shifted[, 1], log(shifted[, 2]), type = 'l', col = 'blue') # dynamic change: raise formants at the beginning, lower at the end sheep2 = shiftFormants(sheep, multFormants = c(1.3, .7), freqWindow = 150) playme(sheep2, [email protected]) spectrogram(sheep2, [email protected]) ## End(Not run)s = soundgen(sylLen = 200, ampl = c(0,-10), pitch = c(250, 350), rolloff = c(-9, -15), noise = -40, formants = 'aii', addSilence = 50) # playme(s) s1 = shiftFormants(s, samplingRate = 16000, multFormants = 1.25, freqWindow = 200) # playme(s1) ## Not run: data(sheep, package = 'seewave') # import a recording from seewave playme(sheep) spectrogram(sheep) # Lower formants by 4 semitones or ~20% = 2 ^ (-4 / 12) sheep1 = shiftFormants(sheep, multFormants = 2 ^ (-4 / 12), freqWindow = 150) playme(sheep1, sheep@samp.rate) spectrogram(sheep1, sheep@samp.rate) orig = seewave::meanspec(sheep, wl = 128, plot = FALSE) shifted = seewave::meanspec(sheep1, wl = 128, f = sheep@samp.rate, plot = FALSE) plot(orig[, 1], log(orig[, 2]), type = 'l') points(shifted[, 1], log(shifted[, 2]), type = 'l', col = 'blue') # dynamic change: raise formants at the beginning, lower at the end sheep2 = shiftFormants(sheep, multFormants = c(1.3, .7), freqWindow = 150) playme(sheep2, sheep@samp.rate) spectrogram(sheep2, sheep@samp.rate) ## End(Not run)
Raises or lowers pitch with or without also shifting the formants (resonance
frequencies) and performing a time-stretch. The three operations (pitch
shift, formant shift, and time stretch) are independent and can be performed
in any combination, statically or dynamically. shiftPitch can also be
used to shift formants without changing pitch or duration, but the dedicated
shiftFormants is faster for that task.
shiftPitch( x, multPitch = 1, multFormants = multPitch, timeStretch = 1, samplingRate = NULL, freqWindow = NULL, dynamicRange = 80, windowLength = 40, step = 2, overlap = NULL, wn = "gaussian", interpol = c("approx", "spline")[1], propagation = c("time", "adaptive")[1], preserveEnv = NULL, transplantEnv_pars = list(windowLength = 10), normalize = c("max", "orig", "none")[2], play = FALSE, saveAudio = NULL, reportEvery = NULL, cores = 1 )shiftPitch( x, multPitch = 1, multFormants = multPitch, timeStretch = 1, samplingRate = NULL, freqWindow = NULL, dynamicRange = 80, windowLength = 40, step = 2, overlap = NULL, wn = "gaussian", interpol = c("approx", "spline")[1], propagation = c("time", "adaptive")[1], preserveEnv = NULL, transplantEnv_pars = list(windowLength = 10), normalize = c("max", "orig", "none")[2], play = FALSE, saveAudio = NULL, reportEvery = NULL, cores = 1 )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
multPitch |
1 = no change, >1 = raise pitch (eg 1.1 = 10% up, 2 = one
octave up), <1 = lower pitch. Anchor format accepted for multPitch /
multFormant / timeStretch (see |
multFormants |
1 = no change, >1 = raise formants (eg 1.1 = 10% up, 2 = one octave up), <1 = lower formants |
timeStretch |
1 = no change, >1 = longer, <1 = shorter |
samplingRate |
sampling rate of |
freqWindow |
the width of spectral smoothing window, Hz. Defaults to
detected f0 prior to pitch shifting - see |
dynamicRange |
dynamic range, dB. All values more than one dynamicRange under maximum are treated as zero |
windowLength |
length of FFT window, ms (multiple values in a vector produce a multi-resolution spectrogram) |
step |
you can override |
overlap |
overlap between successive FFT frames, % |
wn |
window type accepted by |
interpol |
the method for interpolating scaled spectra and anchors |
propagation |
the method for propagating phase: "time" = horizontal propagation (default), "adaptive" = an experimental implementation of "vocoder done right" (Prusa & Holighaus 2017) |
preserveEnv |
if TRUE, transplants the amplitude envelope from the
original to the modified sound with |
transplantEnv_pars |
a list of parameters passed on to
|
normalize |
"orig" = same as input (default), "max" = maximum possible peak amplitude, "none" = no normalization |
play |
if TRUE, plays the synthesized sound using the default player on
your system. If character, passed to |
saveAudio |
full path to the folder in which to save audio files (one per detected syllable) |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
Algorithm: phase vocoder. Pitch shifting is accomplished by performing a time
stretch (at present, with horizontal or adaptive phase propagation) followed
by resampling. This shifts both pitch and formants; to preserve the original
formant frequencies or modify them independently of pitch, a variant of
transplantFormants is performed to "transplant" the original or
scaled formants onto the time-stretched new sound. See Prusa 2017 "Phase
vocoder done right", Royer 2019 "Pitch-shifting algorithm design and
applications in music".
shiftFormants transplantFormants
s = soundgen(sylLen = 200, ampl = c(0,-10), pitch = c(250, 350), rolloff = c(-9, -15), noise = -40, formants = 'aii', addSilence = 50) # playme(s) s1 = shiftPitch(s, samplingRate = 16000, freqWindow = 400, multPitch = 1.25, multFormants = .8) # playme(s1) ## Not run: ## Dynamic manipulations # Add a chevron-shaped pitch contour s2 = shiftPitch(s, samplingRate = 16000, multPitch = c(1.1, 1.3, .8)) playme(s2) # Time-stretch only the middle s3 = shiftPitch(s, samplingRate = 16000, timeStretch = list( time = c(0, .25, .31, .5, .55, 1), value = c(1, 1, 3, 3, 1, 1)) ) playme(s3) ## Various combinations of 3 manipulations data(sheep, package = 'seewave') # import a recording from seewave playme(sheep) spectrogram(sheep) # Raise pitch and formants by 3 semitones, shorten by half sheep1 = shiftPitch(sheep, multPitch = 2 ^ (3 / 12), timeStretch = 0.5) playme(sheep1, [email protected]) spectrogram(sheep1, [email protected]) # Just shorten shiftPitch(sheep, multPitch = 1, timeStretch = 0.25, play = TRUE) # Raise pitch preserving formants sheep2 = shiftPitch(sheep, multPitch = 1.2, multFormants = 1, freqWindow = 150) playme(sheep2, [email protected]) spectrogram(sheep2, [email protected]) ## End(Not run)s = soundgen(sylLen = 200, ampl = c(0,-10), pitch = c(250, 350), rolloff = c(-9, -15), noise = -40, formants = 'aii', addSilence = 50) # playme(s) s1 = shiftPitch(s, samplingRate = 16000, freqWindow = 400, multPitch = 1.25, multFormants = .8) # playme(s1) ## Not run: ## Dynamic manipulations # Add a chevron-shaped pitch contour s2 = shiftPitch(s, samplingRate = 16000, multPitch = c(1.1, 1.3, .8)) playme(s2) # Time-stretch only the middle s3 = shiftPitch(s, samplingRate = 16000, timeStretch = list( time = c(0, .25, .31, .5, .55, 1), value = c(1, 1, 3, 3, 1, 1)) ) playme(s3) ## Various combinations of 3 manipulations data(sheep, package = 'seewave') # import a recording from seewave playme(sheep) spectrogram(sheep) # Raise pitch and formants by 3 semitones, shorten by half sheep1 = shiftPitch(sheep, multPitch = 2 ^ (3 / 12), timeStretch = 0.5) playme(sheep1, sheep@samp.rate) spectrogram(sheep1, sheep@samp.rate) # Just shorten shiftPitch(sheep, multPitch = 1, timeStretch = 0.25, play = TRUE) # Raise pitch preserving formants sheep2 = shiftPitch(sheep, multPitch = 1.2, multFormants = 1, freqWindow = 150) playme(sheep2, sheep@samp.rate) spectrogram(sheep2, sheep@samp.rate) ## End(Not run)
Generates a bout of one or more syllables with pauses between them. Two basic components are synthesized: a periodic component (the sum of sine waves with frequencies that are multiples of the fundamental frequency) and an aperiodic noise component. Both components can be filtered with independently specified formants. Intonation and amplitude contours can be applied both within each syllable and across multiple syllables. Suggested application: synthesis of animal or human non-linguistic vocalizations. For more information, see https://cogsci.se/soundgen/sound_generation.html.
soundgen( repeatBout = 1, nSyl = 1, sylLen = 300, pauseLen = 200, pitch = list(time = c(0, 0.1, 0.9, 1), value = c(100, 150, 135, 100)), pitchGlobal = NA, glottis = 0, temperature = 0.025, tempEffects = list(), maleFemale = 0, creakyBreathy = 0, nonlinBalance = 100, nonlinRandomWalk = NULL, subRatio = 2, subFreq = 0, subDep = 0, subWidth = 10000, shortestEpoch = 300, jitterLen = 1, jitterDep = 0, vibratoFreq = 5, vibratoDep = 0, shimmerDep = 0, shimmerLen = 1, attackLen = 50, rolloff = -9, rolloffOct = 0, rolloffKHz = -3, rolloffParab = 0, rolloffParabHarm = 3, rolloffExact = NULL, lipRad = 6, noseRad = 4, mouthOpenThres = 0, formants = c(860, 1430, 2900), formantDep = 1, formantDepStoch = 1, formantWidth = 1, formantCeiling = 2, formantLocking = 0, vocalTract = NA, amDep = 0, amFreq = 30, amType = c("logistic", "sine")[1], amShape = 0, noise = NULL, formantsNoise = NA, rolloffNoise = -4, noiseFlatSpec = 1200, rolloffNoiseExp = 0, noiseAmpRef = c("f0", "source", "filtered")[3], mouth = list(time = c(0, 1), value = c(0.5, 0.5)), ampl = NA, amplGlobal = NA, smoothing = list(interpol = c("approx", "spline", "loess")[3], loessSpan = NULL, discontThres = 0.05, jumpThres = 0.01), samplingRate = 16000, windowLength = 50, overlap = 75, addSilence = 100, pitchFloor = 1, pitchCeiling = 3500, pitchSamplingRate = 16000, dynamicRange = 80, invalidArgAction = c("adjust", "abort", "ignore")[1], plot = FALSE, play = FALSE, saveAudio = NA, ... )soundgen( repeatBout = 1, nSyl = 1, sylLen = 300, pauseLen = 200, pitch = list(time = c(0, 0.1, 0.9, 1), value = c(100, 150, 135, 100)), pitchGlobal = NA, glottis = 0, temperature = 0.025, tempEffects = list(), maleFemale = 0, creakyBreathy = 0, nonlinBalance = 100, nonlinRandomWalk = NULL, subRatio = 2, subFreq = 0, subDep = 0, subWidth = 10000, shortestEpoch = 300, jitterLen = 1, jitterDep = 0, vibratoFreq = 5, vibratoDep = 0, shimmerDep = 0, shimmerLen = 1, attackLen = 50, rolloff = -9, rolloffOct = 0, rolloffKHz = -3, rolloffParab = 0, rolloffParabHarm = 3, rolloffExact = NULL, lipRad = 6, noseRad = 4, mouthOpenThres = 0, formants = c(860, 1430, 2900), formantDep = 1, formantDepStoch = 1, formantWidth = 1, formantCeiling = 2, formantLocking = 0, vocalTract = NA, amDep = 0, amFreq = 30, amType = c("logistic", "sine")[1], amShape = 0, noise = NULL, formantsNoise = NA, rolloffNoise = -4, noiseFlatSpec = 1200, rolloffNoiseExp = 0, noiseAmpRef = c("f0", "source", "filtered")[3], mouth = list(time = c(0, 1), value = c(0.5, 0.5)), ampl = NA, amplGlobal = NA, smoothing = list(interpol = c("approx", "spline", "loess")[3], loessSpan = NULL, discontThres = 0.05, jumpThres = 0.01), samplingRate = 16000, windowLength = 50, overlap = 75, addSilence = 100, pitchFloor = 1, pitchCeiling = 3500, pitchSamplingRate = 16000, dynamicRange = 80, invalidArgAction = c("adjust", "abort", "ignore")[1], plot = FALSE, play = FALSE, saveAudio = NA, ... )
repeatBout |
number of times the whole bout should be repeated |
nSyl |
number of syllables in the bout. 'pitchGlobal', 'amplGlobal', and 'formants' span multiple syllables, but not multiple bouts |
sylLen |
average duration of each syllable, ms (vectorized) |
pauseLen |
average duration of pauses between syllables, ms (can be negative between bouts: force with invalidArgAction = 'ignore') (vectorized) |
pitch |
a numeric vector of f0 values in Hz or a dataframe specifying the time (ms or 0 to 1) and value (Hz) of each anchor, hereafter "anchor format". These anchors are used to create a smooth contour of fundamental frequency f0 (pitch) within one syllable |
pitchGlobal |
unlike |
glottis |
anchors for specifying the proportion of a glottal cycle with closed glottis, % (0 = no modification, 100 = closed phase as long as open phase); numeric vector or dataframe specifying time and value (anchor format) |
temperature |
hyperparameter for regulating the amount of stochasticity in sound generation |
tempEffects |
a list of scaling coefficients regulating the effect of
temperature on particular parameters. To change, specify just those pars
that you want to modify (1 = default, 0 = no stochastic behavior).
|
maleFemale |
hyperparameter for shifting f0 contour, formants, and vocalTract to make the speaker appear more male (-1...0) or more female (0...+1); 0 = no change |
creakyBreathy |
hyperparameter for a rough adjustment of voice quality from creaky (-1) to breathy (+1); 0 = no change |
nonlinBalance |
hyperparameter for regulating the (approximate) proportion of sound with different regimes of pitch effects (none / subharmonics only / subharmonics and jitter). 0% = no noise; 100% = the entire sound has jitter + subharmonics. Ignored if temperature = 0 |
nonlinRandomWalk |
a numeric vector specifying the timing of nonliner regimes: 0 = none, 1 = subharmonics, 2 = subharmonics + jitter + shimmer |
subRatio |
a positive integer giving the ratio of f0 (the main fundamental) to g0 (a lower frequency): 1 = no subharmonics, 2 = period doubling regardless of pitch changes, 3 = period tripling, etc; subRatio overrides subFreq (anchor format) |
subFreq |
instead of a specific number of subharmonics (subRatio), we can specify the approximate g0 frequency (Hz), which is used only if subRatio = 1 and is adjusted to f0 so f0/g0 is always an integer (anchor format) |
subDep |
the depth of subharmonics relative to the main frequency component (f0), %. 0: no subharmonics; 100: g0 harmonics are as strong as the nearest f0 harmonic (anchor format) |
subWidth |
Width of subharmonic sidebands - regulates how rapidly g-harmonics weaken away from f-harmonics: large values like the default 10000 means that all g0 harmonics are equally strong (anchor format) |
shortestEpoch |
minimum duration of each epoch with unchanging subharmonics regime or formant locking, in ms |
jitterLen |
duration of stable periods between pitch jumps, ms. Use a low value for harsh noise, a high value for irregular vibrato or shaky voice (anchor format) |
jitterDep |
cycle-to-cycle random pitch variation, semitones (anchor format) |
vibratoFreq |
the rate of regular pitch modulation, or vibrato, Hz (anchor format) |
vibratoDep |
the depth of vibrato, semitones (anchor format) |
shimmerDep |
random variation in amplitude between individual glottal cycles (0 to 100% of original amplitude of each cycle) (anchor format) |
shimmerLen |
duration of stable periods between amplitude jumps, ms. Use a low value for harsh noise, a high value for shaky voice (anchor format) |
attackLen |
duration of fade-in / fade-out at each end of syllables and noise (ms): a vector of length 1 (symmetric) or 2 (separately for fade-in and fade-out) |
rolloff |
basic rolloff from lower to upper harmonics, db/octave
(exponential decay). All rolloff parameters are in anchor format. See
|
rolloffOct |
basic rolloff changes from lower to upper harmonics
(regardless of f0) by |
rolloffKHz |
rolloff changes linearly with f0 by |
rolloffParab |
an optional quadratic term affecting only the first
|
rolloffParabHarm |
the number of harmonics affected by
|
rolloffExact |
user-specified exact strength of harmonics: a vector or matrix with one row per harmonic, scale 0 to 1 (overrides all other rolloff parameters) |
lipRad |
the effect of lip radiation on source spectrum, dB/oct (the default of +6 dB/oct produces a high-frequency boost when the mouth is open) |
noseRad |
the effect of radiation through the nose on source spectrum,
dB/oct (the alternative to |
mouthOpenThres |
open the lips (switch from nose radiation to lip
radiation) when the mouth is open |
formants |
either a character string referring to default presets for
speaker "M1" (implemented: "aoieu0") or a list of formant times,
frequencies, amplitudes, and bandwidths (see examples). NA or NULL means no
formants, only lip radiation. Time stamps for formants and mouthOpening can
be specified in ms relative to |
formantDep |
scale factor of formant amplitude (1 = no change relative
to amplitudes in |
formantDepStoch |
the amplitude of additional stochastic formants added above the highest specified formant, dB (only if temperature > 0) |
formantWidth |
scale factor of formant bandwidth (1 = no change) |
formantCeiling |
frequency to which stochastic formants are calculated, in multiples of the Nyquist frequency; increase up to ~10 for long vocal tracts to avoid losing energy in the upper part of the spectrum |
formantLocking |
the approximate proportion of sound in which one of the harmonics is locked to the nearest formant, 0 = none, 1 = the entire sound (anchor format) |
vocalTract |
the length of vocal tract, cm. Used for calculating formant
dispersion (for adding extra formants) and formant transitions as the mouth
opens and closes. If |
amDep |
amplitude modulation (AM) depth, %. 0: no change; 100: AM with amplitude range equal to the dynamic range of the sound (anchor format) |
amFreq |
AM frequency, Hz (anchor format) |
amType |
"sine" = sinusoidal, "logistic" = logistic (default) |
amShape |
ignore if amType = "sine", otherwise determines the shape of non-sinusoidal AM: 0 = ~sine, -1 = notches, +1 = clicks (anchor format) |
noise |
loudness of turbulent noise (0 dB = as loud as the periodic (voiced) component, negative values = quieter) such as aspiration, hissing, etc (anchor format) |
formantsNoise |
the same as |
rolloffNoise, noiseFlatSpec
|
linear rolloff of the excitation source for
the noise component, |
rolloffNoiseExp |
exponential rolloff of the excitation source for the noise component, dB/oct (anchor format) applied above 0 Hz |
noiseAmpRef |
noise amplitude is defined relative to: "f0" = the amplitude of the first partial (fundamental frequency), "source" = the amplitude of the harmonic component prior to applying formants, "filtered" = the amplitude of the harmonic component after applying formants |
mouth |
mouth opening (0 to 1, 0.5 = neutral, i.e. no modification) (anchor format) |
ampl |
amplitude envelope (dB, 0 = max amplitude) (anchor format) |
amplGlobal |
global amplitude envelope spanning multiple syllables (dB, 0 = no change) (anchor format) |
smoothing |
a list of parameters passed to
|
samplingRate |
sampling frequency, Hz |
windowLength |
length of FFT window, ms |
overlap |
FFT window overlap, %. For allowed values, see
|
addSilence |
silence before and after the bout, ms: a vector of length 1 (symmetric) or 2 (different duration of silence before/after the sound) |
pitchFloor, pitchCeiling
|
lower & upper bounds of f0 |
pitchSamplingRate |
sampling frequency of the pitch contour only, Hz.
Low values reduce processing time. Set to |
dynamicRange |
dynamic range, dB. Harmonics and noise more than dynamicRange under maximum amplitude are discarded to save computational resources |
invalidArgAction |
what to do if an argument is invalid or outside the
range in |
plot |
if TRUE, plots a spectrogram |
play |
if TRUE, plays the synthesized sound using the default player on
your system. If character, passed to |
saveAudio |
path + filename for saving the output, e.g. '~/Downloads/temp.wav'. If NULL = doesn't save |
... |
other plotting parameters passed to |
Returns the synthesized waveform as a numeric vector.
# Detailed documentation: https://cogsci.se/soundgen/sound_generation.html # A gallery of examples with code: https://cogsci.se/soundgen/demos.html # A GUI for soundgen is available as a Shiny app. # Type "soundgen_app()" to open it in default browser # Set "playback" to TRUE for default system player or the name of preferred # player (eg "aplay") to play back the audio from examples playback = FALSE # or TRUE 'aplay', 'vlc', ... sound = soundgen(play = playback) # spectrogram(sound, 16000, osc = TRUE) # playme(sound) # Control of intonation, amplitude envelope, formants s0 = soundgen( pitch = c(300, 390, 250), ampl = data.frame(time = c(0, 50, 300), value = c(-5, -10, 0)), attack = c(10, 50), formants = c(600, 900, 2200), play = playback ) # Use the in-built collection of presets: # names(presets) # speakers # names(presets$Chimpanzee) # calls per speaker s1 = eval(parse(text = presets$Chimpanzee$Scream_conflict)) # screaming chimp # playme(s1) s2 = eval(parse(text = presets$F1$Scream)) # screaming woman # playme(s2, 18320) # presets of some vowels and consonants names(presets$M1$Formants$vowels) soundgen(sylLen = 500, formants = 'aoieu0', play = playback) ## Not run: # unless temperature is 0, the sound is different every time for (i in 1:3) sound = soundgen(play = playback, temperature = .2) # Bouts versus syllables. Compare: sound = soundgen(formants = 'uai', repeatBout = 3, play = playback) sound = soundgen(formants = 'uai', nSyl = 3, play = playback) # Intonation contours per syllable and globally: sound = soundgen(nSyl = 5, sylLen = 200, pauseLen = 140, pitch = list( time = c(0, 0.65, 1), value = c(977, 1540, 826)), pitchGlobal = list(time = c(0, .5, 1), value = c(-6, 7, 0)), play = playback, plot = TRUE) # Amplitude modulation sound = soundgen(amFreq = 75, amDep = runif(10, 0, 60), pitch = list( time = c(0, .3, .9, 1), value = c(1200, 1547, 1487, 1154)), sylLen = 800, play = playback, plot = TRUE) # Jitter and mouth opening (bark, dog-like) sound = soundgen(repeatBout = 2, sylLen = 160, pauseLen = 100, jitterDep = 1, pitch = c(559, 785, 557), mouth = c(0, 0.5, 0), vocalTract = 5, formants = NULL, play = playback, plot = TRUE) # Ultrasound - need to adjust some defaults: soundgen( sylLen = 10, # just 10 ms attackLen = 1, # should be very short for short vocalizations addSilence = 2, pitch = c(45000, 35000, 65000, 60000), # 35-60 kHz rolloff = -12, rolloffKHz = 0, # NB: the default is -3 dB/kHz, which we do NOT want here! formants = NA, # no formants (or set vocal tract length) samplingRate = 350000, # at least ~10 times the max f0 pitchSamplingRate = 350000, # the same as samplingRate windowLength = .25, # need very short window lengths for USV pitchCeiling = 90000, # max allowed pitch invalidArgAction = 'ignore', # override the ranges allowed by default temperature = 1e-4, plot = TRUE ) # soundgen playing Bach dt = notesToHz( c('E4', 'D4', 'E4', 'C4', 'E4', 'B3', 'E4', 'A3', 'E4', 'G#3', 'E4', 'A3', 'E4', 'B3', 'E4', 'C4', 'E4', 'E3', 'E4', 'F#3', 'E4', 'G#3', 'E4', 'A3', 'E4', 'G#3', 'E4', 'A3', 'E4', 'B3', 'E4', 'C4')) out = 0 for (s in 1:length(dt)) { syl_s = soundgen(sylLen = 100, pitch = dt[s], rolloff = -15, formants = c(750, 1400, 2900, 3800), noise = -45, attackLen = 50, addSilence = 0, temperature = .01) syl_s = fade(matchLengths(syl_s, 0.1 * 16000), samplingRate = 16000) out = c(out, syl_s[1:(0.1 * 16000)]) } spectrogram(out, 16000, yScale = 'ERB') playme(out, 16000) # Project's homepage: http://cogsci.se/soundgen.html ## End(Not run)# Detailed documentation: https://cogsci.se/soundgen/sound_generation.html # A gallery of examples with code: https://cogsci.se/soundgen/demos.html # A GUI for soundgen is available as a Shiny app. # Type "soundgen_app()" to open it in default browser # Set "playback" to TRUE for default system player or the name of preferred # player (eg "aplay") to play back the audio from examples playback = FALSE # or TRUE 'aplay', 'vlc', ... sound = soundgen(play = playback) # spectrogram(sound, 16000, osc = TRUE) # playme(sound) # Control of intonation, amplitude envelope, formants s0 = soundgen( pitch = c(300, 390, 250), ampl = data.frame(time = c(0, 50, 300), value = c(-5, -10, 0)), attack = c(10, 50), formants = c(600, 900, 2200), play = playback ) # Use the in-built collection of presets: # names(presets) # speakers # names(presets$Chimpanzee) # calls per speaker s1 = eval(parse(text = presets$Chimpanzee$Scream_conflict)) # screaming chimp # playme(s1) s2 = eval(parse(text = presets$F1$Scream)) # screaming woman # playme(s2, 18320) # presets of some vowels and consonants names(presets$M1$Formants$vowels) soundgen(sylLen = 500, formants = 'aoieu0', play = playback) ## Not run: # unless temperature is 0, the sound is different every time for (i in 1:3) sound = soundgen(play = playback, temperature = .2) # Bouts versus syllables. Compare: sound = soundgen(formants = 'uai', repeatBout = 3, play = playback) sound = soundgen(formants = 'uai', nSyl = 3, play = playback) # Intonation contours per syllable and globally: sound = soundgen(nSyl = 5, sylLen = 200, pauseLen = 140, pitch = list( time = c(0, 0.65, 1), value = c(977, 1540, 826)), pitchGlobal = list(time = c(0, .5, 1), value = c(-6, 7, 0)), play = playback, plot = TRUE) # Amplitude modulation sound = soundgen(amFreq = 75, amDep = runif(10, 0, 60), pitch = list( time = c(0, .3, .9, 1), value = c(1200, 1547, 1487, 1154)), sylLen = 800, play = playback, plot = TRUE) # Jitter and mouth opening (bark, dog-like) sound = soundgen(repeatBout = 2, sylLen = 160, pauseLen = 100, jitterDep = 1, pitch = c(559, 785, 557), mouth = c(0, 0.5, 0), vocalTract = 5, formants = NULL, play = playback, plot = TRUE) # Ultrasound - need to adjust some defaults: soundgen( sylLen = 10, # just 10 ms attackLen = 1, # should be very short for short vocalizations addSilence = 2, pitch = c(45000, 35000, 65000, 60000), # 35-60 kHz rolloff = -12, rolloffKHz = 0, # NB: the default is -3 dB/kHz, which we do NOT want here! formants = NA, # no formants (or set vocal tract length) samplingRate = 350000, # at least ~10 times the max f0 pitchSamplingRate = 350000, # the same as samplingRate windowLength = .25, # need very short window lengths for USV pitchCeiling = 90000, # max allowed pitch invalidArgAction = 'ignore', # override the ranges allowed by default temperature = 1e-4, plot = TRUE ) # soundgen playing Bach dt = notesToHz( c('E4', 'D4', 'E4', 'C4', 'E4', 'B3', 'E4', 'A3', 'E4', 'G#3', 'E4', 'A3', 'E4', 'B3', 'E4', 'C4', 'E4', 'E3', 'E4', 'F#3', 'E4', 'G#3', 'E4', 'A3', 'E4', 'G#3', 'E4', 'A3', 'E4', 'B3', 'E4', 'C4')) out = 0 for (s in 1:length(dt)) { syl_s = soundgen(sylLen = 100, pitch = dt[s], rolloff = -15, formants = c(750, 1400, 2900, 3800), noise = -45, attackLen = 50, addSilence = 0, temperature = .01) syl_s = fade(matchLengths(syl_s, 0.1 * 16000), samplingRate = 16000) out = c(out, syl_s[1:(0.1 * 16000)]) } spectrogram(out, 16000, yScale = 'ERB') playme(out, 16000) # Project's homepage: http://cogsci.se/soundgen.html ## End(Not run)
Starts a shiny app that provides an interactive wrapper to
soundgen. Supported browsers: Firefox / Chrome. Note that the
browser has to be able to playback WAV audio files, otherwise there will be
no sound.
soundgen_app()soundgen_app()
Takes a spectrogram (either complex or magnitude) and returns a MS with proper row and column labels.
specToMS(spec, windowLength = NULL, step = NULL)specToMS(spec, windowLength = NULL, step = NULL)
spec |
target spectrogram (numeric matrix, frequency in rows, time in columns) |
windowLength |
length of FFT window, ms (multiple values in a vector produce a multi-resolution spectrogram) |
step |
you can override |
Returns a MS - matrix of complex values of the same dimension as spec, with AM in rows and FM in columns.
s = soundgen(sylLen = 500, amFreq = 25, amDep = 50, pitch = 250, samplingRate = 16000) spec = spectrogram(s, samplingRate = 16000, windowLength = 25, step = 5, plot = FALSE) ms = specToMS(spec) plotMS(log(Mod(ms)), quantiles = NULL, col = soundgen:::jet.col(100)) ## Not run: # or plot manually image(x = as.numeric(colnames(ms)), y = as.numeric(rownames(ms)), z = t(log(abs(ms))), xlab = 'Amplitude modulation, Hz', ylab = 'Frequency modulation, cycles/kHz') abline(h = 0, lty = 3); abline(v = 0, lty = 3) ## End(Not run)s = soundgen(sylLen = 500, amFreq = 25, amDep = 50, pitch = 250, samplingRate = 16000) spec = spectrogram(s, samplingRate = 16000, windowLength = 25, step = 5, plot = FALSE) ms = specToMS(spec) plotMS(log(Mod(ms)), quantiles = NULL, col = soundgen:::jet.col(100)) ## Not run: # or plot manually image(x = as.numeric(colnames(ms)), y = as.numeric(rownames(ms)), z = t(log(abs(ms))), xlab = 'Amplitude modulation, Hz', ylab = 'Frequency modulation, cycles/kHz') abline(h = 0, lty = 3); abline(v = 0, lty = 3) ## End(Not run)
Takes a spectrogram and returns the spectrum of each channel. The input can
be an ordinary STFT spectrogram or an auditory spectrogram (a signal
convolved with a bank of bandpass filters). The difference from
specToMS is that, instead of taking a two-dimensional transform
of the spectrogram, here the spectra are calculated independently for each
frequency bin.
specToMS_1D( fb, samplingRate, windowLength = 250, step = windowLength/2, method = c("spec", "meanspec")[2] )specToMS_1D( fb, samplingRate, windowLength = 250, step = windowLength/2, method = c("spec", "meanspec")[2] )
fb |
input spectrogram (numeric matrix with frequency in rows and time in columns) |
samplingRate |
for auditory spectrogram, the sampling rate of input audio; for STFT spectrograms, the number of STFT frames per second |
windowLength, step
|
determine the resolution of modulation spectra (both in ms) |
method |
Returns a modulation spectrum - a matrix of real values, with center frequencies of original filters in rows and modulation frequencies in columns.
data(sheep, package = 'seewave') # auditory spectrogram as = audSpectrogram(sheep, filterType = 'butterworth', nFilters = 24, plot = FALSE) fb = t(do.call(cbind, as$filterbank_env)) rownames(fb) = names(as$filterbank_env) ms = soundgen:::specToMS_1D(fb, [email protected]) plotMS(log(ms+.01), logWarpX = c(10, 2), quantile = NULL, ylab = 'kHz') # ordinary STFT spectrogram sp = spectrogram(sheep, windowLength = 15, step = 0.5, output = 'original', plot = FALSE) ms2 = soundgen:::specToMS_1D(sp, 1000 / 0.5) # 1000/0.5 frames per s plotMS(log(ms2+.01), quantile = NULL, ylab = 'kHz') ## Not run: ms_spec = soundgen:::specToMS_1D(fb, [email protected], method = 'spec') plotMS(log(ms_spec+.01), logWarpX = c(10, 2), quantile = NULL, ylab = 'kHz') ## End(Not run)data(sheep, package = 'seewave') # auditory spectrogram as = audSpectrogram(sheep, filterType = 'butterworth', nFilters = 24, plot = FALSE) fb = t(do.call(cbind, as$filterbank_env)) rownames(fb) = names(as$filterbank_env) ms = soundgen:::specToMS_1D(fb, sheep@samp.rate) plotMS(log(ms+.01), logWarpX = c(10, 2), quantile = NULL, ylab = 'kHz') # ordinary STFT spectrogram sp = spectrogram(sheep, windowLength = 15, step = 0.5, output = 'original', plot = FALSE) ms2 = soundgen:::specToMS_1D(sp, 1000 / 0.5) # 1000/0.5 frames per s plotMS(log(ms2+.01), quantile = NULL, ylab = 'kHz') ## Not run: ms_spec = soundgen:::specToMS_1D(fb, sheep@samp.rate, method = 'spec') plotMS(log(ms_spec+.01), logWarpX = c(10, 2), quantile = NULL, ylab = 'kHz') ## End(Not run)
Produces the spectrogram of a sound using short-time Fourier transform.
Inspired by spectro, this function offers added
routines for reassignment, multi-resolution spectrograms, noise reduction,
smoothing in time and frequency domains, manual control of contrast and
brightness, plotting the oscillogram on a dB scale, grid, etc. Gallery of
examples: https://cogsci.se/soundgen/spectrograms.html.
spectrogram( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, dynamicRange = 80, windowLength = 50, step = windowLength/2, overlap = NULL, specType = c("spectrum", "reassigned", "spectralDerivative")[1], logSpec = TRUE, rasterize = FALSE, wn = "gaussian", zp = 0, normalize = TRUE, smoothFreq = 0, smoothTime = 0, qTime = 0, percentNoise = 10, noiseReduction = 0, output = c("original", "processed", "complex", "all")[1], specManual = NULL, reportEvery = NULL, cores = 1, plot = TRUE, savePlots = NULL, osc = c("none", "linear", "dB")[2], heights = c(3, 1), ylim = NULL, yScale = c("linear", "log", "bark", "mel", "ERB")[1], contrast = 0.2, brightness = 0, blur = 0, maxPoints = c(1e+05, 5e+05), padWithSilence = TRUE, colorTheme = c("bw", "seewave", "heat.colors", "...")[1], col = NULL, extraContour = NULL, xlab = NULL, ylab = NULL, xaxp = NULL, mar = c(5.1, 4.1, 4.1, 2), main = NULL, grid = NULL, width = 900, height = 500, units = "px", res = NA, ... )spectrogram( x, samplingRate = NULL, scale = NULL, from = NULL, to = NULL, dynamicRange = 80, windowLength = 50, step = windowLength/2, overlap = NULL, specType = c("spectrum", "reassigned", "spectralDerivative")[1], logSpec = TRUE, rasterize = FALSE, wn = "gaussian", zp = 0, normalize = TRUE, smoothFreq = 0, smoothTime = 0, qTime = 0, percentNoise = 10, noiseReduction = 0, output = c("original", "processed", "complex", "all")[1], specManual = NULL, reportEvery = NULL, cores = 1, plot = TRUE, savePlots = NULL, osc = c("none", "linear", "dB")[2], heights = c(3, 1), ylim = NULL, yScale = c("linear", "log", "bark", "mel", "ERB")[1], contrast = 0.2, brightness = 0, blur = 0, maxPoints = c(1e+05, 5e+05), padWithSilence = TRUE, colorTheme = c("bw", "seewave", "heat.colors", "...")[1], col = NULL, extraContour = NULL, xlab = NULL, ylab = NULL, xaxp = NULL, mar = c(5.1, 4.1, 4.1, 2), main = NULL, grid = NULL, width = 900, height = 500, units = "px", res = NA, ... )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
scale |
maximum possible amplitude of input used for normalization of
input vector (only needed if |
from, to
|
if NULL (default), analyzes the whole sound, otherwise from...to (s) |
dynamicRange |
dynamic range, dB. All values more than one dynamicRange under maximum are treated as zero |
windowLength |
length of FFT window, ms (multiple values in a vector produce a multi-resolution spectrogram) |
step |
you can override |
overlap |
overlap between successive FFT frames, % |
specType |
plot the original FFT ('spectrum'), reassigned spectrogram ('reassigned'), or spectral derivative ('spectralDerivative') |
logSpec |
if TRUE, log-transforms the spectrogram |
rasterize |
(only applies if specType = 'reassigned') if TRUE, the reassigned spectrogram is plotted after rasterizing it: that is, showing density per time-frequency bins with the same resolution as an ordinary spectrogram |
wn |
window type accepted by |
zp |
window length after zero padding, points |
normalize |
if TRUE, scales input prior to FFT |
smoothFreq, smoothTime
|
length of the window for median smoothing in frequency and time domains, respectively, points |
qTime |
the quantile to be subtracted for each frequency bin. For ex., if qTime = 0.5, the median of each frequency bin (over the entire sound duration) will be calculated and subtracted from each frame (see examples) |
percentNoise |
percentage of frames (0 to 100%) used for calculating noise spectrum |
noiseReduction |
how much noise to remove (non-negative number,
recommended 0 to 2). 0 = no noise reduction, 2 = strong noise reduction:
|
output |
specifies what to return: nothing ('none'), unmodified spectrogram ('original'), denoised and/or smoothed spectrogram ('processed'), or unmodified spectrogram with the imaginary part giving phase ('complex') |
specManual |
manually calculated spectrogram-like representation in the same format as the output of spectrogram(): rows = frequency in kHz, columns = time in ms |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
plot |
should a spectrogram be plotted? TRUE / FALSE |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
osc |
"none" = no oscillogram; "linear" = on the original scale; "dB" = in decibels |
heights |
a vector of length two specifying the relative height of the spectrogram and the oscillogram (including time axes labels) |
ylim |
frequency range to plot, kHz (defaults to 0 to Nyquist frequency). NB: still in kHz, even if yScale = bark, mel, or ERB |
yScale |
scale of the frequency axis: 'linear' = linear, 'log' =
logarithmic (musical), 'bark' = bark with |
contrast |
controls the sharpness or contrast of the image: <0 =
decrease contrast, 0 = no change, >0 increase contrast. Recommended range
approximately (-1, 1). The spectrogram is raised to the power of
|
brightness |
makes the image lighter or darker: <0 = darker, 0 = no change, >0 = lighter, range (-1, 1). The color palette is preserved, so "brightness" works by capping an increasing proportion of image at the lightest or darkest color. To lighten or darken the palette, just change the colors instead |
blur |
apply a Gaussian filter to blur or sharpen the image, two numbers: frequency (Hz), time (ms). A single number is interpreted as frequency, and a square filter is applied. NA / NULL / 0 means no blurring in that dimension. Negative numbers mean un-blurring (sharpening) the image by dividing instead of multiplying by the filter during convolution |
maxPoints |
the maximum number of "pixels" in the oscillogram (if any) and spectrogram; good for quickly plotting long audio files; defaults to c(1e5, 5e5); does not affect reassigned spectrograms |
padWithSilence |
if TRUE, pads the sound with just enough silence to resolve the edges properly (only the original region is plotted, so the apparent duration doesn't change) |
colorTheme |
black and white ('bw'), as in seewave package ('seewave'),
matlab-type palette ('matlab'), or any palette from
|
col |
actual colors, eg rev(rainbow(100)) - see ?hcl.colors for colors in base R (overrides colorTheme) |
extraContour |
a vector of arbitrary length scaled in Hz (regardless of yScale, but nonlinear yScale also warps the contour) that will be plotted over the spectrogram (eg pitch contour); can also be a list with extra graphical parameters such as lwd, col, etc. (see examples) |
xlab, ylab, main, mar, xaxp
|
graphical parameters for plotting |
grid |
if numeric, adds n = |
width, height, units, res
|
graphical parameters for saving plots passed to
|
... |
other graphical parameters |
Many soundgen functions call spectrogram, and you can pass along most
of its graphical parameters from functions like soundgen,
analyze, etc. However, in some cases this will not work (eg for
"units") or may produce unexpected results. If in doubt, omit extra graphical
parameters or save your sound first, then call spectrogram() explicitly.
Reassigned spectrograms are not affected by noise reduction or blurring.
Returns nothing if output = 'none', spectral magnitudes - not power! - if output = 'original', denoised and/or smoothed spectrum if output = 'processed', or spectral derivatives if specType = 'spectralDerivative'. The output is a matrix of real numbers with time in columns (ms) and frequency in rows (kHz). For multi-resolution spectrograms, the complex matrix corresponds to the last value of windowLength.
# Gallery of examples: https://cogsci.se/soundgen/spectrograms.html # synthesize a sound 500 ms long, with gradually increasing hissing noise sound = soundgen(sylLen = 500, temperature = 0.001, noise = list( time = c(0, 650), value = c(-40, 0)), formantsNoise = list( f1 = list(freq = 5000, width = 10000))) # playme(sound, samplingRate = 16000) # basic spectrogram spectrogram(sound, samplingRate = 16000, yScale = 'bark') # add bells and whistles spectrogram(sound, samplingRate = 16000, windowLength = c(5, 40), # multi-resolution osc = 'dB', # plot oscillogram in dB heights = c(2, 1), # spectro/osc height ratio noiseReduction = .9, # subtract the spectrum of noisy parts brightness = -.5, # reduce brightness # pick color theme - see ?hcl.colors # colorTheme = 'heat.colors', # ...or just specify the actual colors col = colorRampPalette(c('white', 'yellow', 'red'))(50), cex.lab = .75, cex.axis = .75, # text size and other base graphics pars grid = 5, # lines per kHz; to customize, add manually with graphics::grid() ylim = c(0, 5), # always in kHz main = 'My spectrogram' # title # + axis labels, etc ) ## Not run: # save spectrograms of all sounds in a folder spectrogram('~/Downloads/temp', savePlots = '', cores = 2) # change dynamic range spectrogram(sound, samplingRate = 16000, dynamicRange = 40) spectrogram(sound, samplingRate = 16000, dynamicRange = 120) # remove the oscillogram spectrogram(sound, samplingRate = 16000, osc = 'none') # or NULL etc # frequencies on a logarithmic (musical) scale (mel/bark/ERB also available) spectrogram(sound, samplingRate = 16000, yScale = 'log', ylim = c(.05, 8)) # broad-band instead of narrow-band spectrogram(sound, samplingRate = 16000, windowLength = 5) # reassigned spectrograms can be plotted without rasterizing, as a # scatterplot instead of a contour plot s = soundgen(sylLen = 500, pitch = c(100, 1100, 120, 1200, 90, 900, 110, 700), samplingRate = 22050, formants = NULL, lipRad = 0, rolloff = -20) spectrogram(s, 22050, windowLength = 5, step = 1, yScale = 'bark') spectrogram(s, 22050, specType = 'reassigned', windowLength = 5, step = 1, yScale = 'bark') # ...or it can be rasterized, but that sacrifices frequency resolution: sp = spectrogram(s, 22050, specType = 'reassigned', rasterize = TRUE, windowLength = 5, step = 1, yScale = 'bark', output = 'all') # The raw reassigned version is saved if output = 'all' for custom plotting df = sp$reassigned df$z1 = soundgen:::zeroOne(log(df$magn)) plot(df$time, df$freq, col = rgb(df$z1, df$z1, 1 - df$z1, 1), pch = 16, cex = 0.25, ylim = c(0, 2)) # multi-resolution spectrograms spectrogram(s, 22050, windowLength = c(1, 10, 20, 50), yScale = 'bark') # (works well in combination with de-blurring) spectrogram(s, 22050, windowLength = c(1, 10, 20, 50), yScale = 'bark', blur = c(-50, -50)) spectrogram(s, 22050, windowLength = 1:10, yScale = 'bark', specType = 'reassigned', dynamicRange = 50) spectrogram(s, 22050, windowLength = 1:10, yScale = 'bark', specType = 'reassigned', dynamicRange = 50, rasterize = TRUE) # Different combinations of specType, mono/multiresolution, and rasterization spectrogram(s, 22050, windowLength = 5) spectrogram(s, 22050, windowLength = c(5, 10)) spectrogram(s, 22050, windowLength = 5, specType = 'reassigned', rasterize = FALSE) spectrogram(s, 22050, windowLength = c(5, 10), specType = 'reassigned', rasterize = FALSE) spectrogram(s, 22050, windowLength = 5, specType = 'reassigned', rasterize = TRUE) spectrogram(s, 22050, windowLength = c(5, 10), specType = 'reassigned', rasterize = TRUE) # focus only on values in the upper 5% for each frequency bin spectrogram(sound, samplingRate = 16000, qTime = 0.95) # detect 10% of the noisiest frames based on entropy and remove the pattern # found in those frames (in this cases, breathing) spectrogram(sound, samplingRate = 16000, noiseReduction = 1.1, brightness = -2) # white noise attenuated # increase contrast, reduce brightness spectrogram(sound, samplingRate = 16000, contrast = .7, brightness = -.5) # increase brightness (drops quiet bins with the same color palette) spectrogram(sound, samplingRate = 16000, brightness = .5) # another approach is to just make the palette lighter: spectrogram(sound, samplingRate = 16000, col = gray.colors(30, 1, .5)) # apply median smoothing in both time and frequency domains spectrogram(sound, samplingRate = 16000, smoothFreq = 5, smoothTime = 5) # Gaussian filter to blur or sharpen ("unblur") the image in time and/or # frequency domains spectrogram(sound, samplingRate = 16000, blur = c(100, 500)) # TIP: when unblurring, set the first (frequency) parameter to the # frequency resolution of interest, eg ~500-1000 Hz for human formants spectrogram(sound, samplingRate = 16000, windowLength = 10, blur = c(-500, 50)) # specify location of tick marks etc - see ?par() for base graphics spectrogram(sound, samplingRate = 16000, ylim = c(0, 3), yaxp = c(0, 3, 5), xaxp = c(0, .8, 10)) # Plot long audio files with reduced resolution data(sheep, package = 'seewave') sp = spectrogram(sheep, overlap = 0, maxPoints = c(1e4, 5e3), # limit the number of pixels in osc/spec output = 'original') nrow(sp) * ncol(sp) / 5e3 # spec downsampled by a factor of ~2 # Plot some arbitrary contour over the spectrogram (simply calling lines() # will not work if osc = TRUE b/c the plot layout is modified) s = soundgen(sylLen = 1500, pitch = c(250, 350, 320, 220), jitterDep = c(0, 0, 3, 2, 0, 0)) an = analyze(s, 16000, plot = TRUE, extraContour = 'dom') spectrogram(s, 16000, extraContour = an$detailed$dom, ylim = c(0, 2), yScale = 'bark') spectrogram(s, 16000, extraContour = list(x = an$detailed$dom, col = 'blue'), ylim = c(0, 2), yScale = 'bark') # or simply add whatever you like to a spectrogram with points(), lines(), # etc., (but only works without an oscillogram): spectrogram(s, 16000, ylim = c(0, 2), yScale = 'bark', osc = FALSE) points(an$detailed$time/1000, # time in s HzToOther(an$detailed$dom, 'bark'), # values in barks lwd = 2, col = 'green', lty = 2) # any graphic pars # For values that are not in Hz, normalize any way you like. NB: if yScale != # 'linear', the extra contour is by default warped to the same scale b/c it # is assumed to be in Hz. Specify "warp = FALSE" to avoid this spectrogram(s, 16000, yScale = 'ERB', ylim = c(0, 5), extraContour = list( x = an$detailed$loudness / max(an$detailed$loudness, na.rm = TRUE) * 5000, # because ylim[2] = 2000 Hz type = 'b', pch = 5, lwd = 2, lty = 2, col = 'blue', warp = FALSE)) # compare: spectrogram(s, 16000, yScale = 'ERB', ylim = c(0, 5), extraContour = list( x = an$detailed$loudness / max(an$detailed$loudness, na.rm = TRUE) * 5000, # because ylim[2] = 2000 Hz type = 'b', pch = 5, lwd = 2, lty = 2, col = 'blue')) # Plot a spectrogram-like matrix paired with an osc ms = modulationSpectrum(s, 16000, msType = '1D', amRes = 10) spectrogram(s, 16000, specManual = ms$modulation_spectrogram, colorTheme = 'matlab', ylab = 'Modulation frequency, kHz', contrast = .25, blur = c(10, 10), yScale = 'log') ## End(Not run)# Gallery of examples: https://cogsci.se/soundgen/spectrograms.html # synthesize a sound 500 ms long, with gradually increasing hissing noise sound = soundgen(sylLen = 500, temperature = 0.001, noise = list( time = c(0, 650), value = c(-40, 0)), formantsNoise = list( f1 = list(freq = 5000, width = 10000))) # playme(sound, samplingRate = 16000) # basic spectrogram spectrogram(sound, samplingRate = 16000, yScale = 'bark') # add bells and whistles spectrogram(sound, samplingRate = 16000, windowLength = c(5, 40), # multi-resolution osc = 'dB', # plot oscillogram in dB heights = c(2, 1), # spectro/osc height ratio noiseReduction = .9, # subtract the spectrum of noisy parts brightness = -.5, # reduce brightness # pick color theme - see ?hcl.colors # colorTheme = 'heat.colors', # ...or just specify the actual colors col = colorRampPalette(c('white', 'yellow', 'red'))(50), cex.lab = .75, cex.axis = .75, # text size and other base graphics pars grid = 5, # lines per kHz; to customize, add manually with graphics::grid() ylim = c(0, 5), # always in kHz main = 'My spectrogram' # title # + axis labels, etc ) ## Not run: # save spectrograms of all sounds in a folder spectrogram('~/Downloads/temp', savePlots = '', cores = 2) # change dynamic range spectrogram(sound, samplingRate = 16000, dynamicRange = 40) spectrogram(sound, samplingRate = 16000, dynamicRange = 120) # remove the oscillogram spectrogram(sound, samplingRate = 16000, osc = 'none') # or NULL etc # frequencies on a logarithmic (musical) scale (mel/bark/ERB also available) spectrogram(sound, samplingRate = 16000, yScale = 'log', ylim = c(.05, 8)) # broad-band instead of narrow-band spectrogram(sound, samplingRate = 16000, windowLength = 5) # reassigned spectrograms can be plotted without rasterizing, as a # scatterplot instead of a contour plot s = soundgen(sylLen = 500, pitch = c(100, 1100, 120, 1200, 90, 900, 110, 700), samplingRate = 22050, formants = NULL, lipRad = 0, rolloff = -20) spectrogram(s, 22050, windowLength = 5, step = 1, yScale = 'bark') spectrogram(s, 22050, specType = 'reassigned', windowLength = 5, step = 1, yScale = 'bark') # ...or it can be rasterized, but that sacrifices frequency resolution: sp = spectrogram(s, 22050, specType = 'reassigned', rasterize = TRUE, windowLength = 5, step = 1, yScale = 'bark', output = 'all') # The raw reassigned version is saved if output = 'all' for custom plotting df = sp$reassigned df$z1 = soundgen:::zeroOne(log(df$magn)) plot(df$time, df$freq, col = rgb(df$z1, df$z1, 1 - df$z1, 1), pch = 16, cex = 0.25, ylim = c(0, 2)) # multi-resolution spectrograms spectrogram(s, 22050, windowLength = c(1, 10, 20, 50), yScale = 'bark') # (works well in combination with de-blurring) spectrogram(s, 22050, windowLength = c(1, 10, 20, 50), yScale = 'bark', blur = c(-50, -50)) spectrogram(s, 22050, windowLength = 1:10, yScale = 'bark', specType = 'reassigned', dynamicRange = 50) spectrogram(s, 22050, windowLength = 1:10, yScale = 'bark', specType = 'reassigned', dynamicRange = 50, rasterize = TRUE) # Different combinations of specType, mono/multiresolution, and rasterization spectrogram(s, 22050, windowLength = 5) spectrogram(s, 22050, windowLength = c(5, 10)) spectrogram(s, 22050, windowLength = 5, specType = 'reassigned', rasterize = FALSE) spectrogram(s, 22050, windowLength = c(5, 10), specType = 'reassigned', rasterize = FALSE) spectrogram(s, 22050, windowLength = 5, specType = 'reassigned', rasterize = TRUE) spectrogram(s, 22050, windowLength = c(5, 10), specType = 'reassigned', rasterize = TRUE) # focus only on values in the upper 5% for each frequency bin spectrogram(sound, samplingRate = 16000, qTime = 0.95) # detect 10% of the noisiest frames based on entropy and remove the pattern # found in those frames (in this cases, breathing) spectrogram(sound, samplingRate = 16000, noiseReduction = 1.1, brightness = -2) # white noise attenuated # increase contrast, reduce brightness spectrogram(sound, samplingRate = 16000, contrast = .7, brightness = -.5) # increase brightness (drops quiet bins with the same color palette) spectrogram(sound, samplingRate = 16000, brightness = .5) # another approach is to just make the palette lighter: spectrogram(sound, samplingRate = 16000, col = gray.colors(30, 1, .5)) # apply median smoothing in both time and frequency domains spectrogram(sound, samplingRate = 16000, smoothFreq = 5, smoothTime = 5) # Gaussian filter to blur or sharpen ("unblur") the image in time and/or # frequency domains spectrogram(sound, samplingRate = 16000, blur = c(100, 500)) # TIP: when unblurring, set the first (frequency) parameter to the # frequency resolution of interest, eg ~500-1000 Hz for human formants spectrogram(sound, samplingRate = 16000, windowLength = 10, blur = c(-500, 50)) # specify location of tick marks etc - see ?par() for base graphics spectrogram(sound, samplingRate = 16000, ylim = c(0, 3), yaxp = c(0, 3, 5), xaxp = c(0, .8, 10)) # Plot long audio files with reduced resolution data(sheep, package = 'seewave') sp = spectrogram(sheep, overlap = 0, maxPoints = c(1e4, 5e3), # limit the number of pixels in osc/spec output = 'original') nrow(sp) * ncol(sp) / 5e3 # spec downsampled by a factor of ~2 # Plot some arbitrary contour over the spectrogram (simply calling lines() # will not work if osc = TRUE b/c the plot layout is modified) s = soundgen(sylLen = 1500, pitch = c(250, 350, 320, 220), jitterDep = c(0, 0, 3, 2, 0, 0)) an = analyze(s, 16000, plot = TRUE, extraContour = 'dom') spectrogram(s, 16000, extraContour = an$detailed$dom, ylim = c(0, 2), yScale = 'bark') spectrogram(s, 16000, extraContour = list(x = an$detailed$dom, col = 'blue'), ylim = c(0, 2), yScale = 'bark') # or simply add whatever you like to a spectrogram with points(), lines(), # etc., (but only works without an oscillogram): spectrogram(s, 16000, ylim = c(0, 2), yScale = 'bark', osc = FALSE) points(an$detailed$time/1000, # time in s HzToOther(an$detailed$dom, 'bark'), # values in barks lwd = 2, col = 'green', lty = 2) # any graphic pars # For values that are not in Hz, normalize any way you like. NB: if yScale != # 'linear', the extra contour is by default warped to the same scale b/c it # is assumed to be in Hz. Specify "warp = FALSE" to avoid this spectrogram(s, 16000, yScale = 'ERB', ylim = c(0, 5), extraContour = list( x = an$detailed$loudness / max(an$detailed$loudness, na.rm = TRUE) * 5000, # because ylim[2] = 2000 Hz type = 'b', pch = 5, lwd = 2, lty = 2, col = 'blue', warp = FALSE)) # compare: spectrogram(s, 16000, yScale = 'ERB', ylim = c(0, 5), extraContour = list( x = an$detailed$loudness / max(an$detailed$loudness, na.rm = TRUE) * 5000, # because ylim[2] = 2000 Hz type = 'b', pch = 5, lwd = 2, lty = 2, col = 'blue')) # Plot a spectrogram-like matrix paired with an osc ms = modulationSpectrum(s, 16000, msType = '1D', amRes = 10) spectrogram(s, 16000, specManual = ms$modulation_spectrogram, colorTheme = 'matlab', ylab = 'Modulation frequency, kHz', contrast = .25, blur = c(10, 10), yScale = 'log') ## End(Not run)
Calculates the self-similarity matrix and novelty vector of a sound. The self-similarity matrix is produced by cross-correlating different segments of the input sound. Novelty is calculated by convolving the self-similarity matrix with a tapered checkerboard kernel. The positive lobes of the kernel represent coherence (self-similarity within the regions on either side of the center point) and the negative lobes anti-coherence (cross-similarity between these two regions). Since novelty is the dot product of the checkerboard kernel with the SSM, it is high when the two regions are self-similar (internally consistent) but different from each other.
ssm( x, samplingRate = NULL, from = NULL, to = NULL, sparse = FALSE, input = c("melspec", "mfcc", "spec", "audSpec")[1], melfcc_pars = list(windowLength = 125, step = 25, nbands = 50), MFCC = 2:13, audSpec_pars = list(nFilters = 16, step = 10), takeLog = FALSE, norm = FALSE, simil = c("cosine", "cor")[1], kernelLen = 1000, kernelSD = 0.5, padWith = 0, ssmWin = NULL, summaryFun = c("mean", "sd"), output = c("ssm", "novelty", "summary"), reportEvery = NULL, cores = 1, plot = TRUE, savePlots = NULL, main = NULL, heights = c(2, 1), width = 900, height = 500, units = "px", res = NA, specPars = list(colorTheme = c("bw", "seewave", "heat.colors", "...")[2], xlab = "Time, s"), ssmPars = list(colorTheme = c("bw", "seewave", "heat.colors", "...")[2], xlab = "Time, s", ylab = "Time, s"), noveltyPars = list(type = "b", pch = 16, col = "black", lwd = 3) )ssm( x, samplingRate = NULL, from = NULL, to = NULL, sparse = FALSE, input = c("melspec", "mfcc", "spec", "audSpec")[1], melfcc_pars = list(windowLength = 125, step = 25, nbands = 50), MFCC = 2:13, audSpec_pars = list(nFilters = 16, step = 10), takeLog = FALSE, norm = FALSE, simil = c("cosine", "cor")[1], kernelLen = 1000, kernelSD = 0.5, padWith = 0, ssmWin = NULL, summaryFun = c("mean", "sd"), output = c("ssm", "novelty", "summary"), reportEvery = NULL, cores = 1, plot = TRUE, savePlots = NULL, main = NULL, heights = c(2, 1), width = 900, height = 500, units = "px", res = NA, specPars = list(colorTheme = c("bw", "seewave", "heat.colors", "...")[2], xlab = "Time, s"), ssmPars = list(colorTheme = c("bw", "seewave", "heat.colors", "...")[2], xlab = "Time, s", ylab = "Time, s"), noveltyPars = list(type = "b", pch = 16, col = "black", lwd = 3) )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
samplingRate |
sampling rate of |
from, to
|
if NULL (default), analyzes the whole sound, otherwise from...to (s) |
sparse |
if TRUE, the entire SSM is not calculated, but only the central region needed to extract the novelty contour (speeds up the processing) |
input |
the spectral representation used to calculate the SSM: "audSpec"
= auditory spectrogram returned by |
melfcc_pars |
a list of parameters passed to |
MFCC |
which mel-frequency cepstral coefficients to use; defaults to
|
audSpec_pars |
a list of parameters passed to
|
takeLog |
if TRUE, the input is log-transformed prior to calculating self-similarity |
norm |
if TRUE, the spectrum of each STFT frame is normalized |
simil |
method for comparing frames: "cosine" = cosine similarity, "cor" = Pearson's correlation |
kernelLen |
length of checkerboard kernel for calculating novelty, ms (larger values favor global, slow vs. local, fast novelty) |
kernelSD |
SD of checkerboard kernel for calculating novelty |
padWith |
how to treat edges when calculating novelty: NA = treat sound before and after the recording as unknown, 0 = treat it as silence |
ssmWin |
window for averaging SSM, frames (has a smoothing effect and speeds up the processing) |
summaryFun |
functions used to summarize each acoustic characteristic, eg "c('mean', 'sd')"; user-defined functions are fine (see examples); NAs are omitted automatically for mean/median/sd/min/max/range/sum, otherwise take care of NAs yourself |
output |
what to return (drop "ssm" to save memory when analyzing a lot of files) |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
plot |
if TRUE, plots the SSM |
savePlots |
full path to the folder in which to save the plots (NULL = don't save, ” = same folder as audio) |
main |
plot title |
heights |
relative sizes of the SSM and spectrogram/novelty plot |
width, height, units, res
|
graphical parameters for saving plots passed to
|
specPars |
graphical parameters passed to |
ssmPars |
graphical parameters passed to |
noveltyPars |
graphical parameters passed to
|
Returns a list of two components: $ssm contains the self-similarity matrix, and $novelty contains the novelty vector.
Foote, J. (1999, October). Visualizing music and audio using self-similarity. In Proceedings of the seventh ACM international conference on Multimedia (Part 1) (pp. 77-80). ACM.
Foote, J. (2000). Automatic audio segmentation using a measure of audio novelty. In Multimedia and Expo, 2000. ICME 2000. 2000 IEEE International Conference on (Vol. 1, pp. 452-455). IEEE.
spectrogram modulationSpectrum
segment
sound = c(soundgen(), soundgen(nSyl = 4, sylLen = 50, pauseLen = 70, formants = NA, pitch = c(500, 330))) # playme(sound) # detailed, local features (captures each syllable) s1 = ssm(sound, samplingRate = 16000, kernelLen = 100, sparse = TRUE) # much faster with 'sparse' # more global features (captures the transition b/w the two sounds) s2 = ssm(sound, samplingRate = 16000, kernelLen = 400, sparse = TRUE) s2$summary s2$novelty # novelty contour ## Not run: ssm(sound, samplingRate = 16000, input = 'mfcc', simil = 'cor', norm = TRUE, ssmWin = 10, # speed up the processing kernelLen = 300, # global features specPars = list(colorTheme = 'seewave'), ssmPars = list(col = rainbow(100)), noveltyPars = list(type = 'l', lty = 3, lwd = 2)) # Custom input: produce a nice spectrogram first, then feed it into ssm() sp = spectrogram(sound, 16000, windowLength = c(5, 40), contrast = .3, output = 'processed') # return the modified spectrogram colnames(sp) = as.numeric(colnames(sp)) / 1000 # convert ms to s ssm(sound, 16000, kernelLen = 400, input = sp) # Custom input: use acoustic features returned by analyze() an = analyze(sound, 16000, windowLength = 20, novelty = NULL) input_an = t(an$detailed[, 4:ncol(an$detailed)]) # or select pitch, HNR, ... input_an = t(apply(input_an, 1, scale)) # z-transform all variables input_an[is.na(input_an)] = 0 # get rid of NAs colnames(input_an) = an$detailed$time / 1000 # time stamps in s rownames(input_an) = 1:nrow(input_an) image(t(input_an)) # not a spectrogram, just a feature matrix ssm(sound, 16000, kernelLen = 500, input = input_an, takeLog = FALSE, specPars = list(ylab = 'Feature')) ## End(Not run)sound = c(soundgen(), soundgen(nSyl = 4, sylLen = 50, pauseLen = 70, formants = NA, pitch = c(500, 330))) # playme(sound) # detailed, local features (captures each syllable) s1 = ssm(sound, samplingRate = 16000, kernelLen = 100, sparse = TRUE) # much faster with 'sparse' # more global features (captures the transition b/w the two sounds) s2 = ssm(sound, samplingRate = 16000, kernelLen = 400, sparse = TRUE) s2$summary s2$novelty # novelty contour ## Not run: ssm(sound, samplingRate = 16000, input = 'mfcc', simil = 'cor', norm = TRUE, ssmWin = 10, # speed up the processing kernelLen = 300, # global features specPars = list(colorTheme = 'seewave'), ssmPars = list(col = rainbow(100)), noveltyPars = list(type = 'l', lty = 3, lwd = 2)) # Custom input: produce a nice spectrogram first, then feed it into ssm() sp = spectrogram(sound, 16000, windowLength = c(5, 40), contrast = .3, output = 'processed') # return the modified spectrogram colnames(sp) = as.numeric(colnames(sp)) / 1000 # convert ms to s ssm(sound, 16000, kernelLen = 400, input = sp) # Custom input: use acoustic features returned by analyze() an = analyze(sound, 16000, windowLength = 20, novelty = NULL) input_an = t(an$detailed[, 4:ncol(an$detailed)]) # or select pitch, HNR, ... input_an = t(apply(input_an, 1, scale)) # z-transform all variables input_an[is.na(input_an)] = 0 # get rid of NAs colnames(input_an) = an$detailed$time / 1000 # time stamps in s rownames(input_an) = 1:nrow(input_an) image(t(input_an)) # not a spectrogram, just a feature matrix ssm(sound, 16000, kernelLen = 500, input = input_an, takeLog = FALSE, specPars = list(ylab = 'Feature')) ## End(Not run)
Dynamically time-stretches a sound without preserving its pitch or formants,
as if gradually changing playback speed. Algorithm: the audio is resampled at
time-varying steps. This is about 100 times faster than time-stretching with a
phase vocoder in shiftPitch, but pitch and formants cannot be
preserved, and large stretch factors may cause artifacts due to aliasing.
timeStretch( x, stretch = 1, samplingRate = NULL, precision = 1000, play = FALSE, saveAudio = NULL, reportEvery = NULL, cores = 1 )timeStretch( x, stretch = 1, samplingRate = NULL, precision = 1000, play = FALSE, saveAudio = NULL, reportEvery = NULL, cores = 1 )
x |
path to a folder, one or more wav or mp3 files c('file1.wav', 'file2.mp3'), Wave object, numeric vector, or a list of Wave objects or numeric vectors |
stretch |
1 = no change, >1 = longer, <1 = shorter. Single value, vector,
or anchor format (see |
samplingRate |
sampling rate of |
precision |
the number of points used for estimating the duration of output (more = better, but slower) |
play |
if TRUE, plays the synthesized sound using the default player on
your system. If character, passed to |
saveAudio |
full path to the folder in which to save audio files (one per detected syllable) |
reportEvery |
when processing multiple inputs, report estimated time left every ... iterations (NULL = default, NA = don't report) |
cores |
number of cores for parallel processing |
data(sheep, package = 'seewave') # import a recording from seewave # playme(sheep) # spectrogram(sheep) s1 = timeStretch(sheep, stretch = c(1, 3)) # playme(s1, [email protected]) # spectrogram(s1, [email protected]) # compare to a similar effect achieved with a phase vocoder in pitchShift(): s2 = shiftPitch( sheep, timeStretch = c(1, 3), # from 1 (original) to mult multPitch = c(1, 1/3), # also drop pitch multFormants = c(1, 1/3) # also drop formants (by the same proportion) ) # playme(s2, [email protected]) # spectrogram(s2, [email protected]) # NB: because the two algorithms calculate transitions between stretch # factors in different ways, the duration is not identical, even though the # range of pitch change is the samedata(sheep, package = 'seewave') # import a recording from seewave # playme(sheep) # spectrogram(sheep) s1 = timeStretch(sheep, stretch = c(1, 3)) # playme(s1, [email protected]) # spectrogram(s1, [email protected]) # compare to a similar effect achieved with a phase vocoder in pitchShift(): s2 = shiftPitch( sheep, timeStretch = c(1, 3), # from 1 (original) to mult multPitch = c(1, 1/3), # also drop pitch multFormants = c(1, 1/3) # also drop formants (by the same proportion) ) # playme(s2, [email protected]) # spectrogram(s2, [email protected]) # NB: because the two algorithms calculate transitions between stretch # factors in different ways, the duration is not identical, even though the # range of pitch change is the same
Extracts a smoothed amplitude envelope of the donor sound and applies
it to the recipient sound. Both sounds are provided as numeric
vectors; they can differ in length and sampling rate. Note that the result
depends on the amount of smoothing (controlled by windowLength) and
the chosen method of calculating the envelope. Very similar to
setenv, but with a different smoothing algorithm and
with a choice of several types of envelope: hil, rms, or peak.
transplantEnv( donor, samplingRateD = NULL, recipient, samplingRateR = samplingRateD, windowLength = 50, method = c("hil", "rms", "peak")[3], killDC = FALSE, dynamicRange = 80, plot = FALSE )transplantEnv( donor, samplingRateD = NULL, recipient, samplingRateR = samplingRateD, windowLength = 50, method = c("hil", "rms", "peak")[3], killDC = FALSE, dynamicRange = 80, plot = FALSE )
donor |
the sound that "donates" the amplitude envelope |
samplingRateD, samplingRateR
|
sampling rate of the donor and recipient, respectively (only needed for vectors, not files) |
recipient |
the sound that needs to have its amplitude envelope adjusted |
windowLength |
the length of smoothing window, ms |
method |
hil = Hilbert envelope, rms = root mean square amplitude, peak = peak amplitude per window |
killDC |
if TRUE, dynamically removes DC offset or similar deviations of average waveform from zero (see examples) |
dynamicRange |
parts of sound quieter than |
plot |
if TRUE, plots the original sound, the smoothed envelope, and the compressed sound |
Returns the recipient sound with the donor's amplitude envelope - a numeric vector with the same sampling rate as the recipient
donor = rnorm(500) * seq(1, 0, length.out = 500) recipient = soundgen(sylLen = 600, addSilence = 50) transplantEnv(donor, samplingRateD = 200, recipient, samplingRateR = 16000, windowLength = 50, method = 'hil', plot = TRUE) transplantEnv(donor, samplingRateD = 200, recipient, samplingRateR = 16000, windowLength = 10, method = 'peak', plot = TRUE)donor = rnorm(500) * seq(1, 0, length.out = 500) recipient = soundgen(sylLen = 600, addSilence = 50) transplantEnv(donor, samplingRateD = 200, recipient, samplingRateR = 16000, windowLength = 50, method = 'hil', plot = TRUE) transplantEnv(donor, samplingRateD = 200, recipient, samplingRateR = 16000, windowLength = 10, method = 'peak', plot = TRUE)
Takes the general spectral envelope of one sound (donor) and
"transplants" it onto another sound (recipient). For biological sounds
like speech or animal vocalizations, this has the effect of replacing the
formants in the recipient sound while preserving the original intonation and
(to some extent) voice quality. Note that the amount of spectral smoothing
(specified with freqWindow or blur) is a crucial parameter: too
little smoothing, and noise between harmonics will be amplified, creasing
artifacts; too much, and formants may be missed. The default is to set
freqWindow to the estimated median pitch, but this is time-consuming
and error-prone, so set it to a reasonable value manually if possible. Also
ensure that both sounds have the same sampling rate.
transplantFormants( donor, recipient, samplingRate = NULL, freqWindow = NULL, blur = NULL, dynamicRange = 80, windowLength = 50, step = NULL, overlap = 90, wn = "gaussian", zp = 0 )transplantFormants( donor, recipient, samplingRate = NULL, freqWindow = NULL, blur = NULL, dynamicRange = 80, windowLength = 50, step = NULL, overlap = 90, wn = "gaussian", zp = 0 )
donor |
the sound that provides the formants (vector, Wave, or file) or
the desired spectral filter (matrix) as returned by
|
recipient |
the sound that receives the formants (vector, Wave, or file) |
samplingRate |
sampling rate of |
freqWindow |
the width of smoothing window used to flatten the
recipient's spectrum per frame. Defaults to median pitch of the donor (or
of the recipient if donor is a filter matrix). If |
blur |
the amount of Gaussian blur applied to the donor's spectrogram as
a faster and more flexible alternative to smoothing it per bin with
|
dynamicRange |
dynamic range, dB. All values more than one dynamicRange under maximum are treated as zero |
windowLength |
length of FFT window, ms (multiple values in a vector produce a multi-resolution spectrogram) |
step |
you can override |
overlap |
overlap between successive FFT frames, % |
wn |
window type accepted by |
zp |
window length after zero padding, points |
Algorithm: makes spectrograms of both sounds, interpolates and smooths or blurs the donor spectrogram, flattens the recipient spectrogram, multiplies the spectrograms, and transforms back into time domain with inverse STFT.
transplantEnv getSpectralEnvelope
addFormants spectrogram soundgen
## Not run: # Objective: take formants from the bleating of a sheep and apply them to a # synthetic sound with any arbitrary duration, intonation, nonlinearities etc data(sheep, package = 'seewave') # import a recording from seewave playme(sheep) spectrogram(sheep, osc = TRUE) recipient = soundgen( sylLen = 1200, pitch = c(100, 300, 250, 200), vibratoFreq = 9, vibratoDep = 1, addSilence = 180, samplingRate = [email protected], # same as donor invalidArgAction = 'ignore') # force to keep the low samplingRate playme(recipient, [email protected]) spectrogram(recipient, [email protected], osc = TRUE) s1 = transplantFormants( donor = sheep, recipient = recipient, samplingRate = [email protected]) playme(s1, [email protected]) spectrogram(s1, [email protected], osc = TRUE) # The spectral envelope of s1 will be similar to sheep's on a frequency scale # determined by freqWindow. Compare the spectra: par(mfrow = c(1, 2)) seewave::meanspec(sheep, dB = 'max0', alim = c(-50, 20), main = 'Donor') seewave::meanspec(s1, f = [email protected], dB = 'max0', alim = c(-50, 20), main = 'Processed recipient') par(mfrow = c(1, 1)) # if needed, transplant amplitude envelopes as well: s2 = transplantEnv(donor = sheep, samplingRateD = [email protected], recipient = s1, windowLength = 10) playme(s2, [email protected]) spectrogram(s2, [email protected], osc = TRUE) # using "blur" to apply Gaussian blur to the donor's spectrogram instead of # smoothing per frame with "freqWindow" (~2.5 times faster) spectrogram(sheep, blur = c(150, 0)) # preview to select the amount of blur s1b = transplantFormants( donor = sheep, recipient = recipient, samplingRate = [email protected], freqWindow = 150, blur = c(150, 0)) # blur: 150 = SD of 150 Hz along the frequency axis, # 0 = no smoothing along the time axis playme(s1b, [email protected]) spectrogram(s1b, [email protected], osc = TRUE) # Now we use human formants on sheep source: the sheep asks "why?" s3 = transplantFormants( donor = getSpectralEnvelope( nr = 512, nc = 100, # fairly arbitrary dimensions formants = 'uaaai', samplingRate = [email protected]), recipient = sheep, samplingRate = [email protected]) playme(s3, [email protected]) spectrogram(s3, [email protected], osc = TRUE) ## End(Not run)## Not run: # Objective: take formants from the bleating of a sheep and apply them to a # synthetic sound with any arbitrary duration, intonation, nonlinearities etc data(sheep, package = 'seewave') # import a recording from seewave playme(sheep) spectrogram(sheep, osc = TRUE) recipient = soundgen( sylLen = 1200, pitch = c(100, 300, 250, 200), vibratoFreq = 9, vibratoDep = 1, addSilence = 180, samplingRate = sheep@samp.rate, # same as donor invalidArgAction = 'ignore') # force to keep the low samplingRate playme(recipient, sheep@samp.rate) spectrogram(recipient, sheep@samp.rate, osc = TRUE) s1 = transplantFormants( donor = sheep, recipient = recipient, samplingRate = sheep@samp.rate) playme(s1, sheep@samp.rate) spectrogram(s1, sheep@samp.rate, osc = TRUE) # The spectral envelope of s1 will be similar to sheep's on a frequency scale # determined by freqWindow. Compare the spectra: par(mfrow = c(1, 2)) seewave::meanspec(sheep, dB = 'max0', alim = c(-50, 20), main = 'Donor') seewave::meanspec(s1, f = sheep@samp.rate, dB = 'max0', alim = c(-50, 20), main = 'Processed recipient') par(mfrow = c(1, 1)) # if needed, transplant amplitude envelopes as well: s2 = transplantEnv(donor = sheep, samplingRateD = sheep@samp.rate, recipient = s1, windowLength = 10) playme(s2, sheep@samp.rate) spectrogram(s2, sheep@samp.rate, osc = TRUE) # using "blur" to apply Gaussian blur to the donor's spectrogram instead of # smoothing per frame with "freqWindow" (~2.5 times faster) spectrogram(sheep, blur = c(150, 0)) # preview to select the amount of blur s1b = transplantFormants( donor = sheep, recipient = recipient, samplingRate = sheep@samp.rate, freqWindow = 150, blur = c(150, 0)) # blur: 150 = SD of 150 Hz along the frequency axis, # 0 = no smoothing along the time axis playme(s1b, sheep@samp.rate) spectrogram(s1b, sheep@samp.rate, osc = TRUE) # Now we use human formants on sheep source: the sheep asks "why?" s3 = transplantFormants( donor = getSpectralEnvelope( nr = 512, nc = 100, # fairly arbitrary dimensions formants = 'uaaai', samplingRate = sheep@samp.rate), recipient = sheep, samplingRate = sheep@samp.rate) playme(s3, sheep@samp.rate) spectrogram(s3, sheep@samp.rate, osc = TRUE) ## End(Not run)